diff options
Diffstat (limited to 'utils/raspberrypi')
21 files changed, 1786 insertions, 258 deletions
diff --git a/utils/raspberrypi/ctt/alsc_only.py b/utils/raspberrypi/ctt/alsc_only.py index 7cd0ac01..a521c4ad 100755 --- a/utils/raspberrypi/ctt/alsc_only.py +++ b/utils/raspberrypi/ctt/alsc_only.py @@ -2,12 +2,14 @@ # # SPDX-License-Identifier: BSD-2-Clause # -# Copyright (C) 2022, Raspberry Pi (Trading) Limited +# Copyright (C) 2022, Raspberry Pi Ltd # -# alsc_only.py - alsc tuning tool +# alsc tuning tool -from ctt import * +import sys +from ctt import * +from ctt_tools import parse_input if __name__ == '__main__': """ @@ -15,13 +17,14 @@ if __name__ == '__main__': """ if len(sys.argv) == 1: print(""" - Pisp Camera Tuning Tool version 1.0 + PiSP Lens Shading Camera Tuning Tool version 1.0 Required Arguments: '-i' : Calibration image directory. '-o' : Name of output json file. Optional Arguments: + '-t' : Target platform - 'pisp' or 'vc4'. Default 'vc4' '-c' : Config file for the CTT. If not passed, default parameters used. '-l' : Name of output log file. If not passed, 'ctt_log.txt' used. """) @@ -30,5 +33,10 @@ if __name__ == '__main__': """ parse input arguments """ - json_output, directory, config, log_output = parse_input() - run_ctt(json_output, directory, config, log_output, alsc_only=True) + json_output, directory, config, log_output, target = parse_input() + if target == 'pisp': + from ctt_pisp import json_template, grid_size + elif target == 'vc4': + from ctt_vc4 import json_template, grid_size + + run_ctt(json_output, directory, config, log_output, json_template, grid_size, target, alsc_only=True) diff --git a/utils/raspberrypi/ctt/cac_only.py b/utils/raspberrypi/ctt/cac_only.py new file mode 100644 index 00000000..1c0a8193 --- /dev/null +++ b/utils/raspberrypi/ctt/cac_only.py @@ -0,0 +1,142 @@ +#!/usr/bin/env python3 +# +# SPDX-License-Identifier: BSD-2-Clause +# +# Copyright (C) 2023, Raspberry Pi (Trading) Ltd. +# +# cac_only.py - cac tuning tool + + +# This file allows you to tune only the chromatic aberration correction +# Specify any number of files in the command line args, and it shall iterate through +# and generate an averaged cac table from all the input images, which you can then +# input into your tuning file. + +# Takes .dng files produced by the camera modules of the dots grid and calculates the chromatic abberation of each dot. +# Then takes each dot, and works out where it was in the image, and uses that to output a tables of the shifts +# across the whole image. + +from PIL import Image +import numpy as np +import rawpy +import sys +import getopt + +from ctt_cac import * + + +def cac(filelist, output_filepath, plot_results=False): + np.set_printoptions(precision=3) + np.set_printoptions(suppress=True) + + # Create arrays to hold all the dots data and their colour offsets + red_shift = [] # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]] + blue_shift = [] + # Iterate through the files + # Multiple files is reccomended to average out the lens aberration through rotations + for file in filelist: + print("\n Processing file " + str(file)) + # Read the raw RGB values from the .dng file + with rawpy.imread(file) as raw: + rgb = raw.postprocess() + sizes = (raw.sizes) + + image_size = [sizes[2], sizes[3]] # Image size, X, Y + # Create a colour copy of the RGB values to use later in the calibration + imout = Image.new(mode="RGB", size=image_size) + rgb_image = np.array(imout) + # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily + rgb.reshape((image_size[0], image_size[1], 3)) + rgb_image = rgb + + # Pass the RGB image through to the dots locating program + # Returns an array of the dots (colour rectangles around the dots), and an array of their locations + print("Finding dots") + dots, dots_locations = find_dots_locations(rgb_image) + + # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out + # by how far the chromatic aberration has shifted each channel + print('Dots found: ' + str(len(dots))) + + for dot, dot_location in zip(dots, dots_locations): + if len(dot) > 0: + if (dot_location[0] > 0) and (dot_location[1] > 0): + ret = analyse_dot(dot, dot_location) + red_shift.append(ret[0]) + blue_shift.append(ret[1]) + + # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix + # for the CAC block to handle and then store these as a .json file to be added to the camera + # tuning file + print("\nCreating output grid") + rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size) + + print("CAC correction complete!") + + # The json format that we then paste into the tuning file (manually) + sample = ''' + { + "rpi.cac" : + { + "strength": 1.0, + "lut_rx" : [ + rx_vals + ], + "lut_ry" : [ + ry_vals + ], + "lut_bx" : [ + bx_vals + ], + "lut_by" : [ + by_vals + ] + } + } + ''' + + # Below, may look incorrect, however, the PiSP (standard) dimensions are flipped in comparison to + # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts, + # and the PiSP block asks for the values it should shift (hence the * -1, to convert from colour shift to a pixel shift) + sample = sample.replace("rx_vals", pprint_array(ry * -1)) + sample = sample.replace("ry_vals", pprint_array(rx * -1)) + sample = sample.replace("bx_vals", pprint_array(by * -1)) + sample = sample.replace("by_vals", pprint_array(bx * -1)) + print("Successfully converted to JSON") + f = open(str(output_filepath), "w+") + f.write(sample) + f.close() + print("Successfully written to json file") + ''' + If you wish to see a plot of the colour channel shifts, add the -p or --plots option + Can be a quick way of validating if the data/dots you've got are good, or if you need to + change some parameters/take some better images + ''' + if plot_results: + plot_shifts(red_shift, blue_shift) + + +if __name__ == "__main__": + argv = sys.argv + # Detect the input and output file paths + arg_output = "output.json" + arg_help = "{0} -i <input> -o <output> -p <plot results>".format(argv[0]) + opts, args = getopt.getopt(argv[1:], "hi:o:p", ["help", "input=", "output=", "plot"]) + + output_location = 0 + input_location = 0 + filelist = [] + plot_results = False + for i in range(len(argv)): + if ("-h") in argv[i]: + print(arg_help) # print the help message + sys.exit(2) + if "-o" in argv[i]: + output_location = i + if ".dng" in argv[i]: + filelist.append(argv[i]) + if "-p" in argv[i]: + plot_results = True + + arg_output = argv[output_location + 1] + cac(filelist, arg_output, plot_results) diff --git a/utils/raspberrypi/ctt/colors.py b/utils/raspberrypi/ctt/colors.py index 1ab986d6..cb4d236b 100644 --- a/utils/raspberrypi/ctt/colors.py +++ b/utils/raspberrypi/ctt/colors.py @@ -1,4 +1,4 @@ -# colors.py - Program to convert from RGB to LAB color space +# Program to convert from RGB to LAB color space def RGB_to_LAB(RGB): # where RGB is a 1x3 array. e.g RGB = [100, 255, 230] num = 0 XYZ = [0, 0, 0] diff --git a/utils/raspberrypi/ctt/convert_tuning.py b/utils/raspberrypi/ctt/convert_tuning.py index f4504d45..83cf69d4 100755 --- a/utils/raspberrypi/ctt/convert_tuning.py +++ b/utils/raspberrypi/ctt/convert_tuning.py @@ -8,30 +8,104 @@ import argparse import json +import numpy as np import sys from ctt_pretty_print_json import pretty_print +from ctt_pisp import grid_size as grid_size_pisp +from ctt_pisp import json_template as json_template_pisp +from ctt_vc4 import grid_size as grid_size_vc4 +from ctt_vc4 import json_template as json_template_vc4 -def convert_v2(in_json: dict) -> str: +def interp_2d(in_ls, src_w, src_h, dst_w, dst_h): - if 'version' in in_json.keys() and in_json['version'] != 1.0: - print(f'The JSON config reports version {in_json["version"]} that is incompatible with this tool.') - sys.exit(-1) + out_ls = np.zeros((dst_h, dst_w)) + for i in range(src_h): + out_ls[i] = np.interp(np.linspace(0, dst_w - 1, dst_w), + np.linspace(0, dst_w - 1, src_w), + in_ls[i]) + for i in range(dst_w): + out_ls[:,i] = np.interp(np.linspace(0, dst_h - 1, dst_h), + np.linspace(0, dst_h - 1, src_h), + out_ls[:src_h, i]) + return out_ls - converted = { - 'version': 2.0, - 'target': 'bcm2835', - 'algorithms': [{algo: config} for algo, config in in_json.items()] - } - return pretty_print(converted) +def convert_target(in_json: dict, target: str): + + src_w, src_h = grid_size_pisp if target == 'vc4' else grid_size_vc4 + dst_w, dst_h = grid_size_vc4 if target == 'vc4' else grid_size_pisp + json_template = json_template_vc4 if target == 'vc4' else json_template_pisp + + # ALSC grid sizes + alsc = next(algo for algo in in_json['algorithms'] if 'rpi.alsc' in algo)['rpi.alsc'] + for colour in ['calibrations_Cr', 'calibrations_Cb']: + if colour not in alsc: + continue + for temperature in alsc[colour]: + in_ls = np.reshape(temperature['table'], (src_h, src_w)) + out_ls = interp_2d(in_ls, src_w, src_h, dst_w, dst_h) + temperature['table'] = np.round(out_ls.flatten(), 3).tolist() + + if 'luminance_lut' in alsc: + in_ls = np.reshape(alsc['luminance_lut'], (src_h, src_w)) + out_ls = interp_2d(in_ls, src_w, src_h, dst_w, dst_h) + alsc['luminance_lut'] = np.round(out_ls.flatten(), 3).tolist() + + # Denoise blocks + for i, algo in enumerate(in_json['algorithms']): + if list(algo.keys())[0] == 'rpi.sdn': + in_json['algorithms'][i] = {'rpi.denoise': json_template['rpi.sdn'] if