diff options
-rw-r--r-- | aiq/aiq_input_parameters.cpp | 2 | ||||
-rw-r--r-- | ipu3.cpp | 76 |
2 files changed, 62 insertions, 16 deletions
diff --git a/aiq/aiq_input_parameters.cpp b/aiq/aiq_input_parameters.cpp index bc87b31..46553a6 100644 --- a/aiq/aiq_input_parameters.cpp +++ b/aiq/aiq_input_parameters.cpp @@ -130,7 +130,7 @@ AiqInputParameters &AiqInputParameters::operator=(const AiqInputParameters &othe void AiqInputParameters::setAeAwbAfDefaults() { - /*Ae Params */ + /* Ae Params */ aeInputParams.num_exposures = NUM_EXPOSURES; aeInputParams.frame_use = ia_aiq_frame_use_preview; aeInputParams.flash_mode = ia_aiq_flash_mode_off; @@ -59,7 +59,8 @@ private: void fillParams(unsigned int frame, ipu3_uapi_params *params); void parseStatistics(unsigned int frame, int64_t frameTimestamp, - const ipu3_uapi_stats_3a *stats); + const ipu3_uapi_stats_3a *stats, + const ControlList& sensorCtrls); void setControls(unsigned int frame); @@ -83,7 +84,7 @@ private: /* Temporary storage until we have a FrameContext object / struct */ aiq::AiqInputParameters aiqInputParams_; - aiq::AiqResults results_; + aiq::AiqResultsRingBuffer resultsHistory_; BinaryData aiqb_; BinaryData nvm_; @@ -282,6 +283,8 @@ int IPAIPU3::configure(const IPAConfigInfo &configInfo, /* Upate the camera controls using the new sensor settings. */ updateControls(sensorInfo_, ctrls_, ipaControls); + resultsHistory_.reset(); + return 0; } @@ -327,7 +330,10 @@ void IPAIPU3::processEvent(const IPU3Event &event) const ipu3_uapi_stats_3a *stats = reinterpret_cast<ipu3_uapi_stats_3a *>(mem.data()); - parseStatistics(event.frame, event.frameTimestamp, stats); + parseStatistics(event.frame, + event.frameTimestamp, + stats, + event.sensorControls); break; } case EventFillParams: { @@ -374,14 +380,16 @@ void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params) */ /* Run algorithms into/using this context structure */ - if (frame % 10 == 0) - aiq_.run2a(frame, aiqInputParams_, results_); + resultsHistory_.extendOne(); + aiq::AiqResults& latestResults = resultsHistory_.latest(); - aic_.updateRuntimeParams(results_); + aiq_.run2a(frame, aiqInputParams_, latestResults); + aic_.updateRuntimeParams(latestResults); aic_.run(params); - exposure_ = results_.ae()->exposures[0].sensor_exposure->coarse_integration_time; - gain_ = results_.ae()->exposures[0].sensor_exposure->analog_gain_code_global; + exposure_ = latestResults.ae()->exposures[0].sensor_exposure->coarse_integration_time; + gain_ = latestResults.ae()->exposures[0].sensor_exposure->analog_gain_code_global; + setControls(frame); IPU3Action op; @@ -392,7 +400,8 @@ void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params) void IPAIPU3::parseStatistics(unsigned int frame, int64_t frameTimestamp, - const ipu3_uapi_stats_3a *stats) + const ipu3_uapi_stats_3a *stats, + const ControlList& sensorCtrls) { ControlList ctrls(controls::controls); @@ -403,10 +412,46 @@ void IPAIPU3::parseStatistics(unsigned int frame, */ ASSERT (frameTimestamp > 0); - aiq_.setStatistics(frame, frameTimestamp, results_, stats); + + /* + * Ae algorithm expects the statistics to be set with its corresponding + * Ae result, i.e., the Ae result should match the exposure time and + * analog gain with the the effective sensor controls of the statistics. + * Search the required Ae result in the result history and combine it + * with the latest result as the input to AIQ::setStatistics(). + */ + + int32_t effectiveExpo = 0; + int32_t effectiveGain = 0; + ControlValue ctrlValue; + + ctrlValue = sensorCtrls.get(V4L2_CID_EXPOSURE); + if (!ctrlValue.isNone()) + effectiveExpo = ctrlValue.get<int32_t>(); + + ctrlValue = sensorCtrls.get(V4L2_CID_ANALOGUE_GAIN); + if (!ctrlValue.isNone()) + effectiveGain = ctrlValue.get<int32_t>(); + + auto pred = [effectiveExpo, effectiveGain] (aiq::AiqResults& result) { + ia_aiq_exposure_sensor_parameters* sensorExposure = + result.ae()->exposures[0].sensor_exposure; + + return (effectiveExpo == sensorExposure->coarse_integration_time || + effectiveGain == sensorExposure->analog_gain_code_global); + }; + + aiq::AiqResults& latestResults = resultsHistory_.latest(); + aiq::AiqResults& aeMatchedResults = resultsHistory_.searchBackward(pred, latestResults); + + aiq::AiqResults combinedResults = latestResults; + combinedResults.setAe(aeMatchedResults.ae()); + + /* Aiq library expects timestamp in microseconds */ + aiq_.setStatistics(frame, (frameTimestamp / 1000), combinedResults, stats); /* Set frame durations from exposure results */ - ia_aiq_exposure_sensor_parameters *sensorExposure = results_.ae()->exposures->sensor_exposure; + ia_aiq_exposure_sensor_parameters *sensorExposure = combinedResults.ae()->exposures->sensor_exposure; int64_t frameDuration = (sensorExposure->line_length_pixels * sensorExposure->frame_length_lines) / (sensorInfo_.pixelRate / 1e6); ctrls.set(controls::FrameDuration, frameDuration); @@ -423,10 +468,11 @@ void IPAIPU3::setControls(unsigned int frame) IPU3Action op; op.op = ActionSetSensorControls; - ControlList ctrls(ctrls_); - ctrls.set(V4L2_CID_EXPOSURE, static_cast<int32_t>(exposure_)); - ctrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast<int32_t>(gain_)); - op.controls = ctrls; + ControlList sensorCtrls(ctrls_); + sensorCtrls.set(V4L2_CID_EXPOSURE, static_cast<int32_t>(exposure_)); + sensorCtrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast<int32_t>(gain_)); + + op.sensorControls = sensorCtrls; queueFrameAction.emit(frame, op); } |