/* SPDX-License-Identifier: LGPL-2.1-or-later */ /* * Copyright (C) 2020, Google Inc. * * ipu3.cpp - IPU3 Image Processing Algorithms */ #include <algorithm> #include <array> #include <cmath> #include <limits> #include <map> #include <memory> #include <stdint.h> #include <utility> #include <vector> #include <linux/intel-ipu3.h> #include <linux/v4l2-controls.h> #include <libcamera/base/log.h> #include <libcamera/control_ids.h> #include <libcamera/framebuffer.h> #include <libcamera/ipa/ipa_interface.h> #include <libcamera/ipa/ipa_module_info.h> #include <libcamera/ipa/ipu3_ipa_interface.h> #include <libcamera/request.h> #include "libcamera/internal/mapped_framebuffer.h" #include "algorithms/agc.h" #include "algorithms/algorithm.h" #include "algorithms/awb.h" #include "algorithms/tone_mapping.h" #include "libipa/camera_sensor_helper.h" /** * \file ipa_context.h * \brief Context and state information shared between the algorithms */ /** * \struct IPASessionConfiguration * \brief Session configuration for the IPA module * * The session configuration contains all IPA configuration parameters that * remain constant during the capture session, from IPA module start to stop. * It is typically set during the configure() operation of the IPA module, but * may also be updated in the start() operation. */ /** * \struct IPAFrameContext * \brief Per-frame context for algorithms * * The frame context stores data specific to a single frame processed by the * IPA. Each frame processed by the IPA has a context associated with it, * accessible through the IPAContext structure. * * \todo Detail how to access contexts for a particular frame * * Each of the fields in the frame context belongs to either a specific * algorithm, or to the top-level IPA module. A field may be read by any * algorithm, but should only be written by its owner. */ /** * \struct IPAContext * \brief Global IPA context data shared between all algorithms * * \var IPAContext::configuration * \brief The IPA session configuration, immutable during the session * * \var IPAContext::frameContext * \brief The frame context for the frame being processed * * \todo While the frame context is supposed to be per-frame, this * single frame context stores data related to both the current frame * and the previous frames, with fields being updated as the algorithms * are run. This needs to be turned into real per-frame data storage. */ /** * \struct IPASessionConfiguration::grid * \brief Grid configuration of the IPA * * \var IPASessionConfiguration::grid::bdsGrid * \brief Bayer Down Scaler grid plane config used by the kernel * * \var IPASessionConfiguration::grid::bdsOutputSize * \brief BDS output size configured by the pipeline handler */ /** * \struct IPAFrameContext::agc * \brief Context for the Automatic Gain Control algorithm * * The exposure and gain determined are expected to be applied to the sensor * at the earliest opportunity. * * \var IPAFrameContext::agc::exposure * \brief Exposure time expressed as a number of lines * * \var IPAFrameContext::agc::gain * \brief Analogue gain multiplier * * The gain should be adapted to the sensor specific gain code before applying. */ /** * \struct IPAFrameContext::awb * \brief Context for the Automatic White Balance algorithm * * \struct IPAFrameContext::awb::gains * \brief White balance gains * * \var IPAFrameContext::awb::gains::red * \brief White balance gain for R channel * * \var IPAFrameContext::awb::gains::green * \brief White balance gain for G channel * * \var IPAFrameContext::awb::gains::blue * \brief White balance gain for B channel */ /** * \struct IPAFrameContext::toneMapping * \brief Context for