diff options
Diffstat (limited to 'src/ipa/rkisp1')
34 files changed, 3212 insertions, 516 deletions
diff --git a/src/ipa/rkisp1/algorithms/agc.cpp b/src/ipa/rkisp1/algorithms/agc.cpp index a1bb7d97..50e0690f 100644 --- a/src/ipa/rkisp1/algorithms/agc.cpp +++ b/src/ipa/rkisp1/algorithms/agc.cpp @@ -2,7 +2,7 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * agc.cpp - AGC/AEC mean-based control algorithm + * AGC/AEC mean-based control algorithm */ #include "agc.h" @@ -14,6 +14,7 @@ #include <libcamera/base/log.h> #include <libcamera/base/utils.h> +#include <libcamera/control_ids.h> #include <libcamera/ipa/core_ipa_interface.h> #include "libipa/histogram.h" @@ -35,32 +36,32 @@ namespace ipa::rkisp1::algorithms { LOG_DEFINE_CATEGORY(RkISP1Agc) -/* Limits for analogue gain values */ -static constexpr double kMinAnalogueGain = 1.0; -static constexpr double kMaxAnalogueGain = 8.0; - -/* \todo Honour the FrameDurationLimits control instead of hardcoding a limit */ -static constexpr utils::Duration kMaxShutterSpeed = 60ms; - -/* Number of frames to wait before calculating stats on minimum exposure */ -static constexpr uint32_t kNumStartupFrames = 10; - -/* Target value to reach for the top 2% of the histogram */ -static constexpr double kEvGainTarget = 0.5; +Agc::Agc() +{ + supportsRaw_ = true; +} -/* - * Relative luminance target. +/** + * \brief Initialise the AGC algorithm from tuning files + * \param[in] context The shared IPA context + * \param[in] tuningData The YamlObject containing Agc tuning data * - * It's a number that's chosen so that, when the camera points at a grey - * target, the resulting image brightness is considered right. + * This function calls the base class' tuningData parsers to discover which + * control values are supported. * - * \todo Why is the value different between IPU3 and RkISP1 ? + * \return 0 on success or errors from the base class */ -static constexpr double kRelativeLuminanceTarget = 0.4; - -Agc::Agc() - : frameCount_(0), numCells_(0), numHistBins_(0), filteredExposure_(0s) +int Agc::init(IPAContext &context, const YamlObject &tuningData) { + int ret; + + ret = parseTuningData(tuningData); + if (ret) + return ret; + + context.ctrlMap.merge(controls()); + + return 0; } /** @@ -73,21 +74,15 @@ Agc::Agc() int Agc::configure(IPAContext &context, const IPACameraSensorInfo &configInfo) { /* Configure the default exposure and gain. */ - context.frameContext.agc.gain = std::max(context.configuration.agc.minAnalogueGain, kMinAnalogueGain); - context.frameContext.agc.exposure = 10ms / context.configuration.sensor.lineDuration; + context.activeState.agc.automatic.gain = context.configuration.sensor.minAnalogueGain; + context.activeState.agc.automatic.exposure = + 10ms / context.configuration.sensor.lineDuration; + context.activeState.agc.manual.gain = context.activeState.agc.automatic.gain; + context.activeState.agc.manual.exposure = context.activeState.agc.automatic.exposure; + context.activeState.agc.autoEnabled = !context.configuration.raw; - /* - * According to the RkISP1 documentation: - * - versions < V12 have RKISP1_CIF_ISP_AE_MEAN_MAX_V10 entries, - * - versions >= V12 have RKISP1_CIF_ISP_AE_MEAN_MAX_V12 entries. - */ - if (context.configuration.hw.revision < RKISP1_V12) { - numCells_ = RKISP1_CIF_ISP_AE_MEAN_MAX_V10; - numHistBins_ = RKISP1_CIF_ISP_HIST_BIN_N_MAX_V10; - } else { - numCells_ = RKISP1_CIF_ISP_AE_MEAN_MAX_V12; - numHistBins_ = RKISP1_CIF_ISP_HIST_BIN_N_MAX_V12; - } + context.activeState.agc.constraintMode = constraintModes().begin()->first; + context.activeState.agc.exposureMode = exposureModeHelpers().begin()->first; /* * Define the measurement window for AGC as a centered rectangle @@ -98,131 +93,125 @@ int Agc::configure(IPAContext &context, const IPACameraSensorInfo &configInfo) context.configuration.agc.measureWindow.h_size = 3 * configInfo.outputSize.width / 4; context.configuration.agc.measureWindow.v_size = 3 * configInfo.outputSize.height / 4; - /* \todo Use actual frame index by populating it in the frameContext. */ - frameCount_ = 0; + /* \todo Run this again when FrameDurationLimits is passed in */ + setLimits(context.configuration.sensor.minShutterSpeed, + context.configuration.sensor.maxShutterSpeed, + context.configuration.sensor.minAnalogueGain, + context.configuration.sensor.maxAnalogueGain); + + resetFrameCount(); + return 0; } /** - * \brief Apply a filter on the exposure value to limit the speed of changes - * \param[in] exposureValue The target exposure from the AGC algorithm - * - * The speed of the filter is adaptive, and will produce the target quicker - * during startup, or when the target exposure is within 20% of the most recent - * filter output. - * - * \return The filtered exposure + * \copydoc libcamera::ipa::Algorithm::queueRequest */ -utils::Duration Agc::filterExposure(utils::Duration exposureValue) +void Agc::queueRequest(IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) { - double speed = 0.2; + auto &agc = context.activeState.agc; - /* Adapt instantly if we are in startup phase. */ - if (frameCount_ < kNumStartupFrames) - speed = 1.0; + if (!context.configuration.raw) { + const auto &agcEnable = controls.get(controls::AeEnable); + if (agcEnable && *agcEnable != agc.autoEnabled) { + agc.autoEnabled = *agcEnable; - /* - * If we are close to the desired result, go faster to avoid making - * multiple micro-adjustments. - * \todo Make this customisable? - */ - if (filteredExposure_ < 1.2 * exposureValue && - filteredExposure_ > 0.8 * exposureValue) - speed = sqrt(speed); + LOG(RkISP1Agc, Debug) + << (agc.autoEnabled ? "Enabling" : "Disabling") + << " AGC"; + } + } - filteredExposure_ = speed * exposureValue + - filteredExposure_ * (1.0 - speed); + const auto &exposure = controls.get(controls::ExposureTime); + if (exposure && !agc.autoEnabled) { + agc.manual.exposure = *exposure * 1.0us + / context.configuration.sensor.lineDuration; + + LOG(RkISP1Agc, Debug) + << "Set exposure to " << agc.manual.exposure; + } + + const auto &gain = controls.get(controls::AnalogueGain); + if (gain && !agc.autoEnabled) { + agc.manual.gain = *gain; + + LOG(RkISP1Agc, Debug) << "Set gain to " << agc.manual.gain; + } - LOG(RkISP1Agc, Debug) << "After filtering, exposure " << filteredExposure_; + frameContext.agc.autoEnabled = agc.autoEnabled; - return filteredExposure_; + if (!frameContext.agc.autoEnabled) { + frameContext.agc.exposure = agc.manual.exposure; + frameContext.agc.gain = agc.manual.gain; + } } /** - * \brief Estimate the new exposure and gain values - * \param[inout] frameContext The shared IPA frame Context - * \param[in] yGain The gain calculated on the current brightness level - * \param[in] iqMeanGain The gain calculated based on the relative luminance target + * \copydoc libcamera::ipa::Algorithm::prepare */ -void Agc::computeExposure(IPAContext &context, double yGain, double iqMeanGain) +void Agc::prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, rkisp1_params_cfg *params) { - IPASessionConfiguration &configuration = context.configuration; - IPAFrameContext &frameContext = context.frameContext; - - /* Get the effective exposure and gain applied on the sensor. */ - uint32_t exposure = frameContext.sensor.exposure; - double analogueGain = frameContext.sensor.gain; - - /* Use the highest of the two gain estimates. */ - double evGain = std::max(yGain, iqMeanGain); - - utils::Duration minShutterSpeed = configuration.agc.minShutterSpeed; - utils::Duration maxShutterSpeed = std::min(configuration.agc.maxShutterSpeed, - kMaxShutterSpeed); - - double minAnalogueGain = std::max(configuration.agc.minAnalogueGain, - kMinAnalogueGain); - double maxAnalogueGain = std::min(configuration.agc.maxAnalogueGain, - kMaxAnalogueGain); + if (frameContext.agc.autoEnabled) { + frameContext.agc.exposure = context.activeState.agc.automatic.exposure; + frameContext.agc.gain = context.activeState.agc.automatic.gain; + } - /* Consider within 1% of the target as correctly exposed. */ - if (utils::abs_diff(evGain, 1.0) < 0.01) + if (frame > 0) return; - /* extracted from Rpi::Agc::computeTargetExposure. */ - - /* Calculate the shutter time in seconds. */ - utils::Duration currentShutter = exposure * configuration.sensor.lineDuration; - - /* - * Update the exposure value for the next computation using the values - * of exposure and gain really used by the sensor. - */ - utils::Duration effectiveExposureValue = currentShutter * analogueGain; - - LOG(RkISP1Agc, Debug) << "Actual total exposure " << currentShutter * analogueGain - << " Shutter speed " << currentShutter - << " Gain " << analogueGain - << " Needed ev gain " << evGain; - - /* - * Calculate the current exposure value for the scene as the latest - * exposure value applied multiplied by the new estimated gain. - */ - utils::Duration exposureValue = effectiveExposureValue * evGain; + /* Configure the measurement window. */ + params->meas.aec_config.meas_window = context.configuration.agc.measureWindow; + /* Use a continuous method for measure. */ + params->meas.aec_config.autostop = RKISP1_CIF_ISP_EXP_CTRL_AUTOSTOP_0; + /* Estimate Y as (R + G + B) x (85/256). */ + params->meas.aec_config.mode = RKISP1_CIF_ISP_EXP_MEASURING_MODE_1; - /* Clamp the exposure value to the min and max authorized. */ - utils::Duration maxTotalExposure = maxShutterSpeed * maxAnalogueGain; - exposureValue = std::min(exposureValue, maxTotalExposure); - LOG(RkISP1Agc, Debug) << "Target total exposure " << exposureValue - << ", maximum is " << maxTotalExposure; + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_AEC; + params->module_ens |= RKISP1_CIF_ISP_MODULE_AEC; + params->module_en_update |= RKISP1_CIF_ISP_MODULE_AEC; - /* - * Divide the exposure value as new exposure and gain values. - * \todo estimate if we need to desaturate - */ - exposureValue = filterExposure(exposureValue); + /* Configure histogram. */ + params->meas.hst_config.meas_window = context.configuration.agc.measureWindow; + /* Produce the luminance histogram. */ + params->meas.hst_config.mode = RKISP1_CIF_ISP_HISTOGRAM_MODE_Y_HISTOGRAM; + /* Set an average weighted histogram. */ + Span<uint8_t> weights{ + params->meas.hst_config.hist_weight, + context.hw->numHistogramWeights + }; + std::fill(weights.begin(), weights.end(), 1); + /* Step size can't be less than 3. */ + params->meas.hst_config.histogram_predivider = 4; - /* - * Push the shutter time up to the maximum first, and only then - * increase the gain. - */ - utils::Duration shutterTime = std::clamp<utils::Duration>(exposureValue / minAnalogueGain, - minShutterSpeed, maxShutterSpeed); - double stepGain = std::clamp(exposureValue / shutterTime, - minAnalogueGain, maxAnalogueGain); - LOG(RkISP1Agc, Debug) << "Divided up shutter and gain are " - << shutterTime << " and " - << stepGain; + /* Update the configuration for histogram. */ + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_HST; + /* Enable the histogram measure unit. */ + params->module_ens |= RKISP1_CIF_ISP_MODULE_HST; + params->module_en_update |= RKISP1_CIF_ISP_MODULE_HST; +} - /* Update the estimated exposure and gain. */ - frameContext.agc.exposure = shutterTime / configuration.sensor.lineDuration; - frameContext.agc.gain = stepGain; +void Agc::fillMetadata(IPAContext &context, IPAFrameContext &frameContext, + ControlList &metadata) +{ + utils::Duration exposureTime = context.configuration.sensor.lineDuration + * frameContext.sensor.exposure; + metadata.set(controls::AnalogueGain, frameContext.sensor.gain); + metadata.set(controls::ExposureTime, exposureTime.get<std::micro>()); + + /* \todo Use VBlank value calculated from each frame exposure. */ + uint32_t vTotal = context.configuration.sensor.size.height + + context.configuration.sensor.defVBlank; + utils::Duration frameDuration = context.configuration.sensor.lineDuration + * vTotal; + metadata.set(controls::FrameDuration, frameDuration.get<std::micro>()); } /** * \brief Estimate the relative luminance of the frame with a given gain - * \param[in] ae The RkISP1 statistics and ISP results * \param[in] gain The gain to apply to the frame * * This function estimates the average relative luminance of the frame that @@ -236,8 +225,6 @@ void Agc::computeExposure(IPAContext &context, double yGain, double iqMeanGain) * YUV doesn't take into account the fact that the R, G and B components * contribute differently to the relative luminance. * - * \todo Have a dedicated YUV algorithm ? - * * The values are normalized to the [0.0, 1.0] range, where 1.0 corresponds to a * theoretical perfect reflector of 100% reference white. * @@ -246,113 +233,82 @@ void Agc::computeExposure(IPAContext &context, double yGain, double iqMeanGain) * * \return The relative luminance */ -double Agc::estimateLuminance(const rkisp1_cif_isp_ae_stat *ae, - double gain) +double Agc::estimateLuminance(double gain) const { double ySum = 0.0; /* Sum the averages, saturated to 255. */ - for (unsigned int aeCell = 0; aeCell < numCells_; aeCell++) - ySum += std::min(ae->exp_mean[aeCell] * gain, 255.0); + for (uint8_t expMean : expMeans_) + ySum += std::min(expMean * gain, 255.0); /* \todo Weight with the AWB gains */ - return ySum / numCells_ / 255; -} - -/** - * \brief Estimate the mean value of the top 2% of the histogram - * \param[in] hist The histogram statistics computed by the ImgU - * \return The mean value of the top 2% of the histogram - */ -double Agc::measureBrightness(const rkisp1_cif_isp_hist_stat *hist) const -{ - Histogram histogram{ Span<const uint32_t>(hist->hist_bins, numHistBins_) }; - /* Estimate the quantile mean of the top 2% of the histogram. */ - return histogram.interQuantileMean(0.98, 1.0); + return ySum / expMeans_.size() / 255; } /** * \brief Process RkISP1 statistics, and run AGC operations * \param[in] context The shared IPA context + * \param[in] frame The frame context sequence number + * \param[in] frameContext The current frame context * \param[in] stats The RKISP1 statistics and ISP results + * \param[out] metadata Metadata for the frame, to be filled by the algorithm * * Identify the current image brightness, and use that to estimate the optimal * new exposure and gain for the scene. */ -void Agc::process(IPAContext &context, - [[maybe_unused]] IPAFrameContext *frameContext, - const rkisp1_stat_buffer *stats) +void Agc::process(IPAContext &context, [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, const rkisp1_stat_buffer *stats, + ControlList &metadata) { + if (!stats) { + fillMetadata(context, frameContext, metadata); + return; + } + + /* + * \todo Verify that the exposure and gain applied by the sensor for + * this frame match what has been requested. This isn't a hard + * requirement for stability of the AGC (the guarantee we need in + * automatic mode is a perfect match between the frame and the values + * we receive), but is important in manual mode. + */ + const rkisp1_cif_isp_stat *params = &stats->params; ASSERT(stats->meas_type & RKISP1_CIF_ISP_STAT_AUTOEXP); - const rkisp1_cif_isp_ae_stat *ae = ¶ms->ae; - const rkisp1_cif_isp_hist_stat *hist = ¶ms->hist; - - double iqMean = measureBrightness(hist); - double iqMeanGain = kEvGainTarget * numHistBins_ / iqMean; + /* The lower 4 bits are fractional and meant to be discarded. */ + Histogram hist({ params->hist.hist_bins, context.hw->numHistogramBins }, + [](uint32_t x) { return x >> 4; }); + expMeans_ = { params->ae.exp_mean, context.hw->numAeCells }; /* - * Estimate the gain needed to achieve a relative luminance target. To - * account for non-linearity caused by saturation, the value needs to be - * estimated in an iterative process, as multiplying by a gain will not - * increase the relative luminance by the same factor if some image - * regions are saturated. + * The Agc algorithm needs to know the effective exposure value that was + * applied to the sensor when the statistics were collected. */ - double yGain = 1.0; - double yTarget = kRelativeLuminanceTarget; - - for (unsigned int i = 0; i < 8; i++) { - double yValue = estimateLuminance(ae, yGain); - double extra_gain = std::min(10.0, yTarget / (yValue + .001)); - - yGain *= extra_gain; - LOG(RkISP1Agc, Debug) << "Y value: " << yValue - << ", Y target: " << yTarget - << ", gives gain " << yGain; - if (extra_gain < 1.01) - break; - } - - computeExposure(context, yGain, iqMeanGain); - frameCount_++; -} + utils::Duration exposureTime = context.configuration.sensor.lineDuration + * frameContext.sensor.exposure; + double analogueGain = frameContext.sensor.gain; + utils::Duration effectiveExposureValue = exposureTime * analogueGain; -/** - * \copydoc libcamera::ipa::Algorithm::prepare - */ -void Agc::prepare(IPAContext &context, rkisp1_params_cfg *params) -{ - if (context.frameContext.frameCount > 0) - return; + utils::Duration shutterTime; + double aGain, dGain; + std::tie(shutterTime, aGain, dGain) = + calculateNewEv(context.activeState.agc.constraintMode, + context.activeState.agc.exposureMode, + hist, effectiveExposureValue); - /* Configure the measurement window. */ - params->meas.aec_config.meas_window = context.configuration.agc.measureWindow; - /* Use a continuous method for measure. */ - params->meas.aec_config.autostop = RKISP1_CIF_ISP_EXP_CTRL_AUTOSTOP_0; - /* Estimate Y as (R + G + B) x (85/256). */ - params->meas.aec_config.mode = RKISP1_CIF_ISP_EXP_MEASURING_MODE_1; + LOG(RkISP1Agc, Debug) + << "Divided up shutter, analogue gain and digital gain are " + << shutterTime << ", " << aGain << " and " << dGain; - params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_AEC; - params->module_ens |= RKISP1_CIF_ISP_MODULE_AEC; - params->module_en_update |= RKISP1_CIF_ISP_MODULE_AEC; - - /* Configure histogram. */ - params->meas.hst_config.meas_window = context.configuration.agc.measureWindow; - /* Produce the luminance histogram. */ - params->meas.hst_config.mode = RKISP1_CIF_ISP_HISTOGRAM_MODE_Y_HISTOGRAM; - /* Set an average weighted histogram. */ - for (unsigned int histBin = 0; histBin < numHistBins_; histBin++) - params->meas.hst_config.hist_weight[histBin] = 1; - /* Step size can't be less than 3. */ - params->meas.hst_config.histogram_predivider = 4; + IPAActiveState &activeState = context.activeState; + /* Update the estimated exposure and gain. */ + activeState.agc.automatic.exposure = shutterTime / context.configuration.sensor.lineDuration; + activeState.agc.automatic.gain = aGain; - /* Update the configuration for histogram. */ - params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_HST; - /* Enable the histogram measure unit. */ - params->module_ens |= RKISP1_CIF_ISP_MODULE_HST; - params->module_en_update |= RKISP1_CIF_ISP_MODULE_HST; + fillMetadata(context, frameContext, metadata); + expMeans_ = {}; } REGISTER_IPA_ALGORITHM(Agc, "Agc") diff --git a/src/ipa/rkisp1/algorithms/agc.h b/src/ipa/rkisp1/algorithms/agc.h index 22c02779..04b3247e 100644 --- a/src/ipa/rkisp1/algorithms/agc.h +++ b/src/ipa/rkisp1/algorithms/agc.h @@ -2,48 +2,53 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * agc.h - RkISP1 AGC/AEC mean-based control algorithm + * RkISP1 AGC/AEC mean-based control algorithm */ #pragma once #include <linux/rkisp1-config.h> +#include <libcamera/base/span.h> #include <libcamera/base/utils.h> #include <libcamera/geometry.h> +#include "libipa/agc_mean_luminance.h" +#include "libipa/histogram.h" + #include "algorithm.h" namespace libcamera { -struct IPACameraSensorInfo; - namespace ipa::rkisp1::algorithms { -class Agc : public Algorithm +class Agc : public Algorithm, public AgcMeanLuminance { public: Agc(); ~Agc() = default; + int init(IPAContext &context, const YamlObject &tuningData) override; int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override; - void prepare(IPAContext &context, rkisp1_params_cfg *params) override; - void process(IPAContext &context, IPAFrameContext *frameContext, - const rkisp1_stat_buffer *stats) override; + void queueRequest(IPAContext &context, + const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + void process(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + const rkisp1_stat_buffer *stats, + ControlList &metadata) override; private: - void computeExposure(IPAContext &Context, double yGain, double iqMeanGain); - utils::Duration filterExposure(utils::Duration exposureValue); - double estimateLuminance(const rkisp1_cif_isp_ae_stat *ae, double gain); - double measureBrightness(const rkisp1_cif_isp_hist_stat *hist) const; - - uint64_t frameCount_; - - uint32_t numCells_; - uint32_t numHistBins_; + void fillMetadata(IPAContext &context, IPAFrameContext &frameContext, + ControlList &metadata); + double estimateLuminance(double gain) const override; - utils::Duration filteredExposure_; + Span<const uint8_t> expMeans_; }; } /* namespace ipa::rkisp1::algorithms */ diff --git a/src/ipa/rkisp1/algorithms/algorithm.h b/src/ipa/rkisp1/algorithms/algorithm.h index c3212cff..715cfcd8 100644 --- a/src/ipa/rkisp1/algorithms/algorithm.h +++ b/src/ipa/rkisp1/algorithms/algorithm.h @@ -2,7 +2,7 @@ /* * Copyright (C) 2021, Ideas On Board * - * algorithm.h - RkISP1 control algorithm interface + * RkISP1 control algorithm interface */ #pragma once @@ -15,7 +15,17 @@ namespace libcamera { namespace ipa::rkisp1 { -using Algorithm = libcamera::ipa::Algorithm<Module>; +class Algorithm : public libcamera::ipa::Algorithm<Module> +{ +public: + Algorithm() + : disabled_(false), supportsRaw_(false) + { + } + + bool disabled_; + bool supportsRaw_; +}; } /* namespace ipa::rkisp1 */ diff --git a/src/ipa/rkisp1/algorithms/awb.cpp b/src/ipa/rkisp1/algorithms/awb.cpp index 9f00364d..a01fe5d9 100644 --- a/src/ipa/rkisp1/algorithms/awb.cpp +++ b/src/ipa/rkisp1/algorithms/awb.cpp @@ -2,16 +2,18 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * awb.cpp - AWB control algorithm + * AWB control algorithm */ #include "awb.h" #include <algorithm> #include <cmath> +#include <iomanip> #include <libcamera/base/log.h> +#include <libcamera/control_ids.h> #include <libcamera/ipa/core_ipa_interface.h> /** @@ -29,15 +31,27 @@ namespace ipa::rkisp1::algorithms { LOG_DEFINE_CATEGORY(RkISP1Awb) +/* Minimum mean value below which AWB can't operate. */ +constexpr double kMeanMinThreshold = 2.0; + +Awb::Awb() + : rgbMode_(false) +{ +} + /** * \copydoc libcamera::ipa::Algorithm::configure */ int Awb::configure(IPAContext &context, const IPACameraSensorInfo &configInfo) { - context.frameContext.awb.gains.red = 1.0; - context.frameContext.awb.gains.blue = 1.0; - context.frameContext.awb.gains.green = 1.0; + context.activeState.awb.gains.manual.red = 1.0; + context.activeState.awb.gains.manual.blue = 1.0; + context.activeState.awb.gains.manual.green = 1.0; + context.activeState.awb.gains.automatic.red = 1.0; + context.activeState.awb.gains.automatic.blue = 1.0; + context.activeState.awb.gains.automatic.green = 1.0; + context.activeState.awb.autoEnabled = true; /* * Define the measurement window for AWB as a centered rectangle @@ -48,131 +62,264 @@ int Awb::configure(IPAContext &context, context.configuration.awb.measureWindow.h_size = 3 * configInfo.outputSize.width / 4; context.configuration.awb.measureWindow.v_size = 3 * configInfo.outputSize.height / 4; + context.configuration.awb.enabled = true; + return 0; } -uint32_t Awb::estimateCCT(double red, double green, double blue) +/** + * \copydoc libcamera::ipa::Algorithm::queueRequest + */ +void Awb::queueRequest(IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) { - /* Convert the RGB values to CIE tristimulus values (XYZ) */ - double X = (-0.14282) * (red) + (1.54924) * (green) + (-0.95641) * (blue); - double Y = (-0.32466) * (red) + (1.57837) * (green) + (-0.73191) * (blue); - double Z = (-0.68202) * (red) + (0.77073) * (green) + (0.56332) * (blue); + auto &awb = context.activeState.awb; - /* Calculate the normalized chromaticity values */ - double x = X / (X + Y + Z); - double y = Y / (X + Y + Z); + const auto &awbEnable = controls.get(controls::AwbEnable); + if (awbEnable && *awbEnable != awb.autoEnabled) { + awb.autoEnabled = *awbEnable; - /* Calculate CCT */ - double n = (x - 0.3320) / (0.1858 - y); - return 449 * n * n * n + 3525 * n * n + 6823.3 * n + 5520.33; + LOG(RkISP1Awb, Debug) + << (*awbEnable ? "Enabling" : "Disabling") << " AWB"; + } + + const auto &colourGains = controls.get(controls::ColourGains); + if (colourGains && !awb.autoEnabled) { + awb.gains.manual.red = (*colourGains)[0]; + awb.gains.manual.blue = (*colourGains)[1]; + + LOG(RkISP1Awb, Debug) + << "Set colour gains to red: " << awb.gains.manual.red + << ", blue: " << awb.gains.manual.blue; + } + + frameContext.awb.autoEnabled = awb.autoEnabled; + + if (!awb.autoEnabled) { + frameContext.awb.gains.red = awb.gains.manual.red; + frameContext.awb.gains.green = 1.0; + frameContext.awb.gains.blue = awb.gains.manual.blue; + } } /** * \copydoc libcamera::ipa::Algorithm::prepare */ -void Awb::prepare(IPAContext &context, rkisp1_params_cfg *params) +void Awb::prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, rkisp1_params_cfg *params) { - params->others.awb_gain_config.gain_green_b = 256 * context.frameContext.awb.gains.green; - params->others.awb_gain_config.gain_blue = 256 * context.frameContext.awb.gains.blue; - params->others.awb_gain_config.gain_red = 256 * context.frameContext.awb.gains.red; - params->others.awb_gain_config.gain_green_r = 256 * context.frameContext.awb.gains.green; + /* + * This is the latest time we can read the active state. This is the + * most up-to-date automatic values we can read. + */ + if (frameContext.awb.autoEnabled) { + frameContext.awb.gains.red = context.activeState.awb.gains.automatic.red; + frameContext.awb.gains.green = context.activeState.awb.gains.automatic.green; + frameContext.awb.gains.blue = context.activeState.awb.gains.automatic.blue; + } + + params->others.awb_gain_config.gain_green_b = 256 * frameContext.awb.gains.green; + params->others.awb_gain_config.gain_blue = 256 * frameContext.awb.gains.blue; + params->others.awb_gain_config.gain_red = 256 * frameContext.awb.gains.red; + params->others.awb_gain_config.gain_green_r = 256 * frameContext.awb.gains.green; /* Update the gains. */ params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_AWB_GAIN; - /* If we already have configured the gains and window, return. */ - if (context.frameContext.frameCount > 0) + /* If we have already set the AWB measurement parameters, return. */ + if (frame > 0) return; - /* Configure the gains to apply. */ + rkisp1_cif_isp_awb_meas_config &awb_config = params->meas.awb_meas_config; + + /* Configure the measure window for AWB. */ + awb_config.awb_wnd = context.configuration.awb.measureWindow; + + /* Number of frames to use to estimate the means (0 means 1 frame). */ + awb_config.frames = 0; + + /* Select RGB or YCbCr means measurement. */ + if (rgbMode_) { + awb_config.awb_mode = RKISP1_CIF_ISP_AWB_MODE_RGB; + + /* + * For RGB-based measurements, pixels are selected with maximum + * red, green and blue thresholds that are set in the + * awb_ref_cr, awb_min_y and awb_ref_cb respectively. The other + * values are not used, set them to 0. + */ + awb_config.awb_ref_cr = 250; + awb_config.min_y = 250; + awb_config.awb_ref_cb = 250; + + awb_config.max_y = 0; + awb_config.min_c = 0; + awb_config.max_csum = 0; + } else { + awb_config.awb_mode = RKISP1_CIF_ISP_AWB_MODE_YCBCR; + + /* Set the reference Cr and Cb (AWB target) to white. */ + awb_config.awb_ref_cb = 128; + awb_config.awb_ref_cr = 128; + + /* + * Filter out pixels based on luminance and chrominance values. + * The acceptable luma values are specified as a [16, 250] + * range, while the acceptable chroma values are specified with + * a minimum of 16 and a maximum Cb+Cr sum of 250. + */ + awb_config.min_y = 16; + awb_config.max_y = 250; + awb_config.min_c = 16; + awb_config.max_csum = 250; + } + + /* Enable the AWB gains. */ params->module_en_update |= RKISP1_CIF_ISP_MODULE_AWB_GAIN; - /* Update the ISP to apply the gains configured. */ params->module_ens |= RKISP1_CIF_ISP_MODULE_AWB_GAIN; - /* Configure the measure window for AWB. */ - params->meas.awb_meas_config.awb_wnd = context.configuration.awb.measureWindow; - /* - * Measure Y, Cr and Cb means. - * \todo RGB is not working, the kernel seems to not configure it ? - */ - params->meas.awb_meas_config.awb_mode = RKISP1_CIF_ISP_AWB_MODE_YCBCR; - /* Reference Cr and Cb. */ - params->meas.awb_meas_config.awb_ref_cb = 128; - params->meas.awb_meas_config.awb_ref_cr = 128; - /* Y values to include are between min_y and max_y only. */ - params->meas.awb_meas_config.min_y = 16; - params->meas.awb_meas_config.max_y = 250; - /* Maximum Cr+Cb value to take into account for awb. */ - params->meas.awb_meas_config.max_csum = 250; - /* Minimum Cr and Cb values to take into account. */ - params->meas.awb_meas_config.min_c = 16; - /* Number of frames to use to estimate the mean (0 means 1 frame). */ - params->meas.awb_meas_config.frames = 0; - - /* Update AWB measurement unit configuration. */ + /* Update the AWB measurement parameters and enable the AWB module. */ params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_AWB; - /* Make sure the ISP is measuring the means for the next frame. */ params->module_en_update |= RKISP1_CIF_ISP_MODULE_AWB; params->module_ens |= RKISP1_CIF_ISP_MODULE_AWB; } +uint32_t Awb::estimateCCT(double red, double green, double blue) +{ + /* Convert the RGB values to CIE tristimulus values (XYZ) */ + double X = (-0.14282) * (red) + (1.54924) * (green) + (-0.95641) * (blue); + double Y = (-0.32466) * (red) + (1.57837) * (green) + (-0.73191) * (blue); + double Z = (-0.68202) * (red) + (0.77073) * (green) + (0.56332) * (blue); + + /* Calculate the normalized chromaticity values */ + double x = X / (X + Y + Z); + double y = Y / (X + Y + Z); + + /* Calculate CCT */ + double n = (x - 0.3320) / (0.1858 - y); + return 449 * n * n * n + 3525 * n * n + 6823.3 * n + 5520.33; +} + /** * \copydoc libcamera::ipa::Algorithm::process */ -void Awb::process([[maybe_unused]] IPAContext &context, - [[maybe_unused]] IPAFrameContext *frameCtx, - const rkisp1_stat_buffer *stats) +void Awb::process(IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + const rkisp1_stat_buffer *stats, + ControlList &metadata) { const rkisp1_cif_isp_stat *params = &stats->params; const rkisp1_cif_isp_awb_stat *awb = ¶ms->awb; - IPAFrameContext &frameContext = context.frameContext; - - /* Get the YCbCr mean values */ - double yMean = awb->awb_mean[0].mean_y_or_g; - double crMean = awb->awb_mean[0].mean_cr_or_r; - double cbMean = awb->awb_mean[0].mean_cb_or_b; + IPAActiveState &activeState = context.activeState; + double greenMean; + double redMean; + double blueMean; + + if (rgbMode_) { + greenMean = awb->awb_mean[0].mean_y_or_g; + redMean = awb->awb_mean[0].mean_cr_or_r; + blueMean = awb->awb_mean[0].mean_cb_or_b; + } else { + /* Get the YCbCr mean values */ + double yMean = awb->awb_mean[0].mean_y_or_g; + double cbMean = awb->awb_mean[0].mean_cb_or_b; + double crMean = awb->awb_mean[0].mean_cr_or_r; + + /* + * Convert from YCbCr to RGB. + * The hardware uses the following formulas: + * Y = 16 + 0.2500 R + 0.5000 G + 0.1094 B + * Cb = 128 - 0.1406 R - 0.2969 G + 0.4375 B + * Cr = 128 + 0.4375 R - 0.3750 G - 0.0625 B + * + * The inverse matrix is thus: + * [[1,1636, -0,0623, 1,6008] + * [1,1636, -0,4045, -0,7949] + * [1,1636, 1,9912, -0,0250]] + */ + yMean -= 16; + cbMean -= 128; + crMean -= 128; + redMean = 1.1636 * yMean - 0.0623 * cbMean + 1.6008 * crMean; + greenMean = 1.1636 * yMean - 0.4045 * cbMean - 0.7949 * crMean; + blueMean = 1.1636 * yMean + 1.9912 * cbMean - 0.0250 * crMean; + + /* + * Due to hardware rounding errors in the YCbCr means, the + * calculated RGB means may be negative. This would lead to + * negative gains, messing up calculation. Prevent this by + * clamping the means to positive values. + */ + redMean = std::max(redMean, 0.0); + greenMean = std::max(greenMean, 0.0); + blueMean = std::max(blueMean, 0.0); + } /* - * Convert from YCbCr to RGB. - * The hardware uses the following formulas: - * Y = 16 + 0.2500 R + 0.5000 G + 0.1094 B - * Cb = 128 - 0.1406 R - 0.2969 G + 0.4375 B - * Cr = 128 + 0.4375 R - 0.3750 G - 0.0625 B - * - * The inverse matrix is thus: - * [[1,1636, -0,0623, 1,6008] - * [1,1636, -0,4045, -0,7949] - * [1,1636, 1,9912, -0,0250]] + * The ISP computes the AWB means after applying the colour gains, + * divide by the gains that were used to get the raw means from the + * sensor. */ - yMean -= 16; - cbMean -= 128; - crMean -= 128; - double redMean = 1.1636 * yMean - 0.0623 * cbMean + 1.6008 * crMean; - double greenMean = 1.1636 * yMean - 0.4045 * cbMean - 0.7949 * crMean; - double blueMean = 1.1636 * yMean + 1.9912 * cbMean - 0.0250 * crMean; + redMean /= frameContext.awb.gains.red; + greenMean /= frameContext.awb.gains.green; + blueMean /= frameContext.awb.gains.blue; - /* Estimate the red and blue gains to apply in a grey world. */ - double redGain = greenMean / (redMean + 1); - double blueGain = greenMean / (blueMean + 1); + /* + * If the means are too small we don't have enough information to + * meaningfully calculate gains. Freeze the algorithm in that case. + */ + if (redMean < kMeanMinThreshold && greenMean < kMeanMinThreshold && + blueMean < kMeanMinThreshold) { + frameContext.awb.temperatureK = activeState.awb.temperatureK; + return; + } - /* Filter the values to avoid oscillations. */ - double speed = 0.2; - redGain = speed * redGain + (1 - speed) * frameContext.awb.gains.red; - blueGain = speed * blueGain + (1 - speed) * frameContext.awb.gains.blue; + activeState.awb.temperatureK = estimateCCT(redMean, greenMean, blueMean); /* - * Gain values are unsigned integer value, range 0 to 4 with 8 bit - * fractional part. + * Estimate the red and blue gains to apply in a grey world. The green + * gain is hardcoded to 1.0. Avoid divisions by zero by clamping the + * divisor to a minimum value of 1.0. */ - frameContext.awb.gains.red = std::clamp(redGain, 0.0, 1023.0 / 256); - frameContext.awb.gains.blue = std::clamp(blueGain, 0.0, 1023.0 / 256); - /* Hardcode the green gain to 1.0. */ - frameContext.awb.gains.green = 1.0; + double redGain = greenMean / std::max(redMean, 1.0); + double blueGain = greenMean / std::max(blueMean, 1.0); - frameContext.awb.temperatureK = estimateCCT(redMean, greenMean, blueMean); + /* + * Clamp the gain values to the hardware, which expresses gains as Q2.8 + * unsigned integer values. Set the minimum just above zero to avoid + * divisions by zero when computing the raw means in subsequent + * iterations. + */ + redGain = std::clamp(redGain, 1.0 / 256, 1023.0 / 256); + blueGain = std::clamp(blueGain, 1.0 / 256, 1023.0 / 256); - LOG(RkISP1Awb, Debug) << "Gain found for red: " << context.frameContext.awb.gains.red - << " and for blue: " << context.frameContext.awb.gains.blue; + /* Filter the values to avoid oscillations. */ + double speed = 0.2; + redGain = speed * redGain + (1 - speed) * activeState.awb.gains.automatic.red; + blueGain = speed * blueGain + (1 - speed) * activeState.awb.gains.automatic.blue; + + activeState.awb.gains.automatic.red = redGain; + activeState.awb.gains.automatic.blue = blueGain; + activeState.awb.gains.automatic.green = 1.0; + + frameContext.awb.temperatureK = activeState.awb.temperatureK; + + metadata.set(controls::AwbEnable, frameContext.awb.autoEnabled); + metadata.set(controls::ColourGains, { + static_cast<float>(frameContext.awb.gains.red), + static_cast<float>(frameContext.awb.gains.blue) + }); + metadata.set(controls::ColourTemperature, frameContext.awb.temperatureK); + + LOG(RkISP1Awb, Debug) << std::showpoint + << "Means [" << redMean << ", " << greenMean << ", " << blueMean + << "], gains [" << activeState.awb.gains.automatic.red << ", " + << activeState.awb.gains.automatic.green << ", " + << activeState.awb.gains.automatic.blue << "], temp " + << frameContext.awb.temperatureK << "K"; } REGISTER_IPA_ALGORITHM(Awb, "Awb") diff --git a/src/ipa/rkisp1/algorithms/awb.h b/src/ipa/rkisp1/algorithms/awb.h index 7647842f..06c92896 100644 --- a/src/ipa/rkisp1/algorithms/awb.h +++ b/src/ipa/rkisp1/algorithms/awb.h @@ -2,13 +2,11 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * awb.h - AWB control algorithm + * AWB control algorithm */ #pragma once -#include <linux/rkisp1-config.h> - #include "algorithm.h" namespace libcamera { @@ -18,16 +16,25 @@ namespace ipa::rkisp1::algorithms { class Awb : public Algorithm { public: - Awb() = default; + Awb(); ~Awb() = default; int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override; - void prepare(IPAContext &context, rkisp1_params_cfg *params) override; - void process(IPAContext &context, IPAFrameContext *frameCtx, - const rkisp1_stat_buffer *stats) override; + void queueRequest(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + void process(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + const rkisp1_stat_buffer *stats, + ControlList &metadata) override; private: uint32_t estimateCCT(double red, double green, double blue); + + bool rgbMode_; }; } /* namespace ipa::rkisp1::algorithms */ diff --git a/src/ipa/rkisp1/algorithms/blc.cpp b/src/ipa/rkisp1/algorithms/blc.cpp index 3542f61c..d2e74354 100644 --- a/src/ipa/rkisp1/algorithms/blc.cpp +++ b/src/ipa/rkisp1/algorithms/blc.cpp @@ -2,11 +2,15 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * blc.cpp - RkISP1 Black Level Correction control + * RkISP1 Black Level Correction control */ #include "blc.h" +#include <libcamera/base/log.h> + +#include "libcamera/internal/yaml_parser.h" + /** * \file blc.h */ @@ -29,23 +33,54 @@ namespace ipa::rkisp1::algorithms { * isn't currently supported. */ +LOG_DEFINE_CATEGORY(RkISP1Blc) + +BlackLevelCorrection::BlackLevelCorrection() + : tuningParameters_(false) +{ +} + +/** + * \copydoc libcamera::ipa::Algorithm::init + */ +int BlackLevelCorrection::init([[maybe_unused]] IPAContext &context, + const YamlObject &tuningData) +{ + blackLevelRed_ = tuningData["R"].get<int16_t>(256); + blackLevelGreenR_ = tuningData["Gr"].get<int16_t>(256); + blackLevelGreenB_ = tuningData["Gb"].get<int16_t>(256); + blackLevelBlue_ = tuningData["B"].get<int16_t>(256); + + tuningParameters_ = true; + + LOG(RkISP1Blc, Debug) + << "Black levels: red " << blackLevelRed_ + << ", green (red) " << blackLevelGreenR_ + << ", green (blue) " << blackLevelGreenB_ + << ", blue " << blackLevelBlue_; + + return 0; +} + /** * \copydoc libcamera::ipa::Algorithm::prepare */ -void BlackLevelCorrection::prepare(IPAContext &context, +void BlackLevelCorrection::prepare([[maybe_unused]] IPAContext &context, + const uint32_t frame, + [[maybe_unused]] IPAFrameContext &frameContext, rkisp1_params_cfg *params) { - if (context.frameContext.frameCount > 0) + if (frame > 0) + return; + + if (!tuningParameters_) return; - /* - * Substract fixed values taken from imx219 tuning file. - * \todo Use a configuration file for it ? - */ + params->others.bls_config.enable_auto = 0; - params->others.bls_config.fixed_val.r = 256; - params->others.bls_config.fixed_val.gr = 256; - params->others.bls_config.fixed_val.gb = 256; - params->others.bls_config.fixed_val.b = 256; + params->others.bls_config.fixed_val.r = blackLevelRed_; + params->others.bls_config.fixed_val.gr = blackLevelGreenR_; + params->others.bls_config.fixed_val.gb = blackLevelGreenB_; + params->others.bls_config.fixed_val.b = blackLevelBlue_; params->module_en_update |= RKISP1_CIF_ISP_MODULE_BLS; params->module_ens |= RKISP1_CIF_ISP_MODULE_BLS; diff --git a/src/ipa/rkisp1/algorithms/blc.h b/src/ipa/rkisp1/algorithms/blc.h index 69874d8f..460ebcc1 100644 --- a/src/ipa/rkisp1/algorithms/blc.h +++ b/src/ipa/rkisp1/algorithms/blc.h @@ -2,28 +2,34 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * blc.h - RkISP1 Black Level Correction control + * RkISP1 Black Level Correction control */ #pragma once -#include <linux/rkisp1-config.h> - #include "algorithm.h" namespace libcamera { -struct IPACameraSensorInfo; - namespace ipa::rkisp1::algorithms { class BlackLevelCorrection : public Algorithm { public: - BlackLevelCorrection() = default; + BlackLevelCorrection(); ~BlackLevelCorrection() = default; - void prepare(IPAContext &context, rkisp1_params_cfg *params) override; + int init(IPAContext &context, const YamlObject &tuningData) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + +private: + bool tuningParameters_; + int16_t blackLevelRed_; + int16_t blackLevelGreenR_; + int16_t blackLevelGreenB_; + int16_t blackLevelBlue_; }; } /* namespace ipa::rkisp1::algorithms */ diff --git a/src/ipa/rkisp1/algorithms/cproc.cpp b/src/ipa/rkisp1/algorithms/cproc.cpp new file mode 100644 index 00000000..68bb8180 --- /dev/null +++ b/src/ipa/rkisp1/algorithms/cproc.cpp @@ -0,0 +1,111 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Color Processing control + */ + +#include "cproc.h" + +#include <algorithm> +#include <cmath> + +#include <libcamera/base/log.h> + +#include <libcamera/control_ids.h> + +/** + * \file cproc.h + */ + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +/** + * \class ColorProcessing + * \brief RkISP1 Color Processing control + * + * The ColorProcessing algorithm is responsible for applying brightness, + * contrast and saturation corrections. The values are directly provided + * through requests by the corresponding controls. + */ + +LOG_DEFINE_CATEGORY(RkISP1CProc) + +/** + * \copydoc libcamera::ipa::Algorithm::queueRequest + */ +void ColorProcessing::queueRequest(IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) +{ + auto &cproc = context.activeState.cproc; + bool update = false; + + const auto &brightness = controls.get(controls::Brightness); + if (brightness) { + int value = std::clamp<int>(std::lround(*brightness * 128), -128, 127); + if (cproc.brightness != value) { + cproc.brightness = value; + update = true; + } + + LOG(RkISP1CProc, Debug) << "Set brightness to " << value; + } + + const auto &contrast = controls.get(controls::Contrast); + if (contrast) { + int value = std::clamp<int>(std::lround(*contrast * 128), 0, 255); + if (cproc.contrast != value) { + cproc.contrast = value; + update = true; + } + + LOG(RkISP1CProc, Debug) << "Set contrast to " << value; + } + + const auto saturation = controls.get(controls::Saturation); + if (saturation) { + int value = std::clamp<int>(std::lround(*saturation * 128), 0, 255); + if (cproc.saturation != value) { + cproc.saturation = value; + update = true; + } + + LOG(RkISP1CProc, Debug) << "Set saturation to " << value; + } + + frameContext.cproc.brightness = cproc.brightness; + frameContext.cproc.contrast = cproc.contrast; + frameContext.cproc.saturation = cproc.saturation; + frameContext.cproc.update = update; +} + +/** + * \copydoc libcamera::ipa::Algorithm::prepare + */ +void ColorProcessing::prepare([[maybe_unused]] IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) +{ + /* Check if the algorithm configuration has been updated. */ + if (!frameContext.cproc.update) + return; + + params->others.cproc_config.brightness = frameContext.cproc.brightness; + params->others.cproc_config.contrast = frameContext.cproc.contrast; + params->others.cproc_config.sat = frameContext.cproc.saturation; + + params->module_en_update |= RKISP1_CIF_ISP_MODULE_CPROC; + params->module_ens |= RKISP1_CIF_ISP_MODULE_CPROC; + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_CPROC; +} + +REGISTER_IPA_ALGORITHM(ColorProcessing, "ColorProcessing") + +} /* namespace ipa::rkisp1::algorithms */ + +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/cproc.h b/src/ipa/rkisp1/algorithms/cproc.h new file mode 100644 index 00000000..bafba5cc --- /dev/null +++ b/src/ipa/rkisp1/algorithms/cproc.h @@ -0,0 +1,33 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Color Processing control + */ + +#pragma once + +#include <sys/types.h> + +#include "algorithm.h" + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +class ColorProcessing : public Algorithm +{ +public: + ColorProcessing() = default; + ~ColorProcessing() = default; + + void queueRequest(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; +}; + +} /* namespace ipa::rkisp1::algorithms */ +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/dpcc.cpp b/src/ipa/rkisp1/algorithms/dpcc.cpp new file mode 100644 index 00000000..b5a339e9 --- /dev/null +++ b/src/ipa/rkisp1/algorithms/dpcc.cpp @@ -0,0 +1,251 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Defect Pixel Cluster Correction control + */ + +#include "dpcc.h" + +#include <libcamera/base/log.h> + +#include "libcamera/internal/yaml_parser.h" + +#include "linux/rkisp1-config.h" + +/** + * \file dpcc.h + */ + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +/** + * \class DefectPixelClusterCorrection + * \brief RkISP1 Defect Pixel Cluster Correction control + * + * Depending of the sensor quality, some pixels can be defective and then + * appear significantly brighter or darker than the other pixels. + * + * The Defect Pixel Cluster Correction algorithms is responsible to minimize + * the impact of the pixels. This can be done with algorithms applied at run + * time (on-the-fly method) or with a table of defective pixels. Only the first + * method is supported for the moment. + */ + +LOG_DEFINE_CATEGORY(RkISP1Dpcc) + +DefectPixelClusterCorrection::DefectPixelClusterCorrection() + : config_({}) +{ +} + +/** + * \copydoc libcamera::ipa::Algorithm::init + */ +int DefectPixelClusterCorrection::init([[maybe_unused]] IPAContext &context, + const YamlObject &tuningData) +{ + config_.mode = RKISP1_CIF_ISP_DPCC_MODE_STAGE1_ENABLE; + config_.output_mode = RKISP1_CIF_ISP_DPCC_OUTPUT_MODE_STAGE1_INCL_G_CENTER + | RKISP1_CIF_ISP_DPCC_OUTPUT_MODE_STAGE1_INCL_RB_CENTER; + + config_.set_use = tuningData["fixed-set"].get<bool>(false) + ? RKISP1_CIF_ISP_DPCC_SET_USE_STAGE1_USE_FIX_SET : 0; + + /* Get all defined sets to apply (up to 3). */ + const YamlObject &setsObject = tuningData["sets"]; + if (!setsObject.isList()) { + LOG(RkISP1Dpcc, Error) + << "'sets' parameter not found in tuning file"; + return -EINVAL; + } + + if (setsObject.size() > RKISP1_CIF_ISP_DPCC_METHODS_MAX) { + LOG(RkISP1Dpcc, Error) + << "'sets' size in tuning file (" << setsObject.size() + << ") exceeds the maximum hardware capacity (3)"; + return -EINVAL; + } + + for (std::size_t i = 0; i < setsObject.size(); ++i) { + struct rkisp1_cif_isp_dpcc_methods_config &method = config_.methods[i]; + const YamlObject &set = setsObject[i]; + uint16_t value; + + /* Enable set if described in YAML tuning file. */ + config_.set_use |= 1 << i; + + /* PG Method */ + const YamlObject &pgObject = set["pg-factor"]; + + if (pgObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_PG_GREEN_ENABLE; + + value = pgObject["green"].get<uint16_t>(0); + method.pg_fac |= RKISP1_CIF_ISP_DPCC_PG_FAC_G(value); + } + + if (pgObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_PG_RED_BLUE_ENABLE; + + value = pgObject["red-blue"].get<uint16_t>(0); + method.pg_fac |= RKISP1_CIF_ISP_DPCC_PG_FAC_RB(value); + } + + /* RO Method */ + const YamlObject &roObject = set["ro-limits"]; + + if (roObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RO_GREEN_ENABLE; + + value = roObject["green"].get<uint16_t>(0); + config_.ro_limits |= + RKISP1_CIF_ISP_DPCC_RO_LIMITS_n_G(i, value); + } + + if (roObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RO_RED_BLUE_ENABLE; + + value = roObject["red-blue"].get<uint16_t>(0); + config_.ro_limits |= + RKISP1_CIF_ISP_DPCC_RO_LIMITS_n_RB(i, value); + } + + /* RG Method */ + const YamlObject &rgObject = set["rg-factor"]; + method.rg_fac = 0; + + if (rgObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RG_GREEN_ENABLE; + + value = rgObject["green"].get<uint16_t>(0); + method.rg_fac |= RKISP1_CIF_ISP_DPCC_RG_FAC_G(value); + } + + if (rgObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RG_RED_BLUE_ENABLE; + + value = rgObject["red-blue"].get<uint16_t>(0); + method.rg_fac |= RKISP1_CIF_ISP_DPCC_RG_FAC_RB(value); + } + + /* RND Method */ + const YamlObject &rndOffsetsObject = set["rnd-offsets"]; + + if (rndOffsetsObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RND_GREEN_ENABLE; + + value = rndOffsetsObject["green"].get<uint16_t>(0); + config_.rnd_offs |= + RKISP1_CIF_ISP_DPCC_RND_OFFS_n_G(i, value); + } + + if (rndOffsetsObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RND_RED_BLUE_ENABLE; + + value = rndOffsetsObject["red-blue"].get<uint16_t>(0); + config_.rnd_offs |= + RKISP1_CIF_ISP_DPCC_RND_OFFS_n_RB(i, value); + } + + const YamlObject &rndThresholdObject = set["rnd-threshold"]; + method.rnd_thresh = 0; + + if (rndThresholdObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RND_GREEN_ENABLE; + + value = rndThresholdObject["green"].get<uint16_t>(0); + method.rnd_thresh |= + RKISP1_CIF_ISP_DPCC_RND_THRESH_G(value); + } + + if (rndThresholdObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_RND_RED_BLUE_ENABLE; + + value = rndThresholdObject["red-blue"].get<uint16_t>(0); + method.rnd_thresh |= + RKISP1_CIF_ISP_DPCC_RND_THRESH_RB(value); + } + + /* LC Method */ + const YamlObject &lcThresholdObject = set["line-threshold"]; + method.line_thresh = 0; + + if (lcThresholdObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_LC_GREEN_ENABLE; + + value = lcThresholdObject["green"].get<uint16_t>(0); + method.line_thresh |= + RKISP1_CIF_ISP_DPCC_LINE_THRESH_G(value); + } + + if (lcThresholdObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_LC_RED_BLUE_ENABLE; + + value = lcThresholdObject["red-blue"].get<uint16_t>(0); + method.line_thresh |= + RKISP1_CIF_ISP_DPCC_LINE_THRESH_RB(value); + } + + const YamlObject &lcTMadFactorObject = set["line-mad-factor"]; + method.line_mad_fac = 0; + + if (lcTMadFactorObject.contains("green")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_LC_GREEN_ENABLE; + + value = lcTMadFactorObject["green"].get<uint16_t>(0); + method.line_mad_fac |= + RKISP1_CIF_ISP_DPCC_LINE_MAD_FAC_G(value); + } + + if (lcTMadFactorObject.contains("red-blue")) { + method.method |= + RKISP1_CIF_ISP_DPCC_METHODS_SET_LC_RED_BLUE_ENABLE; + + value = lcTMadFactorObject["red-blue"].get<uint16_t>(0); + method.line_mad_fac |= + RKISP1_CIF_ISP_DPCC_LINE_MAD_FAC_RB(value); + } + } + + return 0; +} + +/** + * \copydoc libcamera::ipa::Algorithm::prepare + */ +void DefectPixelClusterCorrection::prepare([[maybe_unused]] IPAContext &context, + const uint32_t frame, + [[maybe_unused]] IPAFrameContext &frameContext, + rkisp1_params_cfg *params) +{ + if (frame > 0) + return; + + params->others.dpcc_config = config_; + + params->module_en_update |= RKISP1_CIF_ISP_MODULE_DPCC; + params->module_ens |= RKISP1_CIF_ISP_MODULE_DPCC; + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_DPCC; +} + +REGISTER_IPA_ALGORITHM(DefectPixelClusterCorrection, "DefectPixelClusterCorrection") + +} /* namespace ipa::rkisp1::algorithms */ + +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/dpcc.h b/src/ipa/rkisp1/algorithms/dpcc.h new file mode 100644 index 00000000..d39b7bed --- /dev/null +++ b/src/ipa/rkisp1/algorithms/dpcc.h @@ -0,0 +1,32 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Defect Pixel Cluster Correction control + */ + +#pragma once + +#include "algorithm.h" + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +class DefectPixelClusterCorrection : public Algorithm +{ +public: + DefectPixelClusterCorrection(); + ~DefectPixelClusterCorrection() = default; + + int init(IPAContext &context, const YamlObject &tuningData) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + +private: + rkisp1_cif_isp_dpcc_config config_; +}; + +} /* namespace ipa::rkisp1::algorithms */ +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/dpf.cpp b/src/ipa/rkisp1/algorithms/dpf.cpp new file mode 100644 index 00000000..abf95728 --- /dev/null +++ b/src/ipa/rkisp1/algorithms/dpf.cpp @@ -0,0 +1,260 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Denoise Pre-Filter control + */ + +#include "dpf.h" + +#include <cmath> + +#include <libcamera/base/log.h> + +#include <libcamera/control_ids.h> + +#include "linux/rkisp1-config.h" + +/** + * \file dpf.h + */ + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +/** + * \class Dpf + * \brief RkISP1 Denoise Pre-Filter control + * + * The denoise pre-filter algorithm is a bilateral filter which combines a + * range filter and a domain filter. The denoise pre-filter is applied before + * demosaicing. + */ + +LOG_DEFINE_CATEGORY(RkISP1Dpf) + +Dpf::Dpf() + : config_({}), strengthConfig_({}) +{ +} + +/** + * \copydoc libcamera::ipa::Algorithm::init + */ +int Dpf::init([[maybe_unused]] IPAContext &context, + const YamlObject &tuningData) +{ + std::vector<uint8_t> values; + + /* + * The domain kernel is configured with a 9x9 kernel for the green + * pixels, and a 13x9 or 9x9 kernel for red and blue pixels. + */ + const YamlObject &dFObject = tuningData["DomainFilter"]; + + /* + * For the green component, we have the 9x9 kernel specified + * as 6 coefficients: + * Y + * ^ + * 4 | 6 5 4 5 6 + * 3 | 5 3 3 5 + * 2 | 5 3 2 3 5 + * 1 | 3 1 1 3 + * 0 - 4 2 0 2 4 + * -1 | 3 1 1 3 + * -2 | 5 3 2 3 5 + * -3 | 5 3 3 5 + * -4 | 6 5 4 5 6 + * +---------|--------> X + * -4....-1 0 1 2 3 4 + */ + values = dFObject["g"].getList<uint8_t>().value_or(std::vector<uint8_t>{}); + if (values.size() != RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS) { + LOG(RkISP1Dpf, Error) + << "Invalid 'DomainFilter:g': expected " + << RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS + << " elements, got " << values.size(); + return -EINVAL; + } + + std::copy_n(values.begin(), values.size(), + std::begin(config_.g_flt.spatial_coeff)); + + config_.g_flt.gr_enable = true; + config_.g_flt.gb_enable = true; + + /* + * For the red and blue components, we have the 13x9 kernel specified + * as 6 coefficients: + * + * Y + * ^ + * 4 | 6 5 4 3 4 5 6 + * | + * 2 | 5 4 2 1 2 4 5 + * | + * 0 - 5 3 1 0 1 3 5 + * | + * -2 | 5 4 2 1 2 4 5 + * | + * -4 | 6 5 4 3 4 5 6 + * +-------------|------------> X + * -6 -4 -2 0 2 4 6 + * + * For a 9x9 kernel, columns -6 and 6 are dropped, so coefficient + * number 6 is not used. + */ + values = dFObject["rb"].getList<uint8_t>().value_or(std::vector<uint8_t>{}); + if (values.size() != RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS && + values.size() != RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS - 1) { + LOG(RkISP1Dpf, Error) + << "Invalid 'DomainFilter:rb': expected " + << RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS - 1 + << " or " << RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS + << " elements, got " << values.size(); + return -EINVAL; + } + + config_.rb_flt.fltsize = values.size() == RKISP1_CIF_ISP_DPF_MAX_SPATIAL_COEFFS + ? RKISP1_CIF_ISP_DPF_RB_FILTERSIZE_13x9 + : RKISP1_CIF_ISP_DPF_RB_FILTERSIZE_9x9; + + std::copy_n(values.begin(), values.size(), + std::begin(config_.rb_flt.spatial_coeff)); + + config_.rb_flt.r_enable = true; + config_.rb_flt.b_enable = true; + + /* + * The range kernel is configured with a noise level lookup table (NLL) + * which stores a piecewise linear function that characterizes the + * sensor noise profile as a noise level function curve (NLF). + */ + const YamlObject &rFObject = tuningData["NoiseLevelFunction"]; + + std::vector<uint16_t> nllValues; + nllValues = rFObject["coeff"].getList<uint16_t>().value_or(std::vector<uint16_t>{}); + if (nllValues.size() != RKISP1_CIF_ISP_DPF_MAX_NLF_COEFFS) { + LOG(RkISP1Dpf, Error) + << "Invalid 'RangeFilter:coeff': expected " + << RKISP1_CIF_ISP_DPF_MAX_NLF_COEFFS + << " elements, got " << nllValues.size(); + return -EINVAL; + } + + std::copy_n(nllValues.begin(), nllValues.size(), + std::begin(config_.nll.coeff)); + + std::string scaleMode = rFObject["scale-mode"].get<std::string>(""); + if (scaleMode == "linear") { + config_.nll.scale_mode = RKISP1_CIF_ISP_NLL_SCALE_LINEAR; + } else if (scaleMode == "logarithmic") { + config_.nll.scale_mode = RKISP1_CIF_ISP_NLL_SCALE_LOGARITHMIC; + } else { + LOG(RkISP1Dpf, Error) + << "Invalid 'RangeFilter:scale-mode': expected " + << "'linear' or 'logarithmic' value, got " + << scaleMode; + return -EINVAL; + } + + const YamlObject &fSObject = tuningData["FilterStrength"]; + + strengthConfig_.r = fSObject["r"].get<uint16_t>(64); + strengthConfig_.g = fSObject["g"].get<uint16_t>(64); + strengthConfig_.b = fSObject["b"].get<uint16_t>(64); + + return 0; +} + +/** + * \copydoc libcamera::ipa::Algorithm::queueRequest + */ +void Dpf::queueRequest(IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) +{ + auto &dpf = context.activeState.dpf; + bool update = false; + + const auto &denoise = controls.get(controls::draft::NoiseReductionMode); + if (denoise) { + LOG(RkISP1Dpf, Debug) << "Set denoise to " << *denoise; + + switch (*denoise) { + case controls::draft::NoiseReductionModeOff: + if (dpf.denoise) { + dpf.denoise = false; + update = true; + } + break; + case controls::draft::NoiseReductionModeMinimal: + case controls::draft::NoiseReductionModeHighQuality: + case controls::draft::NoiseReductionModeFast: + if (!dpf.denoise) { + dpf.denoise = true; + update = true; + } + break; + default: + LOG(RkISP1Dpf, Error) + << "Unsupported denoise value " + << *denoise; + break; + } + } + + frameContext.dpf.denoise = dpf.denoise; + frameContext.dpf.update = update; +} + +/** + * \copydoc libcamera::ipa::Algorithm::prepare + */ +void Dpf::prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, rkisp1_params_cfg *params) +{ + if (frame == 0) { + params->others.dpf_config = config_; + params->others.dpf_strength_config = strengthConfig_; + + const auto &awb = context.configuration.awb; + const auto &lsc = context.configuration.lsc; + auto &mode = params->others.dpf_config.gain.mode; + + /* + * The DPF needs to take into account the total amount of + * digital gain, which comes from the AWB and LSC modules. The + * DPF hardware can be programmed with a digital gain value + * manually, but can also use the gains supplied by the AWB and + * LSC modules automatically when they are enabled. Use that + * mode of operation as it simplifies control of the DPF. + */ + if (awb.enabled && lsc.enabled) + mode = RKISP1_CIF_ISP_DPF_GAIN_USAGE_AWB_LSC_GAINS; + else if (awb.enabled) + mode = RKISP1_CIF_ISP_DPF_GAIN_USAGE_AWB_GAINS; + else if (lsc.enabled) + mode = RKISP1_CIF_ISP_DPF_GAIN_USAGE_LSC_GAINS; + else + mode = RKISP1_CIF_ISP_DPF_GAIN_USAGE_DISABLED; + + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_DPF | + RKISP1_CIF_ISP_MODULE_DPF_STRENGTH; + } + + if (frameContext.dpf.update) { + params->module_en_update |= RKISP1_CIF_ISP_MODULE_DPF; + if (frameContext.dpf.denoise) + params->module_ens |= RKISP1_CIF_ISP_MODULE_DPF; + } +} + +REGISTER_IPA_ALGORITHM(Dpf, "Dpf") + +} /* namespace ipa::rkisp1::algorithms */ + +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/dpf.h b/src/ipa/rkisp1/algorithms/dpf.h new file mode 100644 index 00000000..da0115ba --- /dev/null +++ b/src/ipa/rkisp1/algorithms/dpf.h @@ -0,0 +1,38 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Denoise Pre-Filter control + */ + +#pragma once + +#include <sys/types.h> + +#include "algorithm.h" + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +class Dpf : public Algorithm +{ +public: + Dpf(); + ~Dpf() = default; + + int init(IPAContext &context, const YamlObject &tuningData) override; + void queueRequest(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + +private: + struct rkisp1_cif_isp_dpf_config config_; + struct rkisp1_cif_isp_dpf_strength_config strengthConfig_; +}; + +} /* namespace ipa::rkisp1::algorithms */ +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/filter.cpp b/src/ipa/rkisp1/algorithms/filter.cpp new file mode 100644 index 00000000..9752248a --- /dev/null +++ b/src/ipa/rkisp1/algorithms/filter.cpp @@ -0,0 +1,216 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Filter control + */ + +#include "filter.h" + +#include <cmath> + +#include <libcamera/base/log.h> + +#include <libcamera/control_ids.h> + +/** + * \file filter.h + */ + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +/** + * \class Filter + * \brief RkISP1 Filter control + * + * Denoise and Sharpness filters will be applied by RkISP1 during the + * demosaicing step. The denoise filter is responsible for removing noise from + * the image, while the sharpness filter will enhance its acutance. + * + * \todo In current version the denoise and sharpness control is based on user + * controls. In a future version it should be controlled automatically by the + * algorithm. + */ + +LOG_DEFINE_CATEGORY(RkISP1Filter) + +static constexpr uint32_t kFiltLumWeightDefault = 0x00022040; +static constexpr uint32_t kFiltModeDefault = 0x000004f2; + +/** + * \copydoc libcamera::ipa::Algorithm::queueRequest + */ +void Filter::queueRequest(IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) +{ + auto &filter = context.activeState.filter; + bool update = false; + + const auto &sharpness = controls.get(controls::Sharpness); + if (sharpness) { + unsigned int value = std::round(std::clamp(*sharpness, 0.0f, 10.0f)); + + if (filter.sharpness != value) { + filter.sharpness = value; + update = true; + } + + LOG(RkISP1Filter, Debug) << "Set sharpness to " << *sharpness; + } + + const auto &denoise = controls.get(controls::draft::NoiseReductionMode); + if (denoise) { + LOG(RkISP1Filter, Debug) << "Set denoise to " << *denoise; + + switch (*denoise) { + case controls::draft::NoiseReductionModeOff: + if (filter.denoise != 0) { + filter.denoise = 0; + update = true; + } + break; + case controls::draft::NoiseReductionModeMinimal: + if (filter.denoise != 1) { + filter.denoise = 1; + update = true; + } + break; + case controls::draft::NoiseReductionModeHighQuality: + case controls::draft::NoiseReductionModeFast: + if (filter.denoise != 3) { + filter.denoise = 3; + update = true; + } + break; + default: + LOG(RkISP1Filter, Error) + << "Unsupported denoise value " + << *denoise; + break; + } + } + + frameContext.filter.denoise = filter.denoise; + frameContext.filter.sharpness = filter.sharpness; + frameContext.filter.update = update; +} + +/** + * \copydoc libcamera::ipa::Algorithm::prepare + */ +void Filter::prepare([[maybe_unused]] IPAContext &context, + [[maybe_unused]] const uint32_t frame, + IPAFrameContext &frameContext, rkisp1_params_cfg *params) +{ + /* Check if the algorithm configuration has been updated. */ + if (!frameContext.filter.update) + return; + + static constexpr uint16_t filt_fac_sh0[] = { + 0x04, 0x07, 0x0a, 0x0c, 0x10, 0x14, 0x1a, 0x1e, 0x24, 0x2a, 0x30 + }; + + static constexpr uint16_t filt_fac_sh1[] = { + 0x04, 0x08, 0x0c, 0x10, 0x16, 0x1b, 0x20, 0x26, 0x2c, 0x30, 0x3f + }; + + static constexpr uint16_t filt_fac_mid[] = { + 0x04, 0x06, 0x08, 0x0a, 0x0c, 0x10, 0x13, 0x17, 0x1d, 0x22, 0x28 + }; + + static constexpr uint16_t filt_fac_bl0[] = { + 0x02, 0x02, 0x04, 0x06, 0x08, 0x0a, 0x0c, 0x10, 0x15, 0x1a, 0x24 + }; + + static constexpr uint16_t filt_fac_bl1[] = { + 0x00, 0x00, 0x00, 0x02, 0x04, 0x04, 0x06, 0x08, 0x0d, 0x14, 0x20 + }; + + static constexpr uint16_t filt_thresh_sh0[] = { + 0, 18, 26, 36, 41, 75, 90, 120, 170, 250, 1023 + }; + + static constexpr uint16_t filt_thresh_sh1[] = { + 0, 33, 44, 51, 67, 100, 120, 150, 200, 300, 1023 + }; + + static constexpr uint16_t filt_thresh_bl0[] = { + 0, 8, 13, 23, 26, 50, 60, 80, 140, 180, 1023 + }; + + static constexpr uint16_t filt_thresh_bl1[] = { + 0, 2, 5, 10, 15, 20, 26, 51, 100, 150, 1023 + }; + + static constexpr uint16_t stage1_select[] = { + 6, 6, 4, 4, 3, 3, 2, 2, 2, 1, 0 + }; + + static constexpr uint16_t filt_chr_v_mode[] = { + 1, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3 + }; + + static constexpr uint16_t filt_chr_h_mode[] = { + 0, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3 + }; + + uint8_t denoise = frameContext.filter.denoise; + uint8_t sharpness = frameContext.filter.sharpness; + auto &flt_config = params->others.flt_config; + + flt_config.fac_sh0 = filt_fac_sh0[sharpness]; + flt_config.fac_sh1 = filt_fac_sh1[sharpness]; + flt_config.fac_mid = filt_fac_mid[sharpness]; + flt_config.fac_bl0 = filt_fac_bl0[sharpness]; + flt_config.fac_bl1 = filt_fac_bl1[sharpness]; + + flt_config.lum_weight = kFiltLumWeightDefault; + flt_config.mode = kFiltModeDefault; + flt_config.thresh_sh0 = filt_thresh_sh0[denoise]; + flt_config.thresh_sh1 = filt_thresh_sh1[denoise]; + flt_config.thresh_bl0 = filt_thresh_bl0[denoise]; + flt_config.thresh_bl1 = filt_thresh_bl1[denoise]; + flt_config.grn_stage1 = stage1_select[denoise]; + flt_config.chr_v_mode = filt_chr_v_mode[denoise]; + flt_config.chr_h_mode = filt_chr_h_mode[denoise]; + + /* + * Combined high denoising and high sharpening requires some + * adjustments to the configuration of the filters. A first stage + * filter with a lower strength must be selected, and the blur factors + * must be decreased. + */ + if (denoise == 9) { + if (sharpness > 3) + flt_config.grn_stage1 = 2; + } else if (denoise == 10) { + if (sharpness > 5) + flt_config.grn_stage1 = 2; + else if (sharpness > 3) + flt_config.grn_stage1 = 1; + } + + if (denoise > 7) { + if (sharpness > 7) { + flt_config.fac_bl0 /= 2; + flt_config.fac_bl1 /= 4; + } else if (sharpness > 4) { + flt_config.fac_bl0 = flt_config.fac_bl0 * 3 / 4; + flt_config.fac_bl1 /= 2; + } + } + + params->module_en_update |= RKISP1_CIF_ISP_MODULE_FLT; + params->module_ens |= RKISP1_CIF_ISP_MODULE_FLT; + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_FLT; +} + +REGISTER_IPA_ALGORITHM(Filter, "Filter") + +} /* namespace ipa::rkisp1::algorithms */ + +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/filter.h b/src/ipa/rkisp1/algorithms/filter.h new file mode 100644 index 00000000..d595811d --- /dev/null +++ b/src/ipa/rkisp1/algorithms/filter.h @@ -0,0 +1,33 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Filter control + */ + +#pragma once + +#include <sys/types.h> + +#include "algorithm.h" + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +class Filter : public Algorithm +{ +public: + Filter() = default; + ~Filter() = default; + + void queueRequest(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + const ControlList &controls) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; +}; + +} /* namespace ipa::rkisp1::algorithms */ +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/gsl.cpp b/src/ipa/rkisp1/algorithms/gsl.cpp new file mode 100644 index 00000000..9b056c6e --- /dev/null +++ b/src/ipa/rkisp1/algorithms/gsl.cpp @@ -0,0 +1,146 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Gamma Sensor Linearization control + */ + +#include "gsl.h" + +#include <libcamera/base/log.h> +#include <libcamera/base/utils.h> + +#include "libcamera/internal/yaml_parser.h" + +#include "linux/rkisp1-config.h" + +/** + * \file gsl.h + */ + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +/** + * \class GammaSensorLinearization + * \brief RkISP1 Gamma Sensor Linearization control + * + * This algorithm linearizes the sensor output to compensate the sensor + * non-linearities by applying piecewise linear functions to the red, green and + * blue channels. + * + * The curves are specified in the tuning data and