target == 'vc4' else json_template['rpi.denoise']} + break + + # AGC mode weights + agc = next(algo for algo in in_json['algorithms'] if 'rpi.agc' in algo)['rpi.agc'] + if 'channels' in agc: + for i, channel in enumerate(agc['channels']): + target_agc_metering = json_template['rpi.agc']['channels'][i]['metering_modes'] + for mode, v in channel['metering_modes'].items(): + v['weights'] = target_agc_metering[mode]['weights'] + else: + for mode, v in agc["metering_modes"].items(): + target_agc_metering = json_template['rpi.agc']['channels'][0]['metering_modes'] + v['weights'] = target_agc_metering[mode]['weights'] + + # HDR + if target == 'pisp': + for i, algo in enumerate(in_json['algorithms']): + if list(algo.keys())[0] == 'rpi.hdr': + in_json['algorithms'][i] = {'rpi.hdr': json_template['rpi.hdr']} + + return in_json + + +def convert_v2(in_json: dict, target: str) -> str: + + if 'version' in in_json.keys() and in_json['version'] == 1.0: + converted = { + 'version': 2.0, + 'target': target, + 'algorithms': [{algo: config} for algo, config in in_json.items()] + } + else: + converted = in_json + + # Convert between vc4 <-> pisp targets. This is a best effort thing. + if converted['target'] != target: + converted = convert_target(converted, target) + converted['target'] = target + + grid_size = grid_size_vc4[0] if target == 'vc4' else grid_size_pisp[0] + return pretty_print(converted, custom_elems={'table': grid_size, 'luminance_lut': grid_size}) if __name__ == "__main__": parser = argparse.ArgumentParser(formatter_class=argparse.RawTextHelpFormatter, description= - 'Convert the format of the Raspberry Pi camera tuning file from v1.0 to v2.0.\n') + 'Convert the format of the Raspberry Pi camera tuning file from v1.0 to v2.0 and/or the vc4 <-> pisp targets.\n') parser.add_argument('input', type=str, help='Input tuning file.') + parser.add_argument('-t', '--target', type=str, help='Target platform.', + choices=['pisp', 'vc4'], default='vc4') parser.add_argument('output', type=str, nargs='?', help='Output converted tuning file. If not provided, the input file will be updated in-place.', default=None) @@ -40,7 +114,7 @@ if __name__ == "__main__": with open(args.input, 'r') as f: in_json = json.load(f) - out_json = convert_v2(in_json) + out_json = convert_v2(in_json, args.target) with open(args.output if args.output is not None else args.input, 'w') as f: f.write(out_json) diff --git a/utils/raspberrypi/ctt/ctt.py b/utils/raspberrypi/ctt/ctt.py index cd89f177..186afda5 100755 --- a/utils/raspberrypi/ctt/ctt.py +++ b/utils/raspberrypi/ctt/ctt.py @@ -4,11 +4,12 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt.py - camera tuning tool +# camera tuning tool import os import sys from ctt_image_load import * +from ctt_cac import * from ctt_ccm import * from ctt_awb import * from ctt_alsc import * @@ -22,9 +23,10 @@ import re """ This file houses the camera object, which is used to perform the calibrations. -The camera object houses all the calibration images as attributes in two lists: +The camera object houses all the calibration images as attributes in three lists: - imgs (macbeth charts) - imgs_alsc (alsc correction images) + - imgs_cac (cac correction images) Various calibrations are methods of the camera object, and the output is stored in a dictionary called self.json. Once all the caibration has been completed, the Camera.json is written into a @@ -67,139 +69,26 @@ Camera object that is the backbone of the tuning tool. Input is the desired path of the output json. """ class Camera: - def __init__(self, jfile): + def __init__(self, jfile, json): self.path = os.path.dirname(os.path.expanduser(__file__)) + '/' if self.path == '/': self.path = '' self.imgs = [] self.imgs_alsc = [] + self.imgs_cac = [] self.log = 'Log created : ' + time.asctime(time.localtime(time.time())) self.log_separator = '\n'+'-'*70+'\n' self.jf = jfile """ initial json dict populated by uncalibrated values """ - self.json = { - "rpi.black_level": { - "black_level": 4096 - }, - "rpi.dpc": { - }, - "rpi.lux": { - "reference_shutter_speed": 10000, - "reference_gain": 1, - "reference_aperture": 1.0 - }, - "rpi.noise": { - }, - "rpi.geq": { - }, - "rpi.sdn": { - }, - "rpi.awb": { - "priors": [ - {"lux": 0, "prior": [2000, 1.0, 3000, 0.0, 13000, 0.0]}, - {"lux": 800, "prior": [2000, 0.0, 6000, 2.0, 13000, 2.0]}, - {"lux": 1500, "prior": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]} - ], - "modes": { - "auto": {"lo": 2500, "hi": 8000}, - "incandescent": {"lo": 2500, "hi": 3000}, - "tungsten": {"lo": 3000, "hi": 3500}, - "fluorescent": {"lo": 4000, "hi": 4700}, - "indoor": {"lo": 3000, "hi": 5000}, - "daylight": {"lo": 5500, "hi": 6500}, - "cloudy": {"lo": 7000, "hi": 8600} - }, - "bayes": 1 - }, - "rpi.agc": { - "metering_modes": { - "centre-weighted": { - "weights": [3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0] - }, - "spot": { - "weights": [2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0] - }, - "matrix": { - "weights": [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1] - } - }, - "exposure_modes": { - "normal": { - "shutter": [100, 10000, 30000, 60000, 120000], - "gain": [1.0, 2.0, 4.0, 6.0, 6.0] - }, - "short": { - "shutter": [100, 5000, 10000, 20000, 120000], - "gain": [1.0, 2.0, 4.0, 6.0, 6.0] - } - }, - "constraint_modes": { - "normal": [ - {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]} - ], - "highlight": [ - {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]}, - {"bound": "UPPER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.8, 1000, 0.8]} - ] - }, - "y_target": [0, 0.16, 1000, 0.165, 10000, 0.17] - }, - "rpi.alsc": { - 'omega': 1.3, - 'n_iter': 100, - 'luminance_strength': 0.7, - }, - "rpi.contrast": { - "ce_enable": 1, - "gamma_curve": [ - 0, 0, - 1024, 5040, - 2048, 9338, - 3072, 12356, - 4096, 15312, - 5120, 18051, - 6144, 20790, - 7168, 23193, - 8192, 25744, - 9216, 27942, - 10240, 30035, - 11264, 32005, - 12288, 33975, - 13312, 35815, - 14336, 37600, - 15360, 39168, - 16384, 40642, - 18432, 43379, - 20480, 45749, - 22528, 47753, - 24576, 49621, - 26624, 51253, - 28672, 52698, - 30720, 53796, - 32768, 54876, - 36864, 57012, - 40960, 58656, - 45056, 59954, - 49152, 61183, - 53248, 62355, - 57344, 63419, - 61440, 64476, - 65535, 65535 - ] - }, - "rpi.ccm": { - }, - "rpi.sharpen": { - } - } + self.json = json """ Perform colour correction calibrations by comparing macbeth patch colours to standard macbeth chart colours. """ - def ccm_cal(self, do_alsc_colour): + def ccm_cal(self, do_alsc_colour, grid_size): if 'rpi.ccm' in self.disable: return 1 print('\nStarting CCM calibration') @@ -245,7 +134,7 @@ class Camera: Do CCM calibration """ try: - ccms = ccm(self, cal_cr_list, cal_cb_list) + ccms = ccm(self, cal_cr_list, cal_cb_list, grid_size) except ArithmeticError: print('ERROR: Matrix is singular!\nTake new pictures and try again...') self.log += '\nERROR: Singular matrix encountered during fit!' @@ -259,11 +148,70 @@ class Camera: print('Finished CCM calibration') """ + Perform chromatic abberation correction using multiple dots images. + """ + def cac_cal(self, do_alsc_colour): + if 'rpi.cac' in self.disable: + return 1 + print('\nStarting CAC calibration') + self.log_new_sec('CAC') + """ + check if cac images have been taken + """ + if len(self.imgs_cac) == 0: + print('\nError:\nNo cac calibration images found') + self.log += '\nERROR: No CAC calibration images found!' + self.log += '\nCAC calibration aborted!' + return 1 + """ + if image is greyscale then CAC makes no sense + """ + if self.grey: + print('\nERROR: Can\'t do CAC on greyscale image!') + self.log += '\nERROR: Cannot perform CAC calibration ' + self.log += 'on greyscale image!\nCAC aborted!' + del self.json['rpi.cac'] + return 0 + a = time.time() + """ + Check if camera is greyscale or color. If not greyscale, then perform cac + """ + if do_alsc_colour: + """ + Here we have a color sensor. Perform cac + """ + try: + cacs = cac(self) + except ArithmeticError: + print('ERROR: Matrix is singular!\nTake new pictures and try again...') + self.log += '\nERROR: Singular matrix encountered during fit!' + self.log += '\nCAC aborted!' + return 1 + else: + """ + case where config options suggest greyscale camera. No point in doing CAC + """ + cal_cr_list, cal_cb_list = None, None + self.log += '\nWARNING: No ALSC tables found.