ToneMapping and Gamma control * * \var IPAFrameContext::toneMapping::gammaCorrection * \brief Per-pixel tone mapping implemented as a LUT * * The LUT structure is defined by the IPU3 kernel interface. See * <linux/intel-ipu3.h> struct ipu3_uapi_gamma_corr_lut for further details. */ static constexpr uint32_t kMaxCellWidthPerSet = 160; static constexpr uint32_t kMaxCellHeightPerSet = 56; namespace libcamera { LOG_DEFINE_CATEGORY(IPAIPU3) namespace ipa::ipu3 { class IPAIPU3 : public IPAIPU3Interface { public: int init(const IPASettings &settings, const IPACameraSensorInfo &sensorInfo, const ControlInfoMap &sensorControls, ControlInfoMap *ipaControls) override; int start() override; void stop() override {} int configure(const IPAConfigInfo &configInfo) override; void mapBuffers(const std::vector<IPABuffer> &buffers) override; void unmapBuffers(const std::vector<unsigned int> &ids) override; void processEvent(const IPU3Event &event) override; private: void processControls(unsigned int frame, const ControlList &controls); void fillParams(unsigned int frame, ipu3_uapi_params *params); void parseStatistics(unsigned int frame, int64_t frameTimestamp, const ipu3_uapi_stats_3a *stats); void setControls(unsigned int frame); void calculateBdsGrid(const Size &bdsOutputSize); std::map<unsigned int, MappedFrameBuffer> buffers_; ControlInfoMap ctrls_; IPACameraSensorInfo sensorInfo_; /* Camera sensor controls. */ uint32_t defVBlank_; uint32_t exposure_; uint32_t minExposure_; uint32_t maxExposure_; uint32_t gain_; uint32_t minGain_; uint32_t maxGain_; /* Interface to the Camera Helper */ std::unique_ptr<CameraSensorHelper> camHelper_; /* Maintain the algorithms used by the IPA */ std::list<std::unique_ptr<ipa::ipu3::Algorithm>> algorithms_; /* Local parameter storage */ struct IPAContext context_; }; /** * Initialize the IPA module and its controls. * * This function receives the camera sensor information from the pipeline * handler, computes the limits of the controls it handles and returns * them in the \a ipaControls output parameter. */ int IPAIPU3::init(const IPASettings &settings, const IPACameraSensorInfo &sensorInfo, const ControlInfoMap &sensorControls, ControlInfoMap *ipaControls) { camHelper_ = CameraSensorHelperFactory::create(settings.sensorModel); if (camHelper_ == nullptr) { LOG(IPAIPU3, Error) << "Failed to create camera sensor helper for " << settings.sensorModel; return -ENODEV; } /* Initialize Controls. */ ControlInfoMap::Map controls{}; /* * Compute exposure time limits. * * Initialize the control using the line length and pixel rate of the * current configuration converted to microseconds. Use the * V4L2_CID_EXPOSURE control to get exposure min, max and default and * convert it from lines to microseconds. */ double lineDuration = sensorInfo.lineLength / (sensorInfo.pixelRate / 1e6); const ControlInfo &v4l2Exposure = sensorControls.find(V4L2_CID_EXPOSURE)->second; int32_t minExposure = v4l2Exposure.min().get<int32_t>() * lineDuration; int32_t maxExposure = v4l2Exposure.max().get<int32_t>() * lineDuration; int32_t defExposure = v4l2Exposure.def().get<int32_t>() * lineDuration; controls[&controls::ExposureTime] = ControlInfo(minExposure, maxExposure, defExposure); /* * Compute the frame duration limits. * * The frame length is computed assuming a fixed line length combined * with the vertical frame sizes. */ const ControlInfo &v4l2HBlank = sensorControls.find(V4L2_CID_HBLANK)->second; uint32_t hblank = v4l2HBlank.def().get<int32_t>(); uint32_t lineLength = sensorInfo.outputSize.width + hblank; const ControlInfo &v4l2VBlank = sensorControls.find(V4L2_CID_VBLANK)->second; std::array<uint32_t, 3> frameHeights{ v4l2VBlank.min().get<int32_t>() + sensorInfo.outputSize.height, v4l2VBlank.max().get<int32_t>() + sensorInfo.outputSize.height, v4l2VBlank.def().get<int32_t>() + sensorInfo.outputSize.height, }; std::array<int64_t, 3> frameDurations; for (unsigned int i = 0; i < frameHeights.size(); ++i) { uint64_t frameSize = lineLength * frameHeights[i]; frameDurations[i] = frameSize / (sensorInfo.pixelRate / 1000000U); } controls[&controls::FrameDurationLimits] = ControlInfo(frameDurations[0], frameDurations[1], frameDurations[2]); *ipaControls = ControlInfoMap(std::move(controls), controls::controls); /* Construct our Algorithms */ algorithms_.push_back(std::make_unique<algorithms::Agc>()); algorithms_.push_back(std::make_unique<algorithms::Awb>()); algorithms_.push_back(std::make_unique<algorithms::ToneMapping>()); return 0; } int IPAIPU3::start() { setControls(0); return 0; } /** * This function calculates a grid for the AWB algorithm in the IPU3 firmware. * Its input is the BDS output size calculated in the ImgU. * It is limited for now to the simplest method: find the lesser error * with the width/height and respective log2 width/height of the cells. * * \todo The frame is divided into cells which can be 8x8 => 128x128. * As a smaller cell improves the algorithm precision, adapting the * x_start and y_start parameters of the grid would provoke a loss of * some pixels but would also result in more accurate algorithms. */ void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize) { uint32_t minError = std::numeric_limits<uint32_t>::max(); Size best; Size bestLog2; /* Set the BDS output size in the IPAConfiguration structure */ context_.configuration.grid.bdsOutputSize = bdsOutputSize; for (uint32_t widthShift = 3; widthShift <= 7; ++widthShift) { uint32_t width = std::min(kMaxCellWidthPerSet, bdsOutputSize.width >> widthShift); width = width << widthShift; for (uint32_t heightShift = 3; heightShift <= 7; ++heightShift) { int32_t height = std::min(kMaxCellHeightPerSet, bdsOutputSize.height >> heightShift); height = height << heightShift; uint32_t error = std::abs(static_cast<int>(width - bdsOutputSize.width)) + std::abs(static_cast<int>(height - bdsOutputSize.height)); if (error > minError) continue; minError = error; best.width = width; best.height = height; bestLog2.width = widthShift; bestLog2.height = heightShift; } } struct ipu3_uapi_grid_config &bdsGrid = context_.configuration.grid.bdsGrid; bdsGrid.x_start = 0; bdsGrid.y_start = 0; bdsGrid.width = best.width >> bestLog2.width; bdsGrid.block_width_log2 = bestLog2.width; bdsGrid.height = best.height >> bestLog2.height; bdsGrid.block_height_log2 = bestLog2.height; LOG(IPAIPU3, Debug) << "Best grid found is: (" << (int)bdsGrid.width << " << " << (int)bdsGrid.block_width_log2 << ") x (" << (int)bdsGrid.height << " << " << (int)bdsGrid.block_height_log2 << ")"; } int IPAIPU3::configure(const IPAConfigInfo &configInfo) { if (configInfo.entityControls.empty()) { LOG(IPAIPU3, Error) << "No controls provided"; return -ENODATA; } sensorInfo_ = configInfo.sensorInfo; ctrls_ = configInfo.entityControls.at(0); const auto itExp = ctrls_.find(V4L2_CID_EXPOSURE); if (itExp == ctrls_.end()) { LOG(IPAIPU3, Error) << "Can't find exposure control"; return -EINVAL; } const auto itGain = ctrls_.find(V4L2_CID_ANALOGUE_GAIN); if (itGain == ctrls_.end()) { LOG(IPAIPU3, Error) << "Can't find gain control"; return -EINVAL; } const auto itVBlank = ctrls_.find(V4L2_CID_VBLANK); if (itVBlank == ctrls_.end()) { LOG(IPAIPU3, Error) << "Can't find VBLANK control"; return -EINVAL; } minExposure_ = std::max(itExp->second.min().get<int32_t>(), 1); maxExposure_ = itExp->second.max().get<int32_t>(); exposure_ = minExposure_; minGain_ = std::max(itGain->second.min().get<int32_t>(), 1); maxGain_ = itGain->second.max().get<int32_t>(); gain_ = minGain_; defVBlank_ = itVBlank->second.def().get<int32_t>(); /* Clean context at configuration */ context_ = {}; calculateBdsGrid(configInfo.bdsOutputSize); for (auto const &algo : algorithms_) { int ret = algo->configure(context_, configInfo); if (ret) return ret; } return 0; } void IPAIPU3::mapBuffers(const std::vector<IPABuffer> &buffers) { for (const IPABuffer &buffer : buffers) { const FrameBuffer fb(buffer.planes); buffers_.emplace(buffer.id, MappedFrameBuffer(&fb, MappedFrameBuffer::MapFlag::ReadWrite)); } } void IPAIPU3::unmapBuffers(const std::vector<unsigned int> &ids) { for (unsigned int id : ids) { auto it = buffers_.find(id); if (it == buffers_.end()) continue; buffers_.erase(it); } } void IPAIPU3::processEvent(const IPU3Event &event) { switch (event.op) { case EventProcessControls: { processControls(event.frame, event.controls); break; } case EventStatReady: { auto it = buffers_.find(event.bufferId); if (it == buffers_.end()) { LOG(IPAIPU3, Error) << "Could not find stats buffer!"; return; } Span<uint8_t> mem = it->second.maps()[0]; const ipu3_uapi_stats_3a *stats = reinterpret_cast<ipu3_uapi_stats_3a *>(mem.data()); parseStatistics(event.frame, event.frameTimestamp, stats); break; } case EventFillParams: { auto it = buffers_.find(event.bufferId); if (it == buffers_.end()) { LOG(IPAIPU3, Error) << "Could not find param buffer!"; return; } Span<uint8_t> mem = it->second.maps()[0]; ipu3_uapi_params *params = reinterpret_cast<ipu3_uapi_params *>(mem.data()); fillParams(event.frame, params); break; } default: LOG(IPAIPU3, Error) << "Unknown event " << event.op; break; } } void IPAIPU3::processControls([[maybe_unused]] unsigned int frame, [[maybe_unused]] const ControlList &controls) { /* \todo Start processing for 'frame' based on 'controls'. */ } void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params) { for (auto const &algo : algorithms_) algo->prepare(context_, params); IPU3Action op; op.op = ActionParamFilled; queueFrameAction.emit(frame, op); } void IPAIPU3::parseStatistics(unsigned int frame, [[maybe_unused]] int64_t frameTimestamp, [[maybe_unused]] const ipu3_uapi_stats_3a *stats) { ControlList ctrls(controls::controls); /* \todo These fields should not be written by the IPAIPU3 layer */ context_.frameContext.agc.gain = camHelper_->gain(gain_); context_.frameContext.agc.exposure = exposure_; for (auto const &algo : algorithms_) algo->process(context_, stats); setControls(frame); /* \todo Use VBlank value calculated from each frame exposure. */ int64_t frameDuration = sensorInfo_.lineLength * (defVBlank_ + sensorInfo_.outputSize.height) / (sensorInfo_.pixelRate / 1e6); ctrls.set(controls::FrameDuration, frameDuration); IPU3Action op; op.op = ActionMetadataReady; op.controls = ctrls; queueFrameAction.emit(frame, op); } void IPAIPU3::setControls(unsigned int frame) { IPU3Action op; op.op = ActionSetSensorControls; exposure_ = context_.frameContext.agc.exposure; gain_ = camHelper_->gainCode(context_.frameContext.agc.gain); ControlList ctrls(ctrls_); ctrls.set(V4L2_CID_EXPOSURE, static_cast<int32_t>(exposure_)); ctrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast<int32_t>(gain_)); op.controls = ctrls; queueFrameAction.emit(frame, op); } } /* namespace ipa::ipu3 */ /* * External IPA module interface */ extern "C" { const struct IPAModuleInfo ipaModuleInfo = { IPA_MODULE_API_VERSION, 1, "PipelineHandlerIPU3", "ipu3", }; IPAInterface *ipaCreate() { return new ipa::ipu3::IPAIPU3(); } } } /* namespace libcamera */