defined using 17 points. + * + * - The X coordinates are expressed using 16 intervals, with the first point + * at X coordinate 0. Each interval is expressed as a 2-bit value DX (from + * GAMMA_DX_1 to GAMMA_DX_16), stored in the RKISP1_CIF_ISP_GAMMA_DX_LO and + * RKISP1_CIF_ISP_GAMMA_DX_HI registers. The real interval is equal to + * \f$2^{dx+4}\f$. X coordinates are shared between the red, green and blue + * curves. + * + * - The Y coordinates are specified as 17 values separately for the + * red, green and blue channels, with a 12-bit resolution. Each value must be + * in the [-2048, 2047] range compared to the previous value. + */ + +LOG_DEFINE_CATEGORY(RkISP1Gsl) + +static constexpr unsigned int kDegammaXIntervals = 16; + +GammaSensorLinearization::GammaSensorLinearization() +{ +} + +/** + * \copydoc libcamera::ipa::Algorithm::init + */ +int GammaSensorLinearization::init([[maybe_unused]] IPAContext &context, + const YamlObject &tuningData) +{ + std::vector<uint16_t> xIntervals = + tuningData["x-intervals"].getList<uint16_t>().value_or(std::vector<uint16_t>{}); + if (xIntervals.size() != kDegammaXIntervals) { + LOG(RkISP1Gsl, Error) + << "Invalid 'x' coordinates: expected " + << kDegammaXIntervals << " elements, got " + << xIntervals.size(); + + return -EINVAL; + } + + /* Compute gammaDx_ intervals from xIntervals values */ + gammaDx_[0] = 0; + gammaDx_[1] = 0; + for (unsigned int i = 0; i < kDegammaXIntervals; ++i) + gammaDx_[i / 8] |= (xIntervals[i] & 0x07) << ((i % 8) * 4); + + const YamlObject &yObject = tuningData["y"]; + if (!yObject.isDictionary()) { + LOG(RkISP1Gsl, Error) + << "Issue while parsing 'y' in tuning file: " + << "entry must be a dictionary"; + return -EINVAL; + } + + curveYr_ = yObject["red"].getList<uint16_t>().value_or(std::vector<uint16_t>{}); + if (curveYr_.size() != RKISP1_CIF_ISP_DEGAMMA_CURVE_SIZE) { + LOG(RkISP1Gsl, Error) + << "Invalid 'y:red' coordinates: expected " + << RKISP1_CIF_ISP_DEGAMMA_CURVE_SIZE + << " elements, got " << curveYr_.size(); + return -EINVAL; + } + + curveYg_ = yObject["green"].getList<uint16_t>().value_or(std::vector<uint16_t>{}); + if (curveYg_.size() != RKISP1_CIF_ISP_DEGAMMA_CURVE_SIZE) { + LOG(RkISP1Gsl, Error) + << "Invalid 'y:green' coordinates: expected " + << RKISP1_CIF_ISP_DEGAMMA_CURVE_SIZE + << " elements, got " << curveYg_.size(); + return -EINVAL; + } + + curveYb_ = yObject["blue"].getList<uint16_t>().value_or(std::vector<uint16_t>{}); + if (curveYb_.size() != RKISP1_CIF_ISP_DEGAMMA_CURVE_SIZE) { + LOG(RkISP1Gsl, Error) + << "Invalid 'y:blue' coordinates: expected " + << RKISP1_CIF_ISP_DEGAMMA_CURVE_SIZE + << " elements, got " << curveYb_.size(); + return -EINVAL; + } + + return 0; +} + +/** + * \copydoc libcamera::ipa::Algorithm::prepare + */ +void GammaSensorLinearization::prepare([[maybe_unused]] IPAContext &context, + const uint32_t frame, + [[maybe_unused]] IPAFrameContext &frameContext, + rkisp1_params_cfg *params) +{ + if (frame > 0) + return; + + params->others.sdg_config.xa_pnts.gamma_dx0 = gammaDx_[0]; + params->others.sdg_config.xa_pnts.gamma_dx1 = gammaDx_[1]; + + std::copy(curveYr_.begin(), curveYr_.end(), + params->others.sdg_config.curve_r.gamma_y); + std::copy(curveYg_.begin(), curveYg_.end(), + params->others.sdg_config.curve_g.gamma_y); + std::copy(curveYb_.begin(), curveYb_.end(), + params->others.sdg_config.curve_b.gamma_y); + + params->module_en_update |= RKISP1_CIF_ISP_MODULE_SDG; + params->module_ens |= RKISP1_CIF_ISP_MODULE_SDG; + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_SDG; +} + +REGISTER_IPA_ALGORITHM(GammaSensorLinearization, "GammaSensorLinearization") + +} /* namespace ipa::rkisp1::algorithms */ + +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/gsl.h b/src/ipa/rkisp1/algorithms/gsl.h new file mode 100644 index 00000000..c404105e --- /dev/null +++ b/src/ipa/rkisp1/algorithms/gsl.h @@ -0,0 +1,35 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Gamma Sensor Linearization control + */ + +#pragma once + +#include "algorithm.h" + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +class GammaSensorLinearization : public Algorithm +{ +public: + GammaSensorLinearization(); + ~GammaSensorLinearization() = default; + + int init(IPAContext &context, const YamlObject &tuningData) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + +private: + uint32_t gammaDx_[2]; + std::vector<uint16_t> curveYr_; + std::vector<uint16_t> curveYg_; + std::vector<uint16_t> curveYb_; +}; + +} /* namespace ipa::rkisp1::algorithms */ +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/lsc.cpp b/src/ipa/rkisp1/algorithms/lsc.cpp new file mode 100644 index 00000000..161183fc --- /dev/null +++ b/src/ipa/rkisp1/algorithms/lsc.cpp @@ -0,0 +1,342 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Lens Shading Correction control + */ + +#include "lsc.h" + +#include <algorithm> +#include <cmath> +#include <numeric> + +#include <libcamera/base/log.h> +#include <libcamera/base/utils.h> + +#include "libcamera/internal/yaml_parser.h" + +#include "linux/rkisp1-config.h" + +/** + * \file lsc.h + */ + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +/** + * \class LensShadingCorrection + * \brief RkISP1 Lens Shading Correction control + * + * Due to the optical characteristics of the lens, the light intensity received + * by the sensor is not uniform. + * + * The Lens Shading Correction algorithm applies multipliers to all pixels + * to compensate for the lens shading effect. The coefficients are + * specified in a downscaled table in the YAML tuning file. + */ + +LOG_DEFINE_CATEGORY(RkISP1Lsc) + +static std::vector<double> parseSizes(const YamlObject &tuningData, + const char *prop) +{ + std::vector<double> sizes = + tuningData[prop].getList<double>().value_or(std::vector<double>{}); + if (sizes.size() != RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE) { + LOG(RkISP1Lsc, Error) + << "Invalid '" << prop << "' values: expected " + << RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE + << " elements, got " << sizes.size(); + return {}; + } + + /* + * The sum of all elements must be 0.5 to satisfy hardware constraints. + * Validate it here, allowing a 1% tolerance as rounding errors may + * prevent an exact match (further adjustments will be performed in + * LensShadingCorrection::prepare()). + */ + double sum = std::accumulate(sizes.begin(), sizes.end(), 0.0); + if (sum < 0.495 || sum > 0.505) { + LOG(RkISP1Lsc, Error) + << "Invalid '" << prop << "' values: sum of the elements" + << " should be 0.5, got " << sum; + return {}; + } + + return sizes; +} + +static std::vector<uint16_t> parseTable(const YamlObject &tuningData, + const char *prop) +{ + static constexpr unsigned int kLscNumSamples = + RKISP1_CIF_ISP_LSC_SAMPLES_MAX * RKISP1_CIF_ISP_LSC_SAMPLES_MAX; + + std::vector<uint16_t> table = + tuningData[prop].getList<uint16_t>().value_or(std::vector<uint16_t>{}); + if (table.size() != kLscNumSamples) { + LOG(RkISP1Lsc, Error) + << "Invalid '" << prop << "' values: expected " + << kLscNumSamples + << " elements, got " << table.size(); + return {}; + } + + return table; +} + +LensShadingCorrection::LensShadingCorrection() + : lastCt_({ 0, 0 }) +{ +} + +/** + * \copydoc libcamera::ipa::Algorithm::init + */ +int LensShadingCorrection::init([[maybe_unused]] IPAContext &context, + const YamlObject &tuningData) +{ + xSize_ = parseSizes(tuningData, "x-size"); + ySize_ = parseSizes(tuningData, "y-size"); + + if (xSize_.empty() || ySize_.empty()) + return -EINVAL; + + /* Get all defined sets to apply. */ + const YamlObject &yamlSets = tuningData["sets"]; + if (!yamlSets.isList()) { + LOG(RkISP1Lsc, Error) + << "'sets' parameter not found in tuning file"; + return -EINVAL; + } + + const auto &sets = yamlSets.asList(); + for (const auto &yamlSet : sets) { + uint32_t ct = yamlSet["ct"].get<uint32_t>(0); + + if (sets_.count(ct)) { + LOG(RkISP1Lsc, Error) + << "Multiple sets found for color temperature " + << ct; + return -EINVAL; + } + + Components &set = sets_[ct]; + + set.ct = ct; + set.r = parseTable(yamlSet, "r"); + set.gr = parseTable(yamlSet, "gr"); + set.gb = parseTable(yamlSet, "gb"); + set.b = parseTable(yamlSet, "b"); + + if (set.r.empty() || set.gr.empty() || + set.gb.empty() || set.b.empty()) { + LOG(RkISP1Lsc, Error) + << "Set for color temperature " << ct + << " is missing tables"; + return -EINVAL; + } + } + + if (sets_.empty()) { + LOG(RkISP1Lsc, Error) << "Failed to load any sets"; + return -EINVAL; + } + + return 0; +} + +/** + * \copydoc libcamera::ipa::Algorithm::configure + */ +int LensShadingCorrection::configure(IPAContext &context, + [[maybe_unused]] const IPACameraSensorInfo &configInfo) +{ + const Size &size = context.configuration.sensor.size; + Size totalSize{}; + + for (unsigned int i = 0; i < RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE; ++i) { + xSizes_[i] = xSize_[i] * size.width; + ySizes_[i] = ySize_[i] * size.height; + + /* + * To prevent unexpected behavior of the ISP, the sum of x_size_tbl and + * y_size_tbl items shall be equal to respectively size.width/2 and + * size.height/2. Enforce it by computing the last tables value to avoid + * rounding-induced errors. + */ + if (i == RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE - 1) { + xSizes_[i] = size.width / 2 - totalSize.width; + ySizes_[i] = size.height / 2 - totalSize.height; + } + + totalSize.width += xSizes_[i]; + totalSize.height += ySizes_[i]; + + xGrad_[i] = std::round(32768 / xSizes_[i]); + yGrad_[i] = std::round(32768 / ySizes_[i]); + } + + context.configuration.lsc.enabled = true; + return 0; +} + +void LensShadingCorrection::setParameters(rkisp1_params_cfg *params) +{ + struct rkisp1_cif_isp_lsc_config &config = params->others.lsc_config; + + memcpy(config.x_grad_tbl, xGrad_, sizeof(config.x_grad_tbl)); + memcpy(config.y_grad_tbl, yGrad_, sizeof(config.y_grad_tbl)); + memcpy(config.x_size_tbl, xSizes_, sizeof(config.x_size_tbl)); + memcpy(config.y_size_tbl, ySizes_, sizeof(config.y_size_tbl)); + + params->module_en_update |= RKISP1_CIF_ISP_MODULE_LSC; + params->module_ens |= RKISP1_CIF_ISP_MODULE_LSC; + params->module_cfg_update |= RKISP1_CIF_ISP_MODULE_LSC; +} + +void LensShadingCorrection::copyTable(rkisp1_cif_isp_lsc_config &config, + const Components &set) +{ + std::copy(set.r.begin(), set.r.end(), &config.r_data_tbl[0][0]); + std::copy(set.gr.begin(), set.gr.end(), &config.gr_data_tbl[0][0]); + std::copy(set.gb.begin(), set.gb.end(), &config.gb_data_tbl[0][0]); + std::copy(set.b.begin(), set.b.end(), &config.b_data_tbl[0][0]); +} + +/* + * Interpolate LSC parameters based on color temperature value. + */ +void LensShadingCorrection::interpolateTable(rkisp1_cif_isp_lsc_config &config, + const Components &set0, + const Components &set1, + const uint32_t ct) +{ + double coeff0 = (set1.ct - ct) / static_cast<double>(set1.ct - set0.ct); + double coeff1 = (ct - set0.ct) / static_cast<double>(set1.ct - set0.ct); + + for (unsigned int i = 0; i < RKISP1_CIF_ISP_LSC_SAMPLES_MAX; ++i) { + for (unsigned int j = 0; j < RKISP1_CIF_ISP_LSC_SAMPLES_MAX; ++j) { + unsigned int sample = i * RKISP1_CIF_ISP_LSC_SAMPLES_MAX + j; + + config.r_data_tbl[i][j] = + set0.r[sample] * coeff0 + + set1.r[sample] * coeff1; + + config.gr_data_tbl[i][j] = + set0.gr[sample] * coeff0 + + set1.gr[sample] * coeff1; + + config.gb_data_tbl[i][j] = + set0.gb[sample] * coeff0 + + set1.gb[sample] * coeff1; + + config.b_data_tbl[i][j] = + set0.b[sample] * coeff0 + + set1.b[sample] * coeff1; + } + } +} + +/** + * \copydoc libcamera::ipa::Algorithm::prepare + */ +void LensShadingCorrection::prepare(IPAContext &context, + const uint32_t frame, + [[maybe_unused]] IPAFrameContext &frameContext, + rkisp1_params_cfg *params) +{ + struct rkisp1_cif_isp_lsc_config &config = params->others.lsc_config; + + /* + * If there is only one set, the configuration has already been done + * for first frame. + */ + if (sets_.size() == 1 && frame > 0) + return; + + /* + * If there is only one set, pick it. We can ignore lastCt_, as it will + * never be relevant. + */ + if (sets_.size() == 1) { + setParameters(params); + copyTable(config, sets_.cbegin()->second); + return; + } + + uint32_t ct = context.activeState.awb.temperatureK; + ct = std::clamp(ct, sets_.cbegin()->first, sets_.crbegin()->first); + + /* + * If the original is the same, then it means the same adjustment would + * be made. If the adjusted is the same, then it means that it's the + * same as what was actually applied. Thus in these cases we can skip + * reprogramming the LSC. + * + * original == adjusted can only happen if an interpolation + * happened, or if original has an exact entry in sets_. This means + * that if original != adjusted, then original was adjusted to + * the nearest available entry in sets_, resulting in adjusted. + * Clearly, any ct value that is in between original and adjusted + * will be adjusted to the same adjusted value, so we can skip + * reprogramming the LSC table. + * + * We also skip updating the original value, as the last one had a + * larger bound and thus a larger range of ct values that will be + * adjusted to the same adjusted. + */ + if ((lastCt_.original <= ct && ct <= lastCt_.adjusted) || + (lastCt_.adjusted <= ct && ct <= lastCt_.original)) + return; + + setParameters(params); + + /* + * The color temperature matches exactly one of the available LSC tables. + */ + if (sets_.count(ct)) { + copyTable(config, sets_[ct]); + lastCt_ = { ct, ct }; + return; + } + + /* No shortcuts left; we need to round or interpolate */ + auto iter = sets_.upper_bound(ct); + const Components &set1 = iter->second; + const Components &set0 = (--iter)->second; + uint32_t ct0 = set0.ct; + uint32_t ct1 = set1.ct; + uint32_t diff0 = ct - ct0; + uint32_t diff1 = ct1 - ct; + static constexpr double kThreshold = 0.1; + float threshold = kThreshold * (ct1 - ct0); + + if (diff0 < threshold || diff1 < threshold) { + const Components &set = diff0 < diff1 ? set0 : set1; + LOG(RkISP1Lsc, Debug) << "using LSC table for " << set.ct; + copyTable(config, set); + lastCt_ = { ct, set.ct }; + return; + } + + /* + * ct is not within 10% of the difference between the neighbouring + * color temperatures, so we need to interpolate. + */ + LOG(RkISP1Lsc, Debug) + << "ct is " << ct << ", interpolating between " + << ct0 << " and " << ct1; + interpolateTable(config, set0, set1, ct); + lastCt_ = { ct, ct }; +} + +REGISTER_IPA_ALGORITHM(LensShadingCorrection, "LensShadingCorrection") + +} /* namespace ipa::rkisp1::algorithms */ + +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/lsc.h b/src/ipa/rkisp1/algorithms/lsc.h new file mode 100644 index 00000000..5baf5927 --- /dev/null +++ b/src/ipa/rkisp1/algorithms/lsc.h @@ -0,0 +1,59 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2021-2022, Ideas On Board + * + * RkISP1 Lens Shading Correction control + */ + +#pragma once + +#include <map> + +#include "algorithm.h" + +namespace libcamera { + +namespace ipa::rkisp1::algorithms { + +class LensShadingCorrection : public Algorithm +{ +public: + LensShadingCorrection(); + ~LensShadingCorrection() = default; + + int init(IPAContext &context, const YamlObject &tuningData) override; + int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override; + void prepare(IPAContext &context, const uint32_t frame, + IPAFrameContext &frameContext, + rkisp1_params_cfg *params) override; + +private: + struct Components { + uint32_t ct; + std::vector<uint16_t> r; + std::vector<uint16_t> gr; + std::vector<uint16_t> gb; + std::vector<uint16_t> b; + }; + + void setParameters(rkisp1_params_cfg *params); + void copyTable(rkisp1_cif_isp_lsc_config &config, const Components &set0); + void interpolateTable(rkisp1_cif_isp_lsc_config &config, + const Components &set0, const Components &set1, + const uint32_t ct); + + std::map<uint32_t, Components> sets_; + std::vector<double> xSize_; + std::vector<double> ySize_; + uint16_t xGrad_[RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE]; + uint16_t yGrad_[RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE]; + uint16_t xSizes_[RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE]; + uint16_t ySizes_[RKISP1_CIF_ISP_LSC_SECTORS_TBL_SIZE]; + struct { + uint32_t original; + uint32_t adjusted; + } lastCt_; +}; + +} /* namespace ipa::rkisp1::algorithms */ +} /* namespace libcamera */ diff --git a/src/ipa/rkisp1/algorithms/meson.build b/src/ipa/rkisp1/algorithms/meson.build index 7ec53d89..93a48329 100644 --- a/src/ipa/rkisp1/algorithms/meson.build +++ b/src/ipa/rkisp1/algorithms/meson.build @@ -4,4 +4,10 @@ rkisp1_ipa_algorithms = files([ 'agc.cpp', 'awb.cpp', 'blc.cpp', + 'cproc.cpp', + 'dpcc.cpp', + 'dpf.cpp', + 'filter.cpp', + 'gsl.cpp', + 'lsc.cpp', ]) diff --git a/src/ipa/rkisp1/data/imx219.yaml b/src/ipa/rkisp1/data/imx219.yaml index 232d8ae8..cbcc43b8 100644 --- a/src/ipa/rkisp1/data/imx219.yaml +++ b/src/ipa/rkisp1/data/imx219.yaml @@ -1,5 +1,5 @@ # SPDX-License-Identifier: CC0-1.0 -%YAML 1.2 +%YAML 1.1 --- version: 1 algorithms: @@ -10,4 +10,109 @@ algorithms: Gr: 256 Gb: 256 B: 256 + - LensShadingCorrection: + x-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + y-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + sets: + - ct: 5800 + r: [ + 1501, 1480, 1478, 1362, 1179, 1056, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1030, 1053, 1134, 1185, 1520, 1480, 1463, 1179, 1056, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1027, 1046, 1134, 1533, 1471, 1179, 1056, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1025, 1039, 1471, + 1314, 1068, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1025, 1314, 1150, 1028, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1150, 1050, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1076, 1026, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1052, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1050, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1050, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1050, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1025, 1086, 1037, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1025, 1057, 1182, 1071, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1057, 1161, + 1345, 1146, 1027, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1036, 1161, 1298, 1612, 1328, 1089, 1025, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1025, 1036, 1161, 1324, 1463, 1884, 1651, 1339, 1103, 1032, + 1025, 1024, 1024, 1024, 1024, 1025, 1038, 1101, 1204, 1324, 1463, 1497, 1933, + 1884, 1587, 1275, 1079, 1052, 1046, 1046, 1046, 1046, 1055, 1101, 1204, 1336, + 1487, 1493, 1476, + ] + gr: [ + 1262, 1250, 1094, 1027, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1250, 1095, 1028, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1095, 1030, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1030, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1025, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1041, 1051, 1025, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1051, 1165, 1088, + 1051, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1051, 1165, 1261, + ] + gb: [ + 1259, 1248, 1092, 1027, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1248, 1092, 1027, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1092, 1029, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1029, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1025, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1041, 1051, 1025, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1052, 1166, 1090, + 1051, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1052, 1166, 1266, + ] + b: [ + 1380, 1378, 1377, 1247, 1080, 1025, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1030, 1406, 1378, 1284, 1092, 1027, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1406, 1338, 1129, 1029, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1338, + 1205, 1043, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1205, 1094, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1116, 1039, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1070, 1025, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1052, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1052, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1052, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1052, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1070, 1025, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1025, 1109, 1036, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1025, 1057, + 1175, 1082, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1057, 1176, 1293, 1172, 1036, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1054, 1185, 1334, 1438, 1294, 1099, 1025, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1054, 1185, 1334, 1334, 1462, + 1438, 1226, 1059, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1025, 1054, 1185, + 1326, 1334, 1334, + ] ... diff --git a/src/ipa/rkisp1/data/imx258.yaml b/src/ipa/rkisp1/data/imx258.yaml new file mode 100644 index 00000000..43dddf20 --- /dev/null +++ b/src/ipa/rkisp1/data/imx258.yaml @@ -0,0 +1,54 @@ +# SPDX-License-Identifier: CC0-1.0 +%YAML 1.1 +--- +version: 1 +algorithms: + - Agc: + - Awb: + - LensShadingCorrection: + x-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + y-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + sets: + #4208x3120_A_70 - A + - ct: 2856 + resolution: 4208x3120 + r: [1483, 1423, 1410, 1414, 1417, 1384, 1356, 1348, 1349, 1348, 1393, 1392, 1409, 1444, 1460, 1475, 1568, 1462, 1409, 1398, 1391, 1361, 1343, 1328, 1312, 1316, 1325, 1328, 1372, 1395, 1427, 1410, 1440, 1525, 1441, 1366, 1373, 1364, 1338, 1312, 1287, 1270, 1262, 1267, 1305, 1339, 1380, 1402, 1425, 1424, 1510, 1423, 1376, 1375, 1353, 1309, 1253, 1220, 1201, 1192, 1203, 1243, 1286, 1338, 1375, 1427, 1438, 1499, 1405, 1353, 1354, 1331, 1269, 1207, 1169, 1140, 1137, 1145, 1186, 1246, 1309, 1373, 1399, 1438, 1512, 1391, 1349, 1351, 1306, 1236, 1174, 1121, 1089, 1083, 1098, 1139, 1202, 1276, 1349, 1384, 1428, 1494, 1401, 1337, 1336, 1277, 1211, 1138, 1082, 1057, 1053, 1067, 1110, 1166, 1253, 1331, 1375, 1417, 1485, 1401, 1341, 1316, 1269, 1184, 1115, 1063, 1037, 1029, 1042, 1082, 1144, 1234, 1322, 1368, 1405, 1480, 1387, 1329, 1305, 1257, 1179, 1104, 1049, 1028, 1024, 1037, 1078, 1144, 1231, 1312, 1363, 1404, 1456, 1401, 1341, 1313, 1254, 1177, 1104, 1053, 1041, 1026, 1042, 1082, 1149, 1229, 1322, 1372, 1397, 1457, 1397, 1344, 1312, 1271, 1191, 1122, 1070, 1052, 1044, 1061, 1097, 1166, 1245, 1334, 1382, 1405, 1476, 1400, 1342, 1333, 1293, 1213, 1146, 1099, 1073, 1061, 1081, 1134, 1202, 1273, 1332, 1380, 1411, 1484, 1414, 1350, 1344, 1301, 1251, 1181, 1133, 1109, 1100, 1118, 1164, 1218, 1299, 1338, 1373, 1408, 1459, 1397, 1360, 1342, 1339, 1293, 1231, 1181, 1149, 1155, 1161, 1202, 1256, 1315, 1364, 1383, 1396, 1479, 1382, 1342, 1358, 1346, 1314, 1284, 1231, 1210, 1198, 1224, 1251, 1303, 1338, 1361, 1381, 1394, 1455, 1386, 1338, 1342, 1341, 1326, 1296, 1274, 1254, 1249, 1262, 1280, 1319, 1357, 1367, 1373, 1379, 1462, 1426, 1340, 1356, 1354, 1330, 1344, 1291, 1275, 1255, 1272, 1298, 1333, 1374, 1390, 1393, 1418, 1580, ] + gr: [1274, 1203, 1200, 1184, 1165, 1167, 1155, 1160, 1155, 1158, 1164, 1181, 1196, 1223, 1219, 1220, 1369, 1233, 1172, 1161, 1158, 1146, 1149, 1142, 1129, 1133, 1137, 1144, 1155, 1173, 1189, 1204, 1205, 1268, 1215, 1172, 1148, 1137, 1135, 1124, 1123, 1114, 1110, 1116, 1131, 1149, 1161, 1175, 1191, 1220, 1263, 1185, 1153, 1140, 1137, 1119, 1106, 1094, 1088, 1086, 1099, 1107, 1125, 1152, 1154, 1187, 1209, 1255, 1195, 1141, 1133, 1133, 1112, 1083, 1081, 1066, 1057, 1067, 1088, 1103, 1134, 1154, 1172, 1199, 1255, 1186, 1136, 1127, 1121, 1094, 1077, 1055, 1044, 1040, 1048, 1067, 1086, 1121, 1146, 1155, 1185, 1258, 1177, 1127, 1117, 1104, 1082, 1063, 1044, 1038, 1027, 1036, 1057, 1070, 1101, 1138, 1151, 1177, 1245, 1184, 1116, 1119, 1098, 1070, 1045, 1037, 1030, 1027, 1026, 1045, 1062, 1099, 1132, 1149, 1179, 1238, 1172, 1120, 1113, 1100, 1070, 1042, 1029, 1027, 1029, 1027, 1042, 1066, 1088, 1126, 1149, 1174, 1223, 1162, 1118, 1117, 1093, 1065, 1039, 1030, 1028, 1022, 1028, 1045, 1060, 1101, 1134, 1146, 1165, 1246, 1172, 1116, 1119, 1102, 1075, 1046, 1029, 1032, 1030, 1038, 1049, 1073, 1097, 1132, 1146, 1168, 1231, 1178, 1118, 1123, 1111, 1083, 1062, 1041, 1038, 1033, 1041, 1054, 1074, 1109, 1135, 1144, 1175, 1244, 1193, 1136, 1123, 1118, 1100, 1070, 1045, 1036, 1044, 1047, 1067, 1090, 1116, 1135, 1158, 1174, 1232, 1198, 1142, 1127, 1130, 1107, 1085, 1068, 1060, 1057, 1069, 1079, 1102, 1115, 1124, 1154, 1178, 1241, 1192, 1136, 1125, 1113, 1116, 1096, 1081, 1075, 1075, 1088, 1097, 1116, 1124, 1135, 1155, 1177, 1232, 1183, 1142, 1119, 1113, 1099, 1101, 1088, 1084, 1085, 1089, 1103, 1109, 1122, 1133, 1147, 1175, 1258, 1238, 1162, 1161, 1143, 1124, 1131, 1108, 1111, 1107, 1115, 1116, 1138, 1137, 1150, 1163, 1186, 1381, ] + gb: [1277, 1217, 1179, 1179, 1163, 1158, 1151, 1150, 1149, 1143, 1151, 1172, 1184, 1207, 1216, 1246, 1375, 1242, 1194, 1166, 1151, 1144, 1145, 1135, 1130, 1129, 1132, 1137, 1154, 1166, 1189, 1207, 1210, 1290, 1229, 1177, 1153, 1144, 1140, 1135, 1124, 1110, 1104, 1115, 1126, 1148, 1162, 1171, 1199, 1220, 1268, 1226, 1163, 1152, 1138, 1130, 1111, 1091, 1088, 1086, 1089, 1097, 1126, 1147, 1164, 1187, 1206, 1273, 1212, 1151, 1141, 1132, 1117, 1093, 1075, 1060, 1059, 1062, 1088, 1108, 1133, 1162, 1168, 1204, 1278, 1207, 1141, 1130, 1126, 1095, 1075, 1063, 1046, 1044, 1054, 1069, 1084, 1120, 1153, 1167, 1195, 1269, 1200, 1141, 1126, 1113, 1092, 1063, 1045, 1033, 1036, 1038, 1055, 1080, 1117, 1139, 1165, 1182, 1262, 1195, 1130, 1128, 1115, 1079, 1052, 1041, 1031, 1024, 1028, 1046, 1072, 1110, 1141, 1160, 1175, 1258, 1189, 1136, 1124, 1105, 1077, 1049, 1029, 1021, 1029, 1033, 1040, 1074, 1108, 1143, 1152, 1173, 1237, 1200, 1130, 1126, 1109, 1080, 1050, 1030, 1031, 1027, 1031, 1043, 1069, 1099, 1141, 1152, 1168, 1249, 1203, 1132, 1124, 1113, 1082, 1058, 1032, 1030, 1024, 1033, 1050, 1083, 1109, 1151, 1156, 1178, 1253, 1204, 1130, 1128, 1112, 1088, 1060, 1045, 1030, 1027, 1036, 1058, 1082, 1120, 1145, 1160, 1176, 1246, 1195, 1137, 1123, 1121, 1102, 1072, 1046, 1037, 1037, 1047, 1072, 1090, 1125, 1140, 1158, 1177, 1252, 1209, 1147, 1128, 1125, 1114, 1088, 1063, 1053, 1051, 1058, 1084, 1101, 1128, 1140, 1159, 1176, 1243, 1195, 1138, 1130, 1127, 1113, 1101, 1076, 1071, 1067, 1082, 1087, 1111, 1125, 1140, 1151, 1183, 1235, 1189, 1137, 1126, 1122, 1112, 1104, 1091, 1089, 1081, 1085, 1103, 1112, 1125, 1140, 1157, 1175, 1242, 1234, 1181, 1161, 1150, 1127, 1117, 1101, 1094, 1094, 1102, 1117, 1130, 1138, 1155, 1171, 1192, 1399, ] + b: [1309, 1209, 1169, 1157, 1149, 1136, 1116, 1117, 1126, 1128, 1127, 1141, 1143, 1182, 1196, 1209, 1398, 1231, 1176, 1140, 1123, 1119, 1113, 1111, 1122, 1105, 1117, 1116, 1135, 1130, 1135, 1171, 1169, 1271, 1251, 1154, 1132, 1118, 1104, 1109, 1103, 1094, 1088, 1104, 1093, 1120, 1130, 1135, 1151, 1180, 1267, 1219, 1136, 1111, 1125, 1106, 1107, 1082, 1074, 1077, 1074, 1101, 1112, 1117, 1136, 1139, 1173, 1256, 1205, 1125, 1108, 1118, 1110, 1091, 1081, 1065, 1068, 1065, 1086, 1087, 1105, 1123, 1119, 1156, 1249, 1195, 1106, 1112, 1101, 1085, 1068, 1064, 1053, 1043, 1048, 1068, 1073, 1095, 1117, 1118, 1123, 1251, 1193, 1101, 1091, 1097, 1081, 1052, 1043, 1045, 1041, 1045, 1052, 1065, 1100, 1112, 1112, 1123, 1200, 1180, 1096, 1103, 1083, 1069, 1053, 1045, 1035, 1034, 1035, 1045, 1062, 1087, 1108, 1113, 1113, 1228, 1176, 1093, 1095, 1080, 1062, 1055, 1035, 1033, 1028, 1037, 1039, 1064, 1080, 1115, 1121, 1120, 1202, 1174, 1086, 1087, 1078, 1064, 1049, 1037, 1027, 1022, 1031, 1045, 1058, 1087, 1113, 1108, 1113, 1207, 1200, 1095, 1102, 1092, 1072, 1052, 1043, 1033, 1024, 1033, 1043, 1069, 1095, 1112, 1128, 1123, 1220, 1215, 1101, 1091, 1096, 1080, 1059, 1051, 1040, 1031, 1040, 1064, 1064, 1095, 1111, 1112, 1141, 1222, 1198, 1119, 1108, 1097, 1080, 1059, 1050, 1043, 1034, 1043, 1063, 1073, 1100, 1107, 1114, 1131, 1212, 1197, 1136, 1094, 1109, 1096, 1078, 1054, 1052, 1051, 1060, 1063, 1078, 1101, 1109, 1116, 1142, 1256, 1212, 1112, 1098, 1097, 1094, 1084, 1074, 1061, 1051, 1057, 1064, 1080, 1089, 1102, 1115, 1136, 1227, 1185, 1118, 1081, 1059, 1072, 1068, 1057, 1049, 1048, 1054, 1066, 1058, 1067, 1096, 1109, 1143, 1223, 1291, 1173, 1131, 1113, 1087, 1077, 1090, 1081, 1090, 1086, 1090, 1092, 1103, 1144, 1149, 1216, 1387, ] + #4208x3120_D50_70 - D50 + - ct: 5003 + resolution: 4208x3120 + r: [1240, 1212, 1218, 1191, 1191, 1171, 1136, 1144, 1113, 1148, 1182, 1166, 1210, 1211, 1213, 1240, 1336, 1236, 1193, 1176, 1158, 1147, 1126, 1107, 1122, 1107, 1107, 1110, 1146, 1176, 1194, 1195, 1219, 1259, 1210, 1157, 1156, 1153, 1123, 1115, 1094, 1074, 1078, 1081, 1098, 1130, 1163, 1170, 1179, 1220, 1284, 1228, 1146, 1159, 1132, 1101, 1074, 1059, 1053, 1044, 1060, 1072, 1102, 1131, 1156, 1186, 1227, 1272, 1219, 1176, 1150, 1124, 1091, 1043, 1036, 1025, 1025, 1031, 1042, 1076, 1095, 1155, 1188, 1209, 1296, 1206, 1161, 1128, 1101, 1065, 1032, 1019, 1018, 1027, 1018, 1034, 1057, 1102, 1139, 1161, 1211, 1274, 1184, 1133, 1119, 1097, 1042, 1018, 1020, 1027, 1034, 1030, 1032, 1042, 1075, 1119, 1164, 1199, 1270, 1205, 1124, 1114, 1086, 1033, 1015, 1023, 1039, 1039, 1033, 1026, 1041, 1074, 1111, 1142, 1206, 1278, 1193, 1118, 1098, 1084, 1023, 1003, 1016, 1047, 1059, 1038, 1025, 1046, 1063, 1124, 1148, 1190, 1238, 1191, 1124, 1107, 1069, 1027, 1009, 1012, 1036, 1045, 1036, 1020, 1024, 1058, 1118, 1158, 1183, 1262, 1213, 1121, 1112, 1076, 1030, 1012, 1003, 1019, 1028, 1013, 1020, 1036, 1078, 1123, 1155, 1176, 1228, 1221, 1135, 1117, 1105, 1055, 1020, 1005, 1007, 1007, 1004, 1017, 1048, 1088, 1131, 1169, 1183, 1280, 1209, 1141, 1125, 1105, 1074, 1025, 1012, 1008, 1000, 1011, 1024, 1050, 1113, 1128, 1154, 1199, 1290, 1217, 1142, 1134, 1120, 1101, 1054, 1028, 1014, 1006, 1017, 1040, 1078, 1105, 1136, 1164, 1188, 1250, 1195, 1130, 1148, 1120, 1108, 1083, 1053, 1041, 1032, 1061, 1067, 1097, 1127, 1136, 1152, 1181, 1227, 1166, 1145, 1140, 1141, 1119, 1092, 1075, 1072, 1052, 1065, 1089, 1107, 1147, 1154, 1158, 1183, 1230, 1136, 1147, 1150, 1168, 1139, 1113, 1098, 1055, 1048, 1072, 1079, 1129, 1147, 1173, 1188, 1181, 1283, ] + gr: [1246, 1183, 1160, 1143, 1145, 1138, 1113, 1111, 1117, 1116, 1132, 1145, 1167, 1167, 1196, 1197, 1335, 1205, 1152, 1123, 1122, 1123, 1103, 1107, 1102, 1097, 1102, 1099, 1128, 1141, 1157, 1152, 1184, 1242, 1204, 1141, 1112, 1106, 1102, 1093, 1096, 1085, 1076, 1085, 1094, 1107, 1123, 1146, 1162, 1178, 1218, 1169, 1130, 1114, 1100, 1096, 1083, 1072, 1059, 1065, 1070, 1087, 1096, 1116, 1134, 1155, 1174, 1238, 1159, 1126, 1105, 1102, 1083, 1062, 1060, 1049, 1047, 1054, 1063, 1084, 1111, 1131, 1140, 1164, 1243, 1167, 1114, 1105, 1088, 1067, 1047, 1034, 1034, 1028, 1042, 1042, 1059, 1096, 1114, 1135, 1170, 1200, 1156, 1101, 1098, 1089, 1068, 1048, 1027, 1034, 1029, 1032, 1047, 1043, 1088, 1111, 1130, 1160, 1201, 1143, 1100, 1086, 1087, 1051, 1034, 1029, 1028, 1030, 1019, 1033, 1044, 1087, 1109, 1124, 1155, 1211, 1148, 1098, 1088, 1077, 1058, 1037, 1026, 1025, 1034, 1033, 1031, 1054, 1074, 1107, 1134, 1159, 1211, 1150, 1090, 1084, 1074, 1056, 1029, 1020, 1028, 1025, 1027, 1031, 1044, 1080, 1109, 1126, 1152, 1208, 1131, 1101, 1088, 1073, 1048, 1035, 1030, 1026, 1024, 1034, 1038, 1053, 1083, 1104, 1124, 1160, 1206, 1147, 1103, 1082, 1082, 1060, 1035, 1026, 1023, 1018, 1031, 1044, 1058, 1096, 1114, 1128, 1153, 1208, 1170, 1112, 1098, 1088, 1070, 1049, 1027, 1027, 1023, 1031, 1046, 1071, 1085, 1106, 1129, 1150, 1228, 1164, 1111, 1101, 1089, 1078, 1058, 1040, 1030, 1032, 1037, 1060, 1073, 1102, 1097, 1125, 1156, 1223, 1181, 1115, 1097, 1093, 1083, 1072, 1056, 1047, 1041, 1057, 1071, 1079, 1081, 1102, 1124, 1141, 1195, 1170, 1109, 1091, 1089, 1061, 1074, 1049, 1054, 1052, 1057, 1067, 1076, 1097, 1106, 1121, 1141, 1211, 1173, 1129, 1108, 1099, 1093, 1092, 1076, 1063, 1057, 1065, 1090, 1107, 1117, 1140, 1123, 1175, 1343, ] + gb: [1238, 1183, 1160, 1160, 1134, 1134, 1124, 1108, 1131, 1127, 1124, 1145, 1172, 1188, 1201, 1217, 1349, 1216, 1160, 1128, 1120, 1117, 1110, 1108, 1105, 1102, 1111, 1114, 1125, 1144, 1160, 1162, 1192, 1260, 1212, 1141, 1127, 1118, 1101, 1104, 1103, 1086, 1077, 1086, 1105, 1116, 1126, 1147, 1167, 1191, 1242, 1191, 1130, 1126, 1103, 1093, 1082, 1074, 1070, 1064, 1064, 1079, 1099, 1113, 1132, 1156, 1185, 1247, 1175, 1117, 1114, 1109, 1081, 1067, 1061, 1047, 1044, 1051, 1066, 1083, 1108, 1134, 1141, 1180, 1248, 1187, 1108, 1106, 1095, 1076, 1052, 1044, 1036, 1034, 1042, 1052, 1070, 1105, 1124, 1140, 1161, 1228, 1171, 1091, 1095, 1088, 1069, 1041, 1035, 1034, 1034, 1037, 1048, 1062, 1090, 1120, 1129, 1165, 1223, 1158, 1108, 1093, 1080, 1052, 1030, 1034, 1027, 1030, 1028, 1034, 1054, 1083, 1112, 1133, 1141, 1208, 1158, 1099, 1091, 1075, 1047, 1031, 1017, 1021, 1035, 1027, 1033, 1054, 1088, 1110, 1120, 1146, 1211, 1171, 1099, 1093, 1079, 1056, 1029, 1021, 1030, 1025, 1031, 1037, 1047, 1077, 1116, 1122, 1132, 1203, 1179, 1093, 1087, 1076, 1053, 1038, 1028, 1024, 1024, 1024, 1040, 1058, 1082, 1108, 1114, 1144, 1198, 1167, 1091, 1091, 1087, 1059, 1047, 1029, 1016, 1021, 1036, 1045, 1066, 1093, 1113, 1116, 1144, 1205, 1159, 1113, 1099, 1091, 1069, 1047, 1029, 1029, 1024, 1037, 1054, 1072, 1088, 1109, 1125, 1150, 1200, 1186, 1114, 1097, 1098, 1087, 1065, 1035, 1033, 1043, 1042, 1054, 1076, 1089, 1111, 1126, 1130, 1214, 1153, 1106, 1100, 1090, 1086, 1082, 1057, 1059, 1053, 1059, 1066, 1077, 1088, 1113, 1117, 1144, 1203, 1147, 1107, 1110, 1090, 1088, 1072, 1070, 1060, 1062, 1058, 1074, 1087, 1096, 