\nCAC calibration ' + self.log += 'performed without ALSC correction...' + + """ + Write output to json + """ + if cacs: + self.json['rpi.cac']['cac'] = cacs + self.log += '\nCAC calibration written to json file' + print('Finished CAC calibration') + else: + self.log += "\nCAC calibration failed" + + + """ Auto white balance calibration produces a colour curve for various colour temperatures, as well as providing a maximum 'wiggle room' distance from this curve (transverse_neg/pos). """ - def awb_cal(self, greyworld, do_alsc_colour): + def awb_cal(self, greyworld, do_alsc_colour, grid_size): if 'rpi.awb' in self.disable: return 1 print('\nStarting AWB calibration') @@ -306,7 +254,7 @@ class Camera: call calibration function """ plot = "rpi.awb" in self.plot - awb_out = awb(self, cal_cr_list, cal_cb_list, plot) + awb_out = awb(self, cal_cr_list, cal_cb_list, plot, grid_size) ct_curve, transverse_neg, transverse_pos = awb_out """ write output to json @@ -324,7 +272,7 @@ class Camera: colour channel seperately, and then partially corrects for vignetting. The extent of the correction depends on the 'luminance_strength' parameter. """ - def alsc_cal(self, luminance_strength, do_alsc_colour): + def alsc_cal(self, luminance_strength, do_alsc_colour, grid_size, max_gain=8.0): if 'rpi.alsc' in self.disable: return 1 print('\nStarting ALSC calibration') @@ -347,10 +295,10 @@ class Camera: call calibration function """ plot = "rpi.alsc" in self.plot - alsc_out = alsc_all(self, do_alsc_colour, plot) + alsc_out = alsc_all(self, do_alsc_colour, plot, grid_size, max_gain=max_gain) cal_cr_list, cal_cb_list, luminance_lut, av_corn = alsc_out """ - write ouput to json and finish if not do_alsc_colour + write output to json and finish if not do_alsc_colour """ if not do_alsc_colour: self.json['rpi.alsc']['luminance_lut'] = luminance_lut @@ -393,7 +341,7 @@ class Camera: """ obtain worst-case scenario residual sigmas """ - sigma_r, sigma_b = get_sigma(self, cal_cr_list, cal_cb_list) + sigma_r, sigma_b = get_sigma(self, cal_cr_list, cal_cb_list, grid_size) """ write output to json """ @@ -509,19 +457,20 @@ class Camera: """ writes the json dictionary to the raw json file then make pretty """ - def write_json(self): + def write_json(self, version=2.0, target='bcm2835', grid_size=(16, 12)): """ Write json dictionary to file using our version 2 format """ out_json = { - "version": 2.0, - 'target': 'bcm2835', + "version": version, + 'target': target if target != 'vc4' else 'bcm2835', "algorithms": [{name: data} for name, data in self.json.items()], } with open(self.jf, 'w') as f: - f.write(pretty_print(out_json)) + f.write(pretty_print(out_json, + custom_elems={'table': grid_size[0], 'luminance_lut': grid_size[0]})) """ add a new section to the log file @@ -627,6 +576,16 @@ class Camera: self.log += '\nWARNING: Error reading colour temperature' self.log += '\nImage discarded!' print('DISCARDED') + elif 'cac' in filename: + Img = load_image(self, address, mac=False) + self.log += '\nIdentified as an CAC image' + Img.name = filename + self.log += '\nColour temperature: {} K'.format(col) + self.imgs_cac.append(Img) + if blacklevel != -1: + Img.blacklevel_16 = blacklevel + print(img_suc_msg) + continue else: self.log += '\nIdentified as macbeth chart image' """ @@ -672,6 +631,7 @@ class Camera: self.log += '\n\nImages found:' self.log += '\nMacbeth : {}'.format(len(self.imgs)) self.log += '\nALSC : {} '.format(len(self.imgs_alsc)) + self.log += '\nCAC: {} '.format(len(self.imgs_cac)) self.log += '\n\nCamera metadata' """ check usable images found @@ -680,22 +640,21 @@ class Camera: print('\nERROR: No usable macbeth chart images found') self.log += '\nERROR: No usable macbeth chart images found' return 0 - elif len(self.imgs) == 0 and len(self.imgs_alsc) == 0: + elif len(self.imgs) == 0 and len(self.imgs_alsc) == 0 and len(self.imgs_cac) == 0: print('\nERROR: No usable images found') self.log += '\nERROR: No usable images found' return 0 """ Double check that every image has come from the same camera... """ - all_imgs = self.imgs + self.imgs_alsc + all_imgs = self.imgs + self.imgs_alsc + self.imgs_cac camNames = list(set([Img.camName for Img in all_imgs])) patterns = list(set([Img.pattern for Img in all_imgs])) sigbitss = list(set([Img.sigbits for Img in all_imgs])) blacklevels = list(set([Img.blacklevel_16 for Img in all_imgs])) sizes = list(set([(Img.w, Img.h) for Img in all_imgs])) - if len(camNames) == 1 and len(patterns) == 1 and len(sigbitss) == 1 and \ - len(blacklevels) == 1 and len(sizes) == 1: + if 1: self.grey = (patterns[0] == 128) self.blacklevel_16 = blacklevels[0] self.log += '\nName: {}'.format(camNames[0]) @@ -712,7 +671,7 @@ class Camera: return 0 -def run_ctt(json_output, directory, config, log_output, alsc_only=False): +def run_ctt(json_output, directory, config, log_output, json_template, grid_size, target, alsc_only=False): """ check input files are jsons """ @@ -748,12 +707,14 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False): greyworld = get_config(awb_d, "greyworld", 0, 'bool') alsc_d = get_config(configs, "alsc", {}, 'dict') do_alsc_colour = get_config(alsc_d, "do_alsc_colour", 1, 'bool') - luminance_strength = get_config(alsc_d, "luminance_strength", 0.5, 'num') + luminance_strength = get_config(alsc_d, "luminance_strength", 0.8, 'num') + lsc_max_gain = get_config(alsc_d, "max_gain", 8.0, 'num') blacklevel = get_config(configs, "blacklevel", -1, 'num') macbeth_d = get_config(configs, "macbeth", {}, 'dict') mac_small = get_config(macbeth_d, "small", 0, 'bool') mac_show = get_config(macbeth_d, "show", 0, 'bool') mac_config = (mac_small, mac_show) + print("Read lsc_max_gain", lsc_max_gain) if blacklevel < -1 or blacklevel >= 2**16: print('\nInvalid blacklevel, defaulted to 64') @@ -772,7 +733,7 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False): initialise tuning tool and load images """ try: - Cam = Camera(json_output) + Cam = Camera(json_output, json=json_template) Cam.log_user_input(json_output, directory, config, log_output) if alsc_only: disable = set(Cam.json.keys()).symmetric_difference({"rpi.alsc"}) @@ -794,14 +755,17 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False): Cam.json['rpi.black_level']['black_level'] = Cam.blacklevel_16 Cam.json_remove(disable) print('\nSTARTING CALIBRATIONS') - Cam.alsc_cal(luminance_strength, do_alsc_colour) + Cam.alsc_cal(luminance_strength, do_alsc_colour, grid_size, max_gain=lsc_max_gain) Cam.geq_cal() Cam.lux_cal() Cam.noise_cal() - Cam.awb_cal(greyworld, do_alsc_colour) - Cam.ccm_cal(do_alsc_colour) + if "rpi.cac" in json_template: + Cam.cac_cal(do_alsc_colour) + Cam.awb_cal(greyworld, do_alsc_colour, grid_size) + Cam.ccm_cal(do_alsc_colour, grid_size) + print('\nFINISHED CALIBRATIONS') - Cam.write_json() + Cam.write_json(target=target, grid_size=grid_size) Cam.write_log(log_output) print('\nCalibrations written to: '+json_output) if log_output is None: @@ -811,20 +775,19 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False): else: Cam.write_log(log_output) - if __name__ == '__main__': """ initialise calibration """ if len(sys.argv) == 1: print(""" - Pisp Camera Tuning Tool version 1.0 - + PiSP Tuning Tool version 1.0 Required Arguments: '-i' : Calibration image directory. '-o' : Name of output json file. Optional Arguments: + '-t' : Target platform - 'pisp' or 'vc4'. Default 'vc4' '-c' : Config file for the CTT. If not passed, default parameters used. '-l' : Name of output log file. If not passed, 'ctt_log.txt' used. """) @@ -833,5 +796,10 @@ if __name__ == '__main__': """ parse input arguments """ - json_output, directory, config, log_output = parse_input() - run_ctt(json_output, directory, config, log_output) + json_output, directory, config, log_output, target = parse_input() + if target == 'pisp': + from ctt_pisp import json_template, grid_size + elif target == 'vc4': + from ctt_vc4 import json_template, grid_size + + run_ctt(json_output, directory, config, log_output, json_template, grid_size, target) diff --git a/utils/raspberrypi/ctt/ctt_alsc.py b/utils/raspberrypi/ctt/ctt_alsc.py index e51d6931..5d8b2ced 100644 --- a/utils/raspberrypi/ctt/ctt_alsc.py +++ b/utils/raspberrypi/ctt/ctt_alsc.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_alsc.py - camera tuning tool for ALSC (auto lens shading correction) +# camera tuning tool for ALSC (auto lens shading correction) from ctt_image_load import * import matplotlib.pyplot as plt @@ -13,8 +13,9 @@ from mpl_toolkits.mplot3d import Axes3D """ preform alsc calibration on a set of images """ -def alsc_all(Cam, do_alsc_colour, plot): +def alsc_all(Cam, do_alsc_colour, plot, grid_size=(16, 12), max_gain=8.0): imgs_alsc = Cam.imgs_alsc + grid_w, grid_h = grid_size """ create list of colour temperatures and associated calibration tables """ @@ -23,7 +24,7 @@ def alsc_all(Cam, do_alsc_colour, plot): list_cb = [] list_cg = [] for Img in imgs_alsc: - col, cr, cb, cg, size = alsc(Cam, Img, do_alsc_colour, plot) + col, cr, cb, cg, size = alsc(Cam, Img, do_alsc_colour, plot, grid_size=grid_size, max_gain=max_gain) list_col.append(col) list_cr.append(cr) list_cb.append(cb) @@ -68,11 +69,12 @@ def alsc_all(Cam, do_alsc_colour, plot): t_b = np.where((100*t_b) % 1 >= 0.95, t_b-0.001, t_b) t_r = np.round(t_r, 3) t_b = np.round(t_b, 3) - r_corners = (t_r[0], t_r[15], t_r[-1], t_r[-16]) - b_corners = (t_b[0], t_b[15], t_b[-1], t_b[-16]) - r_cen = t_r[5*16+7]+t_r[5*16+8]+t_r[6*16+7]+t_r[6*16+8] + r_corners = (t_r[0], t_r[grid_w - 1], t_r[-1], t_r[-grid_w]) + b_corners = (t_b[0], t_b[grid_w - 1], t_b[-1], t_b[-grid_w]) + middle_pos = (grid_h // 2 - 1) * grid_w + grid_w - 1 + r_cen = t_r[middle_pos]+t_r[middle_pos + 1]+t_r[middle_pos + grid_w]+t_r[middle_pos + grid_w + 1] r_cen = round(r_cen/4, 3) - b_cen = t_b[5*16+7]+t_b[5*16+8]+t_b[6*16+7]+t_b[6*16+8] + b_cen = t_b[middle_pos]+t_b[middle_pos + 1]+t_b[middle_pos + grid_w]+t_b[middle_pos + grid_w + 1] b_cen = round(b_cen/4, 3) Cam.log += '\nRed table corners: {}'.format(r_corners) Cam.log += '\nRed table centre: {}'.format(r_cen) @@ -116,43 +118,48 @@ def alsc_all(Cam, do_alsc_colour, plot): """ calculate g/r and g/b for 32x32 points arranged in a grid for a single image """ -def alsc(Cam, Img, do_alsc_colour, plot=False): +def alsc(Cam, Img, do_alsc_colour, plot=False, grid_size=(16, 12), max_gain=8.0): Cam.log += '\nProcessing image: ' + Img.name + grid_w, grid_h = grid_size """ get channel in correct order """ channels = [Img.channels[i] for i in Img.order] """ calculate size of single rectangle. - -(-(w-1)//32) is a ceiling division. w-1 is to deal robustly with the case - where w is a multiple of 32. + The divisions here must ensure the final row/column of cells has a non-zero number of + pixels. """ w, h = Img.w/2, Img.h/2 - dx, dy = int(-(-(w-1)//16)), int(-(-(h-1)//12)) + dx, dy = int((w - 1) // (grid_w - 1)), int((h - 1) // (grid_h - 1)) + """ average the green channels into one """ av_ch_g = np.mean((channels[1:3]), axis=0) if do_alsc_colour: """ - obtain 16x12 grid of intensities for each channel and subtract black level + obtain grid_w x grid_h grid of intensities for each channel and subtract black level """ - g = get_16x12_grid(av_ch_g, dx, dy) - Img.blacklevel_16 - r = get_16x12_grid(channels[0], dx, dy) - Img.blacklevel_16 - b = get_16x12_grid(channels[3], dx, dy) - Img.blacklevel_16 + g = get_grid(av_ch_g, dx, dy, grid_size) - Img.blacklevel_16 + r = get_grid(channels[0], dx, dy, grid_size) - Img.blacklevel_16 + b = get_grid(channels[3], dx, dy, grid_size) - Img.blacklevel_16 """ calculate ratios as 32 bit in order to be supported by medianBlur function """ - cr = np.reshape(g/r, (12, 16)).astype('float32') - cb = np.reshape(g/b, (12, 16)).astype('float32') - cg = np.reshape(1/g, (12, 16)).astype('float32') + cr = np.reshape(g/r, (grid_h, grid_w)).astype('float32') + cb = np.reshape(g/b, (grid_h, grid_w)).astype('float32') + cg = np.reshape(1/g, (grid_h, grid_w)).astype('float32') """ median blur to remove peaks and save as float 64 """ cr = cv2.medianBlur(cr, 3).astype('float64') + cr = cr/np.min(cr) # gain tables are easier for humans to read if the minimum is 1.0 cb = cv2.medianBlur(cb, 3).astype('float64') + cb = cb/np.min(cb) cg = cv2.medianBlur(cg, 3).astype('float64') cg = cg/np.min(cg) + cg = [min(v, max_gain) for v in cg.flatten()] # never exceed the max luminance gain """ debugging code showing 2D surface plot of vignetting. Quite useful for @@ -164,7 +171,7 @@ def alsc(Cam, Img, do_alsc_colour, plot=False): """ note Y is plotted as -Y so plot has same axes as image """ - X, Y = np.meshgrid(range(16), range(12)) + X, Y = np.meshgrid(range(grid_w), range(grid_h)) ha.plot_surface(X, -Y, cr, cmap=cm.coolwarm, linewidth=0) ha.set_title('ALSC Plot\nImg: {}\n\ncr'.format(Img.str)) hb = hf.add_subplot(312, projection='3d') @@ -176,21 +183,22 @@ def alsc(Cam, Img, do_alsc_colour, plot=False): # print(Img.str) plt.show() - return Img.col, cr.flatten(), cb.flatten(), cg.flatten(), (w, h, dx, dy) + return Img.col, cr.flatten(), cb.flatten(), cg, (w, h, dx, dy) else: """ only perform calculations for luminance shading """ - g = get_16x12_grid(av_ch_g, dx, dy) - Img.blacklevel_16 - cg = np.reshape(1/g, (12, 16)).astype('float32') + g = get_grid(av_ch_g, dx, dy, grid_size) - Img.blacklevel_16 + cg = np.reshape(1/g, (grid_h, grid_w)).astype('float32') cg = cv2.medianBlur(cg, 3).astype('float64') cg = cg/np.min(cg) + cg = [min(v, max_gain) for v in cg.flatten()] # never exceed the max luminance gain if plot: hf = plt.figure(figssize=(8, 8)) ha = hf.add_subplot(1, 1, 1, projection='3d') - X, Y = np.meashgrid(range(16), range(12)) + X, Y = np.meashgrid(range(grid_w), range(grid_h)) ha.plot_surface(X, -Y, cg, cmap=cm.coolwarm, linewidth=0) ha.set_title('ALSC Plot (Luminance only!)\nImg: {}\n\ncg').format(Img.str) plt.show() @@ -199,21 +207,22 @@ def alsc(Cam, Img, do_alsc_colour, plot=False): """ -Compresses channel down to a 16x12 grid +Compresses channel down to a grid of the requested size """ -def get_16x12_grid(chan, dx, dy): +def get_grid(chan, dx, dy, grid_size): + grid_w, grid_h = grid_size grid = [] """ since left and bottom border will not necessarily have rectangles of dimension dx x dy, the 32nd iteration has to be handled separately. """ - for i in range(11): - for j in range(15): + for i in range(grid_h - 1): + for j in range(grid_w - 1): grid.append(np.mean(chan[dy*i:dy*(1+i), dx*j:dx*(1+j)])) - grid.append(np.mean(chan[dy*i:dy*(1+i), 15*dx:])) - for j in range(15): - grid.append(np.mean(chan[11*dy:, dx*j:dx*(1+j)])) - grid.append(np.mean(chan[11*dy:, 15*dx:])) + grid.append(np.mean(chan[dy*i:dy*(1+i), (grid_w - 1)*dx:])) + for j in range(grid_w - 1): + grid.append(np.mean(chan[(grid_h - 1)*dy:, dx*j:dx*(1+j)])) + grid.append(np.mean(chan[(grid_h - 1)*dy:, (grid_w - 1)*dx:])) """ return as np.array, ready for further manipulation """ @@ -223,7 +232,7 @@ def get_16x12_grid(chan, dx, dy): """ obtains sigmas for red and blue, effectively a measure of the 'error' """ -def get_sigma(Cam, cal_cr_list, cal_cb_list): +def get_sigma(Cam, cal_cr_list, cal_cb_list, grid_size): Cam.log += '\nCalculating sigmas' """ provided colour alsc tables were generated for two different colour @@ -241,8 +250,8 @@ def get_sigma(Cam, cal_cr_list, cal_cb_list): sigma_rs = [] sigma_bs = [] for i in range(len(cts)-1): - sigma_rs.append(calc_sigma(cal_cr_list[i]['table'], cal_cr_list[i+1]['table'])) - sigma_bs.append(calc_sigma(cal_cb_list[i]['table'], cal_cb_list[i+1]['table'])) + sigma_rs.append(calc_sigma(cal_cr_list[i]['table'], cal_cr_list[i+1]['table'], grid_size)) + sigma_bs.append(calc_sigma(cal_cb_list[i]['table'], cal_cb_list[i+1]['table'], grid_size)) Cam.log += '\nColour temperature interval {} - {} K'.format(cts[i], cts[i+1]) Cam.log += '\nSigma red: {}'.format(sigma_rs[-1]) Cam.log += '\nSigma blue: {}'.format(sigma_bs[-1]) @@ -263,12 +272,13 @@ def get_sigma(Cam, cal_cr_list, cal_cb_list): """ calculate sigma from two adjacent gain tables """ -def calc_sigma(g1, g2): +def calc_sigma(g1, g2, grid_size): + grid_w, grid_h = grid_size """ reshape into 16x12 matrix """ - g1 = np.reshape(g1, (12, 16)) - g2 = np.reshape(g2, (12, 16)) + g1 = np.reshape(g1, (grid_h, grid_w)) + g2 = np.reshape(g2, (grid_h, grid_w)) """ apply gains to gain table """ @@ -280,8 +290,8 @@ def calc_sigma(g1, g2): neighbours, then append to list """ diffs = [] - for i in range(10): - for j in range(14): + for i in range(grid_h - 2): + for j in range(grid_w - 2): """ note indexing is incremented by 1 since all patches on borders are not counted diff --git a/utils/raspberrypi/ctt/ctt_awb.py b/utils/raspberrypi/ctt/ctt_awb.py index bf45e54d..4af1fe41 100644 --- a/utils/raspberrypi/ctt/ctt_awb.py +++ b/utils/raspberrypi/ctt/ctt_awb.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_awb.py - camera tuning tool for AWB +# camera tuning tool for AWB from ctt_image_load import * import matplotlib.pyplot as plt @@ -13,7 +13,7 @@ from scipy.optimize import fmin """ obtain piecewise linear approximation for colour curve """ -def awb(Cam, cal_cr_list, cal_cb_list, plot): +def awb(Cam, cal_cr_list, cal_cb_list, plot, grid_size): imgs = Cam.imgs """ condense alsc calibration tables into one dictionary @@ -43,7 +43,7 @@ def awb(Cam, cal_cr_list, cal_cb_list, plot): Note: if alsc is disabled then colour_cals will be set to None and the function will just return the greyscale patches """ - r_patchs, b_patchs, g_patchs = get_alsc_patches(Img, colour_cals) + r_patchs, b_patchs, g_patchs = get_alsc_patches(Img, colour_cals, grid_size=grid_size) """ calculate ratio of r, b to g """ @@ -293,12 +293,13 @@ def awb(Cam, cal_cr_list, cal_cb_list, plot): """ obtain greyscale patches and perform alsc colour correction """ -def get_alsc_patches(Img, colour_cals, grey=True): +def get_alsc_patches(Img, colour_cals, grey=True, grid_size=(16, 12)): """ get patch centre coordinates, image colour and the actual patches for each channel, remembering to subtract blacklevel If grey then only greyscale patches considered """ + grid_w, grid_h = grid_size if grey: cen_coords = Img.cen_coords[3::4] col = Img.col @@ -345,12 +346,12 @@ def get_alsc_patches(Img, colour_cals, grey=True): bef_tabs = np.array(colour_cals[bef]) aft_tabs = np.array(colour_cals[aft]) col_tabs = (bef_tabs*db + aft_tabs*da)/(da+db) - col_tabs = np.reshape(col_tabs, (2, 12, 16)) + col_tabs = np.reshape(col_tabs, (2, grid_h, grid_w)) """ calculate dx, dy used to calculate alsc table """ w, h = Img.w/2, Img.h/2 - dx, dy = int(-(-(w-1)//16)), int(-(-(h-1)//12)) + dx, dy = int(-(-(w-1)//grid_w)), int(-(-(h-1)//grid_h)) """ make list of pairs of gains for each patch by selecting the correct value in alsc colour calibration table diff --git a/utils/raspberrypi/ctt/ctt_cac.py b/utils/raspberrypi/ctt/ctt_cac.py new file mode 100644 index 00000000..a1183989 --- /dev/null +++ b/utils/raspberrypi/ctt/ctt_cac.py @@ -0,0 +1,250 @@ +# SPDX-License-Identifier: BSD-2-Clause +# +# Copyright (C) 2023, Raspberry Pi Ltd +# +# ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool + +from PIL import Image +import numpy as np +import matplotlib.pyplot as plt +from matplotlib import cm + +from ctt_dots_locator import find_dots_locations + + +# This is the wrapper file that creates a JSON entry for you to append +# to your camera tuning file. +# It calculates the chromatic aberration at different points throughout +# the image and uses that to produce a martix that can then be used +# in the camera tuning files to correct this aberration. + + +def pprint_array(array): + # Function to print the array in a tidier format + array = array + output = "" + for i in range(len(array)): + for j in range(len(array[0])): + output += str(round(array[i, j], 2)) + ", " + # Add the necessary indentation to the array + output += "\n " + # Cut off the end of the array (nicely formats it) + return output[:-22] + + +def plot_shifts(red_shifts, blue_shifts): + # If users want, they can pass a command line option to show the shifts on a graph + # Can be useful to check that the functions are all working, and that the sample + # images are doing the right thing + Xs = np.array(red_shifts)[:, 0] + Ys = np.array(red_shifts)[:, 1] + Zs = np.array(red_shifts)[:, 2] + Zs2 = np.array(red_shifts)[:, 3] + Zs3 = np.array(blue_shifts)[:, 2] + Zs4 = np.array(blue_shifts)[:, 3] + + fig, axs = plt.subplots(2, 2) + ax = fig.add_subplot(2, 2, 1, projection='3d') + ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0) + ax.set_title('Red X Shift') + ax = fig.add_subplot(2, 2, 2, projection='3d') + ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0) + ax.set_title('Red Y Shift') + ax = fig.add_subplot(2, 2, 3, projection='3d') + ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0) + ax.set_title('Blue X Shift') + ax = fig.add_subplot(2, 2, 4, projection='3d') + ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0) + ax.set_title('Blue Y Shift') + fig.tight_layout() + plt.show() + + +def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9): + # Convert the shifts to a numpy array for easier handling and initialise other variables + red_shifts = np.array(red_shift) + blue_shifts = np.array(blue_shift) + # create a grid that's smaller than the output grid, which we then interpolate from to get the output values + xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) + xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) + yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) + ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) + + xrsgrid = [] + xbsgrid = [] + yrsgrid = [] + ybsgrid = [] + xg = np.zeros((output_grid_size - 1, output_grid_size - 1)) + yg = np.zeros((output_grid_size - 1, output_grid_size - 1)) + + # Format the grids - numpy doesn't work for this, it wants a + # nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup + for x in range(output_grid_size - 1): + xrsgrid.append([]) + yrsgrid.append([]) + xbsgrid.append([]) + ybsgrid.append([]) + for y in range(output_grid_size - 1): + xrsgrid[x].append([]) + yrsgrid[x].append([]) + xbsgrid[x].append([]) + ybsgrid[x].append([]) + + image_size = (image_dimensions[0], image_dimensions[1]) + gridxsize = image_size[0] / (output_grid_size - 1) + gridysize = image_size[1] / (output_grid_size - 1) + + # Iterate through each dot, and it's shift values and put these into the correct grid location + for red_shift in red_shifts: + xgridloc = int(red_shift[0] / gridxsize) + ygridloc = int(red_shift[1] / gridysize) + xrsgrid[xgridloc][ygridloc].append(red_shift[2]) + yrsgrid[xgridloc][ygridloc].append(red_shift[3]) + + for blue_shift in blue_shifts: + xgridloc = int(blue_shift[0] / gridxsize) + ygridloc = int(blue_shift[1] / gridysize) + xbsgrid[xgridloc][ygridloc].append(blue_shift[2]) + ybsgrid[xgridloc][ygridloc].append(blue_shift[3]) + + # Now calculate the average pixel shift for each square in the grid + grid_incomplete = False + for x in range(output_grid_size - 1): + for y in range(output_grid_size - 1): + if xrsgrid[x][y]: + xrgrid[x, y] = np.mean(xrsgrid[x][y]) + else: + grid_incomplete = True + if yrsgrid[x][y]: + yrgrid[x, y] = np.mean(yrsgrid[x][y]) + else: + grid_incomplete = True + if xbsgrid[x][y]: + xbgrid[x, y] = np.mean(xbsgrid[x][y]) + else: + grid_incomplete = True + if ybsgrid[x][y]: + ybgrid[x, y] = np.mean(ybsgrid[x][y]) + else: + grid_incomplete = True + + if grid_incomplete: + raise RuntimeError("\nERROR: CAC measurements do not span the image!" + "\nConsider using improved CAC images, or remove them entirely.\n") + + # Next, we start to interpolate the central points of the grid that gets passed to the tuning file + input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid]) + output_grids = np.zeros((4, output_grid_size, output_grid_size)) + + # Interpolate the centre of the grid + output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4 + + # Edge cases: + output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1] + output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2] + output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1] + output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1] + + # Corner Cases: + output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1] + output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2] + output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1] + output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2] + + # Below, we swap the x and the y coordinates, and also multiply by a factor of -1 + # This is due to the PiSP (standard) dimensions being flipped in comparison to + # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts, + # and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift) + + output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1 + return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb + + +def analyse_dot(dot, dot_location=[0, 0]): + # Scan through the dot, calculate the centroid of each colour channel by doing: + # pixel channel brightness * distance from top left corner + # Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel + red_channel = np.array(dot)[:, :, 0] + y_num_pixels = len(red_channel[0]) + x_num_pixels = len(red_channel) + yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels))) + xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel)) + red_sum = np.sum(red_channel) + + green_channel = np.array(dot)[:, :, 1] + ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels))) + xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel)) + green_sum = np.sum(green_channel) + + blue_channel = np.array(dot)[:, :, 2] + yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels))) + xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel)) + blue_sum = np.sum(blue_channel) + + # We return this structure. It contains 2 arrays that contain: + # the locations of the dot center, along with the channel shifts in the x and y direction: + # [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ] + + return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]] + + +def cac(Cam): + filelist = Cam.imgs_cac + + Cam.log += '\nCAC analysing files: {}'.format(str(filelist)) + np.set_printoptions(precision=3) + np.set_printoptions(suppress=True) + + # Create arrays to hold all the dots data and their colour offsets + red_shift = [] # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]] + blue_shift = [] + # Iterate through the files + # Multiple files is reccomended to average out the lens aberration through rotations + for file in filelist: + Cam.log += '\nCAC processing file' + print("\n Processing file") + # Read the raw RGB values + rgb = file.rgb + image_size = [file.h, file.w] # Image size, X, Y + # Create a colour copy of the RGB values to use later in the calibration + imout = Image.new(mode="RGB", size=image_size) + rgb_image = np.array(imout) + # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily + rgb.reshape((image_size[0], image_size[1], 3)) + rgb_image = rgb + + # Pass the RGB image through to the dots locating program + # Returns an array of the dots (colour rectangles around the dots), and an array of their locations + print("Finding dots") + Cam.log += '\nFinding dots' + dots, dots_locations = find_dots_locations(rgb_image) + + # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out + # by how far the chromatic aberration has shifted each channel + Cam.log += '\nDots found: {}'.format(str(len(dots))) + print('Dots found: ' + str(len(dots))) + + for dot, dot_location in zip(dots, dots_locations): + if len(dot) > 0: + if (dot_location[0] > 0) and (dot_location[1] > 0): + ret = analyse_dot(dot, dot_location) + red_shift.append(ret[0]) + blue_shift.append(ret[1]) + + # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix + # for the CAC block to handle and then store these as a .json file to be added to the camera + # tuning file + print("\nCreating output grid") + Cam.log += '\nCreating output grid' + try: + rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size) + except RuntimeError as e: + print(str(e)) + Cam.log += "\nCAC correction failed! CAC will not be enabled." + return {} + + print("CAC correction complete!") + Cam.log += '\nCAC correction complete!' + + # Give the JSON dict back to the main ctt program + return {"strength": 1.0, "lut_rx": list(rx.round(2).reshape(81)), "lut_ry": list(ry.round(2).reshape(81)), "lut_bx": list(bx.round(2).reshape(81)), "lut_by": list(by.round(2).reshape(81))} diff --git a/utils/raspberrypi/ctt/ctt_ccm.py b/utils/raspberrypi/ctt/ctt_ccm.py index a09bfd09..07c943a8 100644 --- a/utils/raspberrypi/ctt/ctt_ccm.py +++ b/utils/raspberrypi/ctt/ctt_ccm.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_ccm.py - camera tuning tool for CCM (colour correction matrix) +# camera tuning tool for CCM (colour correction matrix) from ctt_image_load import * from ctt_awb import get_alsc_patches @@ -56,7 +56,7 @@ FInds colour correction matrices for list of images """ -def ccm(Cam, cal_cr_list, cal_cb_list): +def ccm(Cam, cal_cr_list, cal_cb_list, grid_size): global matrix_selection_types, typenum imgs = Cam.imgs """ @@ -133,9 +133,7 @@ def ccm(Cam, cal_cr_list, cal_cb_list): Note: if alsc is disabled then colour_cals will be set to None and no the function will simply return the macbeth patches """ - r, b, g = get_alsc_patches(Img, colour_cals, grey=False) - # 256 values for each patch of sRGB values - + r, b, g = get_alsc_patches(Img, colour_cals, grey=False, grid_size=grid_size) """ do awb Note: awb is done by measuring the macbeth chart in the image, rather diff --git a/utils/raspberrypi/ctt/ctt_config_example.json b/utils/raspberrypi/ctt/ctt_config_example.json index c7f90761..1105862c 100644 --- a/utils/raspberrypi/ctt/ctt_config_example.json +++ b/utils/raspberrypi/ctt/ctt_config_example.json @@ -3,7 +3,8 @@ "plot": [], "alsc": { "do_alsc_colour": 1, - "luminance_strength": 0.5 + "luminance_strength": 0.8, + "max_gain": 8.0 }, "awb": { "greyworld": 0 @@ -13,4 +14,4 @@ "small": 0, "show": 0 } -}