1109, 1126, 1150, 1216, 1170, 1145, 1128, 1108, 1088, 1110, 1085, 1070, 1064, 1078, 1077, 1101, 1107, 1136, 1148, 1163, 1345, ] + b: [1252, 1185, 1146, 1139, 1147, 1130, 1114, 1111, 1122, 1111, 1121, 1123, 1144, 1150, 1171, 1167, 1303, 1187, 1152, 1125, 1101, 1104, 1096, 1101, 1099, 1093, 1096, 1098, 1103, 1118, 1141, 1160, 1156, 1226, 1222, 1125, 1112, 1118, 1104, 1094, 1083, 1073, 1073, 1094, 1099, 1103, 1114, 1133, 1146, 1174, 1212, 1162, 1123, 1104, 1110, 1100, 1081, 1066, 1065, 1057, 1053, 1072, 1094, 1107, 1117, 1136, 1162, 1226, 1197, 1124, 1088, 1092, 1084, 1066, 1055, 1051, 1044, 1049, 1061, 1081, 1096, 1102, 1134, 1143, 1234, 1171, 1110, 1099, 1075, 1070, 1051, 1052, 1030, 1030, 1035, 1055, 1071, 1092, 1100, 1113, 1128, 1214, 1174, 1099, 1080, 1069, 1054, 1047, 1032, 1031, 1027, 1034, 1042, 1061, 1086, 1091, 1113, 1139, 1222, 1156, 1088, 1089, 1072, 1051, 1036, 1032, 1026, 1030, 1024, 1040, 1047, 1074, 1091, 1109, 1131, 1198, 1158, 1090, 1079, 1071, 1047, 1038, 1031, 1028, 1027, 1028, 1029, 1046, 1068, 1087, 1105, 1122, 1196, 1173, 1098, 1080, 1060, 1040, 1036, 1022, 1019, 1022, 1029, 1029, 1045, 1077, 1094, 1103, 1109, 1189, 1170, 1096, 1070, 1063, 1048, 1033, 1026, 1023, 1016, 1021, 1037, 1053, 1068, 1098, 1107, 1128, 1195, 1166, 1099, 1086, 1066, 1061, 1040, 1022, 1022, 1028, 1027, 1041, 1057, 1086, 1094, 1103, 1124, 1188, 1202, 1113, 1081, 1083, 1071, 1040, 1025, 1024, 1025, 1019, 1055, 1055, 1081, 1099, 1112, 1128, 1202, 1171, 1108, 1083, 1084, 1078, 1051, 1043, 1020, 1037, 1037, 1049, 1072, 1069, 1100, 1107, 1115, 1176, 1180, 1106, 1094, 1077, 1068, 1053, 1050, 1035, 1041, 1038, 1062, 1068, 1068, 1084, 1098, 1125, 1184, 1164, 1104, 1077, 1057, 1064, 1049, 1039, 1041, 1036, 1041, 1042, 1058, 1064, 1087, 1099, 1111, 1173, 1209, 1137, 1099, 1083, 1076, 1072, 1077, 1065, 1066, 1065, 1061, 1081, 1096, 1135, 1126, 1150, 1333, ] + #4208x3120_D65_70 - D65 + - ct: 6504 + resolution: 4208x3120 + r: [1359, 1336, 1313, 1273, 1274, 1250, 1250, 1218, 1222, 1223, 1240, 1266, 1308, 1327, 1333, 1336, 1456, 1359, 1286, 1256, 1249, 1235, 1235, 1216, 1219, 1187, 1205, 1216, 1240, 1267, 1277, 1303, 1311, 1420, 1326, 1254, 1250, 1239, 1212, 1207, 1191, 1181, 1176, 1181, 1187, 1226, 1241, 1281, 1295, 1326, 1391, 1304, 1253, 1234, 1234, 1209, 1174, 1156, 1147, 1131, 1139, 1168, 1196, 1227, 1265, 1282, 1293, 1385, 1302, 1242, 1224, 1216, 1171, 1140, 1112, 1098, 1087, 1098, 1124, 1177, 1206, 1245, 1266, 1310, 1389, 1327, 1227, 1231, 1195, 1156, 1116, 1094, 1070, 1067, 1073, 1101, 1151, 1190, 1223, 1251, 1281, 1402, 1285, 1229, 1203, 1184, 1135, 1093, 1063, 1047, 1041, 1050, 1083, 1119, 1176, 1211, 1248, 1288, 1388, 1269, 1210, 1215, 1173, 1118, 1078, 1046, 1028, 1025, 1037, 1059, 1103, 1170, 1213, 1230, 1268, 1355, 1295, 1208, 1203, 1171, 1124, 1070, 1041, 1024, 1027, 1030, 1057, 1094, 1168, 1206, 1252, 1270, 1364, 1293, 1196, 1187, 1156, 1110, 1075, 1039, 1022, 1022, 1028, 1065, 1096, 1166, 1213, 1245, 1273, 1349, 1291, 1213, 1203, 1162, 1131, 1079, 1053, 1038, 1029, 1044, 1080, 1119, 1176, 1225, 1243, 1271, 1354, 1284, 1222, 1202, 1186, 1136, 1097, 1063, 1054, 1041, 1054, 1083, 1131, 1186, 1232, 1256, 1276, 1360, 1290, 1237, 1210, 1207, 1166, 1116, 1076, 1066, 1070, 1080, 1109, 1152, 1188, 1230, 1240, 1293, 1341, 1304, 1231, 1229, 1210, 1177, 1153, 1128, 1097, 1105, 1108, 1140, 1170, 1213, 1224, 1260, 1282, 1357, 1299, 1237, 1218, 1218, 1202, 1171, 1144, 1135, 1131, 1143, 1161, 1189, 1221, 1233, 1261, 1271, 1346, 1262, 1216, 1229, 1218, 1191, 1187, 1162, 1161, 1148, 1153, 1180, 1201, 1220, 1234, 1251, 1250, 1352, 1294, 1234, 1242, 1240, 1246, 1200, 1178, 1172, 1137, 1154, 1187, 1214, 1252, 1251, 1247, 1296, 1456, ] + gr: [1240, 1187, 1158, 1152, 1144, 1129, 1130, 1118, 1115, 1113, 1119, 1141, 1156, 1172, 1180, 1199, 1330, 1223, 1153, 1127, 1123, 1115, 1104, 1104, 1095, 1100, 1107, 1110, 1121, 1137, 1156, 1169, 1179, 1261, 1205, 1138, 1122, 1108, 1101, 1104, 1098, 1088, 1083, 1090, 1106, 1119, 1125, 1144, 1163, 1186, 1236, 1170, 1122, 1112, 1101, 1091, 1089, 1076, 1068, 1061, 1072, 1084, 1101, 1118, 1134, 1156, 1179, 1243, 1162, 1120, 1105, 1105, 1088, 1067, 1061, 1050, 1050, 1057, 1070, 1088, 1112, 1127, 1145, 1166, 1232, 1163, 1108, 1111, 1099, 1079, 1054, 1046, 1041, 1030, 1040, 1053, 1074, 1098, 1120, 1140, 1170, 1226, 1158, 1105, 1094, 1099, 1064, 1048, 1034, 1036, 1028, 1029, 1049, 1055, 1089, 1116, 1135, 1166, 1218, 1142, 1107, 1094, 1092, 1061, 1041, 1030, 1024, 1025, 1028, 1036, 1053, 1087, 1110, 1128, 1153, 1223, 1142, 1098, 1092, 1084, 1056, 1036, 1025, 1024, 1027, 1024, 1038, 1055, 1082, 1108, 1132, 1153, 1203, 1155, 1098, 1094, 1080, 1056, 1034, 1023, 1025, 1022, 1025, 1036, 1053, 1078, 1112, 1126, 1144, 1212, 1163, 1096, 1092, 1083, 1059, 1039, 1027, 1023, 1028, 1026, 1044, 1056, 1091, 1114, 1130, 1149, 1204, 1152, 1103, 1090, 1089, 1065, 1045, 1031, 1028, 1025, 1035, 1048, 1064, 1092, 1116, 1131, 1157, 1203, 1162, 1100, 1098, 1093, 1076, 1049, 1033, 1030, 1030, 1040, 1050, 1067, 1094, 1103, 1127, 1154, 1221, 1162, 1112, 1099, 1095, 1079, 1064, 1042, 1033, 1034, 1048, 1061, 1077, 1091, 1108, 1126, 1148, 1213, 1154, 1112, 1106, 1095, 1081, 1065, 1056, 1052, 1050, 1059, 1071, 1082, 1091, 1102, 1129, 1149, 1211, 1157, 1106, 1092, 1081, 1066, 1072, 1064, 1048, 1056, 1061, 1066, 1076, 1091, 1107, 1122, 1145, 1207, 1204, 1127, 1117, 1106, 1098, 1081, 1073, 1068, 1062, 1068, 1081, 1107, 1102, 1127, 1148, 1170, 1353, ] + gb: [1240, 1177, 1157, 1143, 1129, 1130, 1118, 1112, 1123, 1123, 1123, 1137, 1159, 1181, 1197, 1206, 1354, 1217, 1153, 1130, 1124, 1109, 1114, 1105, 1108, 1116, 1110, 1114, 1131, 1145, 1145, 1163, 1183, 1249, 1197, 1134, 1124, 1107, 1115, 1104, 1100, 1085, 1091, 1097, 1102, 1110, 1133, 1145, 1155, 1190, 1227, 1191, 1125, 1107, 1105, 1093, 1084, 1072, 1066, 1071, 1072, 1081, 1106, 1124, 1129, 1153, 1178, 1238, 1193, 1108, 1104, 1098, 1085, 1072, 1059, 1052, 1048, 1059, 1075, 1089, 1105, 1126, 1146, 1162, 1233, 1166, 1098, 1099, 1091, 1078, 1053, 1043, 1036, 1035, 1045, 1058, 1070, 1100, 1113, 1128, 1156, 1230, 1173, 1100, 1087, 1087, 1064, 1046, 1037, 1031, 1031, 1034, 1047, 1063, 1092, 1107, 1112, 1153, 1228, 1169, 1089, 1089, 1079, 1057, 1043, 1030, 1030, 1027, 1027, 1035, 1057, 1087, 1111, 1125, 1136, 1218, 1166, 1097, 1087, 1079, 1056, 1035, 1022, 1021, 1027, 1022, 1035, 1053, 1083, 1109, 1118, 1138, 1198, 1151, 1100, 1087, 1077, 1057, 1034, 1023, 1024, 1027, 1025, 1036, 1051, 1083, 1109, 1116, 1129, 1215, 1159, 1096, 1091, 1079, 1053, 1037, 1026, 1021, 1020, 1020, 1039, 1063, 1086, 1113, 1116, 1134, 1214, 1158, 1096, 1091, 1087, 1065, 1043, 1034, 1025, 1020, 1028, 1046, 1059, 1088, 1109, 1119, 1130, 1202, 1168, 1101, 1091, 1084, 1074, 1050, 1029, 1028, 1026, 1035, 1055, 1072, 1099, 1105, 1121, 1138, 1204, 1160, 1104, 1093, 1094, 1079, 1067, 1043, 1036, 1036, 1048, 1057, 1081, 1089, 1107, 1118, 1140, 1222, 1158, 1101, 1096, 1090, 1082, 1076, 1059, 1052, 1053, 1063, 1071, 1086, 1094, 1103, 1119, 1134, 1206, 1150, 1105, 1098, 1093, 1082, 1077, 1067, 1063, 1065, 1069, 1081, 1081, 1088, 1108, 1123, 1138, 1211, 1198, 1133, 1114, 1117, 1097, 1093, 1076, 1073, 1067, 1077, 1076, 1089, 1101, 1119, 1154, 1163, 1346, ] + b: [1241, 1188, 1165, 1151, 1131, 1127, 1134, 1115, 1122, 1127, 1131, 1136, 1154, 1165, 1173, 1161, 1319, 1210, 1153, 1138, 1120, 1111, 1114, 1118, 1124, 1108, 1118, 1121, 1123, 1132, 1151, 1161, 1150, 1244, 1224, 1149, 1118, 1108, 1107, 1107, 1103, 1098, 1091, 1103, 1103, 1121, 1124, 1135, 1167, 1177, 1224, 1195, 1130, 1099, 1108, 1101, 1083, 1081, 1078, 1074, 1084, 1086, 1097, 1115, 1128, 1145, 1181, 1211, 1191, 1111, 1109, 1098, 1087, 1081, 1071, 1059, 1053, 1064, 1078, 1091, 1109, 1127, 1139, 1167, 1226, 1192, 1111, 1097, 1098, 1072, 1064, 1050, 1042, 1040, 1046, 1053, 1077, 1099, 1113, 1130, 1152, 1215, 1179, 1106, 1093, 1084, 1070, 1055, 1039, 1037, 1034, 1033, 1046, 1067, 1088, 1112, 1120, 1150, 1220, 1178, 1092, 1097, 1085, 1066, 1049, 1033, 1032, 1026, 1028, 1038, 1058, 1081, 1112, 1120, 1137, 1208, 1170, 1103, 1096, 1082, 1063, 1038, 1035, 1025, 1026, 1027, 1035, 1060, 1075, 1109, 1122, 1133, 1214, 1175, 1095, 1097, 1074, 1061, 1039, 1029, 1028, 1022, 1025, 1033, 1049, 1083, 1107, 1117, 1125, 1212, 1179, 1097, 1091, 1076, 1062, 1045, 1030, 1031, 1027, 1031, 1039, 1055, 1082, 1109, 1114, 1144, 1204, 1178, 1102, 1080, 1087, 1060, 1052, 1027, 1028, 1025, 1028, 1043, 1067, 1093, 1113, 1121, 1123, 1189, 1191, 1117, 1100, 1092, 1079, 1058, 1037, 1037, 1020, 1037, 1058, 1065, 1092, 1101, 1115, 1140, 1194, 1173, 1120, 1096, 1085, 1085, 1065, 1048, 1039, 1036, 1046, 1053, 1076, 1096, 1099, 1114, 1140, 1195, 1180, 1105, 1090, 1079, 1073, 1066, 1056, 1049, 1043, 1057, 1061, 1077, 1081, 1090, 1115, 1131, 1180, 1154, 1095, 1084, 1061, 1055, 1056, 1045, 1043, 1039, 1041, 1051, 1067, 1077, 1092, 1108, 1122, 1197, 1210, 1139, 1117, 1112, 1088, 1097, 1084, 1073, 1074, 1065, 1079, 1091, 1103, 1131, 1144, 1154, 1356, ] + #4208x3120_D75_70 - D75 + - ct: 7504 + resolution: 4208x3120 + r: [2718, 2443, 2251, 2101, 1949, 1828, 1725, 1659, 1637, 1656, 1692, 1787, 1913, 2038, 2175, 2358, 2612, 2566, 2301, 2129, 1946, 1798, 1654, 1562, 1501, 1474, 1484, 1541, 1628, 1753, 1900, 2056, 2216, 2458, 2439, 2204, 2002, 1839, 1664, 1534, 1419, 1372, 1340, 1357, 1403, 1489, 1621, 1784, 1950, 2114, 2358, 2344, 2108, 1932, 1723, 1559, 1413, 1321, 1258, 1239, 1246, 1293, 1388, 1512, 1675, 1846, 2036, 2269, 2294, 2047, 1842, 1635, 1464, 1328, 1231, 1178, 1144, 1167, 1208, 1298, 1419, 1582, 1769, 1962, 2198, 2234, 1977, 1769, 1556, 1393, 1262, 1164, 1108, 1086, 1096, 1146, 1232, 1350, 1513, 1700, 1913, 2137, 2206, 1942, 1733, 1515, 1345, 1216, 1120, 1066, 1045, 1060, 1099, 1182, 1316, 1462, 1656, 1868, 2131, 2182, 1922, 1685, 1495, 1315, 1188, 1092, 1045, 1025, 1037, 1080, 1160, 1283, 1442, 1624, 1853, 2102, 2193, 1910, 1702, 1477, 1310, 1179, 1087, 1034, 1024, 1029, 1069, 1163, 1278, 1441, 1624, 1846, 2081, 2191, 1936, 1698, 1495, 1325, 1192, 1100, 1052, 1033, 1042, 1082, 1166, 1291, 1448, 1634, 1852, 2118, 2209, 1957, 1732, 1534, 1357, 1223, 1125, 1078, 1062, 1066, 1113, 1204, 1324, 1486, 1665, 1895, 2127, 2267, 2018, 1789, 1577, 1407, 1280, 1181, 1124, 1105, 1113, 1166, 1252, 1388, 1539, 1724, 1936, 2180, 2319, 2074, 1867, 1659, 1491, 1354, 1248, 1192, 1175, 1191, 1236, 1333, 1441, 1618, 1798, 2005, 2249, 2399, 2148, 1955, 1752, 1578, 1442, 1351, 1293, 1272, 1286, 1334, 1418, 1547, 1709, 1872, 2085, 2297, 2497, 2217, 2069, 1857, 1694, 1560, 1458, 1403, 1384, 1400, 1443, 1537, 1670, 1815, 1991, 2157, 2412, 2594, 2341, 2147, 2004, 1827, 1693, 1600, 1537, 1521, 1524, 1576, 1665, 1788, 1941, 2083, 2257, 2529, 2745, 2483, 2315, 2146, 2006, 1868, 1779, 1701, 1679, 1704, 1744, 1845, 1954, 2087, 2219, 2407, 2701, ] + gr: [2344, 2089, 1940, 1831, 1739, 1672, 1602, 1564, 1546, 1553, 1585, 1636, 1713, 1798, 1899, 2031, 2234, 2182, 1973, 1842, 1732, 1637, 1548, 1485, 1448, 1422, 1438, 1466, 1527, 1594, 1695, 1784, 1902, 2122, 2082, 1884, 1773, 1653, 1549, 1465, 1398, 1351, 1329, 1338, 1376, 1435, 1516, 1611, 1725, 1828, 2008, 1997, 1821, 1706, 1585, 1480, 1382, 1319, 1261, 1244, 1253, 1291, 1352, 1439, 1540, 1647, 1772, 1932, 1947, 1773, 1655, 1522, 1409, 1310, 1239, 1184, 1161, 1174, 1213, 1284, 1368, 1480, 1601, 1717, 1882, 1904, 1739, 1605, 1470, 1360, 1257, 1173, 1124, 1094, 1111, 1149, 1221, 1320, 1433, 1550, 1678, 1844, 1878, 1711, 1571, 1443, 1317, 1213, 1126, 1077, 1057, 1066, 1105, 1180, 1279, 1400, 1515, 1652, 1819, 1862, 1687, 1556, 1420, 1299, 1183, 1102, 1048, 1029, 1041, 1081, 1155, 1258, 1374, 1495, 1634, 1800, 1856, 1692, 1556, 1415, 1289, 1176, 1095, 1044, 1024, 1033, 1073, 1145, 1247, 1370, 1492, 1626, 1800, 1869, 1697, 1555, 1419, 1303, 1190, 1104, 1054, 1040, 1045, 1085, 1154, 1260, 1373, 1511, 1632, 1804, 1887, 1717, 1571, 1440, 1323, 1216, 1128, 1077, 1066, 1069, 1109, 1182, 1284, 1398, 1520, 1656, 1831, 1910, 1751, 1607, 1480, 1360, 1261, 1173, 1123, 1100, 1114, 1154, 1226, 1326, 1444, 1555, 1689, 1856, 1962, 1793, 1656, 1522, 1416, 1315, 1237, 1180, 1166, 1176, 1214, 1288, 1375, 1486, 1603, 1722, 1910, 2020, 1845, 1710, 1586, 1477, 1387, 1307, 1266, 1241, 1257, 1292, 1347, 1446, 1548, 1657, 1785, 1964, 2118, 1888, 1794, 1658, 1552, 1462, 1394, 1349, 1332, 1342, 1378, 1436, 1525, 1617, 1736, 1848, 2048, 2195, 1989, 1855, 1742, 1633, 1555, 1487, 1437, 1427, 1429, 1471, 1521, 1603, 1699, 1804, 1921, 2149, 2334, 2103, 1971, 1863, 1757, 1666, 1598, 1565, 1537, 1554, 1579, 1640, 1716, 1810, 1923, 2044, 2308, ] + gb: [2383, 2122, 1974, 1866, 1767, 1684, 1620, 1581, 1559, 1575, 1592, 1654, 1726, 1816, 1917, 2071, 2294, 2242, 2002, 1872, 1752, 1650, 1564, 1499, 1455, 1438, 1442, 1485, 1537, 1614, 1715, 1814, 1935, 2155, 2114, 1929, 1797, 1674, 1568, 1477, 1406, 1358, 1340, 1348, 1386, 1447, 1534, 1631, 1754, 1861, 2057, 2044, 1859, 1737, 1606, 1493, 1396, 1322, 1270, 1247, 1259, 1305, 1370, 1455, 1566, 1679, 1808, 1979, 1981, 1812, 1674, 1549, 1424, 1325, 1246, 1191, 1168, 1179, 1222, 1294, 1383, 1498, 1623, 1748, 1932, 1939, 1777, 1626, 1500, 1376, 1265, 1179, 1128, 1104, 1119, 1160, 1235, 1331, 1447, 1577, 1708, 1885, 1922, 1735, 1602, 1464, 1333, 1226, 1134, 1083, 1061, 1071, 1113, 1191, 1296, 1412, 1543, 1677, 1849, 1885, 1723, 1574, 1437, 1310, 1191, 1105, 1055, 1035, 1048, 1088, 1164, 1272, 1388, 1516, 1660, 1847, 1891, 1714, 1568, 1431, 1300, 1185, 1099, 1047, 1024, 1038, 1075, 1155, 1259, 1386, 1512, 1649, 1832, 1901, 1722, 1575, 1434, 1309, 1196, 1109, 1054, 1041, 1047, 1087, 1162, 1267, 1385, 1526, 1650, 1833, 1912, 1740, 1588, 1456, 1329, 1220, 1133, 1080, 1065, 1072, 1113, 1189, 1289, 1410, 1538, 1672, 1862, 1949, 1767, 1632, 1487, 1367, 1261, 1175, 1123, 1100, 1114, 1158, 1224, 1331, 1450, 1571, 1705, 1880, 1990, 1811, 1670, 1531, 1420, 1315, 1227, 1180, 1158, 1172, 1212, 1285, 1375, 1490, 1611, 1744, 1925, 2033, 1864, 1715, 1588, 1477, 1377, 1307, 1253, 1232, 1248, 1285, 1344, 1439, 1545, 1661, 1797, 1971, 2126, 1898, 1798, 1658, 1548, 1449, 1381, 1338, 1315, 1329, 1366, 1428, 1512, 1617, 1730, 1853, 2058, 2203, 1998, 1856, 1734, 1624, 1539, 1467, 1424, 1409, 1409, 1448, 1505, 1584, 1689, 1796, 1923, 2148, 2342, 2110, 1959, 1848, 1740, 1635, 1572, 1533, 1519, 1527, 1561, 1610, 1693, 1786, 1900, 2039, 2306, ] + b: [2199, 1976, 1828, 1725, 1640, 1549, 1510, 1473, 1457, 1462, 1485, 1529, 1603, 1690, 1796, 1922, 2111, 2048, 1861, 1735, 1618, 1532, 1462, 1400, 1360, 1346, 1355, 1384, 1433, 1501, 1589, 1680, 1793, 1982, 1975, 1801, 1672, 1564, 1465, 1387, 1326, 1294, 1272, 1284, 1310, 1363, 1440, 1518, 1627, 1730, 1888, 1903, 1736, 1617, 1500, 1405, 1325, 1260, 1219, 1198, 1208, 1239, 1296, 1365, 1465, 1557, 1664, 1833, 1837, 1684, 1556, 1449, 1345, 1261, 1200, 1151, 1132, 1137, 1175, 1238, 1307, 1402, 1517, 1627, 1775, 1806, 1650, 1518, 1407, 1306, 1216, 1144, 1099, 1078, 1092, 1120, 1185, 1270, 1360, 1472, 1596, 1740, 1778, 1621, 1499, 1381, 1270, 1180, 1110, 1066, 1046, 1057, 1087, 1150, 1236, 1335, 1447, 1560, 1703, 1764, 1612, 1479, 1367, 1255, 1158, 1089, 1045, 1031, 1038, 1071, 1128, 1218, 1312, 1430, 1544, 1702, 1773, 1604, 1480, 1359, 1252, 1148, 1082, 1041, 1024, 1036, 1061, 1124, 1210, 1314, 1432, 1542, 1693, 1782, 1617, 1485, 1366, 1253, 1162, 1092, 1046, 1038, 1043, 1068, 1130, 1215, 1322, 1431, 1549, 1700, 1786, 1634, 1499, 1378, 1276, 1184, 1108, 1067, 1060, 1062, 1094, 1153, 1235, 1346, 1450, 1556, 1722, 1813, 1667, 1535, 1411, 1306, 1220, 1148, 1103, 1089, 1091, 1132, 1189, 1277, 1372, 1474, 1593, 1740, 1852, 1712, 1569, 1449, 1354, 1263, 1195, 1156, 1137, 1149, 1180, 1239, 1319, 1413, 1516, 1627, 1798, 1910, 1741, 1617, 1509, 1403, 1324, 1267, 1221, 1205, 1213, 1244, 1296, 1377, 1459, 1565, 1679, 1826, 1984, 1788, 1696, 1556, 1473, 1386, 1333, 1296, 1280, 1282, 1316, 1361, 1442, 1519, 1624, 1732, 1905, 2059, 1881, 1746, 1642, 1533, 1467, 1400, 1370, 1354, 1357, 1389, 1438, 1500, 1587, 1688, 1800, 1995, 2190, 1971, 1845, 1743, 1643, 1562, 1515, 1468, 1453, 1454, 1501, 1532, 1608, 1692, 1782, 1904, 2117, ] + #4208x3120_F11_TL84_70 - F11_TL84 + - ct: 4000 + resolution: 4208x3120 + r: [1286, 1278, 1265, 1240, 1240, 1217, 1199, 1205, 1185, 1191, 1213, 1243, 1251, 1276, 1282, 1297, 1358, 1273, 1227, 1225, 1219, 1199, 1190, 1164, 1151, 1137, 1151, 1174, 1213, 1238, 1237, 1261, 1274, 1331, 1273, 1220, 1214, 1199, 1174, 1154, 1126, 1115, 1105, 1106, 1132, 1183, 1215, 1238, 1260, 1277, 1310, 1254, 1204, 1204, 1193, 1151, 1097, 1081, 1066, 1057, 1066, 1094, 1133, 1183, 1228, 1240, 1275, 1341, 1239, 1196, 1193, 1167, 1112, 1071, 1046, 1035, 1034, 1045, 1056, 1097, 1153, 1210, 1232, 1257, 1313, 1240, 1187, 1195, 1142, 1080, 1048, 1031, 1023, 1025, 1026, 1034, 1065, 1115, 1186, 1223, 1254, 1322, 1241, 1178, 1166, 1121, 1060, 1031, 1014, 1029, 1039, 1026, 1032, 1057, 1101, 1162, 1210, 1247, 1295, 1224, 1178, 1157, 1104, 1049, 1021, 1015, 1036, 1044, 1036, 1024, 1049, 1097, 1144, 1206, 1235, 1312, 1215, 1170, 1153, 1098, 1046, 1020, 1017, 1043, 1046, 1036, 1028, 1039, 1086, 1144, 1202, 1234, 1280, 1224, 1178, 1148, 1093, 1049, 1010, 1011, 1032, 1038, 1030, 1024, 1042, 1094, 1153, 1213, 1231, 1294, 1237, 1185, 1157, 1104, 1050, 1017, 1005, 1029, 1030, 1022, 1027, 1048, 1098, 1172, 1213, 1243, 1300, 1244, 1173, 1168, 1122, 1073, 1021, 1011, 1004, 1007, 1015, 1029, 1062, 1115, 1176, 1219, 1227, 1304, 1243, 1192, 1182, 1148, 1093, 1048, 1014, 1004, 1007, 1019, 1039, 1068, 1132, 1187, 1214, 1237, 1290, 1233, 1197, 1186, 1170, 1130, 1068, 1043, 1021, 1024, 1035, 1063, 1100, 1148, 1200, 1218, 1239, 1280, 1225, 1193, 1182, 1178, 1152, 1113, 1082, 1057, 1055, 1069, 1098, 1133, 1184, 1199, 1214, 1224, 1291, 1224, 1180, 1184, 1176, 1165, 1145, 1105, 1093, 1081, 1091, 1128, 1167, 1185, 1197, 1202, 1207, 1268, 1216, 1185, 1208, 1194, 1182, 1156, 1131, 1104, 1097, 1110, 1150, 1176, 1214, 1220, 1219, 1234, 1375, ] + gr: [1267, 1211, 1186, 1180, 1181, 1169, 1162, 1152, 1144, 1152, 1159, 1184, 1192, 1196, 1221, 1236, 1372, 1236, 1175, 1159, 1149, 1143, 1142, 1134, 1123, 1120, 1130, 1134, 1154, 1170, 1190, 1202, 1212, 1256, 1214, 1170, 1139, 1139, 1125, 1116, 1120, 1100, 1097, 1106, 1111, 1131, 1160, 1173, 1191, 1203, 1266, 1206, 1150, 1137, 1128, 1111, 1095, 1087, 1073, 1069, 1077, 1097, 1116, 1137, 1160, 1182, 1204, 1252, 1187, 1142, 1137, 1122, 1098, 1068, 1065, 1046, 1052, 1054, 1069, 1093, 1121, 1147, 1174, 1200, 1253, 1176, 1136, 1125, 1111, 1080, 1061, 1044, 1042, 1032, 1041, 1055, 1072, 1106, 1139, 1157, 1186, 1246, 1182, 1120, 1109, 1092, 1067, 1042, 1037, 1033, 1028, 1031, 1043, 1058, 1094, 1130, 1156, 1179, 1240, 1162, 1120, 1110, 1088, 1054, 1032, 1030, 1027, 1027, 1025, 1035, 1050, 1091, 1121, 1149, 1186, 1226, 1152, 1122, 1108, 1092, 1054, 1031, 1024, 1026, 1029, 1021, 1037, 1055, 1085, 1113, 1144, 1178, 1217, 1168, 1113, 1102, 1084, 1053, 1032, 1025, 1024, 1027, 1027, 1032, 1048, 1083, 1123, 1142, 1168, 1226, 1163, 1116, 1111, 1086, 1060, 1033, 1023, 1023, 1025, 1028, 1035, 1062, 1090, 1124, 1140, 1164, 1216, 1179, 1124, 1107, 1100, 1072, 1043, 1024, 1024, 1020, 1029, 1044, 1067, 1106, 1128, 1143, 1163, 1219, 1179, 1127, 1117, 1105, 1086, 1053, 1034, 1029, 1029, 1034, 1054, 1076, 1102, 1125, 1157, 1179, 1231, 1165, 1137, 1120, 1112, 1100, 1069, 1051, 1038, 1038, 1052, 1068, 1097, 1109, 1132, 1146, 1166, 1233, 1187, 1128, 1122, 1111, 1107, 1083, 1073, 1057, 1060, 1076, 1083, 1105, 1114, 1134, 1139, 1170, 1243, 1174, 1126, 1115, 1111, 1097, 1093, 1072, 1073, 1067, 1077, 1095, 1104, 1120, 1139, 1135, 1169, 1256, 1232, 1141, 1148, 1125, 1122, 1123, 1104, 1096, 1093, 1094, 1117, 1137, 1146, 1153, 1158, 1160, 1389, ] + gb: [1264, 1211, 1190, 1175, 1162, 1153, 1144, 1142, 1132, 1132, 1149, 1168, 1193, 1211, 1221, 1230, 1377, 1240, 1176, 1162, 1152, 1140, 1139, 1131, 1120, 1120, 1122, 1142, 1155, 1163, 1191, 1203, 1210, 1274, 1240, 1171, 1153, 1142, 1131, 1118, 1104, 1091, 1099, 1099, 1111, 1133, 1156, 1172, 1192, 1213, 1273, 1222, 1157, 1140, 1134, 1117, 1092, 1075, 1069, 1067, 1080, 1091, 1115, 1136, 1167, 1180, 1211, 1272, 1226, 1153, 1134, 1124, 1102, 1079, 1063, 1048, 1050, 1055, 1072, 1097, 1123, 1158, 1180, 1201, 1273, 1199, 1142, 1131, 1117, 1088, 1059, 1042, 1035, 1034, 1037, 1057, 1078, 1116, 1145, 1161, 1193, 1256, 1211, 1141, 1116, 1106, 1074, 1049, 1035, 1031, 1033, 1033, 1045, 1073, 1104, 1136, 1153, 1188, 1250, 1196, 1128, 1114, 1100, 1060, 1039, 1030, 1034, 1032, 1030, 1030, 1057, 1094, 1125, 1155, 1169, 1257, 1204, 1126, 1114, 1100, 1063, 1037, 1022, 1024, 1032, 1034, 1036, 1060, 1094, 1125, 1148, 1172, 1242, 1188, 1123, 1116, 1093, 1060, 1035, 1025, 1024, 1027, 1027, 1034, 1057, 1090, 1134, 1146, 1172, 1239, 1192, 1122, 1119, 1095, 1069, 1040, 1021, 1026, 1016, 1030, 1038, 1065, 1094, 1136, 1148, 1173, 1244, 1202, 1132, 1117, 1104, 1068, 1043, 1034, 1020, 1019, 1025, 1042, 1072, 1102, 1136, 1152, 1167, 1237, 1191, 1136, 1120, 1108, 1087, 1053, 1034, 1025, 1020, 1032, 1050, 1073, 1110, 1130, 1148, 1182, 1238, 1201, 1133, 1117, 1120, 1100, 1071, 1049, 1038, 1032, 1048, 1064, 1090, 1117, 1134, 1152, 1170, 1237, 1188, 1128, 1128, 1115, 1106, 1090, 1067, 1058, 1058, 1066, 1082, 1107, 1115, 1135, 1148, 1171, 1250, 1187, 1138, 1126, 1119, 1108, 1095, 1078, 1075, 1066, 1079, 1090, 1099, 1121, 1143, 1149, 1165, 1237, 1229, 1158, 1157, 1139, 1119, 1118, 1101, 1078, 1084, 1091, 1103, 1125, 1130, 1149, 1173, 1184, 1398, ] + b: [1291, 1208, 1168, 1145, 1132, 1140, 1122, 1134, 1138, 1129, 1131, 1140, 1161, 1197, 1196, 1179, 1329, 1235, 1176, 1150, 1125, 1118, 1113, 1115, 1113, 1108, 1113, 1115, 1131, 1136, 1149, 1181, 1176, 1255, 1237, 1147, 1129, 1116, 1119, 1106, 1104, 1091, 1086, 1099, 1104, 1119, 1137, 1134, 1164, 1179, 1231, 1204, 1137, 1111, 1113, 1103, 1096, 1079, 1070, 1070, 1074, 1090, 1104, 1120, 1126, 1149, 1183, 1234, 1208, 1123, 1112, 1118, 1097, 1075, 1066, 1055, 1051, 1059, 1066, 1090, 1114, 1127, 1135, 1157, 1226, 1197, 1110, 1109, 1095, 1083, 1055, 1047, 1044, 1040, 1044, 1051, 1063, 1095, 1112, 1132, 1148, 1232, 1198, 1107, 1098, 1081, 1063, 1051, 1043, 1036, 1033, 1033, 1043, 1061, 1082, 1109, 1116, 1144, 1209, 1161, 1095, 1096, 1091, 1054, 1042, 1039, 1035, 1035, 1022, 1042, 1053, 1080, 1107, 1122, 1132, 1216, 1169, 1097, 1094, 1081, 1048, 1041, 1024, 1034, 1034, 1031, 1034, 1058, 1074, 1105, 1124, 1124, 1218, 1188, 1095, 1092, 1079, 1054, 1042, 1032, 1035, 1022, 1025, 1035, 1053, 1080, 1107, 1118, 1132, 1228, 1181, 1093, 1094, 1077, 1059, 1043, 1030, 1030, 1023, 1033, 1036, 1058, 1090, 1109, 1111, 1135, 1209, 1191, 1105, 1096, 1087, 1060, 1044, 1034, 1034, 1020, 1034, 1037, 1063, 1087, 1112, 1123, 1138, 1226, 1203, 1118, 1090, 1097, 1081, 1052, 1041, 1027, 1030, 1034, 1048, 1067, 1093, 1110, 1121, 1142, 1220, 1210, 1127, 1102, 1091, 1087, 1061, 1052, 1024, 1044, 1041, 1056, 1076, 1091, 1113, 1125, 1152, 1216, 1194, 1107, 1106, 1077, 1085, 1074, 1060, 1048, 1041, 1048, 1060, 1082, 1085, 1085, 1125, 1132, 1218, 1190, 1112, 1074, 1071, 1066, 1067, 1050, 1045, 1045, 1045, 1061, 1075, 1070, 1088, 1106, 1128, 1222, 1234, 1145, 1131, 1120, 1099, 1095, 1079, 1078, 1073, 1078, 1083, 1086, 1108, 1125, 1141, 1156, 1386, ] + #4208x3120_F2_CWF_70 - F2_CWF + - ct: 4230 + resolution: 4208x3120 + r: [1140, 1119, 1106, 1105, 1086, 1079, 1072, 1070, 1070, 1079, 1084, 1102, 1114, 1131, 1157, 1152, 1232, 1131, 1103, 1088, 1084, 1071, 1074, 1077, 1066, 1064, 1063, 1080, 1094, 1101, 1112, 1113, 1134, 1194, 1143, 1073, 1077, 1078, 1069, 1067, 1058, 1060, 1046, 1048, 1067, 1085, 1095, 1101, 1127, 1144, 1169, 1132, 1072, 1074, 1078, 1055, 1045, 1037, 1033, 1039, 1036, 1045, 1068, 1085, 1098, 1122, 1115, 1183, 1106, 1064, 1069, 1068, 1049, 1026, 1030, 1019, 1025, 1026, 1038, 1051, 1070, 1100, 1102, 1120, 1174, 1103, 1043, 1052, 1055, 1024, 1023, 1017, 1019, 1025, 1024, 1032, 1037, 1063, 1085, 1094, 1110, 1195, 1095, 1047, 1062, 1041, 1025, 1017, 1011, 1031, 1027, 1023, 1023, 1030, 1050, 1071, 1084, 1110, 1190, 1073, 1034, 1056, 1042, 1015, 1010, 1016, 1032, 1027, 1024, 1024, 1036, 1039, 1074, 1087, 1109, 1168, 1079, 1042, 1055, 1032, 1019, 1007, 1013, 1026, 1027, 1026, 1021, 1032, 1044, 1082, 1093, 1098, 1158, 1091, 1046, 1053, 1028, 1020, 1007, 1011, 1026, 1022, 1019, 1021, 1020, 1045, 1071, 1084, 1096, 1159, 1114, 1047, 1047, 1030, 1017, 997, 1008, 1016, 1019, 1021, 1016, 1028, 1053, 1080, 1094, 1103, 1157, 1088, 1049, 1052, 1040, 1024, 1003, 1001, 1004, 1010, 1006, 1019, 1037, 1057, 1085, 1084, 1099, 1161, 1106, 1057, 1063, 1056, 1032, 1010, 993, 998, 999, 1006, 1016, 1031, 1052, 1071, 1089, 1106, 1174, 1112, 1055, 1054, 1062, 1043, 1022, 1002, 1004, 1008, 1007, 1015, 1045, 1064, 1085, 1087, 1097, 1157, 1102, 1059, 1064, 1059, 1054, 1035, 1018, 1002, 1005, 1012, 1035, 1052, 1057, 1068, 1071, 1098, 1156, 1098, 1045, 1044, 1042, 1046, 1041, 1024, 1009, 1004, 1017, 1035, 1062, 1062, 1064, 1064, 1088, 1140, 1088, 1043, 1070, 1066, 1041, 1047, 1026, 1014, 1009, 1022, 1032, 1060, 1073, 1077, 1087, 1107, 1237, ] + gr: [1219, 1156, 1145, 1130, 1128, 1112, 1116, 1104, 1112, 1106, 1118, 1128, 1154, 1165, 1161, 1170, 1306, 1183, 1124, 1113, 1099, 1100, 1099, 1091, 1084, 1095, 1090, 1099, 1116, 1126, 1140, 1142, 1158, 1213, 1174, 1112, 1103, 1094, 1084, 1087, 1090, 1075, 1075, 1077, 1088, 1101, 1119, 1133, 1149, 1162, 1193, 1149, 1106, 1091, 1086, 1076, 1071, 1066, 1057, 1064, 1064, 1074, 1082, 1109, 1117, 1140, 1151, 1204, 1155, 1094, 1089, 1088, 1075, 1059, 1052, 1046, 1043, 1048, 1061, 1074, 1101, 1113, 1123, 1154, 1198, 1137, 1093, 1082, 1078, 1059, 1048, 1041, 1033, 1030, 1038, 1048, 1059, 1078, 1109, 1116, 1143, 1198, 1119, 1082, 1074, 1071, 1051, 1040, 1036, 1032, 1031, 1031, 1042, 1047, 1077, 1097, 1112, 1133, 1185, 1126, 1082, 1077, 1058, 1039, 1029, 1025, 1024, 1024, 1022, 1033, 1044, 1068, 1095, 1099, 1131, 1187, 1123, 1078, 1071, 1060, 1043, 1028, 1025, 1027, 1027, 1021, 1033, 1045, 1066, 1087, 1105, 1121, 1173, 1121, 1070, 1067, 1058, 1039, 1024, 1020, 1024, 1024, 1022, 1030, 1043, 1064, 1093, 1099, 1121, 1182, 1112, 1076, 1072, 1065, 1044, 1029, 1021, 1023, 1021, 1026, 1032, 1047, 1066, 1091, 1105, 1131, 1180, 1132, 1076, 1066, 1067, 1052, 1031, 1021, 1021, 1020, 1028, 1039, 1044, 1076, 1098, 1107, 1127, 1179, 1124, 1087, 1076, 1076, 1064, 1036, 1018, 1018, 1020, 1028, 1041, 1056, 1085, 1086, 1106, 1128, 1187, 1126, 1099, 1082, 1072, 1065, 1043, 1031, 1024, 1029, 1034, 1052, 1065, 1074, 1094, 1111, 1127, 1181, 1128, 1086, 1076, 1073, 1072, 1058, 1050, 1046, 1039, 1048, 1059, 1074, 1070, 1096, 1112, 1124, 1174, 1140, 1078, 1077, 1067, 1057, 1055, 1043, 1040, 1042, 1042, 1054, 1069, 1075, 1088, 1099, 1112, 1189, 1182, 1099, 1096, 1093, 1082, 1080, 1072, 1055, 1059, 1061, 1076, 1095, 1090, 1112, 1113, 1140, 1321, ] + gb: [1236, 1163, 1136, 1120, 1113, 1111, 1109, 1101, 1104, 1099, 1102, 1140, 1141, 1158, 1170, 1194, 1332, 1195, 1138, 1114, 1109, 1097, 1098, 1092, 1089, 1085, 1089, 1098, 1117, 1125, 1141, 1155, 1156, 1232, 1186, 1125, 1108, 1095, 1099, 1081, 1078, 1075, 1073, 1073, 1083, 1097, 1118, 1128, 1148, 1166, 1218, 1171, 1107, 1099, 1091, 1086, 1069, 1059, 1051, 1049, 1064, 1071, 1088, 1110, 1118, 1137, 1162, 1225, 1171, 1099, 1092, 1085, 1069, 1057, 1051, 1041, 1036, 1050, 1055, 1077, 1092, 1118, 1133, 1151, 1227, 1158, 1099, 1090, 1086, 1061, 1043, 1039, 1028, 1036, 1039, 1048, 1060, 1091, 1110, 1117, 1147, 1216, 1152, 1086, 1082, 1073, 1054, 1040, 1026, 1028, 1029, 1032, 1040, 1051, 1076, 1104, 1115, 1139, 1222, 1141, 1088, 1078, 1073, 1048, 1034, 1026, 1025, 1025, 1022, 1033, 1051, 1077, 1104, 1115, 1129, 1202, 1154, 1081, 1080, 1069, 1050, 1029, 1023, 1022, 1029, 1027, 1031, 1050, 1070, 1098, 1107, 1127, 1188, 1146, 1090, 1078, 1065, 1044, 1029, 1015, 1022, 1024, 1025, 1035, 1053, 1071, 1104, 1102, 1136, 1207, 1152, 1083, 1078, 1073, 1042, 1027, 1024, 1024, 1016, 1024, 1037, 1056, 1076, 1106, 1111, 1130, 1197, 1146, 1086, 1076, 1074, 1046, 1031, 1023, 1018, 1021, 1026, 1043, 1051, 1081, 1102, 1111, 1126, 1191, 1134, 1090, 1084, 1079, 1067, 1038, 1019, 1018, 1021, 1033, 1041, 1055, 1081, 1099, 1107, 1131, 1199, 1147, 1091, 1082, 1083, 1072, 1050, 1031, 1024, 1027, 1032, 1053, 1063, 1082, 1099, 1107, 1130, 1191, 1139, 1087, 1078, 1077, 1073, 1058, 1048, 1037, 1037, 1046, 1062, 1073, 1079, 1099, 1099, 1130, 1177, 1147, 1082, 1087, 1074, 1061, 1062, 1052, 1042, 1036, 1045, 1063, 1068, 1079, 1094, 1103, 1120, 1189, 1176, 1105, 1102, 1092, 1081, 1073, 1064, 1053, 1053, 1066, 1067, 1084, 1087, 1103, 1134, 1146, 1336, ] + b: [1203, 1195, 1154, 1123, 1104, 1106, 1116, 1099, 1099, 1099, 1102, 1106, 1123, 1155, 1149, 1168, 1283, 1196, 1141, 1119, 1102, 1098, 1088, 1088, 1095, 1086, 1095, 1097, 1101, 1117, 1121, 1156, 1135, 1209, 1211, 1127, 1102, 1082, 1089, 1088, 1072, 1075, 1083, 1083, 1085, 1106, 1107, 1120, 1142, 1149, 1224, 1163, 1121, 1087, 1078, 1085, 1077, 1062, 1065, 1056, 1057, 1082, 1093, 1094, 1096, 1111, 1147, 1193, 1179, 1105, 1083, 1088, 1070, 1074, 1060, 1048, 1055, 1044, 1068, 1082, 1091, 1097, 1102, 1141, 1209, 1178, 1091, 1076, 1077, 1063, 1060, 1043, 1043, 1035, 1046, 1059, 1064, 1084, 1103, 1107, 1125, 1196, 1156, 1088, 1068, 1070, 1057, 1043, 1046, 1041, 1038, 1038, 1046, 1059, 1073, 1083, 1086, 1111, 1178, 1146, 1067, 1083, 1068, 1044, 1042, 1033, 1044, 1033, 1026, 1037, 1045, 1067, 1089, 1092, 1108, 1203, 1148, 1082, 1072, 1066, 1050, 1044, 1035, 1035, 1031, 1028, 1035, 1055, 1069, 1082, 1094, 1101, 1188, 1163, 1067, 1074, 1056, 1040, 1034, 1037, 1026, 1022, 1033, 1037, 1049, 1067, 1084, 1092, 1103, 1185, 1156, 1074, 1073, 1066, 1042, 1036, 1028, 1031, 1030, 1034, 1042, 1051, 1073, 1091, 1090, 1102, 1196, 1172, 1086, 1071, 1077, 1055, 1041, 1036, 1025, 1024, 1028, 1032, 1053, 1076, 1094, 1089, 1101, 1178, 1179, 1095, 1079, 1075, 1070, 1043, 1026, 1022, 1022, 1029, 1045, 1054, 1078, 1075, 1092, 1120, 1179, 1193, 1091, 1074, 1061, 1064, 1056, 1043, 1034, 1026, 1027, 1039, 1060, 1081, 1070, 1078, 1115, 1205, 1172, 1096, 1069, 1060, 1071, 1055, 1044, 1035, 1027, 1043, 1048, 1063, 1054, 1065, 1083, 1122, 1186, 1158, 1088, 1060, 1043, 1037, 1037, 1031, 1033, 1025, 1029, 1035, 1041, 1041, 1060, 1084, 1114, 1202, 1217, 1122, 1101, 1079, 1058, 1061, 1049, 1056, 1051, 1036, 1062, 1061, 1076, 1094, 1116, 1139, 1331, ] + diff --git a/src/ipa/rkisp1/data/meson.build b/src/ipa/rkisp1/data/meson.build index c3b4e388..7150e155 100644 --- a/src/ipa/rkisp1/data/meson.build +++ b/src/ipa/rkisp1/data/meson.build @@ -2,9 +2,11 @@ conf_files = files([ 'imx219.yaml', + 'ov4689.yaml', 'ov5640.yaml', 'uncalibrated.yaml', ]) install_data(conf_files, - install_dir : ipa_data_dir / 'rkisp1') + install_dir : ipa_data_dir / 'rkisp1', + install_tag : 'runtime') diff --git a/src/ipa/rkisp1/data/ov2685.yaml b/src/ipa/rkisp1/data/ov2685.yaml new file mode 100644 index 00000000..fdfc98d3 --- /dev/null +++ b/src/ipa/rkisp1/data/ov2685.yaml @@ -0,0 +1,41 @@ +# SPDX-License-Identifier: CC0-1.0 +%YAML 1.1 +--- +version: 1 +algorithms: + - Agc: + - Awb: + - LensShadingCorrection: + x-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + y-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + sets: + #800x600_A_70 - A + - ct: 2856 + resolution: 800x600 + r: [2451, 2258, 2111, 2039, 1982, 1925, 1860, 1818, 1802, 1815, 1859, 1936, 1997, 2056, 2129, 2298, 2486, 2351, 2157, 2066, 1991, 1912, 1809, 1720, 1677, 1653, 1671, 1739, 1843, 1932, 2009, 2071, 2182, 2392, 2253, 2105, 2018, 1929, 1802, 1670, 1566, 1503, 1475, 1508, 1590, 1705, 1848, 1947, 2026, 2118, 2281, 2174, 2065, 1975, 1854, 1687, 1529, 1412, 1345, 1327, 1358, 1445, 1572, 1733, 1870, 1992, 2075, 2202, 2125, 2033, 1929, 1765, 1574, 1407, 1286, 1220, 1204, 1237, 1318, 1447, 1632, 1801, 1951, 2048, 2142, 2092, 2010, 1877, 1688, 1471, 1304, 1187, 1127, 1118, 1149, 1221, 1348, 1533, 1738, 1918, 2021, 2105, 2088, 1982, 1836, 1628, 1398, 1239, 1128, 1073, 1060, 1086, 1163, 1280, 1466, 1688, 1886, 2001, 2092, 2067, 1965, 1809, 1584, 1358, 1200, 1094, 1044, 1030, 1056, 1123, 1240, 1424, 1649, 1860, 1989, 2082, 2057, 1960, 1795, 1569, 1345, 1187, 1083, 1034, 1024, 1046, 1111, 1229, 1408, 1637, 1850, 1989, 2085, 2053, 1967, 1802, 1578, 1358, 1199, 1095, 1046, 1031, 1058, 1122, 1245, 1423, 1651, 1867, 1989, 2084, 2059, 1970, 1823, 1615, 1399, 1235, 1129, 1074, 1061, 1090, 1161, 1281, 1461, 1689, 1878, 2006, 2096, 2086, 1989, 1866, 1670, 1471, 1302, 1188, 1134, 1117, 1150, 1223, 1352, 1537, 1745, 1909, 2028, 2114, 2101, 2006, 1916, 1749, 1567, 1399, 1278, 1218, 1206, 1237, 1317, 1456, 1633, 1813, 1954, 2053, 2142, 2171, 2023, 1954, 1843, 1680, 1526, 1403, 1339, 1323, 1357, 1440, 1575, 1733, 1885, 1996, 2069, 2212, 2231, 2074, 1990, 1916, 1792, 1656, 1554, 1489, 1473, 1513, 1588, 1702, 1840, 1946, 2011, 2124, 2283, 2343, 2146, 2036, 1973, 1890, 1789, 1700, 1653, 1645, 1678, 1733, 1828, 1922, 1978, 2065, 2181, 2405, 2420, 2246, 2092, 2015, 1954, 1885, 1816, 1776, 1777, 1791, 1847, 1904, 1941, 2016, 2105, 2284, 2463, ] + gr: [1790, 1645, 1522, 1469, 1433, 1419, 1390, 1381, 1374, 1381, 1401, 1428, 1460, 1494, 1552, 1693, 1839, 1687, 1555, 1471, 1433, 1408, 1362, 1335, 1319, 1308, 1318, 1344, 1393, 1430, 1456, 1497, 1591, 1752, 1612, 1503, 1447, 1417, 1365, 1315, 1276, 1248, 1237, 1252, 1290, 1339, 1404, 1435, 1469, 1539, 1661, 1547, 1470, 1424, 1389, 1321, 1260, 1205, 1173, 1165, 1181, 1221, 1286, 1358, 1409, 1452, 1503, 1603, 1504, 1451, 1411, 1358, 1276, 1198, 1148, 1114, 1110, 1124, 1164, 1228, 1320, 1388, 1435, 1479, 1552, 1475, 1437, 1392, 1325, 1231, 1153, 1094, 1069, 1068, 1084, 1119, 1182, 1278, 1365, 1429, 1469, 1529, 1464, 1430, 1375, 1301, 1196, 1118, 1067, 1043, 1039, 1051, 1089, 1150, 1245, 1342, 1417, 1453, 1512, 1461, 1418, 1369, 1281, 1177, 1099, 1051, 1028, 1029, 1037, 1069, 1129, 1224, 1328, 1404, 1449, 1503, 1455, 1422, 1366, 1276, 1170, 1094, 1046, 1026, 1024, 1033, 1063, 1125, 1216, 1322, 1400, 1448, 1508, 1459, 1426, 1368, 1280, 1179, 1102, 1051, 1030, 1029, 1039, 1071, 1132, 1222, 1327, 1406, 1448, 1502, 1473, 1433, 1380, 1302, 1201, 1125, 1069, 1046, 1043, 1055, 1091, 1153, 1245, 1343, 1412, 1461, 1523, 1488, 1445, 1397, 1328, 1242, 1157, 1104, 1079, 1073, 1088, 1127, 1193, 1284, 1373, 1424, 1473, 1543, 1521, 1461, 1424, 1361, 1289, 1210, 1152, 1124, 1118, 1134, 1174, 1242, 1330, 1396, 1439, 1494, 1572, 1573, 1475, 1434, 1397, 1336, 1270, 1213, 1182, 1176, 1194, 1239, 1301, 1366, 1420, 1464, 1510, 1624, 1628, 1510, 1449, 1424, 1378, 1326, 1281, 1252, 1243, 1264, 1304, 1352, 1406, 1443, 1456, 1554, 1692, 1727, 1578, 1482, 1448, 1415, 1374, 1337, 1318, 1317, 1338, 1356, 1398, 1429, 1443, 1501, 1603, 1783, 1776, 1643, 1510, 1448, 1415, 1387, 1353, 1344, 1343, 1348, 1368, 1396, 1407, 1442, 1515, 1674, 1832, ] + gb: [1805, 1650, 1529, 1468, 1430, 1412, 1378, 1371, 1363, 1371, 1393, 1430, 1465, 1501, 1567, 1713, 1864, 1700, 1564, 1476, 1434, 1404, 1359, 1323, 1306, 1294, 1306, 1338, 1388, 1432, 1462, 1509, 1605, 1780, 1627, 1520, 1457, 1423, 1370, 1311, 1267, 1238, 1226, 1245, 1286, 1344, 1414, 1448, 1489, 1563, 1697, 1568, 1487, 1436, 1398, 1325, 1257, 1200, 1163, 1156, 1175, 1221, 1291, 1372, 1427, 1476, 1528, 1636, 1527, 1474, 1431, 1371, 1285, 1201, 1144, 1109, 1104, 1121, 1165, 1239, 1335, 1411, 1461, 1509, 1588, 1498, 1463, 1413, 1343, 1242, 1159, 1094, 1066, 1064, 1083, 1124, 1195, 1299, 1391, 1455, 1499, 1561, 1492, 1454, 1401, 1319, 1209, 1124, 1068, 1042, 1039, 1053, 1096, 1164, 1268, 1370, 1446, 1486, 1547, 1486, 1446, 1392, 1302, 1190, 1108, 1053, 1028, 1029, 1040, 1078, 1146, 1245, 1355, 1437, 1600, 1546, 1600, 1449, 1389, 1294, 1184, 1101, 1047, 1024, 1024, 1035, 1073, 1136, 1240, 1348, 1431, 1483, 1537, 1485, 1450, 1390, 1298, 1188, 1109, 1051, 1030, 1026, 1038, 1077, 1143, 1243, 1354, 1436, 1482, 1547, 1494, 1454, 1400, 1317, 1211, 1125, 1067, 1041, 1038, 1053, 1094, 1165, 1264, 1368, 1440, 1489, 1557, 1513, 1464, 1414, 1340, 1245, 1156, 1097, 1071, 1063, 1081, 1126, 1197, 1298, 1394, 1446, 1502, 1573, 1541, 1477, 1438, 1370, 1292, 1204, 1142, 1111, 1106, 1121, 1169, 1245, 1338, 1411, 1462, 1519, 1599, 1590, 1485, 1447, 1403, 1334, 1263, 1199, 1164, 1158, 1179, 1230, 1299, 1373, 1433, 1477, 1528, 1649, 1643, 1520, 1454, 1426, 1375, 1315, 1266, 1235, 1224, 1247, 1291, 1345, 1408, 1449, 1468, 1572, 1711, 1738, 1579, 1482, 1443, 1406, 1359, 1318, 1294, 1294, 1312, 1338, 1385, 1427, 1441, 1507, 1614, 1799, 1786, 1653, 1516, 1452, 1414, 1383, 1348, 1331, 1328, 1336, 1362, 1391, 1408, 1448, 1529, 1684, 1858, ] + b: [1807, 1633, 1496, 1427, 1395, 1372, 1357, 1340, 1339, 1335, 1356, 1382, 1410, 1454, 1541, 1690, 1860, 1657, 1503, 1411, 1364, 1342, 1312, 1286, 1274, 1262, 1270, 1287, 1326, 1355, 1387, 1447, 1550, 1726, 1556, 1438, 1374, 1340, 1305, 1267, 1236, 1213, 1199, 1211, 1246, 1280, 1324, 1355, 1397, 1475, 1620, 1473, 1407, 1350, 1317, 1270, 1223, 1173, 1144, 1135, 1151, 1185, 1237, 1292, 1326, 1368, 1422, 1544, 1430, 1375, 1331, 1293, 1238, 1166, 1120, 1096, 1091, 1104, 1133, 1188, 1261, 1310, 1351, 1388, 1487, 1383, 1362, 1316, 1269, 1194, 1128, 1076, 1054, 1057, 1070, 1101, 1146, 1229, 1294, 1329, 1368, 1459, 1368, 1347, 1301, 1250, 1162, 1099, 1057, 1039, 1035, 1041, 1076, 1119, 1199, 1271, 1321, 1349, 1440, 1360, 1338, 1299, 1234, 1145, 1086, 1042, 1029, 1026, 1034, 1059, 1104, 1176, 1260, 1307, 1344, 1439, 1347, 1342, 1293, 1226, 1139, 1077, 1040, 1024, 1025, 1030, 1051, 1099, 1170, 1249, 1301, 1335, 1432, 1346, 1342, 1295, 1227, 1145, 1083, 1040, 1025, 1024, 1031, 1059, 1096, 1170, 1247, 1297, 1338, 1436, 1362, 1344, 1299, 1245, 1161, 1095, 1055, 1034, 1031, 1041, 1069, 1115, 1185, 1252, 1299, 1347, 1453, 1378, 1353, 1311, 1261, 1191, 1117, 1077, 1058, 1045, 1063, 1092, 1141, 1210, 1274, 1302, 1358, 1461, 1405, 1364, 1329, 1281, 1229, 1159, 1106, 1084, 1080, 1093, 1124, 1180, 1244, 1285, 1317, 1380, 1496, 1467, 1379, 1343, 1304, 1260, 1208, 1154, 1127, 1117, 1138, 1172, 1225, 1266, 1297, 1340, 1397, 1556, 1532, 1428, 1354, 1325, 1290, 1248, 1211, 1181, 1178, 1197, 1227, 1261, 1293, 1321, 1342, 1450, 1624, 1634, 1502, 1394, 1347, 1316, 1283, 1251, 1239, 1241, 1254, 1266, 1297, 1312, 1328, 1396, 1509, 1739, 1685, 1572, 1426, 1351, 1313, 1285, 1257, 1254, 1249, 1259, 1266, 1287, 1292, 1336, 1429, 1593, 1816, ] + #800x600_D65_70 - D65 + - ct: 6504 + resolution: 800x600 + r: [2310, 2164, 1991, 1936, 1850, 1817, 1755, 1703, 1707, 1707, 1757, 1836, 1862, 1962, 2029, 2221, 2360, 2246, 2047, 1960, 1865, 1809, 1707, 1633, 1600, 1571, 1595, 1646, 1733, 1829, 1886, 1973, 2107, 2297, 2150, 1988, 1897, 1818, 1703, 1592, 1504, 1453, 1424, 1452, 1527, 1625, 1753, 1828, 1929, 2014, 2213, 2056, 1960, 1846, 1757, 1608, 1475, 1376, 1315, 1297, 1330, 1399, 1512, 1645, 1782, 1879, 1981, 2117, 2007, 1925, 1817, 1678, 1513, 1371, 1268, 1205, 1188, 1221, 800, 1406, 1563, 1712, 1840, 1954, 2039, 1988, 1883, 1780, 1612, 1425, 1282, 1180, 1125, 1111, 1140, 1208, 1324, 1484, 1660, 1821, 1914, 2015, 1973, 1864, 1740, 1553, 1366, 1220, 1124, 1069, 1057, 1083, 1154, 1264, 1423, 1615, 1794, 1891, 2000, 1955, 1842, 1717, 1524, 1332, 1187, 1094, 1042, 1028, 1053, 1117, 1229, 1387, 1582, 1767, 1877, 1991, 1942, 1849, 1704, 1509, 1320, 1177, 1081, 1031, 1024, 1042, 1108, 1216, 1376, 1569, 1767, 1877, 1998, 1946, 1853, 1710, 1515, 1335, 1186, 1092, 1041, 1030, 1055, 1118, 1233, 1390, 1584, 1773, 1885, 1985, 1958, 1852, 1737, 1550, 1370, 1224, 1125, 1073, 1058, 1089, 1155, 1265, 1419, 1614, 1788, 1894, 2007, 1973, 1875, 1768, 1604, 1426, 1282, 1181, 1128, 1112, 1145, 1214, 1330, 1491, 1667, 1810, 1926, 2015, 1995, 1902, 1815, 1667, 1513, 1371, 1262, 1207, 1194, 1224, 1299, 1418, 1569, 1723, 1848, 1961, 2038, 2051, 1925, 1837, 1758, 1606, 1473, 1373, 1313, 1302, 1335, 1405, 1521, 1650, 1793, 1893, 1977, 2116, 2136, 1971, 1882, 1815, 1703, 1587, 1492, 1445, 1432, 1461, 1529, 1624, 1754, 1841, 1907, 2032, 2215, 2244, 2038, 1200, 1860, 1800, 1696, 1625, 1583, 1577, 1610, 1653, 1734, 1822, 1865, 1980, 2109, 2298, 2286, 2159, 1971, 1909, 1828, 1794, 1703, 1686, 1686, 1689, 1740, 1810, 1830, 1925, 1999, 2201, 2357, ] + gr: [1785, 1800, 1516, 1458, 1422, 1403, 1374, 1363, 1359, 1363, 1385, 1417, 1447, 1486, 1547, 1693, 1834, 1675, 1547, 1462, 1418, 1393, 1346, 1319, 1304, 1289, 1302, 1330, 1382, 1417, 1451, 1492, 1592, 1743, 1607, 1498, 1437, 1404, 1353, 1301, 1264, 1238, 1226, 1240, 1281, 1325, 1398, 1426, 1468, 1541, 1668, 1547, 1466, 1413, 1382, 1311, 1251, 1202, 1168, 1161, 1176, 1218, 1275, 1351, 1408, 1449, 1498, 1606, 1499, 1447, 1404, 1349, 1269, 1199, 1147, 1113, 1106, 1123, 1163, 1225, 1313, 1384, 1435, 1485, 1551, 1467, 1437, 1388, 1318, 1228, 1154, 1099, 1070, 1066, 1081, 1120, 1185, 1278, 1362, 1430, 1468, 1530, 1460, 1422, 1370, 1293, 1199, 1121, 1068, 1044, 1035, 1052, 1090, 1155, 1244, 1344, 1420, 1457, 1507, 1460, 1416, 1363, 1278, 1179, 1105, 1054, 1028, 1028, 1036, 1073, 1134, 1230, 1323, 1413, 1452, 1509, 1454, 1421, 1361, 1272, 1174, 1097, 1046, 1025, 1024, 1033, 1068, 1130, 1222, 1320, 1408, 1450, 1503, 1456, 1423, 1366, 1275, 1184, 1105, 1053, 1030, 1027, 1040, 1073, 1136, 1228, 1324, 1411, 1457, 1508, 1472, 1429, 1376, 1294, 1205, 1126, 1072, 1046, 1044, 1058, 1095, 1159, 1246, 1345, 1419, 1464, 1530, 1481, 1443, 1396, 1322, 1239, 1161, 1104, 1078, 1070, 1088, 1128, 1196, 1283, 1371, 1428, 1600, 1551, 1521, 1457, 1421, 1355, 1282, 1209, 1152, 1125, 1116, 1134, 1176, 1243, 1324, 1398, 1446, 1497, 1581, 1571, 1471, 1430, 1392, 1328, 1262, 1210, 1179, 1172, 1191, 1236, 1295, 1363, 1424, 1465, 1511, 1636, 1636, 1509, 1448, 1415, 1368, 1316, 1271, 1243, 1234, 1258, 800, 1340, 1407, 1439, 1459, 1561, 1699, 1720, 1577, 1479, 1444, 1408, 1362, 1325, 1304, 1305, 1325, 1348, 1394, 1426, 1439, 1503, 1609, 1788, 1770, 1642, 1502, 1444, 1400, 1384, 1338, 1334, 1329, 1339, 1357, 1389, 1396, 1443, 1514, 1670, 1822, ] + gb: [1791, 1649, 1516, 1459, 1422, 1404, 1373, 1360, 1353, 1358, 1386, 1424, 1451, 1492, 1563, 1710, 1854, 1687, 1553, 1463, 1420, 1393, 1347, 1313, 800, 1284, 1295, 1324, 1376, 1417, 1455, 1493, 1609, 1768, 1617, 1511, 1444, 1409, 1359, 1299, 1260, 1234, 1219, 1237, 1276, 1328, 1403, 1431, 1479, 1557, 1696, 1555, 1477, 1422, 1388, 1311, 1250, 1200, 1165, 1158, 1174, 1217, 1281, 1358, 1416, 1463, 1520, 1629, 1520, 1458, 1415, 1355, 1272, 1203, 1144, 1111, 1105, 1122, 1165, 1231, 1322, 1394, 1447, 1497, 1577, 1481, 1452, 1399, 1330, 1234, 1160, 1101, 1070, 1065, 1082, 1124, 1192, 1288, 1373, 1443, 1485, 1556, 1476, 1437, 1384, 1304, 1207, 1124, 1070, 1045, 1039, 1055, 1092, 1163, 1256, 1357, 1429, 1475, 1539, 1470, 1430, 1373, 1288, 1186, 1108, 1056, 1029, 1027, 1040, 1078, 1142, 1240, 1336, 1424, 1469, 1529, 1465, 1433, 1370, 1281, 1179, 1102, 1049, 1025, 1024, 1035, 1070, 1134, 1230, 1332, 1420, 1464, 1536, 1469, 1434, 1372, 1283, 1186, 1108, 1055, 1029, 1027, 1037, 1076, 1145, 1236, 1337, 1421, 1468, 1535, 1478, 1438, 1382, 1303, 1210, 1128, 1070, 1044, 1040, 1056, 1096, 1164, 1255, 1355, 1427, 1478, 1551, 1489, 1454, 1401, 1329, 1239, 1160, 1102, 1075, 1067, 1084, 1128, 1196, 1288, 1380, 1435, 1492, 1573, 1528, 1464, 1426, 1358, 1283, 1206, 1146, 1116, 1110, 1129, 1172, 1242, 1327, 1402, 1451, 1508, 1597, 1574, 1476, 1433, 1395, 1326, 1254, 1202, 1170, 1165, 1182, 1230, 1292, 1361, 1425, 1471, 1526, 1657, 1638, 1512, 1449, 1418, 1366, 1308, 1259, 1230, 1223, 1246, 1285, 1334, 1402, 1439, 1465, 1574, 1712, 1723, 1575, 1474, 1440, 1400, 1353, 1312, 1289, 1287, 1305, 1332, 1381, 1417, 1440, 1504, 1616, 1806, 1780, 1652, 1506, 1448, 1403, 1380, 1340, 1327, 1325, 1335, 1350, 1390, 1402, 1448, 1532, 1693, 1848, ] + b: [1834, 1686, 1532, 1462, 1420, 1404, 1369, 1360, 1354, 1357, 1375, 1415, 1442, 1496, 1568, 1741, 1872, 1706, 1543, 1441, 1391, 1366, 1321, 1295, 1281, 1270, 1276, 1305, 1345, 1389, 1418, 1477, 1588, 1752, 1594, 1473, 1400, 1363, 1317, 1269, 1238, 1216, 1206, 1214, 1250, 800, 1353, 1389, 1434, 1503, 1664, 1514, 1437, 1372, 1334, 1278, 1228, 1180, 1151, 1143, 1159, 1196, 1246, 1313, 1359, 1405, 1453, 1587, 1465, 1401, 1351, 1308, 1236, 1177, 1127, 1101, 1093, 1109, 1141, 1200, 1274, 1335, 1384, 1427, 1522, 1423, 1386, 1335, 1275, 1199, 1133, 1087, 1063, 1059, 1069, 1104, 1159, 1240, 1316, 1369, 1402, 1493, 1407, 1375, 1318, 1256, 1172, 1107, 1060, 1041, 1035, 1048, 1077, 1135, 1211, 1291, 1354, 1391, 1478, 1390, 1365, 1313, 1239, 1153, 1089, 1047, 1029, 1028, 1033, 1065, 1116, 1193, 1278, 1342, 1382, 1475, 1384, 1364, 1308, 1231, 1146, 1082, 1040, 1025, 1024, 1030, 1057, 1110, 1183, 1269, 1337, 1379, 1475, 1384, 1372, 1309, 1233, 1152, 1086, 1046, 1024, 1024, 1032, 1061, 1113, 1187, 1268, 1337, 1379, 1479, 1395, 1370, 1317, 1249, 1171, 1102, 1058, 1035, 1029, 1047, 1073, 1130, 1200, 1278, 1341, 1388, 1491, 1420, 1383, 1336, 1265, 1195, 1129, 1078, 1059, 1053, 1065, 1102, 1155, 1227, 1301, 1348, 1405, 1505, 1452, 1396, 1356, 1295, 1234, 1166, 1116, 1092, 1084, 1103, 1139, 1195, 1262, 1321, 1364, 1420, 1547, 1517, 1414, 1375, 1324, 1269, 1214, 1165, 1138, 1132, 1148, 1188, 1239, 1291, 1336, 1387, 1446, 1604, 1587, 1471, 1383, 1354, 1309, 1257, 1216, 1192, 1187, 1209, 1241, 1277, 1330, 1366, 1384, 1498, 1682, 1689, 1543, 1427, 1381, 1344, 1303, 1265, 1250, 1251, 1266, 1284, 1326, 1353, 1369, 1447, 1566, 1790, 1754, 1632, 1469, 1391, 1353, 1317, 1292, 1282, 1278, 1294, 1306, 1321, 1347, 1382, 1477, 1650, 1854, ] + #800x600_F2_CWF_70 - F2_CWF + - ct: 4230 + resolution: 800x600 + r: [2065, 1886, 1745, 1661, 1619, 1574, 1532, 1504, 1498, 1499, 1533, 1586, 1628, 1689, 1770, 1942, 2140, 1978, 1796, 1688, 1627, 1565, 1501, 1446, 1424, 1407, 1419, 1460, 1525, 1583, 1642, 1712, 1829, 2032, 1880, 1732, 1643, 1579, 1499, 1418, 1356, 1319, 1300, 1320, 1372, 1443, 1536, 1598, 1661, 1763, 1923, 1812, 1689, 1608, 1535, 1429, 1335, 1267, 1223, 1210, 1234, 1284, 1362, 1461, 1547, 1634, 1715, 1848, 1755, 1664, 1579, 1600, 1362, 1262, 1188, 1145, 1132, 1156, 1211, 1289, 1403, 1504, 1604, 1688, 1791, 1726, 1635, 1548, 1433, 1298, 1199, 1126, 1084, 1080, 1101, 1147, 1226, 1340, 1468, 1586, 1659, 1752, 1707, 1624, 1522, 1393, 1256, 1155, 1085, 1054, 1043, 1059, 1111, 1187, 1302, 1435, 1566, 1645, 1732, 1695, 1605, 1508, 1367, 1230, 1132, 1066, 1034, 1028, 1042, 1084, 1160, 1275, 1418, 1549, 1634, 1722, 1681, 1604, 1498, 1360, 1222, 1121, 1058, 1027, 1024, 1034, 1075, 1151, 1264, 1407, 1543, 1633, 1723, 1691, 1609, 1498, 1361, 1231, 1130, 1064, 1037, 1027, 1043, 1083, 1162, 1275, 1413, 1545, 1638, 1714, 1692, 1612, 1515, 1385, 1258, 1153, 1087, 1051, 1045, 1064, 1109, 1185, 1295, 1437, 1560, 1645, 1741, 1712, 1627, 1538, 1417, 1298, 1199, 1124, 1087, 1075, 1101, 1146, 1231, 1342, 1472, 1574, 1665, 1754, 1743, 1637, 1572, 1466, 1357, 1253, 1181, 1142, 1131, 1154, 1207, 1295, 1401, 1515, 1601, 1687, 1789, 1807, 1661, 1597, 1525, 1425, 1328, 1257, 1215, 1208, 1230, 1282, 1363, 1459, 1555, 1800, 1714, 1857, 1871, 1711, 1631, 1573, 1491, 1407, 1343, 1307, 1298, 1323, 1368, 1440, 1528, 1601, 1649, 1767, 1932, 1982, 1788, 1675, 1617, 1559, 1489, 1433, 1406, 1405, 1425, 1457, 1516, 1581, 1623, 1713, 1836, 2044, 2041, 1885, 1730, 1646, 1589, 1547, 1498, 1476, 1474, 1488, 1518, 1569, 1594, 1656, 1757, 1921, 2111, ] + gr: [1765, 1633, 1502, 1441, 1411, 1389, 1365, 1356, 1350, 1358, 1375, 1408, 1434, 1476, 1534, 1678, 1820, 1671, 1535, 1450, 1410, 1381, 1341, 1311, 1297, 1288, 1295, 1323, 1368, 1407, 1437, 1600, 1580, 1736, 1595, 1488, 1424, 1388, 1342, 1293, 1255, 1230, 1219, 1235, 1270, 1319, 1384, 1413, 1452, 1524, 1657, 1534, 1452, 1399, 1367, 1300, 1238, 1194, 1162, 1155, 1171, 1209, 1267, 1336, 1393, 1435, 1486, 1591, 1491, 1429, 1389, 1335, 1255, 1189, 1139, 1108, 1104, 1118, 1156, 1218, 1302, 1369, 1422, 1470, 1540, 1456, 1416, 1370, 1305, 1216, 1146, 1093, 1068, 1064, 1078, 1116, 1176, 1268, 1345, 1415, 1451, 1510, 1445, 1409, 1352, 1280, 1185, 1113, 1065, 1041, 1039, 1051, 1085, 1147, 1235, 1330, 1402, 1440, 1499, 1444, 1399, 1349, 1261, 1171, 1096, 1050, 1029, 1030, 1037, 1070, 1127, 1217, 1314, 1395, 1437, 1490, 1437, 1401, 1346, 1256, 1161, 1091, 1043, 1026, 1024, 1034, 1064, 1123, 1210, 1308, 1390, 1436, 1490, 1441, 1409, 1346, 1262, 1170, 1097, 1049, 1030, 1029, 1040, 1069, 1129, 1216, 1315, 1393, 1439, 1490, 1458, 1413, 1357, 1280, 1194, 1118, 1065, 1044, 1043, 1055, 1088, 1151, 1235, 1331, 1404, 1448, 1513, 1475, 1426, 1378, 1304, 1225, 1149, 1098, 1074, 1067, 1083, 1122, 1187, 1268, 1356, 1411, 1465, 1530, 1505, 1439, 1402, 1339, 1268, 1197, 1144, 1119, 1110, 1129, 1167, 1232, 1313, 1383, 1428, 1481, 1563, 1564, 1455, 1415, 1373, 1313, 1249, 1203, 1173, 1167, 1184, 1227, 1284, 1349, 1404, 1449, 1499, 1617, 1620, 1493, 1428, 1402, 1354, 1303, 1261, 1236, 1228, 1250, 1285, 1333, 1389, 1428, 1444, 1544, 1684, 1710, 1568, 1462, 1428, 1394, 1354, 1315, 800, 1298, 1317, 1337, 1381, 1411, 1428, 1491, 1594, 1774, 1755, 1632, 1496, 1430, 1395, 1370, 1330, 1328, 1322, 1331, 1348, 1378, 1392, 1426, 1503, 1657, 1810, ] + gb: [1773, 1627, 1500, 1438, 1403, 1382, 1352, 1341, 1336, 1344, 1365, 1404, 1435, 1476, 1545, 1692, 1839, 1672, 1540, 1450, 1406, 1376, 1332, 1298, 1282, 1274, 1284, 1312, 1363, 1405, 1440, 1483, 1594, 1751, 1608, 1494, 1426, 1391, 1341, 1284, 1247, 1219, 1207, 1224, 1263, 1318, 1388, 1423, 1460, 1542, 1678, 1545, 1463, 1407, 1368, 1298, 1235, 1188, 1153, 1148, 1163, 1207, 1268, 1345, 1402, 1450, 1506, 1613, 1499, 1442, 1399, 1342, 1259, 1187, 1135, 1103, 1096, 1116, 1157, 1222, 1310, 1382, 1436, 1489, 1564, 1475, 1434, 1382, 1315, 1221, 1145, 1093, 1065, 1061, 1076, 1115, 1182, 1278, 1364, 1431, 1474, 1541, 1461, 1425, 1368, 1290, 1193, 1118, 1064, 1041, 1037, 1050, 1090, 1154, 1246, 1346, 1420, 1466, 1525, 1463, 1416, 1363, 1273, 1178, 1097, 1051, 1030, 1029, 1039, 1073, 1136, 1232, 1332, 1414, 1460, 1519, 1452, 1420, 1357, 1268, 1172, 1094, 1045, 1026, 1024, 1034, 1067, 1131, 1223, 1324, 1409, 1458, 1521, 1460, 1420, 1359, 1271, 1175, 1099, 1048, 1029, 1027, 1038, 1072, 1136, 1227, 1330, 1412, 1458, 1524, 1467, 1424, 1368, 1289, 1197, 1117, 1063, 1040, 1038, 1053, 1089, 1156, 1246, 1345, 1415, 1470, 1538, 1486, 1437, 1384, 1309, 1224, 1146, 1091, 1067, 1063, 1077, 1118, 1187, 1278, 1367, 1425, 1600, 1553, 1519, 1445, 1408, 1342, 1266, 1192, 1136, 1106, 1102, 1119, 1161, 1230, 1316, 1389, 1438, 1495, 1583, 1567, 1460, 1420, 1374, 1310, 1241, 1189, 1158, 1152, 1173, 1214, 1278, 1348, 1410, 1456, 1511, 1634, 1624, 1498, 1427, 1400, 1346, 1294, 1244, 1219, 1210, 1232, 1271, 1321, 1384, 1430, 1448, 1557, 1697, 1719, 1560, 1458, 1421, 1381, 1338, 1298, 1274, 1275, 1292, 1318, 1365, 1404, 1424, 1489, 1601, 1785, 1751, 1637, 1497, 1429, 1389, 1361, 1323, 1311, 1309, 1318, 1339, 1374, 1388, 1429, 1513, 1674, 1829, ] + b: [1800, 1643, 1486, 1416, 1376, 1354, 1329, 1318, 1309, 1310, 1331, 1359, 1390, 1444, 1533, 1708, 1846, 1664, 1510, 1400, 1351, 1324, 1286, 1260, 1246, 1235, 1244, 1266, 1306, 1341, 1373, 1441, 1556, 1734, 1557, 1441, 1360, 1322, 1282, 1242, 1211, 1188, 1180, 1186, 1220, 1258, 1309, 1346, 1391, 1475, 1626, 1484, 1400, 1331, 1300, 1247, 1202, 1163, 1135, 1127, 1143, 1170, 1215, 1274, 1315, 1365, 1417, 1555, 1422, 1368, 1316, 1270, 1209, 1158, 1117, 1088, 1084, 1094, 1130, 1174, 1240, 800, 1343, 1389, 1497, 1383, 1351, 1299, 1247, 1177, 1122, 1081, 1057, 1051, 1067, 1094, 1142, 1209, 1274, 1329, 1362, 1461, 1367, 1333, 1284, 1224, 1153, 1098, 1056, 1040, 1035, 1042, 1070, 1118, 1186, 1255, 1314, 1349, 1441, 1355, 1327, 1275, 1209, 1137, 1082, 1044, 1029, 1026, 1034, 1056, 1100, 1166, 1241, 1302, 1341, 1439, 1343, 1325, 1270, 1201, 1130, 1075, 1037, 1024, 1026, 1030, 1050, 1094, 1160, 1231, 1295, 1334, 1434, 1347, 1330, 1274, 1203, 1135, 1079, 1040, 1026, 1024, 1031, 1054, 1097, 1161, 1231, 1292, 1338, 1433, 1358, 1330, 1280, 1219, 1152, 1093, 1051, 1032, 1030, 1043, 1067, 1115, 1173, 1237, 1298, 1348, 1447, 1382, 1342, 1298, 1236, 1174, 1115, 1071, 1051, 1044, 1060, 1088, 1138, 1197, 1259, 1301, 1365, 1464, 1410, 1360, 1314, 1259, 1205, 1149, 1104, 1079, 1075, 1090, 1123, 1171, 1227, 1277, 1315, 1387, 1508, 1476, 1376, 1330, 1287, 1238, 1188, 1144, 1122, 1115, 1132, 1165, 1206, 1249, 1294, 1344, 1402, 1567, 1548, 1431, 1348, 1314, 1271, 1224, 1190, 1168, 1163, 1182, 1210, 1246, 1286, 1318, 1344, 1462, 1650, 1658, 1510, 1386, 1342, 1305, 1268, 1232, 1220, 1221, 1236, 1250, 1283, 1311, 1328, 1406, 1530, 1755, 1698, 1587, 1431, 1350, 1304, 1274, 1244, 1238, 1239, 1245, 1262, 1283, 1293, 1339, 1439, 1608, 1825, ] + #800x600_D50_70 - D50 + - ct: 5003 + resolution: 800x600 + r: [2543, 2578, 2509, 2438, 2318, 2233, 2133, 2085, 2088, 2130, 2245, 2390, 2533, 2674, 2811, 2910, 2790, 2536, 2518, 2407, 2309, 2153, 2048, 1910, 1861, 1865, 1921, 2013, 2160, 2340, 2523, 2664, 2836, 2882, 2501, 2408, 2276, 2127, 1951, 1804, 1701, 1655, 1635, 1674, 1771, 1939, 2141, 2356, 2565, 2701, 2839, 2403, 2314, 2154, 1963, 1779, 1618, 1511, 1447, 1433, 1470, 1554, 1714, 1920, 2196, 2430, 2589, 2694, 2352, 2232, 2049, 1828, 1635, 1472, 1357, 1295, 1274, 1317, 1399, 1543, 1785, 2021, 2302, 2494, 2688, 2254, 2143, 1936, 1720, 1509, 1345, 1237, 1168, 1158, 1188, 1271, 1420, 1614, 1894, 2190, 2443, 2592, 2210, 2085, 1870, 1630, 1432, 1264, 1161, 1090, 1079, 1102, 1184, 1329, 1525, 1797, 2112, 2377, 2587, 2224, 2063, 1822, 1598, 1381, 1217, 1121, 1045, 1031, 1063, 1129, 1270, 1481, 1749, 2059, 2344, 2559, 2234, 2083, 1812, 1592, 1381, 1215, 1102, 1046, 1024, 1053, 1122, 1257, 1466, 1734, 2045, 2338, 2530, 2224, 2063, 1856, 1610, 1407, 1237, 1126, 1063, 1044, 1072, 1145, 1288, 1485, 1764, 2059, 2344, 2539, 2273, 2135, 1906, 1675, 1470, 1299, 1187, 1112, 1094, 1120, 1208, 1348, 1546, 1828, 2124, 2377, 2566, 2321, 2197, 1986, 1779, 1563, 1402, 1271, 1209, 1192, 1221, 1313, 1461, 1664, 1929, 2203, 2460, 2659, 2371, 2292, 2119, 1906, 1700, 1538, 1407, 1335, 1321, 1366, 1447, 1593, 1800, 2062, 2331, 2570, 2737, 2485, 2382, 2262, 2078, 1876, 1721, 1587, 1525, 1504, 1545, 1633, 1785, 1985, 2246, 2464, 2631, 2799, 2621, 2465, 2387, 2243, 2063, 1912, 1801, 1734, 1705, 1755, 1848, 2005, 2213, 2417, 2584, 2773, 2900, 2757, 2632, 2519, 2419, 2283, 2160, 2044, 1976, 1979, 2024, 2107, 2272, 2430, 2578, 2731, 2921, 2984, 2724, 2762, 2663, 2570, 2413, 2331, 2245, 2227, 2242, 2278, 2369, 2486, 2647, 2763, 2864, 3041, 2860, ] + gr: [2123, 2151, 2065, 2008, 1917, 1836, 1766, 1738, 1740, 1752, 1817, 1882, 1943, 2023, 2110, 2206, 2123, 2143, 2093, 2006, 1915, 1810, 1724, 1632, 1597, 1588, 1608, 1665, 1733, 1827, 1928, 2014, 2122, 2189, 2104, 2052, 1936, 1805, 1686, 1575, 1502, 1464, 1446, 1461, 1512, 1597, 1705, 1827, 1949, 2027, 2124, 2066, 1962, 1856, 1704, 1563, 1450, 1376, 1323, 1310, 1323, 1371, 1466, 1570, 1714, 1868, 1954, 2066, 1997, 1917, 1771, 1622, 1466, 1351, 1258, 1217, 1199, 1211, 1265, 1351, 1469, 1622, 1781, 1891, 1989, 1958, 1863, 1700, 1537, 1382, 1265, 1182, 1133, 1118, 1128, 1178, 1254, 1385, 1537, 1695, 1838, 1943, 1935, 1829, 1642, 1480, 1319, 1202, 1122, 1078, 1061, 1073, 1114, 1196, 1316, 1477, 1655, 1806, 1913, 1953, 1794, 1639, 1442, 1288, 1171, 1089, 1047, 1031, 1044, 1083, 1153, 1279, 1436, 1623, 1783, 1924, 1940, 1807, 1621, 1442, 1283, 1166, 1083, 1041, 1024, 1034, 1073, 1147, 1270, 1436, 1608, 1768, 1897, 1968, 1828, 1639, 1470, 1297, 1182, 1096, 1055, 1038, 1050, 1090, 1168, 1290, 1442, 1627, 1783, 1917, 1942, 1841, 1682, 1510, 1349, 1222, 1132, 1088, 1067, 1081, 1127, 1206, 1326, 1486, 1651, 1811, 1942, 2005, 1901, 1743, 1578, 1422, 1303, 1209, 1152, 1135, 1148, 1191, 1280, 1399, 1548, 1719, 1845, 1974, 2057, 1952, 1830, 1685, 1512, 1393, 1305, 1245, 1221, 1233, 1289, 1372, 1489, 1634, 1776, 1904, 2031, 2113, 2007, 1918, 1777, 1640, 1511, 1423, 1360, 1344, 1360, 1400, 1494, 1608, 1742, 1862, 1976, 2123, 2199, 2104, 2006, 1879, 1756, 1649, 1553, 1502, 1480, 1495, 1546, 1633, 1732, 1839, 1956, 2052, 2210, 2300, 2191, 2104, 2010, 1907, 1802, 1717, 1669, 1655, 1673, 1717, 1792, 1878, 1955, 2054, 2222, 2274, 2310, 2336, 2195, 2103, 2012, 1925, 1861, 1823, 1814, 1844, 1889, 1931, 2004, 2079, 2166, 2287, 2213, ] + gb: [2166, 2183, 2106, 2056, 1961, 1889, 1800, 1772, 1760, 1791, 1821, 1907, 1948, 2040, 2115, 2205, 2191, 2197, 2125, 2062, 1973, 1862, 1758, 1680, 1620, 1612, 1636, 1693, 1758, 1851, 1953, 2031, 2125, 2174, 2125, 2067, 1974, 1852, 1719, 1621, 1532, 1477, 1465, 1480, 1535, 1605, 1724, 1852, 1967, 2050, 2156, 2107, 2015, 1893, 1738, 1608, 1485, 1406, 1337, 1319, 1337, 1382, 1476, 1589, 1733, 1869, 1985, 2070, 2037, 1948, 1806, 1641, 1501, 1377, 1287, 1227, 1215, 1227, 1274, 1364, 1485, 1645, 1806, 1928, 2028, 1981, 1887, 1728, 1564, 1409, 1285, 1199, 1145, 1125, 1135, 1183, 1270, 1395, 1560, 1733, 1868, 1974, 1965, 1841, 1670, 1509, 1349, 1221, 1138, 1084, 1065, 1073, 1121, 1208, 1332, 1496, 1670, 1835, 1958, 1948, 1818, 1642, 1467, 1315, 1185, 1099, 1052, 1035, 1042, 1084, 1163, 1292, 1458, 1638, 1812, 1948, 1942, 1809, 1635, 1467, 1296, 1178, 1094, 1039, 1024, 1038, 1073, 1157, 1285, 1451, 1640, 1803, 1935, 1948, 1812, 1646, 1483, 1317, 1196, 1107, 1057, 1043, 1053, 1090, 1183, 1296, 1464, 1650, 1818, 1941, 1965, 1841, 1687, 1519, 1362, 1243, 1145, 1094, 1075, 1088, 1137, 1225, 1339, 1512, 1692, 1835, 1988, 1981, 1893, 1738, 1586, 1435, 1314, 1218, 1160, 1143, 1158, 1212, 1294, 1418, 1578, 1742, 1887, 2005, 2037, 1948, 1838, 1674, 1527, 1398, 1309, 1251, 1236, 1253, 1305, 1385, 1514, 1674, 1816, 1934, 2062, 2098, 2015, 1899, 1791, 1656, 1530, 1430, 1379, 1360, 1379, 1428, 1517, 1639, 1781, 1893, 2015, 2117, 2199, 2075, 1988, 1910, 1776, 1664, 1583, 1518, 1502, 1525, 1576, 1668, 1776, 1898, 1981, 2084, 2221, 2269, 2204, 2103, 2021, 1921, 1827, 1751, 1676, 1671, 1693, 1755, 1843, 1927, 2007, 2095, 2224, 2294, 2285, 2285, 2190, 2112, 2009, 1956, 1909, 1853, 1845, 1864, 1921, 1995, 2058, 2137, 2199, 2308, 2231, ] + b: [2007, 2014, 1951, 1922, 1856, 1794, 1746, 1720, 1718, 1747, 1818, 1865, 1956, 2026, 2146, 2219, 2251, 2020, 1954, 1914, 1840, 1745, 1673, 1626, 1592, 1586, 1613, 1674, 1732, 1851, 1938, 2030, 2131, 2207, 1927, 1878, 1807, 1732, 1628, 1548, 1486, 1461, 1440, 1465, 1519, 1601, 1715, 1846, 1943, 2018, 2141, 1863, 1826, 1730, 1633, 1515, 1436, 1369, 1326, 1318, 1337, 1399, 1479, 1598, 1729, 1865, 1962, 2051, 1840, 1751, 1653, 1541, 1426, 1333, 1265, 1217, 1214, 1223, 1281, 1373, 1493, 1641, 1794, 1908, 2015, 1803, 1695, 1587, 1462, 1347, 1245, 1173, 1139, 1122, 1139, 1197, 1288, 1404, 1555, 1712, 1845, 1987, 1781, 1659, 1544, 1402, 1284, 1186, 1117, 1075, 1065, 1088, 1131, 1214, 1342, 1504, 1667, 1808, 1945, 1753, 1639, 1509, 1376, 1253, 1152, 1083, 1045, 1040, 1051, 1094, 1177, 1307, 1464, 1630, 1782, 1939, 1752, 1626, 1510, 1370, 1248, 1141, 1076, 1037, 1024, 1043, 1087, 1163, 1299, 1452, 1631, 1789, 1927, 1761, 1639, 1509, 1384, 1259, 1157, 1088, 1049, 1036, 1061, 1103, 1190, 1321, 1469, 1648, 1806, 1939, 1772, 1673, 1550, 1423, 1304, 1194, 1124, 1088, 1073, 1094, 1143, 1231, 1353, 1508, 1673, 1816, 1955, 1794, 1709, 1599, 1495, 1373, 1269, 1191, 1149, 1129, 1159, 1210, 1298, 1429, 1571, 1726, 1854, 2010, 1840, 1759, 1679, 1567, 1448, 1358, 1284, 1234, 1228, 1249, 1306, 1392, 1507, 1647, 1794, 1917, 2076, 1929, 1835, 1760, 1670, 1565, 1470, 1388, 1351, 1335, 1362, 1423, 1511, 1609, 1743, 1865, 1983, 2145, 2028, 1898, 1841, 1761, 1670, 1590, 1519, 1483, 1475, 1505, 1563, 1640, 1749, 1862, 1943, 2078, 2218, 2109, 2014, 1944, 1883, 1812, 1745, 1674, 1630, 1635, 1665, 1717, 1801, 1884, 1967, 2064, 2188, 2295, 2157, 2126, 2020, 1952, 1891, 1833, 1781, 1761, 1773, 1803, 1857, 1943, 2005, 2026, 2159, 2268, 2251, ] + +... diff --git a/src/ipa/rkisp1/data/ov4689.yaml b/src/ipa/rkisp1/data/ov4689.yaml new file mode 100644 index 00000000..2068684c --- /dev/null +++ b/src/ipa/rkisp1/data/ov4689.yaml @@ -0,0 +1,13 @@ +# SPDX-License-Identifier: CC0-1.0 +%YAML 1.1 +--- +version: 1 +algorithms: + - Agc: + - Awb: + - BlackLevelCorrection: + R: 66 + Gr: 66 + Gb: 66 + B: 66 +... diff --git a/src/ipa/rkisp1/data/ov5640.yaml b/src/ipa/rkisp1/data/ov5640.yaml index 232d8ae8..897b83cb 100644 --- a/src/ipa/rkisp1/data/ov5640.yaml +++ b/src/ipa/rkisp1/data/ov5640.yaml @@ -1,5 +1,5 @@ # SPDX-License-Identifier: CC0-1.0 -%YAML 1.2 +%YAML 1.1 --- version: 1 algorithms: @@ -10,4 +10,245 @@ algorithms: Gr: 256 Gb: 256 B: 256 + - ColorProcessing: + - GammaSensorLinearization: + x-intervals: [ 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2 ] + y: + red: [ 0, 256, 512, 768, 1024, 1280, 1536, 1792, 2048, 2304, 2560, 2816, 3072, 3328, 3584, 3840, 4095 ] + green: [ 0, 256, 512, 768, 1024, 1280, 1536, 1792, 2048, 2304, 2560, 2816, 3072, 3328, 3584, 3840, 4095 ] + blue: [ 0, 256, 512, 768, 1024, 1280, 1536, 1792, 2048, 2304, 2560, 2816, 3072, 3328, 3584, 3840, 4095 ] + - LensShadingCorrection: + x-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + y-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + sets: + - ct: 3000 + r: [ + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + ] + gr: [ + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + ] + gb: [ + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + ] + b: [ + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, 1024, + ] + - ct: 7000 + r: [ + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + ] + gr: [ + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + ] + gb: [ + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + ] + b: [ + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, 1536, + ] + - DefectPixelClusterCorrection: + fixed-set: false + sets: + # PG, LC, RO, RND, RG + - line-threshold: + green: 8 + red-blue: 8 + line-mad-factor: + green: 4 + red-blue: 4 + pg-factor: + green: 8 + red-blue: 8 + rnd-threshold: + green: 10 + red-blue: 10 + rg-factor: + green: 32 + red-blue: 32 + ro-limits: + green: 1 + red-blue: 1 + rnd-offsets: + green: 2 + red-blue: 2 + # PG, LC, RO + - line-threshold: + green: 24 + red-blue: 32 + line-mad-factor: + green: 16 + red-blue: 24 + pg-factor: + green: 6 + red-blue: 8 + ro-limits: + green: 2 + red-blue: 2 + # PG, LC, RO, RND, RG + - line-threshold: + green: 32 + red-blue: 32 + line-mad-factor: + green: 4 + red-blue: 4 + pg-factor: + green: 10 + red-blue: 10 + rnd-threshold: + green: 6 + red-blue: 8 + rg-factor: + green: 4 + red-blue: 4 + ro-limits: + green: 1 + red-blue: 2 + rnd-offsets: + green: 2 + red-blue: 2 + - Dpf: + DomainFilter: + g: [ 16, 16, 16, 16, 16, 16 ] + rb: [ 16, 16, 16, 16, 16, 16 ] + NoiseLevelFunction: + coeff: [ + 1023, 1023, 1023, 1023, 1023, 1023, 1023, 1023, + 1023, 1023, 1023, 1023, 1023, 1023, 1023, 1023, + 1023 + ] + scale-mode: "linear" + FilterStrength: + r: 64 + g: 64 + b: 64 + - Filter: ... diff --git a/src/ipa/rkisp1/data/ov5695.yaml b/src/ipa/rkisp1/data/ov5695.yaml new file mode 100644 index 00000000..2e39e3a5 --- /dev/null +++ b/src/ipa/rkisp1/data/ov5695.yaml @@ -0,0 +1,41 @@ +# SPDX-License-Identifier: CC0-1.0 +%YAML 1.1 +--- +version: 1 +algorithms: + - Agc: + - Awb: + - LensShadingCorrection: + x-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + y-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + sets: + #2592x1944_A_70 - A + - ct: 2856 + resolution: 2592x1944 + r: [2312, 2874, 2965, 2789, 2603, 2424, 2288, 2176, 2151, 2176, 2240, 2345, 2520, 2736, 2856, 2825, 2272, 2675, 3026, 2925, 2693, 2443, 2247, 2074, 1992, 1947, 1972, 2066, 2211, 2386, 2618, 2847, 2953, 2698, 2927, 3008, 2846, 2541, 2272, 2037, 1867, 1782, 1740, 1762, 1855, 1981, 2198, 2454, 2711, 2963, 2927, 2974, 2920, 2664, 2337, 2061, 1822, 1648, 1550, 1503, 1550, 1648, 1794, 1982, 2257, 2565, 2805, 2880, 2933, 2799, 2472, 2161, 1880, 1631, 1457, 1361, 1328, 1364, 1448, 1602, 1817, 2087, 2390, 2698, 2911, 2947, 2734, 2404, 2061, 1759, 1525, 1340, 1244, 1209, 1240, 1343, 1473, 1701, 1975, 2278, 2641, 2823, 2948, 2680, 2342, 1979, 1667, 1425, 1259, 1159, 1125, 1159, 1238, 1407, 1633, 1914, 2235, 2592, 2866, 2936, 2661, 2276, 1908, 1624, 1368, 1190, 1097, 1058, 1086, 1178, 1341, 1556, 1848, 2175, 2509, 2763, 2873, 2603, 2230, 1868, 1578, 1320, 1157, 1058, 1024, 1053, 1142, 1302, 1521, 1789, 2125, 2471, 2760, 2896, 2661, 2276, 1914, 1591, 1349, 1176, 1083, 1044, 1080, 1166, 1327, 1544, 1814, 2141, 2509, 2763, 2969, 2710, 2342, 1985, 1676, 1431, 1250, 1146, 1105, 1140, 1234, 1392, 1616, 1895, 2235, 2578, 2847, 3060, 2800, 2426, 2076, 1764, 1518, 1335, 1227, 1197, 1227, 1314, 1486, 1696, 1989, 2298, 2641, 2863, 2978, 2853, 2496, 2169, 1880, 1631, 1457, 1345, 1304, 1334, 1429, 1586, 1811, 2064, 2378, 2698, 2867, 3024, 2960, 2664, 2327, 2054, 1811, 1626, 1517, 1490, 1514, 1597, 1763, 1962, 2229, 2538, 2768, 2926, 3032, 3077, 2864, 2554, 2272, 2052, 1861, 1747, 1716, 1742, 1816, 1995, 2190, 2454, 2727, 2920, 2927, 2849, 3155, 3008, 2772, 2490, 2276, 2121, 2006, 1954, 1978, 2066, 2202, 2408, 2648, 2847, 2977, 2797, 2440, 3116, 3132, 2900, 2738, 2509, 2329, 2239, 2194, 2230, 2298, 2436, 2617, 2825, 2965, 2899, 2312, ] + gr: [1557, 1922, 2004, 1947, 1841, 1757, 1689, 1651, 1631, 1647, 1680, 1737, 1835, 1911, 1995, 1941, 1613, 1820, 2038, 1996, 1900, 1779, 1692, 1617, 1565, 1549, 1554, 1594, 1670, 1753, 1875, 1957, 2029, 1848, 2009, 2064, 1956, 1834, 1715, 1601, 1518, 1474, 1446, 1459, 1505, 1582, 1666, 1796, 1935, 2029, 2009, 2013, 2006, 1874, 1731, 1602, 1493, 1409, 1346, 1332, 1348, 1395, 1474, 1576, 1689, 1843, 1944, 2003, 1982, 1931, 1783, 1637, 1496, 1386, 1297, 1238, 1219, 1239, 1284, 1370, 1474, 1601, 1747, 1897, 2000, 1998, 1920, 1755, 1587, 1455, 1325, 1228, 1171, 1159, 1176, 1223, 1311, 1418, 1565, 1707, 1855, 1990, 2007, 1897, 1733, 1574, 1423, 1296, 1183, 1121, 1101, 1132, 1182, 1277, 1396, 1539, 1696, 1866, 1990, 2000, 1870, 1692, 1529, 1377, 1239, 1141, 1077, 1057, 1079, 1141, 1230, 1350, 1493, 1640, 1810, 1961, 1957, 1849, 1669, 1496, 1356, 1212, 1112, 1053, 1024, 1049, 1106, 1203, 1322, 1465, 1615, 1780, 1919, 1969, 1870, 1675, 1515, 1365, 1232, 1128, 1063, 1042, 1068, 1123, 1220, 1345, 1483, 1628, 1788, 1945, 2007, 1917, 1728, 1574, 1420, 1285, 1173, 1115, 1088, 1109, 1170, 1268, 1388, 1532, 1678, 1835, 1999, 2033, 1927, 1760, 1613, 1461, 1334, 1234, 1175, 1145, 1168, 1225, 1311, 1423, 1557, 1726, 1874, 2015, 2000, 1960, 1810, 1641, 1515, 1391, 1292, 1228, 1212, 1232, 1275, 1358, 1462, 1601, 1737, 1883, 1974, 2032, 2006, 1874, 1712, 1594, 1477, 1395, 1329, 1316, 1327, 1375, 1453, 1547, 1671, 1808, 1937, 1994, 2039, 2064, 1971, 1829, 1701, 1608, 1521, 1465, 1441, 1462, 1498, 1571, 1666, 1785, 1921, 2003, 2039, 1886, 2087, 2062, 1926, 1817, 1706, 1637, 1572, 1560, 1572, 1613, 1688, 1774, 1868, 1973, 2029, 1886, 1692, 2020, 2067, 2008, 1897, 1822, 1741, 1704, 1683, 1695, 1727, 1783, 1872, 1977, 2022, 1989, 1639, ] + gb: [1553, 1926, 1992, 1930, 1852, 1746, 1675, 1630, 1611, 1622, 1671, 1726, 1804, 1915, 1992, 1955, 1584, 1852, 2043, 2001, 1879, 1773, 1674, 1602, 1548, 1532, 1541, 1583, 1661, 1752, 1867, 1986, 2034, 1881, 1993, 2060, 1976, 1811, 1697, 1590, 1505, 1459, 1439, 1453, 1496, 1579, 1674, 1795, 1940, 2051, 2034, 2018, 2003, 1866, 1735, 1594, 1478, 1396, 1339, 1326, 1339, 1388, 1463, 1579, 1707, 1842, 1980, 2037, 2014, 1950, 1793, 1641, 1509, 1384, 1291, 1229, 1209, 1231, 1283, 1369, 1481, 1625, 1751, 1901, 2023, 2029, 1925, 1750, 1602, 1458, 1330, 1228, 1162, 1144, 1166, 1218, 1308, 1433, 1572, 1730, 1872, 2029, 2020, 1934, 1752, 1578, 1429, 1288, 1181, 1116, 1102, 1130, 1184, 1278, 1400, 1546, 1700, 1870, 2020, 2030, 1899, 1706, 1536, 1388, 1239, 1137, 1074, 1053, 1078, 1134, 1235, 1358, 1509, 1661, 1838, 1989, 1985, 1853, 1682, 1522, 1356, 1209, 1114, 1050, 1024, 1046, 1106, 1206, 1335, 1478, 1623, 1801, 1954, 2005, 1887, 1706, 1536, 1383, 1235, 1131, 1063, 1045, 1059, 1120, 1225, 1356, 1493, 1666, 1815, 