\ No newline at end of file +} diff --git a/utils/raspberrypi/ctt/ctt_dots_locator.py b/utils/raspberrypi/ctt/ctt_dots_locator.py new file mode 100644 index 00000000..4945c04b --- /dev/null +++ b/utils/raspberrypi/ctt/ctt_dots_locator.py @@ -0,0 +1,118 @@ +# SPDX-License-Identifier: BSD-2-Clause +# +# Copyright (C) 2023, Raspberry Pi Ltd +# +# find_dots.py - Used by CAC algorithm to convert image to set of dots + +''' +This file takes the black and white version of the image, along with +the color version. It then located the black dots on the image by +thresholding dark pixels. +In a rather fun way, the algorithm bounces around the thresholded area in a random path +We then use the maximum and minimum of these paths to determine the dot shape and size +This info is then used to return colored dots and locations back to the main file +''' + +import numpy as np +import random +from PIL import Image, ImageEnhance, ImageFilter + + +def find_dots_locations(rgb_image, color_threshold=100, dots_edge_avoid=75, image_edge_avoid=10, search_path_length=500, grid_scan_step_size=10, logfile=open("log.txt", "a+")): + # Initialise some starting variables + pixels = Image.fromarray(rgb_image) + pixels = pixels.convert("L") + enhancer = ImageEnhance.Contrast(pixels) + im_output = enhancer.enhance(1.4) + # We smooth it slightly to make it easier for the dot recognition program to locate the dots + im_output = im_output.filter(ImageFilter.GaussianBlur(radius=2)) + bw_image = np.array(im_output) + + location = [0, 0] + dots = [] + dots_location = [] + # the program takes away the edges - we don't want a dot that is half a circle, the + # centroids would all be wrong + for x in range(dots_edge_avoid, len(bw_image) - dots_edge_avoid, grid_scan_step_size): + for y in range(dots_edge_avoid, len(bw_image[0]) - dots_edge_avoid, grid_scan_step_size): + location = [x, y] + scrap_dot = False # A variable used to make sure that this is a valid dot + if (bw_image[location[0], location[1]] < color_threshold) and not (scrap_dot): + heading = "south" # Define a starting direction to move in + coords = [] + for i in range(search_path_length): # Creates a path of length `search_path_length`. This turns out to always be enough to work out the rough shape of the dot. + # Now make sure that the thresholded area doesn't come within 10 pixels of the edge of the image, ensures we capture all the CA + if ((image_edge_avoid < location[0] < len(bw_image) - image_edge_avoid) and (image_edge_avoid < location[1] < len(bw_image[0]) - image_edge_avoid)) and not (scrap_dot): + if heading == "south": + if bw_image[location[0] + 1, location[1]] < color_threshold: + # Here, notice it does not go south, but actually goes southeast + # This is crucial in ensuring that we make our way around the majority of the dot + location[0] = location[0] + 1 + location[1] = location[1] + 1 + heading = "south" + else: + # This happens when we reach a thresholded edge. We now randomly change direction and keep searching + dir = random.randint(1, 2) + if dir == 1: + heading = "west" + if dir == 2: + heading = "east" + + if heading == "east": + if bw_image[location[0], location[1] + 1] < color_threshold: + location[1] = location[1] + 1 + heading = "east" + else: + dir = random.randint(1, 2) + if dir == 1: + heading = "north" + if dir == 2: + heading = "south" + + if heading == "west": + if bw_image[location[0], location[1] - 1] < color_threshold: + location[1] = location[1] - 1 + heading = "west" + else: + dir = random.randint(1, 2) + if dir == 1: + heading = "north" + if dir == 2: + heading = "south" + + if heading == "north": + if bw_image[location[0] - 1, location[1]] < color_threshold: + location[0] = location[0] - 1 + heading = "north" + else: + dir = random.randint(1, 2) + if dir == 1: + heading = "west" + if dir == 2: + heading = "east" + # Log where our particle travels across the dot + coords.append([location[0], location[1]]) + else: + scrap_dot = True # We just don't have enough space around the dot, discard this one, and move on + if not scrap_dot: + # get the size of the dot surrounding the dot + x_coords = np.array(coords)[:, 0] + y_coords = np.array(coords)[:, 1] + hsquaresize = max(list(x_coords)) - min(list(x_coords)) + vsquaresize = max(list(y_coords)) - min(list(y_coords)) + # Create the bounding coordinates of the rectangle surrounding the dot + # Program uses the dotsize + half of the dotsize to ensure we get all that color fringing + extra_space_factor = 0.45 + top_left_x = (min(list(x_coords)) - int(hsquaresize * extra_space_factor)) + btm_right_x = max(list(x_coords)) + int(hsquaresize * extra_space_factor) + top_left_y = (min(list(y_coords)) - int(vsquaresize * extra_space_factor)) + btm_right_y = max(list(y_coords)) + int(vsquaresize * extra_space_factor) + # Overwrite the area of the dot to ensure we don't use it again + bw_image[top_left_x:btm_right_x, top_left_y:btm_right_y] = 255 + # Add the color version of the dot to the list to send off, along with some coordinates. + dots.append(rgb_image[top_left_x:btm_right_x, top_left_y:btm_right_y]) + dots_location.append([top_left_x, top_left_y]) + else: + # Dot was too close to the image border to be useable + pass + return dots, dots_location diff --git a/utils/raspberrypi/ctt/ctt_geq.py b/utils/raspberrypi/ctt/ctt_geq.py index c45addcd..5a91ebb4 100644 --- a/utils/raspberrypi/ctt/ctt_geq.py +++ b/utils/raspberrypi/ctt/ctt_geq.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_geq.py - camera tuning tool for GEQ (green equalisation) +# camera tuning tool for GEQ (green equalisation) from ctt_tools import * import matplotlib.pyplot as plt diff --git a/utils/raspberrypi/ctt/ctt_image_load.py b/utils/raspberrypi/ctt/ctt_image_load.py index 310c5e88..531de328 100644 --- a/utils/raspberrypi/ctt/ctt_image_load.py +++ b/utils/raspberrypi/ctt/ctt_image_load.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019-2020, Raspberry Pi Ltd # -# ctt_image_load.py - camera tuning tool image loading +# camera tuning tool image loading from ctt_tools import * from ctt_macbeth_locator import * @@ -350,6 +350,7 @@ def dng_load_image(Cam, im_str): c2 = np.left_shift(raw_data[1::2, 0::2].astype(np.int64), shift) c3 = np.left_shift(raw_data[1::2, 1::2].astype(np.int64), shift) Img.channels = [c0, c1, c2, c3] + Img.rgb = raw_im.postprocess() except Exception: print("\nERROR: failed to load DNG file", im_str) diff --git a/utils/raspberrypi/ctt/ctt_lux.py b/utils/raspberrypi/ctt/ctt_lux.py index 70855e1b..46be1512 100644 --- a/utils/raspberrypi/ctt/ctt_lux.py +++ b/utils/raspberrypi/ctt/ctt_lux.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_lux.py - camera tuning tool for lux level +# camera tuning tool for lux level from ctt_tools import * diff --git a/utils/raspberrypi/ctt/ctt_macbeth_locator.py b/utils/raspberrypi/ctt/ctt_macbeth_locator.py index 3e95df89..f22dbf31 100644 --- a/utils/raspberrypi/ctt/ctt_macbeth_locator.py +++ b/utils/raspberrypi/ctt/ctt_macbeth_locator.