1981, 2063, 1948, 1767, 1589, 1438, 1293, 1183, 1116, 1093, 1115, 1174, 1272, 1400, 1546, 1695, 1877, 2012, 2055, 1952, 1795, 1633, 1476, 1347, 1235, 1167, 1146, 1160, 1230, 1323, 1435, 1579, 1730, 1898, 2046, 2059, 1972, 1843, 1666, 1519, 1402, 1291, 1231, 1209, 1233, 1283, 1366, 1481, 1613, 1767, 1922, 2023, 2066, 2036, 1903, 1740, 1609, 1484, 1399, 1337, 1317, 1330, 1378, 1451, 1572, 1689, 1830, 1964, 2037, 2034, 2097, 2005, 1856, 1724, 1608, 1521, 1471, 1450, 1456, 1505, 1593, 1688, 1805, 1940, 2051, 2045, 1974, 2123, 2067, 1958, 1827, 1719, 1633, 1580, 1563, 1576, 1609, 1688, 1783, 1892, 2009, 2053, 1911, 1652, 2078, 2101, 2021, 1915, 1837, 1731, 1682, 1661, 1686, 1717, 1782, 1864, 1982, 2036, 2005, 1669, ] + b: [1439, 1756, 1796, 1808, 1716, 1631, 1568, 1537, 1530, 1546, 1578, 1608, 1676, 1744, 1796, 1756, 1456, 1685, 1858, 1830, 1764, 1687, 1603, 1529, 1486, 1489, 1486, 1493, 1552, 1628, 1721, 1812, 1858, 1727, 1837, 1888, 1825, 1726, 1628, 1548, 1478, 1449, 1423, 1434, 1462, 1521, 1566, 1688, 1809, 1888, 1837, 1889, 1857, 1775, 1680, 1576, 1467, 1403, 1336, 1309, 1329, 1369, 1429, 1529, 1623, 1733, 1822, 1868, 1852, 1828, 1704, 1585, 1486, 1377, 1285, 1237, 1216, 1232, 1268, 1344, 1438, 1536, 1667, 1764, 1813, 1853, 1815, 1675, 1576, 1436, 1333, 1226, 1158, 1145, 1158, 1216, 1298, 1407, 1503, 1640, 1754, 1816, 1908, 1800, 1691, 1536, 1422, 1296, 1188, 1114, 1095, 1114, 1174, 1268, 1388, 1485, 1623, 1742, 1851, 1865, 1783, 1646, 1513, 1378, 1236, 1124, 1071, 1050, 1074, 1132, 1211, 1333, 1463, 1603, 1713, 1829, 1822, 1736, 1621, 1486, 1358, 1211, 1109, 1040, 1024, 1037, 1101, 1197, 1314, 1423, 1559, 1683, 1788, 1829, 1769, 1635, 1513, 1371, 1231, 1128, 1057, 1033, 1057, 1112, 1202, 1327, 1455, 1572, 1700, 1794, 1870, 1831, 1679, 1554, 1430, 1290, 1170, 1103, 1091, 1107, 1165, 1263, 1374, 1501, 1623, 1742, 1833, 1911, 1863, 1724, 1586, 1459, 1352, 1236, 1171, 1153, 1171, 1221, 1315, 1414, 1520, 1663, 1799, 1872, 1913, 1861, 1730, 1626, 1511, 1397, 1296, 1242, 1221, 1227, 1279, 1350, 1446, 1555, 1691, 1779, 1852, 1934, 1893, 1804, 1703, 1576, 1475, 1396, 1329, 1309, 1336, 1363, 1437, 1538, 1634, 1747, 1839, 1868, 1955, 1991, 1910, 1808, 1696, 1596, 1537, 1472, 1445, 1457, 1494, 1539, 1617, 1739, 1825, 1928, 1860, 1818, 2015, 1981, 1906, 1778, 1680, 1627, 1585, 1551, 1566, 1596, 1646, 1725, 1824, 1902, 1945, 1794, 1571, 1937, 1977, 1932, 1866, 1784, 1714, 1674, 1642, 1662, 1678, 1730, 1788, 1859, 1913, 1912, 1592, ] + #2592x1944_D65_70 - D65 + - ct: 6504 + resolution: 2592x1944 + r: [2457, 2985, 2981, 2763, 2587, 2383, 2222, 2123, 2089, 2123, 2167, 2270, 2466, 2638, 2823, 2805, 2457, 2770, 3097, 2893, 2640, 2410, 2169, 2039, 1933, 1908, 1914, 1973, 2117, 2295, 2514, 2728, 2953, 2735, 3009, 2991, 2771, 2467, 2201, 1985, 1825, 1726, 1679, 1703, 1791, 1924, 2085, 2345, 2583, 2806, 2898, 3015, 2906, 2586, 2267, 2005, 1790, 1629, 1527, 1488, 1505, 1597, 1734, 1923, 2169, 2447, 2714, 2876, 2953, 2756, 2435, 2120, 1832, 1617, 1462, 1359, 1326, 1351, 1423, 1573, 1774, 2014, 2285, 2612, 2857, 2963, 2676, 2324, 2016, 1735, 1499, 1334, 1234, 1201, 1227, 1313, 1452, 1649, 1893, 2177, 2503, 2754, 2883, 2582, 2252, 1912, 1634, 1401, 1236, 1144, 1106, 1135, 1215, 1365, 1570, 1804, 2091, 2443, 2715, 2839, 2555, 2196, 1860, 1576, 1346, 1180, 1084, 1046, 1077, 1161, 1305, 1501, 1767, 2056, 2384, 2678, 2797, 2546, 2165, 1832, 1546, 1314, 1150, 1060, 1024, 1046, 1133, 1275, 1474, 1726, 2030, 2378, 2667, 2811, 2555, 2169, 1843, 1564, 1321, 1161, 1069, 1032, 1057, 1146, 1289, 1496, 1751, 2021, 2350, 2653, 2883, 2603, 2195, 1884, 1614, 1388, 1219, 1116, 1077, 1107, 1196, 1335, 1529, 1787, 2079, 2406, 2689, 2900, 2630, 2293, 1963, 1677, 1462, 1294, 1194, 1157, 1181, 1274, 1403, 1622, 1847, 2163, 2464, 2727, 2920, 2731, 2400, 2071, 1798, 1567, 1404, 1301, 1264, 1293, 1376, 1514, 1711, 1949, 2224, 2568, 2767, 3015, 2820, 2545, 2196, 1933, 1719, 1554, 1452, 1422, 1442, 1525, 1661, 1847, 2078, 2358, 2639, 2780, 2971, 2927, 2674, 2396, 2110, 1904, 1767, 1654, 1611, 1627, 1720, 1848, 2026, 2250, 2540, 2722, 2863, 2842, 3023, 2864, 2576, 2311, 2105, 1952, 1857, 1808, 1830, 1912, 2033, 2205, 2417, 2652, 2822, 2667, 2489, 3024, 2981, 2737, 2546, 2317, 2180, 2086, 2041, 2050, 2140, 2255, 2391, 2615, 2735, 2840, 2366, ] + gr: [1766, 2092, 2109, 2006, 1875, 1775, 1707, 1659, 1633, 1646, 1679, 1754, 1844, 1954, 2045, 2041, 1740, 1981, 2142, 2048, 1911, 1779, 1678, 1597, 1549, 1529, 1539, 1570, 1630, 1728, 1848, 1970, 2064, 1971, 2109, 2107, 1982, 1820, 1673, 1563, 1494, 1442, 1423, 1433, 1472, 1538, 1630, 1751, 1899, 2019, 2058, 2121, 2066, 1892, 1719, 1584, 1472, 1386, 1331, 1311, 1326, 1370, 1441, 1533, 1673, 1820, 1956, 2062, 2080, 1982, 1807, 1636, 1493, 1379, 1293, 1236, 1213, 1230, 1280, 1353, 1458, 1580, 1729, 1885, 2017, 2074, 1934, 1756, 1584, 1435, 1318, 1220, 1163, 1142, 1154, 1207, 1280, 1393, 1522, 1666, 1844, 1990, 2041, 1886, 1711, 1535, 1392, 1269, 1165, 1106, 1086, 1103, 1151, 1240, 1356, 1479, 1635, 1802, 1969, 2006, 1856, 1673, 1506, 1359, 1220, 1131, 1067, 1041, 1056, 1113, 1201, 1312, 1446, 1594, 1771, 1937, 2000, 1841, 1654, 1489, 1334, 1201, 1105, 1046, 1024, 1038, 1096, 1183, 1299, 1428, 1577, 1746, 1925, 2006, 1850, 1656, 1490, 1339, 1210, 1112, 1054, 1028, 1044, 1098, 1188, 1296, 1431, 1574, 1754, 1923, 2033, 1868, 1692, 1518, 1366, 1242, 1143, 1085, 1060, 1074, 1133, 1214, 1329, 1460, 1602, 1780, 1938, 2040, 1900, 1722, 1547, 1409, 1291, 1192, 1131, 1107, 1125, 1174, 1258, 1363, 1488, 1644, 1813, 1958, 2052, 1939, 1770, 1592, 1461, 1346, 1254, 1192, 1174, 1186, 1236, 1312, 1410, 1535, 1690, 1846, 1975, 2071, 1986, 1843, 1664, 1533, 1424, 1338, 1280, 1256, 1269, 1309, 1387, 1475, 1596, 1753, 1898, 2006, 2058, 2045, 1906, 1756, 1622, 1517, 1432, 1380, 1363, 1372, 1412, 1480, 1566, 1691, 1835, 1955, 2008, 1971, 2083, 2008, 1842, 1718, 1606, 1530, 1488, 1463, 1468, 1506, 1574, 1675, 1772, 1904, 1992, 1922, 1748, 2103, 2063, 1961, 1838, 1724, 1648, 1600, 1596, 1592, 1627, 1690, 1780, 1890, 1969, 1992, 1713, ] + gb: [1749, 2093, 2072, 1983, 1869, 1765, 1684, 1638, 1621, 1629, 1666, 1734, 1838, 1925, 2019, 2021, 1722, 1981, 2142, 2048, 1904, 1774, 1660, 1582, 1535, 1512, 1528, 1563, 1626, 1728, 1854, 1970, 2064, 1961, 2088, 2107, 1975, 1809, 1668, 1556, 1481, 1424, 1406, 1421, 1456, 1528, 1626, 1761, 1886, 2028, 2068, 2111, 2049, 1873, 1715, 1569, 1465, 1376, 1323, 1300, 1321, 1363, 1432, 1536, 1660, 1808, 1956, 2062, 2089, 1975, 1797, 1632, 1493, 1374, 1284, 1228, 1205, 1226, 1273, 1351, 1449, 1577, 1729, 1898, 2035, 2083, 1934, 1751, 1584, 1441, 1307, 1214, 1156, 1134, 1153, 1203, 1280, 1393, 1526, 1675, 1844, 1998, 2049, 1905, 1702, 1535, 1390, 1265, 1160, 1103, 1078, 1100, 1150, 1238, 1351, 1485, 1631, 1814, 1984, 2014, 1868, 1678, 1506, 1356, 1218, 1123, 1065, 1039, 1055, 1112, 1201, 1317, 1446, 1602, 1782, 1952, 2008, 1853, 1658, 1496, 1344, 1203, 1110, 1046, 1024, 1037, 1091, 1179, 1292, 1428, 1588, 1757, 1947, 2030, 1856, 1660, 1493, 1346, 1212, 1116, 1049, 1024, 1040, 1093, 1190, 1303, 1440, 1590, 1760, 1937, 2041, 1886, 1688, 1522, 1376, 1240, 1146, 1083, 1057, 1074, 1131, 1218, 1331, 1466, 1614, 1785, 1953, 2066, 1920, 1737, 1558, 1415, 1289, 1186, 1130, 1110, 1123, 1172, 1254, 1368, 1492, 1644, 1814, 1974, 2080, 1953, 1775, 1612, 1461, 1343, 1254, 1194, 1174, 1186, 1236, 1309, 1413, 1528, 1695, 1852, 1983, 2081, 2009, 1837, 1678, 1543, 1424, 1338, 1278, 1254, 1273, 1306, 1390, 1485, 1604, 1758, 1905, 2016, 2078, 2062, 1926, 1777, 1626, 1517, 1441, 1388, 1363, 1367, 1412, 1487, 1574, 1686, 1835, 1962, 2018, 1981, 2112, 2016, 1848, 1733, 1614, 1541, 1488, 1469, 1468, 1520, 1570, 1666, 1789, 1911, 1992, 1913, 1776, 2082, 2072, 1968, 1856, 1739, 1657, 1600, 1577, 1592, 1627, 1695, 1786, 1883, 1977, 2002, 1722, ] + b: [1681, 1945, 1998, 1882, 1777, 1699, 1617, 1588, 1571, 1554, 1581, 1644, 1729, 1797, 1905, 1919, 1646, 1868, 2012, 1964, 1828, 1711, 1617, 1535, 1492, 1479, 1478, 1509, 1559, 1636, 1737, 1860, 1925, 1830, 1961, 2001, 1890, 1754, 1638, 1529, 1463, 1407, 1389, 1407, 1432, 1485, 1574, 1668, 1790, 1898, 1922, 1995, 1962, 1813, 1680, 1557, 1453, 1378, 1319, 1297, 1302, 1348, 1418, 1505, 1605, 1726, 1868, 1944, 2004, 1901, 1765, 1611, 1482, 1375, 1287, 1230, 1207, 1224, 1259, 1338, 1420, 1528, 1664, 1807, 1921, 1969, 1858, 1708, 1557, 1434, 1317, 1217, 1161, 1142, 1156, 1206, 1275, 1369, 1481, 1598, 1764, 1880, 1973, 1821, 1664, 1516, 1392, 1270, 1165, 1106, 1085, 1095, 1152, 1231, 1336, 1445, 1567, 1725, 1856, 1947, 1804, 1647, 1495, 1359, 1230, 1136, 1067, 1043, 1060, 1115, 1197, 1299, 1419, 1548, 1695, 1834, 1924, 1787, 1623, 1478, 1346, 1212, 1114, 1052, 1024, 1044, 1094, 1172, 1287, 1408, 1532, 1681, 1853, 1925, 1804, 1641, 1481, 1351, 1225, 1124, 1056, 1032, 1046, 1099, 1181, 1296, 1410, 1531, 1688, 1806, 1951, 1821, 1664, 1516, 1377, 1255, 1150, 1089, 1066, 1082, 1128, 1214, 1315, 1432, 1562, 1709, 1856, 1957, 1840, 1688, 1546, 1413, 1297, 1190, 1139, 1116, 1130, 1179, 1259, 1347, 1462, 1592, 1740, 1859, 1968, 1881, 1728, 1588, 1460, 1345, 1265, 1199, 1180, 1191, 1241, 1307, 1391, 1498, 1644, 1773, 1876, 2008, 1940, 1789, 1654, 1531, 1427, 1341, 1286, 1265, 1273, 1316, 1370, 1471, 1569, 1696, 1830, 1896, 2002, 1977, 1871, 1732, 1620, 1519, 1432, 1387, 1362, 1364, 1402, 1466, 1535, 1654, 1782, 1877, 1896, 1895, 2025, 1975, 1828, 1704, 1599, 1540, 1478, 1456, 1459, 1499, 1548, 1636, 1737, 1841, 1925, 1830, 1705, 2013, 2036, 1912, 1785, 1720, 1636, 1588, 1565, 1576, 1599, 1664, 1722, 1815, 1905, 1945, 1681, ] + #2592x1944_F2_CWF_70 - F2_CWF + - ct: 4230 + resolution: 2592x1944 + r: [2512, 2860, 2753, 2554, 2376, 2198, 2033, 1949, 1924, 1921, 2012, 2100, 2257, 2461, 2682, 2775, 2436, 2753, 2915, 2713, 2415, 2193, 2004, 1869, 1790, 1755, 1774, 1844, 1945, 2108, 2306, 2547, 2755, 2697, 2849, 2810, 2526, 2247, 2018, 1821, 1692, 1608, 1577, 1591, 1653, 1775, 1921, 2132, 2371, 2625, 2765, 2881, 2679, 2376, 2077, 1853, 1677, 1542, 1449, 1412, 1430, 1511, 1615, 1781, 1983, 2258, 2517, 2722, 2832, 2589, 2237, 1977, 1718, 1527, 1403, 1319, 1290, 1307, 1370, 1491, 1658, 1850, 2112, 2408, 2708, 2718, 2474, 2154, 1861, 1616, 1439, 1293, 1211, 1176, 1205, 1275, 1390, 1553, 1773, 2008, 2313, 2607, 2661, 2388, 2066, 1781, 1535, 1359, 1207, 1130, 1098, 1117, 1192, 1313, 1474, 1688, 1934, 2240, 2537, 2672, 2353, 2024, 1733, 1494, 1296, 1162, 1075, 1045, 1064, 1146, 1261, 1422, 1640, 1889, 2197, 2528, 2599, 2332, 1991, 1718, 1484, 1276, 1139, 1051, 1024, 1051, 1117, 1245, 1409, 1620, 1861, 2179, 2481, 2651, 2338, 2004, 1719, 1479, 1289, 1146, 1066, 1034, 1055, 1127, 1248, 1413, 1633, 1872, 2184, 2471, 2640, 2372, 2045, 1751, 1514, 1324, 1189, 1107, 1064, 1097, 1163, 1280, 1455, 1661, 1915, 2226, 2498, 2672, 2457, 2107, 1820, 1587, 1390, 1248, 1170, 1132, 1155, 1235, 1353, 1510, 1729, 1967, 2268, 2544, 2781, 2532, 2198, 1920, 1678, 1486, 1349, 1251, 1225, 1251, 1326, 1438, 1602, 1800, 2043, 2343, 2616, 2826, 2637, 2330, 2024, 1796, 1609, 1480, 1391, 1365, 1370, 1442, 1556, 1714, 1915, 2190, 2461, 2673, 2820, 2738, 2472, 2182, 1949, 1760, 1640, 1545, 1517, 1524, 1591, 1716, 1867, 2073, 2308, 2561, 2686, 2782, 2806, 2648, 2352, 2132, 1926, 1819, 1716, 1678, 1702, 1757, 1872, 2029, 2234, 2434, 2611, 2617, 2538, 2919, 2777, 2554, 2345, 2148, 2012, 1940, 1896, 1930, 1961, 2065, 2243, 2426, 2592, 2669, 2461, ] + gr: [2065, 2350, 2320, 2148, 2002, 1877, 1794, 1730, 1709, 1712, 1754, 1837, 1948, 2082, 2217, 2291, 2054, 2263, 2359, 2204, 2022, 1860, 1735, 1639, 1583, 1560, 1576, 1619, 1694, 1805, 1967, 2126, 2281, 2228, 2353, 2294, 2112, 1897, 1724, 1615, 1525, 1460, 1441, 1448, 1499, 1581, 1684, 1829, 2000, 2187, 2305, 2354, 2194, 1994, 1785, 1626, 1493, 1406, 1349, 1323, 1342, 1384, 1468, 1576, 1722, 1909, 2100, 2265, 2281, 2126, 1894, 1708, 1539, 1409, 1310, 1253, 1225, 1240, 1291, 1377, 1486, 1639, 1821, 2019, 2220, 2257, 2059, 1819, 1622, 1464, 1337, 1233, 1168, 1144, 1161, 1219, 1302, 1420, 1576, 1733, 1934, 2180, 2189, 1991, 1759, 1578, 1407, 1280, 1164, 1107, 1085, 1100, 1157, 1242, 1359, 1514, 1685, 1894, 2110, 2153, 1954, 1726, 1537, 1365, 1229, 1129, 1066, 1039, 1057, 1114, 1202, 1327, 1471, 1638, 1850, 2094, 2153, 1948, 1718, 1522, 1352, 1217, 1114, 1047, 1024, 1038, 1100, 1187, 1310, 1467, 1627, 1851, 2078, 2162, 1947, 1716, 1527, 1367, 1225, 1125, 1054, 1031, 1045, 1106, 1198, 1320, 1465, 1638, 1861, 2094, 2180, 1964, 1731, 1545, 1383, 1252, 1145, 1085, 1057, 1070, 1131, 1223, 1341, 1488, 1658, 1852, 2077, 2199, 2002, 1787, 1584, 1429, 1297, 1194, 1131, 1109, 1124, 1181, 1266, 1384, 1523, 1695, 1908, 2118, 2260, 2071, 1843, 1651, 1502, 1364, 1265, 1203, 1181, 1197, 1244, 1331, 1451, 1579, 1763, 1969, 2153, 2276, 2150, 1922, 1736, 1573, 1453, 1355, 1296, 1275, 1285, 1335, 1417, 1526, 1663, 1849, 2052, 2203, 2294, 2205, 2029, 1834, 1666, 1548, 1461, 1399, 1372, 1390, 1431, 1513, 1620, 1760, 1931, 2115, 2237, 2228, 2271, 2126, 1934, 1784, 1650, 1577, 1512, 1485, 1506, 1547, 1625, 1729, 1872, 2029, 2189, 2160, 2033, 2326, 2227, 2106, 1935, 1815, 1721, 1671, 1627, 1654, 1688, 1768, 1885, 2021, 2160, 2245, 2022, ] + gb: [2062, 2335, 2286, 2148, 1975, 1850, 1776, 1709, 1688, 1709, 1761, 1822, 1943, 2082, 2226, 2300, 2062, 2272, 2345, 2186, 2016, 1856, 1728, 1637, 1579, 1556, 1564, 1610, 1691, 1807, 1961, 2126, 2280, 2237, 2338, 2293, 2081, 1893, 1731, 1594, 1501, 1444, 1424, 1441, 1485, 1572, 1677, 1830, 2022, 2195, 2303, 2352, 2212, 1988, 1782, 1625, 1499, 1400, 1342, 1318, 1335, 1379, 1468, 1579, 1728, 1898, 2116, 2274, 2311, 2127, 1896, 1701, 1538, 1404, 1308, 1249, 1218, 1243, 1290, 1382, 1491, 1641, 1828, 2041, 2249, 2256, 2060, 1820, 1637, 1476, 1335, 1234, 1166, 1147, 1159, 1220, 1302, 1428, 1586, 1754, 1968, 2198, 2225, 2013, 1781, 1584, 1421, 1281, 1166, 1101, 1082, 1105, 1158, 1246, 1372, 1524, 1696, 1914, 2144, 2179, 1961, 1742, 1546, 1378, 1232, 1136, 1064, 1042, 1061, 1118, 1208, 1335, 1489, 1661, 1875, 2110, 2179, 1962, 1734, 1538, 1367, 1224, 1117, 1051, 1024, 1046, 1106, 1195, 1322, 1479, 1658, 1876, 2094, 2179, 1988, 1742, 1543, 1375, 1232, 1128, 1060, 1030, 1050, 1110, 1208, 1330, 1486, 1652, 1881, 2127, 2197, 2006, 1761, 1562, 1396, 1255, 1152, 1086, 1063, 1077, 1137, 1232, 1354, 1504, 1682, 1902, 2135, 2236, 2031, 1810, 1605, 1449, 1311, 1200, 1137, 1110, 1130, 1185, 1275, 1389, 1539, 1720, 1922, 2161, 2290, 2103, 1873, 1675, 1504, 1379, 1276, 1211, 1184, 1202, 1251, 1339, 1460, 1593, 1785, 1983, 2180, 2329, 2176, 1961, 1752, 1598, 1471, 1366, 1308, 1279, 1292, 1348, 1432, 1535, 1682, 1874, 2068, 2222, 2338, 2253, 2059, 1852, 1686, 1565, 1473, 1410, 1385, 1393, 1445, 1522, 1639, 1782, 1959, 2132, 2257, 2272, 2312, 2160, 1961, 1802, 1674, 1587, 1525, 1497, 1508, 1557, 1644, 1741, 1897, 2045, 2197, 2202, 2095, 2335, 2276, 2098, 1969, 1828, 1732, 1669, 1641, 1656, 1699, 1785, 1886, 2036, 2188, 2254, 2030, ] + b: [1957, 2184, 2113, 2000, 1876, 1757, 1686, 1620, 1614, 1596, 1649, 1687, 1805, 1914, 2027, 2082, 1880, 2101, 2170, 2056, 1894, 1763, 1659, 1571, 1527, 1501, 1506, 1541, 1608, 1694, 1809, 1964, 2094, 2040, 2156, 2121, 1964, 1796, 1654, 1563, 1485, 1419, 1399, 1407, 1447, 1499, 1587, 1724, 1859, 2019, 2076, 2184, 2063, 1888, 1705, 1586, 1470, 1383, 1330, 1299, 1315, 1352, 1421, 1513, 1633, 1794, 1956, 2125, 2153, 2012, 1821, 1660, 1511, 1395, 1302, 1241, 1219, 1232, 1275, 1352, 1453, 1570, 1726, 1914, 2080, 2106, 1953, 1751, 1601, 1462, 1333, 1235, 1171, 1142, 1156, 1207, 1285, 1403, 1520, 1656, 1838, 2038, 2081, 1885, 1704, 1553, 1398, 1266, 1166, 1101, 1079, 1097, 1151, 1240, 1340, 1471, 1616, 1780, 1970, 2041, 1882, 1686, 1513, 1364, 1235, 1125, 1065, 1037, 1054, 1108, 1196, 1299, 1429, 1576, 1756, 1935, 2049, 1853, 1665, 1504, 1363, 1227, 1118, 1049, 1024, 1035, 1099, 1188, 1298, 1434, 1582, 1752, 1929, 2073, 1870, 1677, 1520, 1364, 1240, 1131, 1057, 1037, 1048, 1102, 1188, 1308, 1442, 1600, 1756, 1921, 2048, 1885, 1695, 1525, 1387, 1248, 1148, 1085, 1064, 1076, 1131, 1215, 1325, 1458, 1591, 1780, 1926, 2089, 1926, 1731, 1563, 1432, 1304, 1191, 1132, 1112, 1129, 1172, 1258, 1359, 1492, 1647, 1814, 1975, 2115, 1983, 1799, 1626, 1491, 1368, 1270, 1212, 1188, 1204, 1249, 1322, 1416, 1548, 1697, 1874, 2045, 2164, 2047, 1888, 1705, 1571, 1451, 1357, 1296, 1276, 1291, 1336, 1404, 1499, 1616, 1772, 1956, 2069, 2177, 2139, 1964, 1785, 1654, 1549, 1459, 1402, 1376, 1385, 1423, 1493, 1587, 1704, 1847, 2003, 2057, 2144, 2190, 2056, 1906, 1753, 1642, 1556, 1506, 1488, 1485, 1534, 1592, 1684, 1809, 1935, 2076, 2081, 1997, 2228, 2150, 2030, 1888, 1799, 1704, 1637, 1631, 1629, 1667, 1716, 1816, 1914, 2043, 2122, 1917, ] + #2592x1944_D50_70 - D50 + - ct: 5003 + resolution: 2592x1944 + r: [2445, 2929, 2967, 2734, 2576, 2380, 2211, 2113, 2074, 2072, 2166, 2255, 2383, 2626, 2861, 2812, 2411, 2795, 3067, 2915, 2660, 2369, 2162, 2038, 1940, 1900, 1919, 1978, 2106, 2281, 2519, 2702, 2875, 2718, 2953, 3006, 2761, 2452, 2197, 1964, 1815, 1720, 1676, 1712, 1769, 1899, 2070, 2268, 2581, 2739, 2798, 3022, 2895, 2570, 2275, 2011, 1793, 1619, 1512, 1486, 1506, 1577, 1740, 1898, 2123, 2420, 2659, 2869, 2939, 2776, 2457, 2132, 1863, 1619, 1479, 1366, 1332, 1356, 1435, 1571, 1769, 1978, 2272, 2543, 2736, 2905, 2703, 2360, 2023, 1747, 1516, 1355, 1247, 1214, 1243, 1332, 1457, 1651, 1898, 2194, 2488, 2714, 2945, 2615, 2257, 1937, 1653, 1419, 1242, 1151, 1117, 1138, 1219, 1374, 1575, 1795, 2080, 2417, 2695, 2795, 2558, 2207, 1875, 1586, 1350, 1182, 1089, 1046, 1084, 1158, 1305, 1497, 1736, 2027, 2351, 2624, 2840, 2547, 2201, 1863, 1566, 1323, 1172, 1068, 1024, 1057, 1142, 1288, 1484, 1725, 2010, 2343, 2584, 2857, 2580, 2222, 1875, 1573, 1355, 1182, 1086, 1046, 1072, 1151, 1301, 1509, 1762, 2052, 2371, 2707, 2912, 2615, 2257, 1904, 1631, 1389, 1227, 1129, 1090, 1122, 1197, 1331, 1529, 1777, 2040, 2397, 2639, 2905, 2628, 2290, 1987, 1698, 1457, 1296, 1202, 1154, 1181, 1259, 1398, 1607, 1826, 2119, 2466, 2684, 2939, 2748, 2399, 2078, 1796, 1584, 1424, 1310, 1276, 1297, 1377, 1519, 1708, 1943, 2222, 2543, 2736, 2982, 2863, 2570, 2243, 1964, 1740, 1570, 1470, 1435, 1448, 1537, 1683, 1856, 2094, 2342, 2632, 2798, 3037, 2970, 2681, 2413, 2111, 1920, 1769, 1672, 1616, 1634, 1709, 1847, 2019, 2234, 2488, 2709, 2835, 2836, 3026, 2851, 2611, 2315, 2106, 1932, 1836, 1801, 1807, 1899, 2027, 2199, 2392, 2620, 2805, 2644, 2515, 3013, 2967, 2792, 2553, 2343, 2181, 2046, 2035, 2033, 2108, 2239, 2444, 2575, 2731, 2812, 2411, ] + gr: [1764, 2120, 2133, 2015, 1886, 1783, 1704, 1644, 1626, 1631, 1666, 1739, 1792, 1938, 2020, 2014, 1727, 1988, 2163, 2079, 1945, 1797, 1681, 1595, 1551, 1526, 1533, 1567, 1619, 1707, 1833, 1963, 2052, 1936, 2115, 2119, 1964, 1824, 1676, 1555, 1486, 1428, 1406, 1425, 1447, 1526, 1623, 1720, 1866, 2001, 2030, 2142, 2062, 1902, 1716, 1580, 1465, 1376, 1321, 1301, 1314, 1355, 1428, 1513, 1645, 1791, 1941, 2022, 2104, 1988, 1816, 1663, 1515, 1388, 1294, 1235, 1215, 1225, 1271, 1350, 1449, 1571, 1719, 1880, 2028, 2113, 1963, 1766, 1588, 1445, 1325, 1231, 1168, 1142, 1155, 1213, 1284, 1392, 1517, 1662, 1835, 1980, 2065, 1897, 1712, 1544, 1394, 1268, 1163, 1105, 1080, 1097, 1147, 1225, 1348, 1464, 1603, 1780, 1948, 2044, 1877, 1672, 1512, 1355, 1223, 1127, 1057, 1038, 1052, 1107, 1193, 1312, 1437, 1593, 1741, 1931, 2004, 1873, 1674, 1501, 1350, 1211, 1113, 1048, 1024, 1038, 1095, 1180, 1301, 1424, 1571, 1738, 1895, 2027, 1871, 1681, 1506, 1361, 1227, 1123, 1064, 1035, 1057, 1104, 1189, 1310, 1440, 1573, 1758, 1916, 2048, 1884, 1707, 1526, 1374, 1248, 1154, 1087, 1069, 1073, 1128, 1205, 1317, 1455, 1590, 1757, 1925, 2031, 1907, 1720, 1557, 1406, 1289, 1193, 1129, 1104, 1116, 1170, 1244, 1348, 1478, 1621, 1792, 1947, 2075, 1973, 1777, 1615, 1465, 1355, 1269, 1195, 1176, 1184, 1234, 1302, 1412, 1532, 1669, 1826, 1975, 2100, 2028, 1870, 1687, 1542, 1443, 1352, 1294, 1264, 1278, 1324, 1393, 1492, 1602, 1757, 1911, 2031, 2093, 2054, 1935, 1763, 1631, 1529, 1441, 1393, 1361, 1371, 1419, 1480, 1569, 1690, 1827, 1960, 2020, 1957, 2091, 1979, 1864, 1722, 1619, 1529, 1484, 1458, 1471, 1497, 1557, 1654, 1761, 1918, 2005, 1907, 1783, 2076, 2094, 1938, 1829, 1729, 1657, 1592, 1571, 1572, 1616, 1664, 1769, 1880, 1968, 1994, 1718, ] + gb: [1771, 2117, 2122, 1999, 1887, 1768, 1691, 1633, 1619, 1633, 1668, 1736, 1836, 1923, 2010, 2002, 1734, 2040, 2161, 2070, 1925, 1777, 1678, 1601, 1532, 1528, 1518, 1562, 1625, 1724, 1840, 1956, 2079, 1954, 2091, 2109, 1965, 1826, 1669, 1561, 1472, 1419, 1400, 1422, 1450, 1521, 1608, 1732, 1867, 2001, 2028, 2151, 2053, 1877, 1718, 1579, 1465, 1379, 1319, 1296, 1309, 1350, 1428, 1530, 1647, 1792, 1934, 2030, 2112, 2003, 1824, 1656, 1511, 1388, 1296, 1240, 1206, 1228, 1271, 1347, 1458, 1577, 1725, 1894, 2018, 2112, 1978, 1778, 1602, 1451, 1325, 1231, 1165, 1141, 1154, 1207, 1292, 1397, 1530, 1687, 1849, 2030, 2056, 1911, 1723, 1554, 1396, 1271, 1165, 1103, 1077, 1100, 1148, 1236, 1343, 1477, 1626, 1798, 1972, 2027, 1885, 1692, 1522, 1358, 1225, 1126, 1068, 1038, 1055, 1105, 1194, 1313, 1443, 1583, 1771, 1931, 2037, 1868, 1690, 1514, 1355, 1216, 1116, 1053, 1024, 1046, 1096, 1191, 1306, 1433, 1586, 1762, 1925, 2061, 1891, 1688, 1522, 1363, 1236, 1128, 1067, 1037, 1059, 1110, 1196, 1318, 1439, 1596, 1765, 1977, 2056, 1898, 1709, 1535, 1391, 1264, 1157, 1089, 1069, 1076, 1131, 1216, 1335, 1467, 1596, 1775, 1948, 2048, 1929, 1737, 1567, 1427, 1294, 1198, 1130, 1106, 1120, 1168, 1260, 1353, 1491, 1641, 1811, 1963, 2112, 1988, 1795, 1626, 1484, 1374, 1274, 1198, 1174, 1190, 1237, 1317, 1427, 1538, 1695, 1840, 2000, 2140, 2045, 1877, 1708, 1567, 1443, 1360, 1304, 1267, 1288, 1337, 1398, 1491, 1621, 1781, 1919, 2039, 2112, 2109, 1936, 1792, 1633, 1539, 1450, 1396, 1377, 1376, 1422, 1496, 1579, 1697, 1835, 1976, 2028, 2029, 2089, 2028, 1884, 1734, 1638, 1543, 1490, 1460, 1466, 1514, 1579, 1670, 1774, 1910, 2013, 1904, 1790, 2117, 2065, 1961, 1854, 1752, 1672, 1616, 1590, 1599, 1623, 1700, 1782, 1867, 1984, 2022, 1698, ] + b: [1676, 1930, 1956, 1924, 1811, 1685, 1640, 1571, 1556, 1544, 1569, 1639, 1710, 1802, 1890, 1881, 1642, 1930, 2013, 1952, 1827, 1711, 1616, 1538, 1488, 1472, 1470, 1494, 1560, 1632, 1724, 1825, 1906, 1803, 1985, 2007, 1894, 1759, 1625, 1524, 1440, 1401, 1380, 1385, 1411, 1463, 1537, 1649, 1765, 1876, 1884, 1996, 1961, 1831, 1676, 1555, 1444, 1367, 1301, 1282, 1295, 1328, 1383, 1468, 1580, 1708, 1833, 1900, 2020, 1914, 1777, 1618, 1508, 1382, 1284, 1227, 1197, 1216, 1251, 1325, 1408, 1511, 1639, 1796, 1915, 1998, 1901, 1716, 1581, 1447, 1327, 1226, 1169, 1134, 1155, 1199, 1269, 1368, 1486, 1608, 1741, 1879, 1959, 1838, 1674, 1531, 1387, 1269, 1158, 1094, 1072, 1082, 1132, 1217, 1323, 1431, 1568, 1706, 1847, 1956, 1806, 1645, 1497, 1352, 1222, 1124, 1059, 1031, 1049, 1093, 1177, 1292, 1398, 1528, 1686, 1800, 1945, 1806, 1634, 1494, 1357, 1211, 1110, 1049, 1024, 1034, 1080, 1174, 1277, 1388, 1519, 1673, 1809, 1989, 1822, 1664, 1497, 1366, 1239, 1115, 1065, 1033, 1049, 1095, 1183, 1295, 1406, 1544, 1679, 1855, 1981, 1838, 1674, 1512, 1384, 1260, 1151, 1086, 1062, 1069, 1121, 1198, 1303, 1423, 1540, 1691, 1847, 1964, 1856, 1683, 1550, 1422, 1294, 1189, 1122, 1103, 1113, 1164, 1237, 1332, 1446, 1574, 1741, 1859, 2008, 1885, 1755, 1606, 1471, 1371, 1263, 1197, 1169, 1182, 1228, 1298, 1392, 1501, 1620, 1763, 1883, 2034, 1950, 1823, 1676, 1540, 1439, 1353, 1298, 1269, 1276, 1325, 1383, 1468, 1575, 1700, 1833, 1923, 2012, 1995, 1894, 1744, 1625, 1519, 1440, 1389, 1361, 1370, 1403, 1467, 1558, 1642, 1773, 1876, 1908, 1903, 2038, 1942, 1844, 1704, 1599, 1528, 1484, 1445, 1457, 1494, 1544, 1602, 1724, 1843, 1906, 1827, 1724, 2051, 2027, 1914, 1827, 1698, 1640, 1577, 1566, 1588, 1604, 1633, 1717, 1811, 1901, 1930, 1665, ] + +... diff --git a/src/ipa/rkisp1/data/ov8858.yaml b/src/ipa/rkisp1/data/ov8858.yaml new file mode 100644 index 00000000..f297b0e0 --- /dev/null +++ b/src/ipa/rkisp1/data/ov8858.yaml @@ -0,0 +1,54 @@ +# SPDX-License-Identifier: CC0-1.0 +%YAML 1.1 +--- +version: 1 +algorithms: + - Agc: + - Awb: + - LensShadingCorrection: + x-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + y-size: [ 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625, 0.0625 ] + sets: + #3264x2448_A_70 - A + - ct: 2856 + resolution: 3264x2448 + r: [4095, 3932, 3584, 3324, 3113, 2934, 2747, 2619, 2566, 2579, 2671, 2816, 3009, 3217, 3444, 3843, 4095, 4095, 3658, 3343, 3088, 2867, 2620, 2404, 2271, 2207, 2229, 2315, 2485, 2727, 2965, 3232, 3500, 4057, 3926, 3482, 3187, 2914, 2612, 2330, 2112, 1976, 1917, 1931, 2028, 2198, 2456, 2762, 3042, 3335, 3770, 3739, 3331, 3029, 2720, 2364, 2070, 1852, 1718, 1655, 1669, 1765, 1940, 2207, 2538, 2878, 3183, 3565, 3590, 3209, 2910, 2524, 2156, 1860, 1642, 1493, 1431, 1446, 1551, 1734, 1986, 2338, 2721, 3075, 3405, 3484, 3116, 2778, 2373, 1997, 1698, 1466, 1315, 1254, 1272, 1374, 1562, 1825, 2169, 2587, 2946, 3317, 3415, 3044, 2682, 2252, 1873, 1574, 1336, 1192, 1126, 1146, 1249, 1437, 1712, 2050, 2462, 2877, 3238, 3355, 3002, 2619, 2171, 1800, 1490, 1259, 1112, 1051, 1073, 1173, 1359, 1635, 1977, 2388, 2813, 3182, 3348, 2969, 2587, 2138, 1768, 1457, 1228, 1085, 1024, 1043, 1144, 1326, 1603, 1950, 2364, 2783, 3170, 3344, 2984, 2594, 2152, 1776, 1468, 1239, 1098, 1041, 1061, 1161, 1342, 1617, 1962, 2373, 2798, 3177, 3388, 3011, 2637, 2207, 1829, 1528, 1298, 1158, 1100, 1120, 1217, 1408, 1677, 2018, 2429, 2841, 3192, 3442, 3064, 2718, 2301, 1929, 1633, 1405, 1263, 1205, 1224, 1326, 1513, 1777, 2119, 2525, 2903, 3274, 3557, 3138, 2822, 2435, 2066, 1775, 1558, 1414, 1355, 1378, 1478, 1663, 1927, 2255, 2657, 2987, 3369, 3682, 3256, 2940, 2604, 2252, 1958, 1748, 1609, 1557, 1576, 1677, 1857, 2106, 2445, 2793, 3096, 3526, 3874, 3380, 3075, 2783, 2472, 2189, 1974, 1846, 1790, 1811, 1909, 2086, 2342, 2643, 2934, 3247, 3743, 4095, 3583, 3218, 2950, 2708, 2456, 2257, 2114, 2064, 2083, 2185, 2364, 2598, 2856, 3111, 3444, 4045, 4095, 3842, 3474, 3155, 2950, 2731, 2575, 2440, 2388, 2413, 2499, 2659, 2846, 3056, 3334, 3796, 4095, ] + gr: [3246, 2753, 2547, 2359, 2249, 2148, 2052, 1977, 1938, 1947, 1995, 2082, 2183, 2277, 2411, 2655, 2957, 2906, 2568, 2361, 2223, 2092, 1964, 1850, 1767, 1735, 1740, 1790, 1881, 2002, 2124, 2265, 2437, 2751, 2740, 2449, 2261, 2106, 1950, 1798, 1681, 1604, 1570, 1577, 1626, 1714, 1846, 2012, 2149, 2322, 2581, 2628, 2348, 2169, 2000, 1808, 1654, 1539, 1460, 1419, 1429, 1483, 1576, 1710, 1881, 2062, 2231, 2443, 2541, 2279, 2102, 1891, 1687, 1536, 1420, 1330, 1289, 1298, 1362, 1459, 1589, 1773, 1967, 2168, 2352, 2459, 2226, 2027, 1797, 1599, 1442, 1313, 1221, 1179, 1190, 1253, 1359, 1497, 1675, 1898, 2100, 2286, 2406, 2180, 1976, 1732, 1531, 1369, 1231, 1140, 1096, 1109, 1174, 1284, 1431, 1608, 1824, 2055, 2245, 2374, 2148, 1928, 1684, 1484, 1317, 1178, 1084, 1043, 1058, 1122, 1234, 1387, 1562, 1785, 2020, 2218, 2363, 2140, 1910, 1663, 1464, 1292, 1156, 1063, 1024, 1036, 1102, 1214, 1363, 1547, 1762, 2004, 2194, 2366, 2136, 1917, 1670, 1469, 1302, 1163, 1073, 1032, 1047, 1111, 1223, 1373, 1552, 1775, 2009, 2206, 2383, 2158, 1940, 1703, 1506, 1339, 1201, 1112, 1072, 1087, 1150, 1265, 1408, 1584, 1805, 2030, 2228, 2434, 2189, 1994, 1757, 1557, 1400, 1270, 1181, 1142, 1154, 1218, 1328, 1468, 1640, 1860, 2068, 2267, 2497, 2235, 2043, 1837, 1630, 1477, 1360, 1273, 1238, 1249, 1310, 1412, 1544, 1725, 1924, 2124, 2329, 2592, 2305, 2109, 1925, 1731, 1576, 1460, 1384, 1350, 1364, 1422, 1513, 1648, 1818, 2009, 2174, 2427, 2699, 2379, 2188, 2022, 1860, 1696, 1588, 1510, 1480, 1489, 1543, 1637, 1771, 1937, 2072, 2269, 2546, 2862, 2514, 2276, 2120, 1983, 1850, 1737, 1664, 1628, 1642, 1695, 1787, 1914, 2043, 2182, 2390, 2734, 3175, 2661, 2434, 2232, 2119, 2004, 1921, 1849, 1813, 1816, 1874, 1959, 2049, 2159, 2317, 2604, 2891, ] + gb: [3248, 2762, 2549, 2352, 2241, 2135, 2024, 1949, 1910, 1923, 1970, 2058, 2167, 2278, 2427, 2679, 3003, 2939, 2581, 2369, 2212, 2084, 1945, 1829, 1743, 1710, 1713, 1773, 1861, 1999, 2127, 2278, 2456, 2799, 2766, 2468, 2268, 2114, 1949, 1788, 1666, 1587, 1550, 1557, 1612, 1711, 1849, 2022, 2168, 2354, 2627, 2659, 2372, 2185, 2003, 1808, 1646, 1531, 1447, 1404, 1415, 1474, 1573, 1711, 1896, 2082, 2269, 2494, 2572, 2297, 2122, 1903, 1694, 1534, 1411, 1322, 1278, 1294, 1356, 1459, 1599, 1796, 2003, 2204, 2415, 2494, 2259, 2053, 1813, 1609, 1442, 1310, 1216, 1174, 1186, 1254, 1368, 1512, 1699, 1934, 2147, 2352, 2450, 2219, 2006, 1751, 1543, 1372, 1233, 1134, 1096, 1108, 1175, 1292, 1449, 1639, 1865, 2103, 2311, 2424, 2182, 1960, 1705, 1498, 1324, 1181, 1086, 1041, 1059, 1127, 1245, 1404, 1594, 1828, 2078, 2281, 2405, 2182, 1937, 1687, 1480, 1301, 1161, 1062, 1024, 1038, 1107, 1224, 1384, 1581, 1812, 2057, 2272, 2417, 2181, 1951, 1695, 1487, 1312, 1167, 1074, 1032, 1050, 1118, 1235, 1397, 1586, 1820, 2069, 2278, 2450, 2196, 1974, 1724, 1522, 1348, 1205, 1113, 1075, 1089, 1153, 1276, 1430, 1619, 1849, 2095, 2291, 2483, 2229, 2022, 1779, 1573, 1408, 1272, 1181, 1142, 1156, 1223, 1339, 1488, 1673, 1905, 2123, 2343, 2541, 2277, 2079, 1856, 1643, 1485, 1361, 1270, 1235, 1248, 1313, 1421, 1566, 1751, 1971, 2173, 2399, 2635, 2339, 2138, 1944, 1745, 1580, 1458, 1380, 1344, 1359, 1418, 1519, 1661, 1849, 2048, 2222, 2487, 2743, 2413, 2216, 2037, 1864, 1702, 1579, 1500, 1467, 1479, 1537, 1642, 1777, 1958, 2108, 2315, 2617, 2890, 2544, 2293, 2131, 1988, 1842, 1726, 1651, 1612, 1628, 1684, 1783, 1920, 2060, 2213, 2432, 2804, 3189, 2693, 2445, 2245, 2116, 2000, 1902, 1826, 1789, 1798, 1857, 1950, 2045, 2170, 2337, 2642, 2952, ] + b: [3058, 2592, 2385, 2213, 2113, 2016, 1936, 1869, 1845, 1844, 1887, 1965, 2056, 2162, 2288, 2535, 2815, 2739, 2411, 2208, 2067, 1959, 1848, 1747, 1681, 1655, 1659, 1709, 1788, 1909, 2024, 2149, 2317, 2640, 2595, 2298, 2119, 1981, 1836, 1704, 1608, 1543, 1517, 1519, 1561, 1646, 1774, 1925, 2042, 2217, 2463, 2469, 2218, 2033, 1880, 1710, 1575, 1479, 1419, 1384, 1398, 1439, 1527, 1647, 1810, 1968, 2125, 2330, 2404, 2138, 1979, 1785, 1611, 1474, 1374, 1303, 1271, 1280, 1336, 1421, 1545, 1706, 1895, 2058, 2261, 2341, 2104, 1920, 1713, 1535, 1397, 1284, 1203, 1168, 1181, 1237, 1339, 1462, 1631, 1822, 2012, 2194, 2293, 2063, 1882, 1662, 1480, 1336, 1206, 1128, 1092, 1106, 1165, 1270, 1407, 1565, 1767, 1965, 2158, 2262, 2048, 1845, 1625, 1450, 1289, 1165, 1079, 1041, 1057, 1122, 1223, 1370, 1534, 1725, 1940, 2129, 2258, 2046, 1834, 1605, 1433, 1273, 1147, 1058, 1024, 1037, 1102, 1209, 1352, 1519, 1711, 1928, 2110, 2261, 2041, 1847, 1615, 1442, 1282, 1151, 1069, 1028, 1048, 1109, 1218, 1359, 1523, 1716, 1927, 2124, 2282, 2064, 1864, 1645, 1461, 1316, 1184, 1103, 1070, 1083, 1143, 1249, 1389, 1552, 1745, 1948, 2141, 2326, 2090, 1907, 1695, 1505, 1362, 1247, 1164, 1133, 1144, 1202, 1307, 1436, 1597, 1794, 1985, 2182, 2380, 2132, 1952, 1758, 1569, 1429, 1323, 1247, 1215, 1229, 1283, 1379, 1506, 1669, 1851, 2025, 2222, 2458, 2187, 2000, 1835, 1653, 1511, 1407, 1344, 1314, 1326, 1374, 1461, 1583, 1749, 1916, 2069, 2319, 2559, 2255, 2066, 1910, 1757, 1616, 1512, 1450, 1427, 1431, 1481, 1565, 1688, 1850, 1970, 2151, 2432, 2700, 2384, 2151, 1995, 1874, 1747, 1637, 1577, 1552, 1563, 1610, 1689, 1817, 1934, 2064, 2254, 2607, 3019, 2498, 2301, 2107, 1991, 1888, 1808, 1742, 1716, 1716, 1775, 1847, 1930, 2044, 2200, 2494, 2763, ] + #3264x2448_D50_70 - D50 + - ct: 5003 + resolution: 3264x2448 + r: [4095, 3613, 3287, 3049, 2867, 2696, 2545, 2427, 2374, 2387, 2473, 2592, 2779, 2948, 3156, 3544, 3984, 3842, 3341, 3076, 2850, 2650, 2438, 2245, 2123, 2065, 2085, 2164, 2316, 2531, 2745, 2979, 3232, 3738, 3605, 3194, 2924, 2694, 2430, 2182, 1986, 1867, 1814, 1824, 1909, 2060, 2301, 2567, 2807, 3088, 3473, 3432, 3048, 2806, 2516, 2208, 1953, 1758, 1638, 1581, 1596, 1679, 1836, 2061, 2367, 2669, 2928, 3285, 3275, 2940, 2676, 2354, 2027, 1763, 1572, 1443, 1385, 1398, 1496, 1648, 1878, 2184, 2527, 2813, 3150, 3181, 2855, 2566, 2201, 1877, 1622, 1413, 1284, 1226, 1243, 1333, 1502, 1732, 2033, 2391, 2731, 3021, 3116, 2786, 2474, 2100, 1773, 1510, 1304, 1171, 1114, 1131, 1224, 1389, 1630, 1925, 2296, 2638, 2973, 3060, 2752, 2410, 2024, 1710, 1437, 1231, 1101, 1044, 1063, 1152, 1318, 1559, 1865, 2228, 2600, 2919, 3044, 2730, 2388, 2001, 1677, 1403, 1204, 1073, 1024, 1036, 1128, 1289, 1534, 1839, 2198, 2569, 2903, 3039, 2734, 2392, 2004, 1684, 1417, 1210, 1086, 1031, 1050, 1138, 1306, 1544, 1845, 2204, 2576, 2916, 3099, 2751, 2432, 2050, 1732, 1469, 1264, 1136, 1085, 1101, 1194, 1358, 1596, 1891, 2264, 2612, 2929, 3131, 2808, 2499, 2142, 1811, 1556, 1354, 1230, 1178, 1195, 1286, 1451, 1683, 1986, 2341, 2678, 2991, 3235, 2875, 2592, 2258, 1936, 1679, 1491, 1363, 1310, 1332, 1421, 1582, 1813, 2113, 2455, 2737, 3096, 3357, 2965, 2692, 2412, 2094, 1840, 1650, 1533, 1485, 1501, 1591, 1747, 1979, 2275, 2582, 2840, 3239, 3543, 3094, 2808, 2555, 2298, 2043, 1851, 1737, 1685, 1703, 1791, 1955, 2178, 2459, 2700, 2992, 3425, 3749, 3286, 2950, 2712, 2495, 2282, 2093, 1972, 1919, 1950, 2033, 2186, 2412, 2625, 2856, 3165, 3713, 4095, 3514, 3156, 2880, 2701, 2511, 2370, 2249, 2203, 2222, 2309, 2454, 2607, 2813, 3060, 3476, 3973, ] + gr: [3126, 2654, 2449, 2277, 2167, 2065, 1967, 1898, 1859, 1866, 1917, 2000, 2085, 2198, 2323, 2565, 2866, 2805, 2487, 2288, 2151, 2020, 1894, 1781, 1706, 1672, 1681, 1731, 1812, 1937, 2057, 2191, 2358, 2670, 2662, 2378, 2191, 2044, 1889, 1739, 1629, 1554, 1520, 1528, 1576, 1662, 1791, 1947, 2083, 2253, 2496, 2545, 2278, 2108, 1939, 1753, 1606, 1498, 1421, 1385, 1393, 1444, 1533, 1656, 1830, 2001, 2166, 2370, 2460, 2205, 2037, 1834, 1644, 1494, 1384, 1301, 1264, 1275, 1328, 1422, 1547, 1723, 1914, 2100, 2284, 2377, 2164, 1972, 1748, 1557, 1410, 1287, 1200, 1162, 1174, 1231, 1334, 1463, 1632, 1846, 2043, 2218, 2335, 2117, 1922, 1686, 1494, 1339, 