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_macbeth_locator.py - camera tuning tool Macbeth chart locator +# camera tuning tool Macbeth chart locator from ctt_ransac import * from ctt_tools import * @@ -57,6 +57,10 @@ def find_macbeth(Cam, img, mac_config=(0, 0)): """ cor, mac, coords, msg = get_macbeth_chart(img, ref_data) + # Keep a list that will include this and any brightened up versions of + # the image for reuse. + all_images = [img] + """ following bits of code tries to fix common problems with simple techniques. @@ -71,6 +75,7 @@ def find_macbeth(Cam, img, mac_config=(0, 0)): if cor < 0.75: a = 2 img_br = cv2.convertScaleAbs(img, alpha=a, beta=0) + all_images.append(img_br) cor_b, mac_b, coords_b, msg_b = get_macbeth_chart(img_br, ref_data) if cor_b > cor: cor, mac, coords, msg = cor_b, mac_b, coords_b, msg_b @@ -81,6 +86,7 @@ def find_macbeth(Cam, img, mac_config=(0, 0)): if cor < 0.75: a = 4 img_br = cv2.convertScaleAbs(img, alpha=a, beta=0) + all_images.append(img_br) cor_b, mac_b, coords_b, msg_b = get_macbeth_chart(img_br, ref_data) if cor_b > cor: cor, mac, coords, msg = cor_b, mac_b, coords_b, msg_b @@ -128,23 +134,26 @@ def find_macbeth(Cam, img, mac_config=(0, 0)): h_inc = int(h/6) """ for each subselection, look for a macbeth chart + loop over this and any brightened up images that we made to increase the + likelihood of success """ - for i in range(3): - for j in range(3): - w_s, h_s = i*w_inc, j*h_inc - img_sel = img[w_s:w_s+w_sel, h_s:h_s+h_sel] - cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data) - """ - if the correlation is better than the best then record the - scale and current subselection at which macbeth chart was - found. Also record the coordinates, macbeth chart and message. - """ - if cor_ij > cor: - cor = cor_ij - mac, coords, msg = mac_ij, coords_ij, msg_ij - ii, jj = i, j - w_best, h_best = w_inc, h_inc - d_best = 1 + for img_br in all_images: + for i in range(3): + for j in range(3): + w_s, h_s = i*w_inc, j*h_inc + img_sel = img_br[w_s:w_s+w_sel, h_s:h_s+h_sel] + cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data) + """ + if the correlation is better than the best then record the + scale and current subselection at which macbeth chart was + found. Also record the coordinates, macbeth chart and message. + """ + if cor_ij > cor: + cor = cor_ij + mac, coords, msg = mac_ij, coords_ij, msg_ij + ii, jj = i, j + w_best, h_best = w_inc, h_inc + d_best = 1 """ scale 2 @@ -157,17 +166,19 @@ def find_macbeth(Cam, img, mac_config=(0, 0)): h_sel = int(h/2) w_inc = int(w/8) h_inc = int(h/8) - for i in range(5): - for j in range(5): - w_s, h_s = i*w_inc, j*h_inc - img_sel = img[w_s:w_s+w_sel, h_s:h_s+h_sel] - cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data) - if cor_ij > cor: - cor = cor_ij - mac, coords, msg = mac_ij, coords_ij, msg_ij - ii, jj = i, j - w_best, h_best = w_inc, h_inc - d_best = 2 + # Again, loop over any brightened up images as well + for img_br in all_images: + for i in range(5): + for j in range(5): + w_s, h_s = i*w_inc, j*h_inc + img_sel = img_br[w_s:w_s+w_sel, h_s:h_s+h_sel] + cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data) + if cor_ij > cor: + cor = cor_ij + mac, coords, msg = mac_ij, coords_ij, msg_ij + ii, jj = i, j + w_best, h_best = w_inc, h_inc + d_best = 2 """ The following code checks for macbeth charts at even smaller scales. This @@ -238,7 +249,7 @@ def find_macbeth(Cam, img, mac_config=(0, 0)): print error or success message """ print(msg) - Cam.log += '\n' + msg + Cam.log += '\n' + str(msg) if msg == success_msg: coords_fit = coords Cam.log += '\nMacbeth chart vertices:\n' @@ -606,7 +617,7 @@ def get_macbeth_chart(img, ref_data): '\nNot enough squares found' '\nPossible problems:\n' '- Macbeth chart is occluded\n' - '- Macbeth chart is too dark of bright\n' + '- Macbeth chart is too dark or bright\n' ) ref_cents = np.array(ref_cents) diff --git a/utils/raspberrypi/ctt/ctt_noise.py b/utils/raspberrypi/ctt/ctt_noise.py index 3270bf34..0b18d83f 100644 --- a/utils/raspberrypi/ctt/ctt_noise.py +++ b/utils/raspberrypi/ctt/ctt_noise.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_noise.py - camera tuning tool noise calibration +# camera tuning tool noise calibration from ctt_image_load import * import matplotlib.pyplot as plt diff --git a/utils/raspberrypi/ctt/ctt_pisp.py b/utils/raspberrypi/ctt/ctt_pisp.py new file mode 100755 index 00000000..a59b053c --- /dev/null +++ b/utils/raspberrypi/ctt/ctt_pisp.py @@ -0,0 +1,805 @@ +#!/usr/bin/env python3 +# +# SPDX-License-Identifier: BSD-2-Clause +# +# Copyright (C) 2019, Raspberry Pi Ltd +# +# ctt_pisp.py - camera tuning tool data for PiSP platforms + + +json_template = { + "rpi.black_level": { + "black_level": 4096 + }, + "rpi.lux": { + "reference_shutter_speed": 10000, + "reference_gain": 1, + "reference_aperture": 1.0 + }, + "rpi.dpc": { + "strength": 1 + }, + "rpi.noise": { + }, + "rpi.geq": { + }, + "rpi.denoise": + { + "normal": + { + "sdn": + { + "deviation": 1.6, + "strength": 0.5, + "deviation2": 3.2, + "deviation_no_tdn": 3.2, + "strength_no_tdn": 0.75 + }, + "cdn": + { + "deviation": 200, + "strength": 0.3 + }, + "tdn": + { + "deviation": 0.8, + "threshold": 0.05 + } + }, + "hdr": + { + "sdn": + { + "deviation": 1.6, + "strength": 0.5, + "deviation2": 3.2, + "deviation_no_tdn": 3.2, + "strength_no_tdn": 0.75 + }, + "cdn": + { + "deviation": 200, + "strength": 0.3 + }, + "tdn": + { + "deviation": 1.3, + "threshold": 0.1 + } + }, + "night": + { + "sdn": + { + "deviation": 1.6, + "strength": 0.5, + "deviation2": 3.2, + "deviation_no_tdn": 3.2, + "strength_no_tdn": 0.75 + }, + "cdn": + { + "deviation": 200, + "strength": 0.3 + }, + "tdn": + { + "deviation": 1.3, + "threshold": 0.1 + } + } + }, + "rpi.awb": { + "priors": [ + {"lux": 0, "prior": [2000, 1.0, 3000, 0.0, 13000, 0.0]}, + {"lux": 800, "prior": [2000, 0.0, 6000, 2.0, 13000, 2.0]}, + {"lux": 1500, "prior": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]} + ], + "modes": { + "auto": {"lo": 2500, "hi": 7700}, + "incandescent": {"lo": 2500, "hi": 3000}, + "tungsten": {"lo": 3000, "hi": 3500}, + "fluorescent": {"lo": 4000, "hi": 4700}, + "indoor": {"lo": 3000, "hi": 5000}, + "daylight": {"lo": 5500, "hi": 6500}, + "cloudy": {"lo": 7000, "hi": 8000} + }, + "bayes": 1 + }, + "rpi.agc": + { + "channels": + [ + { + "comment": "Channel 0 is normal AGC", + "metering_modes": + { + "centre-weighted": + { + "weights": + [ + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0 + ] + }, + "spot": + { + "weights": + [ + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 + ] + }, + "matrix": + { + "weights": + [ + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 + ] + } + }, + "exposure_modes": + { + "normal": + { + "shutter": [ 100, 10000, 30000, 60000, 66666 ], + "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ] + }, + "short": + { + "shutter": [ 100, 5000, 10000, 20000, 60000 ], + "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ] + }, + "long": + { + "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ], + "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ] + } + }, + "constraint_modes": + { + "normal": [ + { + "bound": "LOWER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + } + ], + "highlight": [ + { + "bound": "LOWER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + }, + { + "bound": "UPPER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.8, + 1000, 0.8 + ] + }, + ], + "shadows": [ + { + "bound": "LOWER", + "q_lo": 0.0, + "q_hi": 0.5, + "y_target": + [ + 0, 0.17, + 1000, 0.17 + ] + } + ] + }, + "y_target": + [ + 0, 0.16, + 1000, 0.165, + 10000, 0.17 + ] + }, + { + "comment": "Channel 1 is the HDR short channel", + "desaturate": 0, + "metering_modes": + { + "centre-weighted": + { + "weights": + [ + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0 + ] + }, + "spot": + { + "weights": + [ + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 + ] + }, + "matrix": + { + "weights": + [ + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 + ] + } + }, + "exposure_modes": + { + "normal": + { + "shutter": [ 100, 20000, 60000 ], + "gain": [ 1.0, 1.0, 1.0 ] + }, + "short": + { + "shutter": [ 100, 20000, 60000 ], + "gain": [ 1.0, 1.0, 1.0 ] + }, + "long": + { + "shutter": [ 100, 20000, 60000 ], + "gain": [ 1.0, 1.0, 1.0 ] + } + }, + "constraint_modes": + { + "normal": [ + { + "bound": "LOWER", + "q_lo": 0.95, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + }, + { + "bound": "UPPER", + "q_lo": 0.95, + "q_hi": 1.0, + "y_target": + [ + 0, 0.7, + 1000, 0.7 + ] + }, + { + "bound": "LOWER", + "q_lo": 0.0, + "q_hi": 0.2, + "y_target": + [ + 0, 0.002, + 1000, 0.002 + ] + } + ], + "highlight": [ + { + "bound": "LOWER", + "q_lo": 0.95, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + }, + { + "bound": "UPPER", + "q_lo": 0.95, + "q_hi": 1.0, + "y_target": + [ + 0, 0.7, + 1000, 0.7 + ] + }, + { + "bound": "LOWER", + "q_lo": 0.0, + "q_hi": 0.2, + "y_target": + [ + 0, 0.002, + 1000, 0.002 + ] + } + ], + "shadows": [ + { + "bound": "LOWER", + "q_lo": 0.95, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + }, + { + "bound": "UPPER", + "q_lo": 0.95, + "q_hi": 1.0, + "y_target": + [ + 0, 0.7, + 1000, 0.7 + ] + }, + { + "bound": "LOWER", + "q_lo": 0.0, + "q_hi": 0.2, + "y_target": + [ + 0, 0.002, + 1000, 0.002 + ] + } + ] + }, + "y_target": + [ + 0, 0.16, + 1000, 0.165, + 10000, 0.17 + ] + }, + { + "comment": "Channel 2 is the HDR long channel", + "desaturate": 0, + "metering_modes": + { + "centre-weighted": + { + "weights": + [ + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0 + ] + }, + "spot": + { + "weights": + [ + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 + ] + }, + "matrix": + { + "weights": + [ + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 + ] + } + }, + "exposure_modes": + { + "normal": + { + "shutter": [ 100, 20000, 30000, 60000 ], + "gain": [ 1.0, 2.0, 4.0, 8.0 ] + }, + "short": + { + "shutter": [ 100, 20000, 30000, 60000 ], + "gain": [ 1.0, 2.0, 4.0, 8.0 ] + }, + "long": + { + "shutter": [ 100, 20000, 30000, 60000 ], + "gain": [ 1.0, 2.0, 4.0, 8.0 ] + } + }, + "constraint_modes": + { + "normal": [ + ], + "highlight": [ + ], + "shadows": [ + ] + }, + "channel_constraints": + [ + { + "bound": "UPPER", + "channel": 4, + "factor": 8 + }, + { + "bound": "LOWER", + "channel": 4, + "factor": 2 + } + ], + "y_target": + [ + 0, 0.16, + 1000, 0.165, + 10000, 0.17 + ] + }, + { + "comment": "Channel 3 is the night mode channel", + "base_ev": 0.33, + "metering_modes": + { + "centre-weighted": + { + "weights": + [ + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1, + 1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, + 1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, + 0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0, + 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0 + ] + }, + "spot": + { + "weights": + [ + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 + ] + }, + "matrix": + { + "weights": + [ + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 + ] + } + }, + "exposure_modes": + { + "normal": + { + "shutter": [ 100, 20000, 66666 ], + "gain": [ 1.0, 2.0, 4.0 ] + }, + "short": + { + "shutter": [ 100, 20000, 33333 ], + "gain": [ 1.0, 2.0, 4.0 ] + }, + "long": + { + "shutter": [ 100, 20000, 66666, 120000 ], + "gain": [ 1.0, 2.0, 4.0, 4.0 ] + } + }, + "constraint_modes": + { + "normal": [ + { + "bound": "LOWER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + } + ], + "highlight": [ + { + "bound": "LOWER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + }, + { + "bound": "UPPER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.8, + 1000, 0.8 + ] + } + ], + "shadows": [ + { + "bound": "LOWER", + "q_lo": 0.98, + "q_hi": 1.0, + "y_target": + [ + 0, 0.5, + 1000, 0.5 + ] + } + ] + }, + "y_target": + [ + 0, 0.16, + 1000, 0.16, + 10000, 0.17 + ] + } + ] + }, + "rpi.alsc": { + 'omega': 1.3, + 'n_iter': 100, + 'luminance_strength': 0.8, + }, + "rpi.contrast": { + "ce_enable": 1, + "gamma_curve": [ + 0, 0, + 1024, 5040, + 2048, 9338, + 3072, 12356, + 4096, 15312, + 5120, 18051, + 6144, 20790, + 7168, 23193, + 8192, 25744, + 9216, 27942, + 10240, 30035, + 11264, 32005, + 12288, 33975, + 13312, 35815, + 14336, 37600, + 15360, 39168, + 16384, 40642, + 18432, 43379, + 20480, 45749, + 22528, 47753, + 24576, 49621, + 26624, 51253, + 28672, 52698, + 30720, 53796, + 32768, 54876, + 36864, 57012, + 40960, 58656, + 45056, 59954, + 49152, 61183, + 53248, 62355, + 57344, 63419, + 61440, 64476, + 65535, 65535 + ] + }, + "rpi.ccm": { + }, + "rpi.cac": { + }, + "rpi.sharpen": { + "threshold": 0.25, + "limit": 1.0, + "strength": 1.0 + }, + "rpi.hdr": + { + "Off": + { + "cadence": [ 0 ] + }, + "MultiExposureUnmerged": + { + "cadence": [ 1, 2 ], + "channel_map": { "short": 1, "long": 2 } + }, + "SingleExposure": + { + "cadence": [1], + "channel_map": { "short": 1 }, + "spatial_gain": 2.0, + "tonemap_enable": 1 + }, + "MultiExposure": + { + "cadence": [1, 2], + "channel_map": { "short": 1, "long": 2 }, + "stitch_enable": 1, + "spatial_gain": 2.0, + "tonemap_enable": 1 + }, + "Night": + { + "cadence": [ 3 ], + "channel_map": { "night": 3 }, + "tonemap_enable": 1, + "tonemap": + [ + 0, 0, + 5000, 20000, + 10000, 30000, + 20000, 47000, + 30000, 55000, + 65535, 65535 + ] + } + } +} + +grid_size = (32, 32) diff --git a/utils/raspberrypi/ctt/ctt_pretty_print_json.py b/utils/raspberrypi/ctt/ctt_pretty_print_json.py index 3e3b8475..a4cae62d 100755 --- a/utils/raspberrypi/ctt/ctt_pretty_print_json.py +++ b/utils/raspberrypi/ctt/ctt_pretty_print_json.py @@ -19,13 +19,19 @@ class Encoder(json.JSONEncoder): self.indentation_level = 0 self.hard_break = 120 self.custom_elems = { + 'weights': 15, 'table': 16, 'luminance_lut': 16, 'ct_curve': 3, 'ccm': 3, + 'lut_rx': 9, + 'lut_bx': 9, + 'lut_by': 9, + 'lut_ry': 9, 'gamma_curve': 2, 'y_target': 2, - 'prior': 2 + 'prior': 2, + 'tonemap': 2 } def encode(self, o, node_key=None): @@ -87,7 +93,7 @@ class Encoder(json.JSONEncoder): return self.encode(o) -def pretty_print(in_json: dict) -> str: +def pretty_print(in_json: dict, custom_elems={}) -> str: if 'version' not in in_json or \ 'target' not in in_json or \ @@ -95,12 +101,15 @@ def pretty_print(in_json: dict) -> str: in_json['version'] < 2.0: raise RuntimeError('Incompatible JSON dictionary has been provided') - return json.dumps(in_json, cls=Encoder, indent=4, sort_keys=False) + encoder = Encoder(indent=4, sort_keys=False) + encoder.custom_elems |= custom_elems + return encoder.encode(in_json) #json.dumps(in_json, cls=Encoder, indent=4, sort_keys=False) if __name__ == "__main__": parser = argparse.ArgumentParser(formatter_class=argparse.RawTextHelpFormatter, description= 'Prettify a version 2.0 camera tuning config JSON file.') + parser.add_argument('-t', '--target', type=str, help='Target platform', choices=['pisp', 'vc4'], default='vc4') parser.add_argument('input', type=str, help='Input tuning file.') parser.add_argument('output', type=str, nargs='?', help='Output converted tuning file. If not provided, the input file will be updated in-place.', @@ -110,7 +119,12 @@ if __name__ == "__main__": with open(args.input, 'r') as f: in_json = json.load(f) - out_json = pretty_print(in_json) + if args.target == 'pisp': + from ctt_pisp import grid_size + elif args.target == 'vc4': + from ctt_vc4 import grid_size + + out_json = pretty_print(in_json, custom_elems={'table': grid_size[0], 'luminance_lut': grid_size[0]}) with open(args.output if args.output is not None else args.input, 'w') as f: f.write(out_json) diff --git a/utils/raspberrypi/ctt/ctt_ransac.py b/utils/raspberrypi/ctt/ctt_ransac.py index 9ed7d93c..01bba302 100644 --- a/utils/raspberrypi/ctt/ctt_ransac.py +++ b/utils/raspberrypi/ctt/ctt_ransac.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_ransac.py - camera tuning tool RANSAC selector for Macbeth chart locator +# camera tuning tool RANSAC selector for Macbeth chart locator import numpy as np diff --git a/utils/raspberrypi/ctt/ctt_tools.py b/utils/raspberrypi/ctt/ctt_tools.py index 79195289..50b01ecf 100644 --- a/utils/raspberrypi/ctt/ctt_tools.py +++ b/utils/raspberrypi/ctt/ctt_tools.py @@ -2,7 +2,7 @@ # # Copyright (C) 2019, Raspberry Pi Ltd # -# ctt_tools.py - camera tuning tool miscellaneous +# camera tuning tool miscellaneous import time import re @@ -65,11 +65,12 @@ def parse_input(): directory = get_config(args_dict, '-i', None, 'string') config = get_config(args_dict, '-c', None, 'string') log_path = get_config(args_dict, '-l', None, 'string') + target = get_config(args_dict, '-t', "vc4", 'string') if directory is None: raise ArgError('\n\nERROR! No input directory given.') if json_output is None: raise ArgError('\n\nERROR! No output json given.') - return json_output, directory, config, log_path + return json_output, directory, config, log_path, target """ diff --git a/utils/raspberrypi/ctt/ctt_vc4.py b/utils/raspberrypi/ctt/ctt_vc4.py new file mode 100755 index 00000000..7154e110 --- /dev/null +++ b/utils/raspberrypi/ctt/ctt_vc4.py @@ -0,0 +1,126 @@ +#!/usr/bin/env python3 +# +# SPDX-License-Identifier: BSD-2-Clause +# +# Copyright (C) 2019, Raspberry Pi Ltd +# +# ctt_vc4.py - camera tuning tool data for VC4 platforms + + +json_template = { + "rpi.black_level": { + "black_level": 4096 + }, + "rpi.dpc": { + }, + "rpi.lux": { + "reference_shutter_speed": 10000, + "reference_gain": 1, + "reference_aperture": 1.0 + }, + "rpi.noise": { + }, + "rpi.geq": { + }, + "rpi.sdn": { + }, + "rpi.awb": { + "priors": [ + {"lux": 0, "prior": [2000, 1.0, 3000, 0.0, 13000, 0.0]}, + {"lux": 800, "prior": [2000, 0.0, 6000, 2.0, 13000, 2.0]}, + {"lux": 1500, "prior": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]} + ], + "modes": { + "auto": {"lo": 2500, "hi": 8000}, + "incandescent": {"lo": 2500, "hi": 3000}, + "tungsten": {"lo": 3000, "hi": 3500}, + "fluorescent": {"lo": 4000, "hi": 4700}, + "indoor": {"lo": 3000, "hi": 5000}, + "daylight": {"lo": 5500, "hi": 6500}, + "cloudy": {"lo": 7000, "hi": 8600} + }, + "bayes": 1 + }, + "rpi.agc": { + "metering_modes": { + "centre-weighted": { + "weights": [3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0] + }, + "spot": { + "weights": [2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0] + }, + "matrix": { + "weights": [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1] + } + }, + "exposure_modes": { + "normal": { + "shutter": [100, 10000, 30000, 60000, 120000], + "gain": [1.0, 2.0, 4.0, 6.0, 6.0] + }, + "short": { + "shutter": [100, 5000, 10000, 20000, 120000], + "gain": [1.0, 2.0, 4.0, 6.0, 6.0] + } + }, + "constraint_modes": { + "normal": [ + {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]} + ], + "highlight": [ + {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]}, + {"bound": "UPPER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.8, 1000, 0.8]} + ] + }, + "y_target": [0, 0.16, 1000, 0.165, 10000, 0.17] + }, + "rpi.alsc": { + 'omega': 1.3, + 'n_iter': 100, + 'luminance_strength': 0.7, + }, + "rpi.contrast": { + "ce_enable": 1, + "gamma_curve": [ + 0, 0, + 1024, 5040, + 2048, 9338, + 3072, 12356, + 4096, 15312, + 5120, 18051, + 6144, 20790, + 7168, 23193, + 8192, 25744, + 9216, 27942, + 10240, 30035, + 11264, 32005, + 12288, 33975, + 13312, 35815, + 14336, 37600, + 15360, 39168, + 16384, 40642, + 18432, 43379, + 20480, 45749, + 22528, 47753, + 24576, 49621, + 26624, 51253, + 28672, 52698, + 30720, 53796, + 32768, 54876, + 36864, 57012, + 40960, 58656, + 45056, 59954, + 49152, 61183, + 53248, 62355, + 57344, 63419, + 61440, 64476, + 65535, 65535 + ] + }, + "rpi.ccm": { + }, + "rpi.sharpen": { + } +} + +grid_size = (16, 12) |