1213, 1125, 1090, 1100, 1157, 1263, 1401, 1569, 1778, 1995, 2176, 2311, 2081, 1879, 1641, 1452, 1292, 1163, 1078, 1038, 1055, 1111, 1217, 1356, 1527, 1740, 1960, 2152, 2296, 2074, 1861, 1621, 1434, 1273, 1142, 1058, 1024, 1032, 1093, 1197, 1338, 1508, 1718, 1949, 2134, 2292, 2079, 1863, 1628, 1441, 1280, 1149, 1065, 1029, 1042, 1100, 1207, 1347, 1519, 1728, 1951, 2144, 2319, 2089, 1890, 1658, 1470, 1312, 1185, 1101, 1065, 1077, 1138, 1242, 1378, 1549, 1757, 1976, 2157, 2353, 2128, 1936, 1706, 1519, 1366, 1249, 1162, 1129, 1142, 1198, 1303, 1434, 1600, 1808, 2011, 2202, 2417, 2165, 1985, 1785, 1586, 1443, 1327, 1249, 1217, 1226, 1283, 1378, 1506, 1675, 1874, 2060, 2255, 2508, 2231, 2044, 1867, 1681, 1530, 1425, 1348, 1320, 1331, 1386, 1476, 1601, 1770, 1955, 2110, 2345, 2616, 2306, 2124, 1958, 1799, 1648, 1536, 1466, 1437, 1448, 1497, 1589, 1716, 1880, 2017, 2199, 2467, 2754, 2434, 2202, 2053, 1920, 1788, 1681, 1608, 1574, 1588, 1641, 1726, 1853, 1980, 2112, 2304, 2656, 3054, 2562, 2347, 2155, 2038, 1931, 1843, 1778, 1742, 1748, 1803, 1887, 1976, 2089, 2229, 2513, 2806, ] + gb: [3110, 2650, 2442, 2268, 2159, 2061, 1963, 1887, 1855, 1860, 1910, 1995, 2091, 2202, 2330, 2589, 2876, 2817, 2480, 2285, 2141, 2019, 1890, 1777, 1697, 1664, 1670, 1725, 1811, 1936, 2060, 2200, 2370, 2701, 2645, 2378, 2188, 2041, 1882, 1735, 1623, 1548, 1513, 1524, 1567, 1660, 1798, 1959, 2096, 2272, 2534, 2550, 2276, 2104, 1935, 1753, 1601, 1494, 1417, 1377, 1388, 1441, 1533, 1660, 1839, 2014, 2181, 2402, 2452, 2209, 2036, 1834, 1641, 1493, 1377, 1298, 1257, 1272, 1328, 1426, 1554, 1732, 1932, 2122, 2315, 2387, 2165, 1969, 1749, 1559, 1407, 1285, 1197, 1159, 1171, 1233, 1337, 1472, 1649, 1862, 2070, 2256, 2336, 2119, 1926, 1684, 1495, 1340, 1210, 1124, 1087, 1100, 1159, 1269, 1411, 1582, 1801, 2019, 2219, 2312, 2092, 1885, 1644, 1453, 1295, 1164, 1077, 1036, 1054, 1115, 1221, 1370, 1544, 1763, 1995, 2189, 2297, 2086, 1862, 1629, 1435, 1275, 1145, 1058, 1024, 1036, 1097, 1205, 1352, 1529, 1746, 1980, 2180, 2305, 2091, 1869, 1634, 1444, 1283, 1151, 1066, 1030, 1045, 1106, 1215, 1360, 1538, 1754, 1987, 2182, 2329, 2104, 1896, 1662, 1476, 1315, 1187, 1101, 1066, 1081, 1142, 1249, 1395, 1566, 1785, 2007, 2205, 2369, 2133, 1942, 1715, 1523, 1370, 1247, 1163, 1128, 1141, 1203, 1309, 1447, 1618, 1834, 2043, 2240, 2430, 2181, 1995, 1785, 1588, 1444, 1330, 1247, 1216, 1227, 1287, 1387, 1520, 1694, 1902, 2086, 2299, 2513, 2244, 2058, 1879, 1688, 1534, 1424, 1350, 1317, 1331, 1388, 1478, 1613, 1786, 1975, 2139, 2392, 2625, 2320, 2129, 1965, 1806, 1649, 1539, 1465, 1435, 1446, 1500, 1596, 1728, 1895, 2039, 2230, 2517, 2757, 2450, 2210, 2061, 1924, 1795, 1680, 1608, 1572, 1587, 1638, 1732, 1863, 1994, 2136, 2337, 2692, 3076, 2574, 2347, 2163, 2039, 1933, 1842, 1764, 1738, 1749, 1804, 1883, 1981, 2095, 2253, 2542, 2845, ] + b: [2915, 2480, 2280, 2121, 2025, 1929, 1854, 1793, 1773, 1769, 1815, 1879, 1970, 2069, 2185, 2406, 2670, 2610, 2321, 2132, 1997, 1889, 1781, 1681, 1616, 1587, 1598, 1642, 1721, 1831, 1945, 2068, 2221, 2492, 2485, 2222, 2043, 1913, 1775, 1639, 1541, 1485, 1457, 1466, 1500, 1579, 1705, 1855, 1972, 2122, 2360, 2380, 2127, 1969, 1815, 1647, 1516, 1427, 1367, 1342, 1342, 1390, 1463, 1577, 1739, 1901, 2041, 2243, 2297, 2061, 1914, 1722, 1549, 1418, 1325, 1261, 1233, 1241, 1287, 1369, 1483, 1638, 1820, 1994, 2158, 2233, 2025, 1852, 1646, 1474, 1347, 1242, 1171, 1142, 1152, 1203, 1293, 1409, 1559, 1758, 1931, 2104, 2198, 1987, 1808, 1594, 1424, 1290, 1178, 1104, 1079, 1088, 1139, 1232, 1358, 1505, 1700, 1893, 2077, 2165, 1972, 1772, 1561, 1393, 1250, 1139, 1065, 1035, 1051, 1101, 1196, 1323, 1473, 1656, 1867, 2046, 2166, 1960, 1769, 1542, 1381, 1234, 1121, 1048, 1024, 1034, 1084, 1178, 1308, 1462, 1651, 1855, 2036, 2166, 1961, 1774, 1548, 1380, 1240, 1126, 1054, 1025, 1041, 1092, 1186, 1315, 1464, 1654, 1862, 2041, 2184, 1975, 1794, 1576, 1408, 1268, 1155, 1082, 1056, 1066, 1118, 1211, 1338, 1492, 1678, 1877, 2063, 2222, 1999, 1826, 1623, 1441, 1314, 1208, 1137, 1109, 1120, 1171, 1261, 1383, 1533, 1724, 1912, 2071, 2265, 2043, 1871, 1684, 1507, 1372, 1276, 1211, 1183, 1193, 1242, 1327, 1447, 1600, 1781, 1941, 2132, 2351, 2095, 1928, 1760, 1588, 1454, 1357, 1297, 1271, 1282, 1326, 1406, 1523, 1684, 1849, 1988, 2215, 2439, 2167, 1992, 1847, 1695, 1551, 1455, 1397, 1372, 1381, 1422, 1507, 1622, 1785, 1897, 2068, 2323, 2564, 2289, 2068, 1923, 1803, 1684, 1581, 1520, 1495, 1504, 1546, 1623, 1752, 1866, 1990, 2170, 2488, 2838, 2390, 2201, 2026, 1908, 1814, 1736, 1669, 1643, 1654, 1700, 1774, 1862, 1964, 2101, 2363, 2613, ] + #3264x2448_D65_70 - D65 + - ct: 6504 + resolution: 3264x2448 + r: [4095, 3609, 3293, 3044, 2858, 2708, 2555, 2426, 2383, 2390, 2485, 2610, 2769, 2948, 3150, 3554, 4002, 3858, 3341, 3067, 2851, 2656, 2436, 2251, 2136, 2083, 2092, 2169, 2327, 2531, 2747, 2983, 3227, 3713, 3579, 3194, 2920, 2704, 2441, 2187, 2002, 1873, 1824, 1838, 1920, 2070, 2308, 2573, 2812, 3074, 3487, 3428, 3039, 2791, 2525, 2213, 1962, 1775, 1650, 1593, 1609, 1691, 1852, 2077, 2379, 2680, 2932, 3261, 3283, 2933, 2685, 2353, 2038, 1779, 1582, 1449, 1395, 1407, 1501, 1661, 1893, 2189, 2527, 2825, 3136, 3179, 2846, 2572, 2206, 1894, 1626, 1426, 1292, 1234, 1250, 1343, 1513, 1744, 2046, 2404, 2725, 3037, 3115, 2787, 2479, 2109, 1786, 1520, 1312, 1180, 1120, 1136, 1229, 1399, 1641, 1938, 2296, 2645, 2956, 3052, 2747, 2419, 2039, 1716, 1448, 1238, 1106, 1047, 1068, 1160, 1326, 1572, 1876, 2228, 2597, 2913, 3044, 2732, 2389, 2006, 1687, 1415, 1208, 1079, 1024, 1040, 1132, 1296, 1542, 1843, 2206, 2571, 2901, 3049, 2721, 2397, 2016, 1694, 1426, 1215, 1091, 1035, 1055, 1145, 1312, 1550, 1859, 2211, 2575, 2919, 3078, 2759, 2434, 2063, 1737, 1478, 1271, 1141, 1088, 1106, 1199, 1367, 1603, 1905, 2267, 2616, 2927, 3143, 2793, 2505, 2140, 1828, 1564, 1364, 1237, 1183, 1202, 1290, 1461, 1695, 1996, 2340, 2676, 2993, 3228, 2867, 2595, 2268, 1942, 1689, 1499, 1370, 1316, 1340, 1431, 1593, 1823, 2117, 2461, 2756, 3077, 3371, 2972, 2696, 2408, 2104, 1852, 1661, 1541, 1491, 1505, 1599, 1758, 1987, 2276, 2582, 2849, 3235, 3523, 3088, 2811, 2565, 2302, 2046, 1860, 1745, 1694, 1716, 1800, 1961, 2188, 2460, 2699, 2987, 3420, 3757, 3276, 2947, 2706, 2497, 2283, 2099, 1979, 1929, 1947, 2032, 2199, 2409, 2626, 2852, 3158, 3715, 4095, 3473, 3168, 2886, 2708, 2514, 2365, 2251, 2203, 2229, 2315, 2440, 2623, 2806, 3061, 3472, 3935, ] + gr: [3109, 2638, 2434, 2267, 2147, 2051, 1954, 1871, 1847, 1848, 1903, 1981, 2080, 2184, 2312, 2555, 2821, 2799, 2481, 2275, 2132, 2010, 1885, 1775, 1698, 1665, 1670, 1719, 1802, 1926, 2045, 2182, 2346, 2660, 2643, 2361, 2180, 2032, 1880, 1730, 1618, 1547, 1513, 1520, 1566, 1652, 1785, 1940, 2074, 2238, 2491, 2534, 2272, 2096, 1934, 1743, 1597, 1491, 1416, 1379, 1389, 1437, 1526, 1653, 1822, 1991, 2156, 2356, 2445, 2203, 2031, 1828, 1639, 1492, 1376, 1298, 1261, 1270, 1325, 1418, 1540, 1717, 1908, 2093, 2270, 2374, 2153, 1965, 1746, 1552, 1404, 1282, 1198, 1160, 1173, 1228, 1331, 1459, 1629, 1836, 2038, 2206, 2328, 2111, 1916, 1679, 1490, 1336, 1208, 1123, 1087, 1097, 1156, 1260, 1398, 1564, 1772, 1985, 2174, 2292, 2087, 1871, 1639, 1448, 1292, 1161, 1077, 1038, 1051, 1111, 1214, 1355, 1521, 1732, 1955, 2142, 2290, 2067, 1852, 1619, 1430, 1271, 1141, 1055, 1024, 1033, 1091, 1194, 1335, 1507, 1715, 1939, 2133, 2285, 2073, 1861, 1623, 1436, 1278, 1147, 1065, 1028, 1042, 1099, 1204, 1345, 1514, 1723, 1945, 2131, 2312, 2082, 1884, 1653, 1467, 1308, 1181, 1100, 1065, 1076, 1133, 1240, 1377, 1543, 1754, 1968, 2151, 2350, 2114, 1928, 1703, 1515, 1364, 1244, 1161, 1126, 1138, 1197, 1300, 1429, 1595, 1803, 2003, 2192, 2404, 2166, 1977, 1775, 1581, 1435, 1322, 1245, 1213, 1223, 1278, 1375, 1504, 1671, 1872, 2048, 2255, 2499, 2220, 2040, 1859, 1678, 1526, 1416, 1345, 1314, 1327, 1380, 1468, 1596, 1763, 1948, 2105, 2337, 2607, 2299, 2116, 1951, 1792, 1638, 1534, 1458, 1431, 1443, 1492, 1583, 1709, 1873, 2004, 2191, 2463, 2733, 2429, 2197, 2044, 1912, 1782, 1670, 1601, 1568, 1581, 1630, 1719, 1847, 1973, 2107, 2304, 2637, 3045, 2548, 2338, 2143, 2029, 1920, 1832, 1762, 1736, 1737, 1795, 1871, 1961, 2070, 2227, 2493, 2794, ] + gb: [3118, 2634, 2434, 2259, 2154, 2052, 1949, 1888, 1844, 1853, 1900, 1987, 2084, 2192, 2325, 2571, 2855, 2786, 2469, 2271, 2125, 2010, 1882, 1775, 1690, 1662, 1669, 1719, 1805, 1928, 2050, 2192, 2362, 2674, 2635, 2358, 2173, 2030, 1872, 1729, 1620, 1547, 1508, 1516, 1565, 1654, 1790, 1947, 2082, 2257, 2516, 2527, 2260, 2094, 1923, 1744, 1598, 1486, 1411, 1374, 1388, 1438, 1525, 1657, 1830, 2001, 2169, 2382, 2431, 2196, 2021, 1824, 1634, 1486, 1376, 1296, 1254, 1269, 1325, 1422, 1547, 1722, 1922, 2106, 2297, 2367, 2146, 1960, 1736, 1550, 1402, 1281, 1196, 1157, 1169, 1230, 1333, 1466, 1640, 1848, 2055, 2232, 2320, 2105, 1909, 1675, 1489, 1335, 1208, 1120, 1083, 1099, 1158, 1265, 1405, 1575, 1794, 2006, 2206, 2295, 2075, 1873, 1634, 1447, 1292, 1162, 1076, 1037, 1052, 1113, 1220, 1363, 1541, 1748, 1982, 2173, 2278, 2071, 1850, 1619, 1430, 1271, 1144, 1056, 1024, 1035, 1096, 1202, 1348, 1521, 1736, 1966, 2162, 2290, 2073, 1856, 1626, 1439, 1279, 1150, 1065, 1029, 1043, 1104, 1211, 1355, 1532, 1744, 1973, 2166, 2302, 2090, 1883, 1651, 1466, 1313, 1184, 1100, 1065, 1078, 1139, 1246, 1388, 1557, 1771, 1995, 2185, 2344, 2122, 1927, 1706, 1513, 1368, 1245, 1163, 1126, 1140, 1200, 1305, 1441, 1612, 1823, 2030, 2225, 2411, 2166, 1983, 1776, 1584, 1439, 1324, 1245, 1213, 1225, 1283, 1383, 1513, 1688, 1887, 2074, 2281, 2493, 2226, 2042, 1867, 1679, 1535, 1418, 1349, 1317, 1329, 1382, 1476, 1607, 1780, 1968, 2128, 2376, 2613, 2305, 2120, 1955, 1797, 1642, 1536, 1460, 1430, 1446, 1496, 1591, 1722, 1887, 2029, 2217, 2500, 2745, 2434, 2202, 2052, 1917, 1784, 1676, 1603, 1572, 1584, 1634, 1731, 1857, 1986, 2128, 2326, 2675, 3059, 2546, 2342, 2153, 2041, 1930, 1833, 1767, 1731, 1739, 1795, 1880, 1970, 2091, 2242, 2528, 2816, ] + b: [2873, 2460, 2268, 2104, 2011, 1921, 1837, 1775, 1753, 1759, 1798, 1871, 1956, 2059, 2172, 2375, 2631, 2606, 2309, 2117, 1990, 1879, 1768, 1673, 1606, 1582, 1588, 1633, 1705, 1820, 1931, 2051, 2202, 2475, 2458, 2204, 2033, 1901, 1760, 1630, 1533, 1475, 1452, 1455, 1495, 1572, 1694, 1839, 1962, 2110, 2332, 2361, 2122, 1964, 1800, 1640, 1506, 1417, 1362, 1332, 1340, 1378, 1452, 1573, 1727, 1887, 2031, 2222, 2280, 2053, 1893, 1713, 1542, 1414, 1321, 1257, 1229, 1235, 1282, 1365, 1470, 1633, 1804, 1974, 2144, 2220, 2010, 1846, 1638, 1472, 1340, 1238, 1168, 1141, 1149, 1201, 1288, 1403, 1551, 1742, 1923, 2094, 2180, 1986, 1797, 1591, 1416, 1287, 1176, 1105, 1077, 1088, 1137, 1230, 1350, 1502, 1688, 1885, 2062, 2161, 1955, 1767, 1554, 1387, 1249, 1135, 1064, 1035, 1050, 1097, 1191, 1317, 1471, 1654, 1863, 2027, 2145, 1955, 1757, 1539, 1375, 1233, 1121, 1047, 1024, 1033, 1086, 1175, 1303, 1454, 1640, 1848, 2020, 2154, 1953, 1760, 1542, 1379, 1237, 1124, 1053, 1027, 1038, 1089, 1182, 1310, 1463, 1645, 1848, 2028, 2167, 1965, 1781, 1567, 1400, 1266, 1152, 1083, 1054, 1066, 1117, 1209, 1334, 1483, 1674, 1867, 2043, 2207, 1995, 1816, 1613, 1440, 1311, 1204, 1137, 1109, 1118, 1169, 1258, 1378, 1527, 1713, 1899, 2067, 2247, 2035, 1862, 1676, 1500, 1369, 1274, 1208, 1182, 1190, 1237, 1324, 1439, 1592, 1770, 1930, 2126, 2337, 2085, 1919, 1752, 1585, 1447, 1353, 1294, 1270, 1278, 1325, 1401, 1517, 1672, 1842, 1979, 2199, 2421, 2154, 1984, 1835, 1686, 1549, 1450, 1393, 1369, 1381, 1418, 1500, 1617, 1769, 1886, 2055, 2310, 2539, 2273, 2056, 1921, 1791, 1680, 1576, 1515, 1490, 1499, 1544, 1624, 1737, 1860, 1983, 2162, 2458, 2817, 2386, 2185, 2018, 1904, 1802, 1724, 1668, 1638, 1646, 1685, 1765, 1851, 1953, 2089, 2342, 2607, ] + #3264x2448_D75_70 - D75 + - ct: 7504 + resolution: 3264x2448 + r: [4095, 3519, 3218, 2985, 2815, 2645, 2509, 2389, 2327, 2355, 2435, 2555, 2710, 2908, 3107, 3455, 3909, 3739, 3284, 3001, 2795, 2603, 2392, 2213, 2093, 2049, 2058, 2135, 2281, 2493, 2685, 2920, 3163, 3650, 3536, 3113, 2865, 2641, 2393, 2149, 1967, 1852, 1802, 1811, 1894, 2037, 2267, 2525, 2747, 3014, 3388, 3358, 2983, 2730, 2466, 2185, 1933, 1755, 1634, 1579, 1590, 1678, 1826, 2049, 2329, 2621, 2864, 3207, 3196, 2870, 2628, 2311, 2001, 1757, 1569, 1439, 1382, 1396, 1488, 1645, 1865, 2163, 2477, 2773, 3063, 3115, 2785, 2512, 2175, 1859, 1619, 1412, 1285, 1228, 1243, 1335, 1502, 1726, 2015, 2362, 2666, 2951, 3027, 2733, 2430, 2073, 1761, 1507, 1303, 1172, 1116, 1132, 1223, 1388, 1622, 1913, 2253, 2591, 2908, 2995, 2683, 2368, 2007, 1696, 1435, 1234, 1104, 1045, 1068, 1154, 1317, 1561, 1846, 2189, 2547, 2845, 2960, 2670, 2344, 1972, 1667, 1403, 1205, 1074, 1024, 1038, 1128, 1290, 1526, 1816, 2166, 2519, 2841, 2985, 2665, 2355, 1980, 1675, 1416, 1210, 1087, 1032, 1052, 1141, 1300, 1537, 1836, 2171, 2530, 2837, 3017, 2686, 2380, 2030, 1721, 1465, 1264, 1140, 1086, 1104, 1190, 1358, 1586, 1879, 2221, 2556, 2871, 3062, 2738, 2456, 2107, 1796, 1549, 1356, 1232, 1175, 1192, 1285, 1446, 1672, 1961, 2298, 2626, 2926, 3172, 2807, 2533, 2227, 1916, 1670, 1485, 1356, 1308, 1325, 1415, 1577, 1801, 2085, 2411, 2676, 3033, 3272, 2904, 2640, 2360, 2069, 1821, 1639, 1525, 1476, 1492, 1580, 1735, 1951, 2232, 2536, 2784, 3143, 3481, 3014, 2752, 2511, 2256, 2018, 1835, 1719, 1672, 1687, 1777, 1931, 2151, 2414, 2647, 2922, 3369, 3652, 3193, 2877, 2650, 2441, 2239, 2058, 1946, 1895, 1918, 1999, 2153, 2365, 2572, 2794, 3086, 3594, 4095, 3408, 3097, 2824, 2643, 2469, 2323, 2215, 2158, 2187, 2264, 2412, 2554, 2742, 2991, 3425, 3869, ] + gr: [3118, 2636, 2433, 2254, 2141, 2035, 1950, 1873, 1840, 1849, 1893, 1975, 2079, 2175, 2303, 2544, 2821, 2787, 2475, 2277, 2131, 2003, 1880, 1767, 1691, 1656, 1665, 1715, 1794, 1921, 2037, 2179, 2343, 2648, 2644, 2359, 2180, 2024, 1877, 1724, 1615, 1543, 1508, 1516, 1561, 1650, 1780, 1935, 2071, 2236, 2483, 2533, 2271, 2094, 1926, 1742, 1593, 1487, 1413, 1377, 1385, 1434, 1520, 1647, 1819, 1984, 2150, 2358, 2451, 2197, 2027, 1823, 1635, 1491, 1375, 1296, 1258, 1268, 1324, 1417, 1538, 1712, 1905, 2087, 2270, 2374, 2145, 1961, 1741, 1549, 1402, 1281, 1196, 1159, 1169, 1227, 1325, 1458, 1624, 1834, 2028, 2212, 2324, 2109, 1912, 1678, 1487, 1335, 1208, 1123, 1087, 1096, 1155, 1260, 1394, 1560, 1769, 1981, 2168, 2302, 2071, 1872, 1633, 1447, 1290, 1159, 1076, 1038, 1052, 1109, 1211, 1356, 1521, 1728, 1954, 2134, 2285, 2065, 1850, 1617, 1427, 1269, 1142, 1054, 1024, 1033, 1090, 1194, 1333, 1502, 1714, 1936, 2128, 2281, 2075, 1855, 1621, 1435, 1277, 1146, 1064, 1030, 1042, 1100, 1203, 1341, 1513, 1721, 1948, 2122, 2312, 2076, 1880, 1647, 1463, 1308, 1180, 1099, 1064, 1075, 1132, 1237, 1375, 1539, 1746, 1961, 2151, 2345, 2115, 1924, 1700, 1514, 1361, 1244, 1160, 1126, 1137, 1194, 1298, 1427, 1592, 1802, 2001, 2181, 2409, 2156, 1978, 1774, 1578, 1435, 1320, 1242, 1211, 1221, 1276, 1372, 1498, 1668, 1864, 2047, 2237, 2494, 2218, 2033, 1858, 1672, 1520, 1415, 1343, 1311, 1324, 1376, 1462, 1590, 1758, 1940, 2097, 2340, 2607, 2290, 2110, 1945, 1786, 1638, 1526, 1455, 1425, 1437, 1485, 1578, 1705, 1868, 1998, 2185, 2460, 2727, 2419, 2192, 2039, 1906, 1775, 1666, 1593, 1565, 1576, 1627, 1711, 1838, 1963, 2101, 2299, 2626, 3040, 2538, 2330, 2138, 2021, 1918, 1827, 1755, 1724, 1732, 1784, 1866, 1954, 2068, 2214, 2496, 2760, ] + gb: [3103, 2631, 2429, 2258, 2149, 2044, 1949, 1878, 1843, 1853, 1904, 1985, 2081, 2188, 2320, 2563, 2842, 2787, 2459, 2271, 2124, 2008, 1878, 1772, 1689, 1663, 1666, 1715, 1801, 1924, 2045, 2190, 2357, 2679, 2626, 2355, 2170, 2027, 1869, 1724, 1617, 1543, 1507, 1517, 1566, 1653, 1785, 1945, 2080, 2250, 2509, 2516, 2256, 2083, 1920, 1737, 1595, 1485, 1413, 1376, 1385, 1438, 1526, 1654, 1826, 1997, 2161, 2383, 2426, 2190, 2013, 1820, 1629, 1486, 1374, 1294, 1255, 1266, 1325, 1419, 1543, 1721, 1918, 2103, 2291, 2358, 2142, 1954, 1731, 1545, 1400, 1280, 1194, 1157, 1171, 1227, 1334, 1465, 1633, 1848, 2045, 2227, 2319, 2095, 1902, 1672, 1488, 1334, 1207, 1123, 1085, 1096, 1157, 1261, 1401, 1572, 1784, 2003, 2191, 2286, 2071, 1863, 1631, 1445, 1289, 1160, 1075, 1038, 1053, 1113, 1221, 1363, 1534, 1743, 1971, 2167, 2278, 2059, 1844, 1613, 1427, 1271, 1143, 1057, 1024, 1035, 1096, 1199, 1346, 1518, 1731, 1960, 2153, 2280, 2065, 1853, 1619, 1438, 1278, 1149, 1066, 1029, 1044, 1105, 1210, 1354, 1528, 1735, 1970, 2160, 2302, 2080, 1875, 1649, 1465, 1309, 1183, 1100, 1065, 1079, 1136, 1246, 1384, 1556, 1767, 1987, 2178, 2346, 2109, 1923, 1697, 1514, 1365, 1245, 1160, 1127, 1141, 1199, 1303, 1438, 1608, 1818, 2027, 2215, 2410, 2158, 1976, 1774, 1578, 1437, 1325, 1245, 1212, 1225, 1284, 1379, 1514, 1680, 1883, 2068, 2272, 2489, 2219, 2041, 1862, 1677, 1529, 1417, 1345, 1314, 1327, 1381, 1474, 1600, 1780, 1961, 2120, 2371, 2601, 2306, 2111, 1953, 1795, 1642, 1534, 1459, 1431, 1443, 1496, 1587, 1717, 1881, 2024, 2213, 2482, 2733, 2436, 2194, 2049, 1910, 1784, 1674, 1600, 1567, 1581, 1632, 1728, 1855, 1985, 2122, 2321, 2675, 3032, 2542, 2344, 2151, 2037, 1930, 1834, 1767, 1732, 1747, 1791, 1879, 1968, 2083, 2239, 2522, 2807, ] + b: [2879, 2455, 2264, 2106, 2006, 1922, 1836, 1777, 1750, 1753, 1802, 1870, 1949, 2055, 2160, 2385, 2620, 2609, 2309, 2119, 1990, 1882, 1764, 1668, 1603, 1583, 1586, 1625, 1704, 1818, 1933, 2054, 2201, 2478, 2465, 2208, 2038, 1897, 1760, 1627, 1531, 1477, 1450, 1453, 1492, 1569, 1686, 1838, 1960, 2103, 2342, 2362, 2116, 1967, 1802, 1637, 1506, 1416, 1359, 1332, 1340, 1379, 1453, 1574, 1722, 1888, 2030, 2214, 2284, 2053, 1896, 1715, 1540, 1412, 1320, 1257, 1227, 1236, 1282, 1363, 1468, 1629, 1806, 1969, 2149, 2217, 2010, 1841, 1638, 1470, 1340, 1237, 1168, 1140, 1146, 1199, 1286, 1401, 1552, 1740, 1932, 2082, 2182, 1981, 1791, 1589, 1418, 1287, 1175, 1104, 1076, 1087, 1137, 1227, 1352, 1497, 1690, 1883, 2059, 2158, 1964, 1767, 1551, 1387, 1247, 1135, 1065, 1036, 1048, 1100, 1190, 1318, 1466, 1651, 1858, 2037, 2149, 1951, 1756, 1539, 1373, 1233, 1121, 1047, 1024, 1035, 1085, 1174, 1302, 1457, 1637, 1845, 2021, 2153, 1952, 1760, 1542, 1378, 1236, 1126, 1054, 1026, 1040, 1090, 1181, 1308, 1458, 1645, 1852, 2025, 2172, 1964, 1780, 1565, 1398, 1266, 1151, 1085, 1055, 1066, 1116, 1209, 1333, 1484, 1667, 1864, 2036, 2200, 1989, 1822, 1612, 1435, 1311, 1202, 1135, 1108, 1117, 1169, 1259, 1374, 1526, 1714, 1895, 2075, 2259, 2034, 1860, 1674, 1500, 1363, 1275, 1208, 1180, 1192, 1237, 1319, 1437, 1591, 1767, 1932, 2119, 2327, 2081, 1914, 1750, 1580, 1445, 1350, 1292, 1269, 1279, 1320, 1400, 1515, 1671, 1835, 1975, 2198, 2428, 2152, 1983, 1838, 1684, 1546, 1448, 1394, 1367, 1377, 1417, 1501, 1615, 1768, 1890, 2056, 2310, 2536, 2273, 2059, 1919, 1794, 1676, 1576, 1512, 1487, 1499, 1543, 1621, 1741, 1856, 1980, 2155, 2463, 2820, 2387, 2189, 2014, 1906, 1806, 1722, 1672, 1639, 1645, 1687, 1758, 1846, 1950, 2094, 2345, 2609, ] + #3264x2448_F11_TL84_70 - F11_TL84 + - ct: 4000 + resolution: 3264x2448 + r: [4002, 3309, 3035, 2794, 2634, 2461, 2319, 2207, 2157, 2168, 2244, 2370, 2537, 2712, 2917, 3269, 3672, 3551, 3103, 2825, 2625, 2420, 2214, 2037, 1922, 1874, 1882, 1956, 2100, 2302, 2511, 2738, 2969, 3444, 3298, 2949, 2692, 2463, 2213, 1969, 1792, 1686, 1640, 1646, 1721, 1857, 2074, 2333, 2576, 2831, 3187, 3157, 2805, 2562, 2298, 1998, 1762, 1596, 1491, 1444, 1454, 1521, 1655, 1863, 2142, 2432, 2691, 3014, 3030, 2709, 2454, 2128, 1831, 1597, 1435, 1335, 1291, 1302, 1366, 1495, 1686, 1971, 2291, 2593, 2883, 2940, 2627, 2345, 1995, 1701, 1475, 1311, 1216, 1176, 1186, 1246, 1372, 1564, 1831, 2173, 2490, 2788, 2868, 2575, 2259, 1900, 1604, 1387, 1231, 1136, 1095, 1105, 1167, 1286, 1475, 1735, 2074, 2418, 2721, 2826, 2533, 2203, 1835, 1548, 1332, 1177, 1084, 1042, 1056, 1116, 1233, 1422, 1676, 2015, 2370, 2679, 2812, 2511, 2176, 1810, 1521, 1303, 1157, 1063, 1024, 1034, 1095, 1216, 1398, 1657, 1989, 2342, 2677, 2816, 2517, 2185, 1816, 1530, 1312, 1161, 1070, 1031, 1041, 1109, 1224, 1410, 1665, 1999, 2359, 2664, 2839, 2531, 2218, 1856, 1571, 1350, 1197, 1106, 1065, 1080, 1142, 1263, 1451, 1708, 2046, 2389, 2703, 2896, 2578, 2281, 1935, 1636, 1421, 1265, 1171, 1135, 1147, 1209, 1335, 1527, 1788, 2123, 2454, 2753, 2994, 2638, 2366, 2046, 1749, 1522, 1365, 1268, 1231, 1245, 1310, 1442, 1638, 1912, 2230, 2518, 2840, 3101, 2741, 2467, 2183, 1895, 1664, 1502, 1402, 1363, 1376, 1451, 1582, 1789, 2057, 2362, 2609, 2977, 3260, 2841, 2581, 2342, 2083, 1842, 1676, 1575, 1534, 1553, 1625, 1769, 1977, 2240, 2474, 2752, 3175, 3489, 3019, 2716, 2496, 2274, 2077, 1899, 1789, 1751, 1769, 1847, 1991, 2189, 2409, 2631, 2927, 3411, 3949, 3229, 2910, 2647, 2477, 2296, 2156, 2049, 2010, 2022, 2104, 2237, 2398, 2579, 2812, 3226, 3666, ] + gr: [3132, 2654, 2457, 2283, 2168, 2064, 1974, 1892, 1855, 1864, 1922, 1997, 2100, 2202, 2331, 2576, 2861, 2822, 2487, 2297, 2143, 2021, 1891, 1780, 1697, 1664, 1669, 1720, 1809, 1934, 2058, 2197, 2364, 2674, 2652, 2374, 2189, 2039, 1882, 1732, 1618, 1541, 1502, 1512, 1561, 1654, 1788, 1943, 2081, 2250, 2503, 2542, 2272, 2100, 1925, 1743, 1592, 1482, 1408, 1367, 1378, 1429, 1517, 1644, 1816, 1993, 2163, 2364, 2454, 2203, 2028, 1824, 1624, 1481, 1366, 1286, 1249, 1256, 1312, 1409, 1527, 1709, 1905, 2097, 2279, 2368, 2158, 1956, 1731, 1540, 1390, 1275, 1189, 1153, 1165, 1219, 1318, 1446, 1615, 1833, 2032, 2220, 2332, 2110, 1908, 1667, 1473, 1322, 1200, 1119, 1085, 1095, 1149, 1249, 1383, 1550, 1760, 1983, 2175, 2300, 2074, 1859, 1619, 1428, 1273, 1154, 1072, 1038, 1052, 1105, 1203, 1339, 1506, 1722, 1951, 2146, 2289, 2061, 1844, 1602, 1410, 1256, 1134, 1053, 1024, 1031, 1089, 1183, 1320, 1490, 1702, 1938, 2137, 2282, 2067, 1845, 1605, 1418, 1260, 1141, 1061, 1027, 1041, 1095, 1194, 1328, 1497, 1713, 1942, 2139, 2318, 2083, 1870, 1634, 1448, 1296, 1173, 1096, 1062, 1073, 1129, 1226, 1363, 1528, 1741, 1967, 2157, 2345, 2113, 1918, 1691, 1495, 1351, 1233, 1154, 1119, 1132, 1189, 1286, 1418, 1583, 1795, 2001, 2190, 2416, 2159, 1976, 1767, 1568, 1424, 1311, 1232, 1202, 1211, 1268, 1363, 1490, 1661, 1868, 2047, 2256, 2502, 2222, 2037, 1855, 1670, 1518, 1407, 1333, 1302, 1313, 1369, 1457, 1591, 1756, 1941, 2106, 2352, 2619, 2304, 2118, 1948, 1789, 1638, 1523, 1449, 1418, 1432, 1483, 1578, 1706, 1875, 2011, 2197, 2473, 2758, 2433, 2198, 2052, 1915, 1783, 1674, 1593, 1566, 1576, 1629, 1721, 1852, 1976, 2115, 2312, 2657, 3071, 2569, 2344, 2154, 2039, 1930, 1841, 1773, 1734, 1748, 1795, 1881, 1974, 2089, 2231, 2521, 2802, ] + gb: [3133, 2656, 2457, 2275, 2154, 2053, 1951, 1877, 1838, 1848, 1901, 1985, 2088, 2205, 2345, 2598, 2891, 2824, 2492, 2292, 2135, 2015, 1879, 1765, 1681, 1647, 1653, 1708, 1800, 1928, 2056, 2208, 2384, 2708, 2667, 2381, 2198, 2039, 1879, 1723, 1610, 1527, 1492, 1502, 1553, 1645, 1781, 1953, 2093, 2277, 2545, 2558, 2287, 2108, 1931, 1743, 1586, 1472, 1400, 1359, 1367, 1424, 1513, 1652, 1830, 2012, 2188, 2417, 2474, 2212, 2042, 1831, 1630, 1477, 1365, 1283, 1242, 1255, 1313, 1408, 1538, 1723, 1930, 2127, 2323, 2395, 2169, 1970, 1738, 1548, 1392, 1272, 1187, 1151, 1161, 1222, 1322, 1459, 1633, 1861, 2066, 2263, 2356, 2130, 1922, 1679, 1479, 1325, 1200, 1118, 1082, 1094, 1151, 1254, 1396, 1573, 1792, 2024, 2227, 2337, 2095, 1883, 1627, 1438, 1279, 1156, 1074, 1038, 1054, 1110, 1211, 1352, 1530, 1752, 1997, 2195, 2306, 2095, 1861, 1616, 1421, 1258, 1139, 1055, 1024, 1035, 1094, 1193, 1335, 1513, 1741, 1986, 2182, 2315, 2094, 1867, 1622, 1427, 1266, 1143, 1064, 1029, 1044, 1100, 1202, 1344, 1523, 1746, 1989, 2193, 2342, 2108, 1890, 1648, 1458, 1299, 1176, 1096, 1061, 1075, 1132, 1236, 1376, 1557, 1773, 2010, 2203, 2377, 2140, 1939, 1704, 1508, 1353, 1232, 1154, 1120, 1131, 1193, 1292, 1432, 1608, 1828, 2044, 2251, 2443, 2185, 1992, 1782, 1577, 1428, 1315, 1233, 1199, 1214, 1271, 1370, 1504, 1685, 1895, 2093, 2305, 2519, 2249, 2058, 1869, 1675, 1519, 1406, 1331, 1298, 1313, 1371, 1462, 1599, 1781, 1976, 2139, 2405, 2637, 2326, 2130, 1962, 1792, 1637, 1521, 1445, 1412, 1428, 1481, 1578, 1713, 1888, 2035, 2238, 2529, 2777, 2458, 2215, 2053, 1917, 1776, 1662, 1588, 1554, 1568, 1624, 1722, 1851, 1992, 2136, 2351, 2708, 3076, 2575, 2354, 2161, 2036, 1925, 1834, 1757, 1723, 1732, 1779, 1874, 1972, 2093, 2258, 2546, 2857, ] + b: [2906, 2483, 2290, 2108, 2020, 1921, 1851, 1778, 1756, 1759, 1799, 1880, 1969, 2074, 2183, 2435, 2664, 2618, 2324, 2122, 1992, 1883, 1772, 1666, 1601, 1578, 1586, 1627, 1712, 1827, 1934, 2072, 2225, 2524, 2483, 2211, 2037, 1900, 1761, 1625, 1532, 1472, 1447, 1449, 1486, 1571, 1692, 1847, 1968, 2118, 2360, 2370, 2126, 1961, 1803, 1638, 1509, 1411, 1355, 1324, 1335, 1376, 1449, 1572, 1729, 1884, 2042, 2233, 2286, 2051, 1902, 1710, 1537, 1407, 1314, 1249, 1222, 1228, 1276, 1356, 1472, 1629, 1815, 1975, 2159, 2238, 2012, 1839, 1636, 1463, 1333, 1232, 1165, 1137, 1144, 1192, 1280, 1394, 1549, 1743, 1922, 2094, 2184, 1979, 1797, 1586, 1413, 1279, 1170, 1102, 1074, 1086, 1134, 1219, 1345, 1492, 1684, 1888, 2067, 2160, 1958, 1765, 1546, 1378, 1240, 1132, 1062, 1035, 1050, 1095, 1184, 1307, 1459, 1646, 1858, 2036, 2151, 1954, 1752, 1531, 1366, 1224, 1115, 1046, 1026, 1033, 1081, 1170, 1293, 1450, 1635, 1845, 2032, 2155, 1948, 1754, 1535, 1373, 1228, 1118, 1053, 1024, 1038, 1088, 1175, 1299, 1452, 1638, 1849, 2027, 2179, 1970, 1780, 1565, 1391, 1259, 1147, 1079, 1053, 1063, 1113, 1203, 1324, 1474, 1668, 1869, 2037, 2214, 1989, 1816, 1610, 1433, 1297, 1194, 1130, 1105, 1112, 1161, 1249, 1367, 1522, 1710, 1892, 2074, 2264, 2034, 1863, 1673, 1491, 1360, 1264, 1199, 1176, 1185, 1230, 1312, 1434, 1590, 1770, 1936, 2127, 2348, 2084, 1916, 1751, 1581, 1437, 1343, 1284, 1254, 1268, 1312, 1395, 1516, 1673, 1837, 1986, 2216, 2445, 2159, 1975, 1832, 1684, 1544, 1441, 1381, 1358, 1367, 1413, 1494, 1612, 1773, 1894, 2067, 2330, 2573, 2285, 2061, 1914, 1791, 1672, 1568, 1507, 1480, 1492, 1529, 1619, 1743, 1862, 1987, 2168, 2475, 2853, 2395, 2197, 2003, 1909, 1798, 1726, 1652, 1638, 1640, 1687, 1762, 1852, 1956, 2101, 2365, 2643, ] + #3264x2448_F2_CWF_70 - F2_CWF + - ct: 4230 + resolution: 3264x2448 + r: [3695, 3077, 2822, 2622, 2472, 2342, 2200, 2111, 2075, 2079, 2145, 2258, 2393, 2547, 2713, 3030, 3396, 3294, 2882, 2641, 2461, 2294, 2117, 1965, 1868, 1822, 1827, 1898, 2020, 2200, 2366, 2557, 2763, 3190, 3081, 2755, 2527, 2334, 2120, 1915, 1760, 1667, 1625, 1635, 1702, 1820, 2002, 2225, 2422, 2641, 2979, 2935, 2624, 2415, 2192, 1939, 1732, 1587, 1496, 1452, 1461, 1526, 1643, 1825, 2064, 2314, 2518, 2804, 2832, 2532, 2323, 2050, 1792, 1591, 1448, 1348, 1301, 1315, 1382, 1504, 1675, 1916, 2190, 2435, 2700, 2735, 2464, 2229, 1935, 1680, 1485, 1327, 1227, 1183, 1194, 1265, 1392, 1567, 1799, 2091, 2351, 2611, 2673, 2415, 2150, 1853, 1597, 1397, 1244, 1144, 1096, 1111, 1182, 1308, 1489, 1715, 2000, 2291, 2552, 2638, 2381, 2104, 1797, 1546, 1342, 1189, 1086, 1042, 1058, 1126, 1255, 1435, 1666, 1950, 2257, 2514, 2621, 2361, 2083, 1766, 1525, 1319, 1164, 1064, 1024, 1037, 1106, 1231, 1415, 1644, 1929, 2233, 2506, 2638, 2364, 2088, 1777, 1528, 1326, 1168, 1073, 1029, 1046, 1115, 1240, 1422, 1654, 1941, 2237, 2511, 2655, 2388, 2121, 1813, 1563, 1366, 1210, 1114, 1070, 1084, 1155, 1283, 1459, 1693, 1981, 2269, 2530, 2712, 2427, 2182, 1884, 1628, 1428, 1281, 1183, 1143, 1158, 1226, 1352, 1531, 1764, 2046, 2317, 2579, 2790, 2485, 2250, 1983, 1722, 1523, 1379, 1284, 1242, 1258, 1327, 1454, 1628, 1862, 2139, 2376, 2667, 2895, 2571, 2344, 2103, 1851, 1644, 1506, 1409, 1371, 1388, 1457, 1578, 1756, 1996, 2250, 2457, 2782, 3048, 2672, 2441, 2229, 2007, 1806, 1658, 1567, 1526, 1541, 1611, 1739, 1916, 2148, 2340, 2583, 2953, 3225, 2827, 2544, 2353, 2172, 1998, 1846, 1755, 1708, 1732, 1794, 1928, 2102, 2282, 2468, 2726, 3175, 3641, 3010, 2734, 2492, 2341, 2192, 2069, 1968, 1937, 1948, 2023, 2139, 2270, 2437, 2634, 2994, 3392, ] + gr: [3050, 2599, 2407, 2232, 2134, 2044, 1950, 1879, 1843, 1845, 1897, 1973, 2069, 2164, 2285, 2518, 2788, 2763, 2436, 2247, 2112, 1994, 1867, 1764, 1688, 1655, 1661, 1710, 1788, 1907, 2024, 2157, 2320, 2612, 2604, 2323, 2155, 2009, 1858, 1715, 1606, 1543, 1504, 1512, 1556, 1640, 1766, 1917, 2047, 2211, 2450, 2492, 2232, 2067, 1906, 1727, 1584, 1480, 1411, 1371, 1381, 1428, 1512, 1632, 1799, 1962, 2124, 2327, 2400, 2164, 1999, 1801, 1617, 1475, 1369, 1292, 1252, 1264, 1317, 1408, 1525, 1691, 1879, 2063, 2240, 2326, 2120, 1935, 1721, 1533, 1392, 1278, 1194, 1156, 1167, 1225, 1319, 1443, 1606, 1809, 2003, 2170, 2291, 2075, 1883, 1653, 1470, 1323, 1204, 1122, 1086, 1096, 1153, 1252, 1381, 1540, 1746, 1951, 2139, 2256, 2043, 1839, 1609, 1430, 1278, 1158, 1076, 1038, 1052, 1108, 1206, 1341, 1500, 1702, 1929, 2103, 2242, 2036, 1820, 1596, 1411, 1260, 1138, 1053, 1024, 1032, 1091, 1186, 1322, 1484, 1690, 1909, 2098, 2251, 2034, 1826, 1598, 1416, 1267, 1143, 1065, 1027, 1043, 1097, 1198, 1328, 1493, 1694, 1913, 2096, 2263, 2048, 1852, 1626, 1447, 1298, 1177, 1096, 1063, 1075, 1131, 1230, 1360, 1521, 1723, 1934, 2117, 2316, 2078, 1897, 1680, 1494, 1351, 1238, 1159, 1123, 1135, 1193, 1290, 1416, 1572, 1776, 1974, 2152, 2362, 2122, 1947, 1746, 1562, 1424, 1313, 1238, 1207, 1218, 1272, 1361, 1484, 1647, 1838, 2014, 2215, 2461, 2182, 2007, 1835, 1653, 1510, 1408, 1336, 1305, 1317, 1368, 1456, 1576, 1736, 1919, 2068, 2306, 2560, 2260, 2080, 1920, 1771, 1626, 1516, 1450, 1420, 1432, 1480, 1566, 1687, 1844, 1975, 2157, 2418, 2703, 2387, 2160, 2012, 1888, 1763, 1660, 1588, 1558, 1566, 1617, 1702, 1827, 1943, 2075, 2267, 2603, 2992, 2511, 2296, 2118, 2001, 1898, 1817, 1749, 1719, 1730, 1779, 1859, 1938, 2050, 2187, 2457, 2741, ] + gb: [3060, 2612, 2398, 2229, 2123, 2030, 1932, 1857, 1822, 1830, 1874, 1957, 2069, 2163, 2291, 2542, 2825, 2776, 2432, 2251, 2106, 1988, 1856, 1748, 1668, 1636, 1641, 1695, 1784, 1902, 2026, 2170, 2338, 2654, 2609, 2336, 2151, 2005, 1853, 1710, 1597, 1527, 1487, 1500, 1546, 1634, 1768, 1926, 2063, 2235, 2497, 2514, 2248, 2075, 1908, 1727, 1578, 1471, 1396, 1360, 1371, 1422, 1509, 1639, 1810, 1981, 2151, 2365, 2415, 2182, 2010, 1807, 1619, 1474, 1366, 1284, 1247, 1257, 1316, 1409, 1532, 1710, 1906, 2098, 2282, 2358, 2140, 1949, 1725, 1539, 1393, 1276, 1191, 1153, 1166, 1224, 1325, 1455, 1628, 1840, 2045, 2226, 2308, 2101, 1903, 1666, 1479, 1329, 1204, 1121, 1083, 1098, 1154, 1260, 1395, 1565, 1775, 2000, 2191, 2296, 2069, 1863, 1625, 1437, 1285, 1160, 1074, 1038, 1053, 1112, 1214, 1355, 1527, 1746, 1970, 2167, 2280, 2060, 1844, 1609, 1422, 1262, 1140, 1055, 1024, 1034, 1095, 1198, 1337, 1516, 1724, 1962, 2155, 2284, 2063, 1850, 1618, 1429, 1273, 1147, 1064, 1030, 1043, 1104, 1207, 1351, 1519, 1738, 1965, 2159, 2303, 2083, 1878, 1640, 1460, 1304, 1182, 1099, 1065, 1078, 1136, 1244, 1379, 1552, 1764, 1986, 2181, 2341, 2110, 1916, 1698, 1504, 1359, 1238, 1159, 1125, 1136, 1197, 1297, 1431, 1599, 1809, 2018, 2208, 2403, 2156, 1967, 1764, 1570, 1427, 1315, 1237, 1205, 1217, 1274, 1369, 1502, 1673, 1875, 2061, 2278, 2488, 2208, 2025, 1848, 1662, 1513, 1405, 1333, 1304, 1314, 1372, 1460, 1588, 1760, 1946, 2108, 2355, 2596, 2289, 2101, 1934, 1775, 1624, 1516, 1442, 1412, 1425, 1476, 1571, 1700, 1865, 2005, 2195, 2486, 2720, 2411, 2169, 2025, 1895, 1760, 1650, 1578, 1548, 1559, 1612, 1702, 1834, 1960, 2101, 2302, 2647, 3035, 2523, 2314, 2125, 2002, 1897, 1806, 1738, 1705, 1716, 1766, 1855, 1944, 2061, 2204, 2497, 2792, ] + b: [2861, 2421, 2239, 2078, 1980, 1893, 1811, 1762, 1723, 1742, 1779, 1851, 1933, 2034, 2151, 2359, 2635, 2562, 2279, 2088, 1949, 1859, 1748, 1650, 1585, 1562, 1570, 1607, 1691, 1798, 1909, 2028, 2181, 2467, 2428, 2166, 2009, 1873, 1736, 1613, 1518, 1461, 1436, 1441, 1480, 1557, 1676, 1814, 1932, 2087, 2311, 2326, 2088, 1923, 1779, 1621, 1492, 1404, 1351, 1322, 1329, 1368, 1445, 1557, 1708, 1863, 2004, 2200, 2250, 2013, 1869, 1687, 1522, 1398, 1309, 1250, 1218, 1231, 1273, 1354, 1457, 1615, 1779, 1941, 2113, 2187, 1979, 1812, 1617, 1454, 1331, 1231, 1163, 1137, 1145, 1195, 1277, 1392, 1537, 1720, 1899, 2061, 2161, 1947, 1769, 1567, 1405, 1273, 1171, 1101, 1078, 1087, 1132, 1222, 1336, 1483, 1665, 1849, 2018, 2122, 1923, 1740, 1530, 1369, 1239, 1131, 1064, 1037, 1049, 1096, 1182, 1306, 1452, 1625, 1829, 1999, 2115, 1919, 1730, 1520, 1360, 1222, 1117, 1046, 1024, 1033, 1086, 1169, 1288, 1439, 1617, 1815, 1991, 2121, 1918, 1736, 1524, 1359, 1227, 1119, 1053, 1025, 1040, 1088, 1173, 1295, 1442, 1624, 1817, 1995, 2136, 1934, 1750, 1546, 1384, 1254, 1147, 1079, 1053, 1063, 1114, 1203, 1321, 1464, 1649, 1837, 2004, 2179, 1955, 1795, 1587, 1423, 1294, 1195, 1131, 1105, 1112, 1161, 1247, 1362, 1506, 1688, 1872, 2037, 2228, 1999, 1833, 1656, 1480, 1353, 1263, 1197, 1172, 1182, 1228, 1311, 1423, 1574, 1751, 1903, 2078, 2309, 2047, 1889, 1724, 1558, 1425, 1336, 1277, 1252, 1263, 1308, 1382, 1500, 1654, 1806, 1954, 2164, 2390, 2114, 1949, 1802, 1660, 1524, 1429, 1373, 1352, 1360, 1401, 1482, 1597, 1748, 1863, 2031, 2287, 2520, 2231, 2019, 1882, 1760, 1651, 1549, 1494, 1466, 1478, 1519, 1597, 1715, 1827, 1947, 2124, 2444, 2788, 2355, 2157, 1974, 1878, 1770, 1701, 1637, 1615, 1612, 1661, 1743, 1824, 1925, 2064, 2315, 2599, ] + diff --git a/src/ipa/rkisp1/data/uncalibrated.yaml b/src/ipa/rkisp1/data/uncalibrated.yaml index bdbd5fda..a7bbd8d8 100644 --- a/src/ipa/rkisp1/data/uncalibrated.yaml +++ b/src/ipa/rkisp1/data/uncalibrated.yaml @@ -1,5 +1,5 @@ # SPDX-License-Identifier: CC0-1.0 -%YAML 1.2 +%YAML 1.1 --- version: 1 algorithms: diff --git a/src/ipa/rkisp1/ipa_context.cpp b/src/ipa/rkisp1/ipa_context.cpp index 1559d3ff..283bc131 100644 --- a/src/ipa/rkisp1/ipa_context.cpp +++ b/src/ipa/rkisp1/ipa_context.cpp @@ -2,7 +2,7 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * ipa_context.cpp - RkISP1 IPA Context + * RkISP1 IPA Context */ #include "ipa_context.h" @@ -15,6 +15,25 @@ namespace libcamera::ipa::rkisp1 { /** + * \struct IPAHwSettings + * \brief RkISP1 version-specific hardware parameters + */ + +/** + * \var IPAHwSettings::numAeCells + * \brief Number of cells in the AE exposure means grid + * + * \var IPAHwSettings::numHistogramBins + * \brief Number of bins in the histogram + * + * \var IPAHwSettings::numHistogramWeights + * \brief Number of weights in the histogram grid + * + * \var IPAHwSettings::numGammaOutSamples + * \brief Number of samples in the gamma out table + */ + +/** * \struct IPASessionConfiguration * \brief Session configuration for the IPA module * @@ -25,84 +44,217 @@ namespace libcamera::ipa::rkisp1 { */ /** - * \struct IPAFrameContext - * \brief Per-frame context for algorithms + * \var IPASessionConfiguration::agc + * \brief AGC parameters configuration of the IPA + * + * \var IPASessionConfiguration::agc.measureWindow + * \brief AGC measure window + */ + +/** + * \var IPASessionConfiguration::awb + * \brief AWB parameters configuration of the IPA * - * The frame context stores data specific to a single frame processed by the - * IPA. Each frame processed by the IPA has a context associated with it, - * accessible through the IPAContext structure. + * \var IPASessionConfiguration::awb.measureWindow + * \brief AWB measure window * - * \todo Detail how to access contexts for a particular frame + * \var IPASessionConfiguration::awb.enabled + * \brief Indicates if the AWB hardware is enabled and applies colour gains * - * Each of the fields in the frame context belongs to either a specific - * algorithm, or to the top-level IPA module. A field may be read by any - * algorithm, but should only be written by its owner. + * The AWB module of the ISP applies colour gains and computes statistics. It is + * enabled when the AWB algorithm is loaded, regardless of whether the algorithm + * operates in manual or automatic mode. */ /** - * \struct IPAContext - * \brief Global IPA context data shared between all algorithms + * \var IPASessionConfiguration::lsc + * \brief Lens Shading Correction configuration of the IPA * - * \var IPAContext::configuration - * \brief The IPA session configuration, immutable during the session + * \var IPASessionConfiguration::lsc.enabled + * \brief Indicates if the LSC hardware is enabled + */ + +/** + * \var IPASessionConfiguration::sensor + * \brief Sensor-specific configuration of the IPA + * + * \var IPASessionConfiguration::sensor.minShutterSpeed + * \brief Minimum shutter speed supported with the sensor + * + * \var IPASessionConfiguration::sensor.maxShutterSpeed + * \brief Maximum shutter speed supported with the sensor * - * \var IPAContext::frameContext - * \brief The frame context for the frame being processed + * \var IPASessionConfiguration::sensor.minAnalogueGain + * \brief Minimum analogue gain supported with the sensor * - * \todo While the frame context is supposed to be per-frame, this - * single frame context stores data related to both the current frame - * and the previous frames, with fields being updated as the algorithms - * are run. This needs to be turned into real per-frame data storage. + * \var IPASessionConfiguration::sensor.maxAnalogueGain + * \brief Maximum analogue gain supported with the sensor + * + * \var IPASessionConfiguration::sensor.defVBlank + * \brief The default vblank value of the sensor + * + * \var IPASessionConfiguration::sensor.lineDuration + * \brief Line duration in microseconds + * + * \var IPASessionConfiguration::sensor.size + * \brief Sensor output resolution */ /** - * \var IPASessionConfiguration::agc - * \brief AGC parameters configuration of the IPA + * \var IPASessionConfiguration::raw + * \brief Indicates if the camera is configured to capture raw frames + */ + +/** + * \struct IPAActiveState + * \brief Active state for algorithms * - * \var IPASessionConfiguration::agc.minShutterSpeed - * \brief Minimum shutter speed supported with the configured sensor + * The active state contains all algorithm-specific data that needs to be + * maintained by algorithms across frames. Unlike the session configuration, + * the active state is mutable and constantly updated by algorithms. The active + * state is accessible through the IPAContext structure. * - * \var IPASessionConfiguration::agc.maxShutterSpeed - * \brief Maximum shutter speed supported with the configured sensor + * The active state stores two distinct categories of information: * - * \var IPASessionConfiguration::agc.minAnalogueGain - * \brief Minimum analogue gain supported with the configured sensor + * - The consolidated value of all algorithm controls. Requests passed to + * the queueRequest() function store values for controls that the + * application wants to modify for that particular frame, and the + * queueRequest() function updates the active state with those values. + * The active state thus contains a consolidated view of the value of all + * controls handled by the algorithm. * - * \var IPASessionConfiguration::agc.maxAnalogueGain - * \brief Maximum analogue gain supported with the configured sensor + * - The value of parameters computed by the algorithm when running in auto + * mode. Algorithms running in auto mode compute new parameters every + * time statistics buffers are received (either synchronously, or + * possibly in a background thread). The latest computed value of those + * parameters is stored in the active state in the process() function. * - * \var IPASessionConfiguration::agc.measureWindow - * \brief AGC measure window + * Each of the members in the active state belongs to a specific algorithm. A + * member may be read by any algorithm, but shall only be written by its owner. + */ + +/** + * \var IPAActiveState::agc + * \brief State for the Automatic Gain Control algorithm * - * \var IPASessionConfiguration::hw - * \brief RkISP1-specific hardware information + * The exposure and gain are the latest values computed by the AGC algorithm. * - * \var IPASessionConfiguration::hw.revision - * \brief Hardware revision of the ISP + * \var IPAActiveState::agc.exposure + * \brief Exposure time expressed as a number of lines + * + * \var IPAActiveState::agc.gain + * \brief Analogue gain multiplier */ /** - * \var IPASessionConfiguration::awb - * \brief AWB parameters configuration of the IPA + * \var IPAActiveState::awb + * \brief State for the Automatic White Balance algorithm * - * \var IPASessionConfiguration::awb.measureWindow - * \brief AWB measure window + * \struct IPAActiveState::awb.gains + * \brief White balance gains + * + * \struct IPAActiveState::awb.gains.manual + * \brief Manual white balance gains (set through requests) + * + * \var IPAActiveState::awb.gains.manual.red + * \brief Manual white balance gain for R channel + * + * \var IPAActiveState::awb.gains.manual.green + * \brief Manual white balance gain for G channel + * + * \var IPAActiveState::awb.gains.manual.blue + * \brief Manual white balance gain for B channel + * + * \struct IPAActiveState::awb.gains.automatic + * \brief Automatic white balance gains (computed by the algorithm) + * + * \var IPAActiveState::awb.gains.automatic.red + * \brief Automatic white balance gain for R channel + * + * \var IPAActiveState::awb.gains.automatic.green + * \brief Automatic white balance gain for G channel + * + * \var IPAActiveState::awb.gains.automatic.blue + * \brief Automatic white balance gain for B channel + * + * \var IPAActiveState::awb.temperatureK + * \brief Estimated color temperature + * + * \var IPAActiveState::awb.autoEnabled + * \brief Whether the Auto White Balance algorithm is enabled */ /** - * \var IPASessionConfiguration::sensor - * \brief Sensor-specific configuration of the IPA + * \var IPAActiveState::cproc + * \brief State for the Color Processing algorithm * - * \var IPASessionConfiguration::sensor.lineDuration - * \brief Line duration in microseconds + * \struct IPAActiveState::cproc.brightness + * \brief Brightness level + * + * \var IPAActiveState::cproc.contrast + * \brief Contrast level + * + * \var IPAActiveState::cproc.saturation + * \brief Saturation level + */ + +/** + * \var IPAActiveState::dpf + * \brief State for the Denoise Pre-Filter algorithm + * + * \var IPAActiveState::dpf.denoise + * \brief Indicates if denoise is activated + */ + +/** + * \var IPAActiveState::filter + * \brief State for the Filter algorithm + * + * \struct IPAActiveState::filter.denoise + * \brief Denoising level + * + * \var IPAActiveState::filter.sharpness + * \brief Sharpness level + */ + +/** + * \struct IPAFrameContext + * \brief Per-frame context for algorithms + * + * The frame context stores two distinct categories of information: + * + * - The value of the controls to be applied to the frame. These values are + * typically set in the queueRequest() function, from the consolidated + * control values stored in the active state. The frame context thus stores + * values for all controls related to the algorithm, not limited to the + * controls specified in the corresponding request, but consolidated from all + * requests that have been queued so far. + * + * For controls that can be set manually or computed by an algorithm + * (depending on the algorithm operation mode), such as for instance the + * colour gains for the AWB algorithm, the control value will be stored in + * the frame context in the queueRequest() function only when operating in + * manual mode. When operating in auto mode, the values are computed by the + * algorithm in process(), stored in the active state, and copied to the + * frame context in prepare(), just before being stored in the ISP parameters + * buffer. + * + * The queueRequest() function can also store ancillary data in the frame + * context, such as flags to indicate if (and what) control values have + * changed compared to the previous request. + * + * - Status information computed by the algorithm for a frame. For instance, + * the colour temperature estimated by the AWB algorithm from ISP statistics + * calculated on a frame is stored in the frame context for that frame in + * the process() function. */ /** * \var IPAFrameContext::agc - * \brief Context for the Automatic Gain Control algorithm + * \brief Automatic Gain Control parameters for this frame * - * The exposure and gain determined are expected to be applied to the sensor - * at the earliest opportunity. + * The exposure and gain are provided by the AGC algorithm, and are to be + * applied to the sensor in order to take effect for this frame. * * \var IPAFrameContext::agc.exposure * \brief Exposure time expressed as a number of lines @@ -115,7 +267,7 @@ namespace libcamera::ipa::rkisp1 { /** * \var IPAFrameContext::awb - * \brief Context for the Automatic White Balance algorithm + * \brief Automatic White Balance parameters for this frame * * \struct IPAFrameContext::awb.gains * \brief White balance gains @@ -131,11 +283,59 @@ namespace libcamera::ipa::rkisp1 { * * \var IPAFrameContext::awb.temperatureK * \brief Estimated color temperature + * + * \var IPAFrameContext::awb.autoEnabled + * \brief Whether the Auto White Balance algorithm is enabled + */ + +/** + * \var IPAFrameContext::cproc + * \brief Color Processing parameters for this frame + * + * \struct IPAFrameContext::cproc.brightness + * \brief Brightness level + * + * \var IPAFrameContext::cproc.contrast + * \brief Contrast level + * + * \var IPAFrameContext::cproc.saturation + * \brief Saturation level + * + * \var IPAFrameContext::cproc.update + * \brief Indicates if the color processing parameters have been updated + * compared to the previous frame + */ + +/** + * \var IPAFrameContext::dpf + * \brief Denoise Pre-Filter parameters for this frame + * + * \var IPAFrameContext::dpf.denoise + * \brief Indicates if denoise is activated + * + * \var IPAFrameContext::dpf.update + * \brief Indicates if the denoise pre-filter parameters have been updated + * compared to the previous frame + */ + +/** + * \var IPAFrameContext::filter + * \brief Filter parameters for this frame + * + * \struct IPAFrameContext::filter.denoise + * \brief Denoising level + * + * \var IPAFrameContext::filter.sharpness + * \brief Sharpness level + * + * \var IPAFrameContext::filter.updateParams + * \brief Indicates if the filter parameters have been updated compared to the + * previous frame */ /** * \var IPAFrameContext::sensor - * \brief Effective sensor values + * \brief Sensor configuration that used been used for this frame * * \var IPAFrameContext::sensor.exposure * \brief Exposure time expressed as a number of lines @@ -145,12 +345,20 @@ namespace libcamera::ipa::rkisp1 { */ /** - * \var IPAFrameContext::frameCount - * \brief Counter of requests queued to the IPA module + * \struct IPAContext + * \brief Global IPA context data shared between all algorithms + * + * \var IPAContext::hw + * \brief RkISP1 version-specific hardware parameters + * + * \var IPAContext::configuration + * \brief The IPA session configuration, immutable during the session + * + * \var IPAContext::activeState + * \brief The IPA active state, storing the latest state for all algorithms * - * The counter is reset to 0 when the IPA module is configured, and is - * incremented for each request being queued, after calling the - * Algorithm::prepare() function of all algorithms. + * \var IPAContext::frameContexts + * \brief Ring buffer of per-frame contexts */ } /* namespace libcamera::ipa::rkisp1 */ diff --git a/src/ipa/rkisp1/ipa_context.h b/src/ipa/rkisp1/ipa_context.h index f387cace..bd02a7a2 100644 --- a/src/ipa/rkisp1/ipa_context.h +++ b/src/ipa/rkisp1/ipa_context.h @@ -2,7 +2,7 @@ /* * Copyright (C) 2021-2022, Ideas On Board * - * ipa_context.h - RkISP1 IPA Context + * RkISP1 IPA Context * */ @@ -12,38 +12,105 @@ #include <libcamera/base/utils.h> +#include <libcamera/controls.h> #include <libcamera/geometry.h> +#include <libipa/fc_queue.h> + namespace libcamera { namespace ipa::rkisp1 { +struct IPAHwSettings { + unsigned int numAeCells; + unsigned int numHistogramBins; + unsigned int numHistogramWeights; + unsigned int numGammaOutSamples; +}; + struct IPASessionConfiguration { struct { - utils::Duration minShutterSpeed; - utils::Duration maxShutterSpeed; - double minAnalogueGain; - double maxAnalogueGain; struct rkisp1_cif_isp_window measureWindow; } agc; struct { struct rkisp1_cif_isp_window measureWindow; + bool enabled; } awb; struct { + bool enabled; + } lsc; + + struct { + utils::Duration minShutterSpeed; + utils::Duration maxShutterSpeed; + double minAnalogueGain; + double maxAnalogueGain; + + int32_t defVBlank; utils::Duration lineDuration; + Size size; } sensor; + bool raw; +}; + +struct IPAActiveState { struct { - rkisp1_cif_isp_version revision; - } hw; + struct { + uint32_t exposure; + double gain; + } manual; + struct { + uint32_t exposure; + double gain; + } automatic; + + bool autoEnabled; + uint32_t constraintMode; + uint32_t exposureMode; + } agc; + + struct { + struct { + struct { + double red; + double green; + double blue; + } manual; + struct { + double red; + double green; + double blue; + } automatic; + } gains; + + unsigned int temperatureK; + bool autoEnabled; + } awb; + + struct { + int8_t brightness; + uint8_t contrast; + uint8_t saturation; + } cproc; + + struct { + bool denoise; + } dpf; + + struct { + uint8_t denoise; + uint8_t sharpness; + } filter; }; -struct IPAFrameContext { +struct IPAFrameContext : public FrameContext { struct { uint32_t exposure; double gain; + bool autoEnabled; } agc; struct { @@ -53,20 +120,42 @@ struct IPAFrameContext { double blue; } gains; - double temperatureK; + unsigned int temperatureK; + bool autoEnabled; } awb; struct { + int8_t brightness; + uint8_t contrast; + uint8_t saturation; + bool update; + } cproc; + + struct { + bool denoise; + bool update; + } dpf; + + struct { + uint8_t denoise; + uint8_t sharpness; + bool update; + } filter; + + struct { uint32_t exposure; double gain; } sensor; - - unsigned int frameCount; }; struct IPAContext { + const IPAHwSettings *hw; IPASessionConfiguration configuration; - IPAFrameContext frameContext; + IPAActiveState activeState; + + FCQueue<IPAFrameContext> frameContexts; + + ControlInfoMap::Map ctrlMap; }; } /* namespace ipa::rkisp1 */ diff --git a/src/ipa/rkisp1/meson.build b/src/ipa/rkisp1/meson.build index ccb84b27..e813da53 100644 --- a/src/ipa/rkisp1/meson.build +++ b/src/ipa/rkisp1/meson.build @@ -29,3 +29,5 @@ if ipa_sign_module install : false, build_by_default : true) endif + +ipa_names += ipa_name diff --git a/src/ipa/rkisp1/module.h b/src/ipa/rkisp1/module.h index 89f83208..16c3e43e 100644 --- a/src/ipa/rkisp1/module.h +++ b/src/ipa/rkisp1/module.h @@ -2,7 +2,7 @@ /* * Copyright (C) 2022, Ideas On Board * - * module.h - RkISP1 IPA Module + * RkISP1 IPA Module */ #pragma once diff --git a/src/ipa/rkisp1/rkisp1.cpp b/src/ipa/rkisp1/rkisp1.cpp index 21166b0f..6687c91e 100644 --- a/src/ipa/rkisp1/rkisp1.cpp +++ b/src/ipa/rkisp1/rkisp1.cpp @@ -2,7 +2,7 @@ /* * Copyright (C) 2019, Google Inc. * - * rkisp1.cpp - RkISP1 Image Processing Algorithms + * RkISP1 Image Processing Algorithms */ #include <algorithm> @@ -24,13 +24,11 @@ #include <libcamera/ipa/rkisp1_ipa_interface.h> #include <libcamera/request.h> +#include "libcamera/internal/formats.h" #include "libcamera/internal/mapped_framebuffer.h" #include "libcamera/internal/yaml_parser.h" -#include "algorithms/agc.h" #include "algorithms/algorithm.h" -#include "algorithms/awb.h" -#include "algorithms/blc.h" #include "libipa/camera_sensor_helper.h" #include "ipa_context.h" @@ -43,16 +41,24 @@ using namespace std::literals::chrono_literals; namespace ipa::rkisp1 { +/* Maximum number of frame contexts to be held */ +static constexpr uint32_t kMaxFrameContexts = 16; + class IPARkISP1 : public IPARkISP1Interface, public Module { public: - int init(const IPASettings &settings, unsigned int hwRevision) override; + IPARkISP1(); + + int init(const IPASettings &settings, unsigned int hwRevision, + const IPACameraSensorInfo &sensorInfo, + const ControlInfoMap &sensorControls, + ControlInfoMap *ipaControls) override; int start() override; - void stop() override {} + void stop() override; - int configure(const IPACameraSensorInfo &info, + int configure(const IPAConfigInfo &ipaConfig, const std::map<uint32_t, IPAStream> &streamConfig, - const std::map<uint32_t, ControlInfoMap> &entityControls) override; + ControlInfoMap *ipaControls) override; void mapBuffers(const std::vector<IPABuffer> &buffers) override; void unmapBuffers(const std::vector<unsigned int> &ids) override; @@ -65,22 +71,15 @@ protected: std::string logPrefix() const override; private: + void updateControls(const IPACameraSensorInfo &sensorInfo, + const ControlInfoMap &sensorControls, + ControlInfoMap *ipaControls); void setControls(unsigned int frame); - void prepareMetadata(unsigned int frame, unsigned int aeState); std::map<unsigned int, FrameBuffer> buffers_; std::map<unsigned int, MappedFrameBuffer> mappedBuffers_; - ControlInfoMap ctrls_; - - /* Camera sensor controls. */ - bool autoExposure_; - - /* revision-specific data */ - rkisp1_cif_isp_version hwRevision_; - unsigned int hwHistBinNMax_; - unsigned int hwGammaOutMaxSamples_; - unsigned int hwHistogramWeightGridsSize_; + ControlInfoMap sensorControls_; /* Interface to the Camera Helper */ std::unique_ptr<CameraSensorHelper> camHelper_; @@ -89,24 +88,59 @@ private: struct IPAContext context_; }; +namespace { + +const IPAHwSettings ipaHwSettingsV10{ + RKISP1_CIF_ISP_AE_MEAN_MAX_V10, + RKISP1_CIF_ISP_HIST_BIN_N_MAX_V10, + RKISP1_CIF_ISP_HISTOGRAM_WEIGHT_GRIDS_SIZE_V10, + RKISP1_CIF_ISP_GAMMA_OUT_MAX_SAMPLES_V10, +}; + +const IPAHwSettings ipaHwSettingsV12{ + RKISP1_CIF_ISP_AE_MEAN_MAX_V12, + RKISP1_CIF_ISP_HIST_BIN_N_MAX_V12, + RKISP1_CIF_ISP_HISTOGRAM_WEIGHT_GRIDS_SIZE_V12, + RKISP1_CIF_ISP_GAMMA_OUT_MAX_SAMPLES_V12, +}; + +/* List of controls handled by the RkISP1 IPA */ +const ControlInfoMap::Map rkisp1Controls{ + { &controls::AeEnable, ControlInfo(false, true) }, + { &controls::AwbEnable, ControlInfo(false, true) }, + { &controls::ColourGains, ControlInfo(0.0f, 3.996f, 1.0f) }, + { &controls::Brightness, ControlInfo(-1.0f, 0.993f, 0.0f) }, + { &controls::Contrast, ControlInfo(0.0f, 1.993f, 1.0f) }, + { &controls::Saturation, ControlInfo(0.0f, 1.993f, 1.0f) }, + { &controls::Sharpness, ControlInfo(0.0f, 10.0f, 1.0f) }, + { &controls::draft::NoiseReductionMode, ControlInfo(controls::draft::NoiseReductionModeValues) }, +}; + +} /* namespace */ + +IPARkISP1::IPARkISP1() + : context_({ {}, {}, {}, { kMaxFrameContexts }, {} }) +{ +} + std::string IPARkISP1::logPrefix() const { return "rkisp1"; } -int IPARkISP1::init(const IPASettings &settings, unsigned int hwRevision) +int IPARkISP1::init(const IPASettings &settings, unsigned int hwRevision, + const IPACameraSensorInfo &sensorInfo, + const ControlInfoMap &sensorControls, + ControlInfoMap *ipaControls) { /* \todo Add support for other revisions */ switch (hwRevision) { case RKISP1_V10: - hwHistBinNMax_ = RKISP1_CIF_ISP_HIST_BIN_N_MAX_V10; - hwGammaOutMaxSamples_ = RKISP1_CIF_ISP_GAMMA_OUT_MAX_SAMPLES_V10; - hwHistogramWeightGridsSize_ = RKISP1_CIF_ISP_HISTOGRAM_WEIGHT_GRIDS_SIZE_V10; + case RKISP1_V_IMX8MP: + context_.hw = &ipaHwSettingsV10; break; case RKISP1_V12: - hwHistBinNMax_ = RKISP1_CIF_ISP_HIST_BIN_N_MAX_V12; - hwGammaOutMaxSamples_ = RKISP1_CIF_ISP_GAMMA_OUT_MAX_SAMPLES_V12; - hwHistogramWeightGridsSize_ = RKISP1_CIF_ISP_HISTOGRAM_WEIGHT_GRIDS_SIZE_V12; + context_.hw = &ipaHwSettingsV12; break; default: LOG(IPARkISP1, Error) @@ -117,10 +151,7 @@ int IPARkISP1::init(const IPASettings &settings, unsigned int hwRevision) LOG(IPARkISP1, Debug) << "Hardware revision is " << hwRevision; - /* Cache the value to set it in configure. */ - hwRevision_ = static_cast<rkisp1_cif_isp_version>(hwRevision); - - camHelper_ = CameraSensorHelperFactory::create(settings.sensorModel); + camHelper_ = CameraSensorHelperFactoryBase::create(settings.sensorModel); if (!camHelper_) { LOG(IPARkISP1, Error) << "Failed to create camera sensor helper for " @@ -128,8 +159,11 @@ int IPARkISP1::init(const IPASettings &settings, unsigned int hwRevision) return -ENODEV; } + context_.configuration.sensor.lineDuration = sensorInfo.minLineLength + * 1.0s / sensorInfo.pixelRate; + /* Load the tuning data file. */ - File file(settings.configurationFile.c_str()); + File file(settings.configurationFile); if (!file.open(File::OpenModeFlag::ReadOnly)) { int ret = file.error(); LOG(IPARkISP1, Error) @@ -155,7 +189,14 @@ int IPARkISP1::init(const IPASettings &settings, unsigned int hwRevision) return -EINVAL; } - return createAlgorithms(context_, (*data)["algorithms"]); + int ret = createAlgorithms(context_, (*data)["algorithms"]); + if (ret) + return ret; + + /* Initialize controls. */ + updateControls(sensorInfo, sensorControls, ipaControls); + + return 0; } int IPARkISP1::start() @@ -165,52 +206,42 @@ int IPARkISP1::start() return 0; } -/** - * \todo The RkISP1 pipeline currently provides an empty IPACameraSensorInfo - * if the connected sensor does not provide enough information to properly - * assemble one. Make sure the reported sensor information are relevant - * before accessing them. - */ -int IPARkISP1::configure([[maybe_unused]] const IPACameraSensorInfo &info, - [[maybe_unused]] const std::map<uint32_t, IPAStream> &streamConfig, - const std::map<uint32_t, ControlInfoMap> &entityControls) +void IPARkISP1::stop() { - if (entityControls.empty()) - return -EINVAL; - - ctrls_ = entityControls.at(0); - - const auto itExp = ctrls_.find(V4L2_CID_EXPOSURE); - if (itExp == ctrls_.end()) { - LOG(IPARkISP1, Error) << "Can't find exposure control"; - return -EINVAL; - } - - const auto itGain = ctrls_.find(V4L2_CID_ANALOGUE_GAIN); - if (itGain == ctrls_.end()) { - LOG(IPARkISP1, Error) << "Can't find gain control"; - return -EINVAL; - } + context_.frameContexts.clear(); +} - autoExposure_ = true; +int IPARkISP1::configure(const IPAConfigInfo &ipaConfig, + const std::map<uint32_t, IPAStream> &streamConfig, + ControlInfoMap *ipaControls) +{ + sensorControls_ = ipaConfig.sensorControls; + const auto itExp = sensorControls_.find(V4L2_CID_EXPOSURE); int32_t minExposure = itExp->second.min().get<int32_t>(); int32_t maxExposure = itExp->second.max().get<int32_t>(); + const auto itGain = sensorControls_.find(V4L2_CID_ANALOGUE_GAIN); int32_t minGain = itGain->second.min().get<int32_t>(); int32_t maxGain = itGain->second.max().get<int32_t>(); - LOG(IPARkISP1, Info) - << "Exposure: " << minExposure << "-" << maxExposure - << " Gain: " << minGain << "-" << maxGain; + LOG(IPARkISP1, Debug) + << "Exposure: [" << minExposure << ", " << maxExposure + << "], gain: [" << minGain << ", " << maxGain << "]"; - /* Clean context at configuration */ - context_ = {}; + /* Clear the IPA context before the streaming session. */ + context_.configuration = {}; + context_.activeState = {}; + context_.frameContexts.clear(); - /* Set the hardware revision for the algorithms. */ - context_.configuration.hw.revision = hwRevision_; + const IPACameraSensorInfo &info = ipaConfig.sensorInfo; + const ControlInfo vBlank = sensorControls_.find(V4L2_CID_VBLANK)->second; + context_.configuration.sensor.defVBlank = vBlank.def().get<int32_t>(); + context_.configuration.sensor.size = info.outputSize; + context_.configuration.sensor.lineDuration = info.minLineLength * 1.0s / info.pixelRate; - context_.configuration.sensor.lineDuration = info.lineLength * 1.0s / info.pixelRate; + /* Update the camera controls using the new sensor settings. */ + updateControls(info, sensorControls_, ipaControls); /* * When the AGC computes the new exposure values for a frame, it needs @@ -219,14 +250,28 @@ int IPARkISP1::configure([[maybe_unused]] const IPACameraSensorInfo &info, * * \todo take VBLANK into account for maximum shutter speed */ - context_.configuration.agc.minShutterSpeed = minExposure * context_.configuration.sensor.lineDuration; - context_.configuration.agc.maxShutterSpeed = maxExposure * context_.configuration.sensor.lineDuration; - context_.configuration.agc.minAnalogueGain = camHelper_->gain(minGain); - context_.configuration.agc.maxAnalogueGain = camHelper_->gain(maxGain); - - context_.frameContext.frameCount = 0; + context_.configuration.sensor.minShutterSpeed = + minExposure * context_.configuration.sensor.lineDuration; + context_.configuration.sensor.maxShutterSpeed = + maxExposure * context_.configuration.sensor.lineDuration; + context_.configuration.sensor.minAnalogueGain = camHelper_->gain(minGain); + context_.configuration.sensor.maxAnalogueGain = camHelper_->gain(maxGain); + + context_.configuration.raw = std::any_of(streamConfig.begin(), streamConfig.end(), + [](auto &cfg) -> bool { + PixelFormat pixelFormat{ cfg.second.pixelFormat }; + const PixelFormatInfo &format = PixelFormatInfo::info(pixelFormat); + return format.colourEncoding == PixelFormatInfo::ColourEncodingRAW; + }); + + for (auto const &a : algorithms()) { + Algorithm *algo = static_cast<Algorithm *>(a.get()); + + /* Disable algorithms that don't support raw formats. */ + algo->disabled_ = context_.configuration.raw && !algo->supportsRaw_; + if (algo->disabled_) + continue; - for (auto const &algo : algorithms()) { int ret = algo->configure(context_, info); if (ret) return ret; @@ -265,14 +310,22 @@ void IPARkISP1::unmapBuffers(const std::vector<unsigned int> &ids) } } -void IPARkISP1::queueRequest([[maybe_unused]] const uint32_t frame, - [[maybe_unused]] const ControlList &controls) +void IPARkISP1::queueRequest(const uint32_t frame, const ControlList &controls) { - /* \todo Start processing for 'frame' based on 'controls'. */ + IPAFrameContext &frameContext = context_.frameContexts.alloc(frame); + + for (auto const &a : algorithms()) { + Algorithm *algo = static_cast<Algorithm *>(a.get()); + if (algo->disabled_) + continue; + algo->queueRequest(context_, frame, frameContext, controls); + } } void IPARkISP1::fillParamsBuffer(const uint32_t frame, const uint32_t bufferId) { + IPAFrameContext &frameContext = context_.frameContexts.get(frame); + rkisp1_params_cfg *params = reinterpret_cast<rkisp1_params_cfg *>( mappedBuffers_.at(bufferId).planes()[0].data()); @@ -281,54 +334,119 @@ void IPARkISP1::fillParamsBuffer(const uint32_t frame, const uint32_t bufferId) memset(params, 0, sizeof(*params)); for (auto const &algo : algorithms()) - algo->prepare(context_, params); + algo->prepare(context_, frame, frameContext, params); paramsBufferReady.emit(frame); - context_.frameContext.frameCount++; } void IPARkISP1::processStatsBuffer(const uint32_t frame, const uint32_t bufferId, const ControlList &sensorControls) { - const rkisp1_stat_buffer *stats = - reinterpret_cast<rkisp1_stat_buffer *>( + IPAFrameContext &frameContext = context_.frameContexts.get(frame); + + /* + * In raw capture mode, the ISP is bypassed and no statistics buffer is + * provided. + */ + const rkisp1_stat_buffer *stats = nullptr; + if (!context_.configuration.raw) + stats = reinterpret_cast<rkisp1_stat_buffer *>( mappedBuffers_.at(bufferId).planes()[0].data()); - context_.frameContext.sensor.exposure = + frameContext.sensor.exposure = sensorControls.get(V4L2_CID_EXPOSURE).get<int32_t>(); - context_.frameContext.sensor.gain = + frameContext.sensor.gain = camHelper_->gain(sensorControls.get(V4L2_CID_ANALOGUE_GAIN).get<int32_t>()); - unsigned int aeState = 0; + ControlList metadata(controls::controls); - for (auto const &algo : algorithms()) - algo->process(context_, nullptr, stats); + for (auto const &a : algorithms()) { + Algorithm *algo = static_cast<Algorithm *>(a.get()); + if (algo->disabled_) + continue; + algo->process(context_, frame, frameContext, stats, metadata); + } setControls(frame); - prepareMetadata(frame, aeState); + metadataReady.emit(frame, metadata); } -void IPARkISP1::setControls(unsigned int frame) +void IPARkISP1::updateControls(const IPACameraSensorInfo &sensorInfo, + const ControlInfoMap &sensorControls, + ControlInfoMap *ipaControls) { - uint32_t exposure = context_.frameContext.agc.exposure; - uint32_t gain = camHelper_->gainCode(context_.frameContext.agc.gain); + ControlInfoMap::Map ctrlMap = rkisp1Controls; - ControlList ctrls(ctrls_); - ctrls.set(V4L2_CID_EXPOSURE, static_cast<int32_t>(exposure)); - ctrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast<int32_t>(gain)); + /* + * Compute exposure time limits from the V4L2_CID_EXPOSURE control + * limits and the line duration. + */ + double lineDuration = context_.configuration.sensor.lineDuration.get<std::micro>(); + const ControlInfo &v4l2Exposure = sensorControls.find(V4L2_CID_EXPOSURE)->second; + int32_t minExposure = v4l2Exposure.min().get<int32_t>() * lineDuration; + int32_t maxExposure = v4l2Exposure.max().get<int32_t>() * lineDuration; + int32_t defExposure = v4l2Exposure.def().get<int32_t>() * lineDuration; + ctrlMap.emplace(std::piecewise_construct, + std::forward_as_tuple(&controls::ExposureTime), + std::forward_as_tuple(minExposure, maxExposure, defExposure)); + + /* Compute the analogue gain limits. */ + const ControlInfo &v4l2Gain = sensorControls.find(V4L2_CID_ANALOGUE_GAIN)->second; + float minGain = camHelper_->gain(v4l2Gain.min().get<int32_t>()); + float maxGain = camHelper_->gain(v4l2Gain.max().get<int32_t>()); + float defGain = camHelper_->gain(v4l2Gain.def().get<int32_t>()); + ctrlMap.emplace(std::piecewise_construct, + std::forward_as_tuple(&controls::AnalogueGain), + std::forward_as_tuple(minGain, maxGain, defGain)); - setSensorControls.emit(frame, ctrls); + /* + * Compute the frame duration limits. + * + * The frame length is computed assuming a fixed line length combined + * with the vertical frame sizes. + */ + const ControlInfo &v4l2HBlank = sensorControls.find(V4L2_CID_HBLANK)->second; + uint32_t hblank = v4l2HBlank.def().get<int32_t>(); + uint32_t lineLength = sensorInfo.outputSize.width + hblank; + + const ControlInfo &v4l2VBlank = sensorControls.find(V4L2_CID_VBLANK)->second; + std::array<uint32_t, 3> frameHeights{ + v4l2VBlank.min().get<int32_t>() + sensorInfo.outputSize.height, + v4l2VBlank.max().get<int32_t>() + sensorInfo.outputSize.height, + v4l2VBlank.def().get<int32_t>() + sensorInfo.outputSize.height, + }; + + std::array<int64_t, 3> frameDurations; + for (unsigned int i = 0; i < frameHeights.size(); ++i) { + uint64_t frameSize = lineLength * frameHeights[i]; + frameDurations[i] = frameSize / (sensorInfo.pixelRate / 1000000U); + } + + ctrlMap[&controls::FrameDurationLimits] = ControlInfo(frameDurations[0], + frameDurations[1], + frameDurations[2]); + + ctrlMap.merge(context_.ctrlMap); + *ipaControls = ControlInfoMap(std::move(ctrlMap), controls::controls); } -void IPARkISP1::prepareMetadata(unsigned int frame, unsigned int aeState) +void IPARkISP1::setControls(unsigned int frame) { - ControlList ctrls(controls::controls); + /* + * \todo The frame number is most likely wrong here, we need to take + * internal sensor delays and other timing parameters into account. + */ + + IPAFrameContext &frameContext = context_.frameContexts.get(frame); + uint32_t exposure = frameContext.agc.exposure; + uint32_t gain = camHelper_->gainCode(frameContext.agc.gain); - if (aeState) - ctrls.set(controls::AeLocked, aeState == 2); + ControlList ctrls(sensorControls_); + ctrls.set(V4L2_CID_EXPOSURE, static_cast<int32_t>(exposure)); + ctrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast<int32_t>(gain)); - metadataReady.emit(frame, ctrls); + setSensorControls.emit(frame, ctrls); } } /* namespace ipa::rkisp1 */ @@ -341,7 +459,7 @@ extern "C" { const struct IPAModuleInfo ipaModuleInfo = { IPA_MODULE_API_VERSION, 1, - "PipelineHandlerRkISP1", + "rkisp1", "rkisp1", }; |