# SPDX-License-Identifier: BSD-2-Clause # # Copyright (C) 2023, Raspberry Pi Ltd # # ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool from PIL import Image import numpy as np import matplotlib.pyplot as plt from matplotlib import cm from ctt_dots_locator import find_dots_locations # This is the wrapper file that creates a JSON entry for you to append # to your camera tuning file. # It calculates the chromatic aberration at different points throughout # the image and uses that to produce a martix that can then be used # in the camera tuning files to correct this aberration. def pprint_array(array): # Function to print the array in a tidier format array = array output = "" for i in range(len(array)): for j in range(len(array[0])): output += str(round(array[i, j], 2)) + ", " # Add the necessary indentation to the array output += "\n " # Cut off the end of the array (nicely formats it) return output[:-22] def plot_shifts(red_shifts, blue_shifts): # If users want, they can pass a command line option to show the shifts on a graph # Can be useful to check that the functions are all working, and that the sample # images are doing the right thing Xs = np.array(red_shifts)[:, 0] Ys = np.array(red_shifts)[:, 1] Zs = np.array(red_shifts)[:, 2] Zs2 = np.array(red_shifts)[:, 3] Zs3 = np.array(blue_shifts)[:, 2] Zs4 = np.array(blue_shifts)[:, 3] fig, axs = plt.subplots(2, 2) ax = fig.add_subplot(2, 2, 1, projection='3d') ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0) ax.set_title('Red X Shift') ax = fig.add_subplot(2, 2, 2, projection='3d') ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0) ax.set_title('Red Y Shift') ax = fig.add_subplot(2, 2, 3, projection='3d') ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0) ax.set_title('Blue X Shift') ax = fig.add_subplot(2, 2, 4, projection='3d') ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0) ax.set_title('Blue Y Shift') fig.tight_layout() plt.show() def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9): # Convert the shifts to a numpy array for easier handling and initialise other variables red_shifts = np.array(red_shift) blue_shifts = np.array(blue_shift) # create a grid that's smaller than the output grid, which we then interpolate from to get the output values xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1)) xrsgrid = [] xbsgrid = [] yrsgrid = [] ybsgrid = [] xg = np.zeros((output_grid_size - 1, output_grid_size - 1)) yg = np.zeros((output_grid_size - 1, output_grid_size - 1)) # Format the grids - numpy doesn't work for this, it wants a # nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup for x in range(output_grid_size - 1): xrsgrid.append([]) yrsgrid.append([]) xbsgrid.append([]) ybsgrid.append([]) for y in range(output_grid_size - 1): xrsgrid[x].append([]) yrsgrid[x].append([]) xbsgrid[x].append([]) ybsgrid[x].append([]) image_size = (image_dimensions[0], image_dimensions[1]) gridxsize = image_size[0] / (output_grid_size - 1) gridysize = image_size[1] / (output_grid_size - 1) # Iterate through each dot, and it's shift values and put these into the correct grid location for red_shift in red_shifts: xgridloc = int(red_shift[0] / gridxsize) ygridloc = int(red_shift[1] / gridysize) xrsgrid[xgridloc][ygridloc].append(red_shift[2]) yrsgrid[xgridloc][ygridloc].append(red_shift[3]) for blue_shift in blue_shifts: xgridloc = int(blue_shift[0] / gridxsize) ygridloc = int(blue_shift[1] / gridysize) xbsgrid[xgridloc][ygridloc].append(blue_shift[2]) ybsgrid[xgridloc][ygridloc].append(blue_shift[3]) # Now calculate the average pixel shift for each square in the grid for x in range(output_grid_size - 1): for y in range(output_grid_size - 1): xrgrid[x, y] = np.mean(xrsgrid[x][y]) yrgrid[x, y] = np.mean(yrsgrid[x][y]) xbgrid[x, y] = np.mean(xbsgrid[x][y]) ybgrid[x, y] = np.mean(ybsgrid[x][y]) # Next, we start to interpolate the central points of the grid that gets passed to the tuning file input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid]) output_grids = np.zeros((4, output_grid_size, output_grid_size)) # Interpolate the centre of the grid output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4 # Edge cases: output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1] output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2] output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1] output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1] # Corner Cases: output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1] output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2] output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1] output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2] # Below, we swap the x and the y coordinates, and also multiply by a factor of -1 # This is due to the PiSP (standard) dimensions being flipped in comparison to # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts, # and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift) output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1 return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb def analyse_dot(dot, dot_location=[0, 0]): # Scan through the dot, calculate the centroid of each colour channel by doing: # pixel channel brightness * distance from top left corner # Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel red_channel = np.array(dot)[:, :, 0] y_num_pixels = len(red_channel[0]) x_num_pixels = len(red_channel) yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels))) xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel)) red_sum = np.sum(red_channel) green_channel = np.array(dot)[:, :, 1] ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels))) xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel)) green_sum = np.sum(green_channel) blue_channel = np.array(dot)[:, :, 2] yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels))) xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel)) blue_sum = np.sum(blue_channel) # We return this structure. It contains 2 arrays that contain: # the locations of the dot center, along with the channel shifts in the x and y direction: # [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ] return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]] def cac(Cam): filelist = Cam.imgs_cac Cam.log += '\nCAC analysing files: {}'.format(str(filelist)) np.set_printoptions(precision=3) np.set_printoptions(suppress=True) # Create arrays to hold all the dots data and their colour offsets red_shift = [] # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]] blue_shift = [] # Iterate through the files # Multiple files is reccomended to average out the lens aberration through rotations for file in filelist: Cam.log += '\nCAC processing file' print("\n Processing file") # Read the raw RGB values rgb = file.rgb image_size = [file.h, file.w] # Image size, X, Y # Create a colour copy of the RGB values to use later in the calibration imout = Image.new(mode="RGB", size=image_size) rgb_image = np.array(imout) # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily rgb.reshape((image_size[0], image_size[1], 3)) rgb_image = rgb # Pass the RGB image through to the dots locating program # Returns an array of the dots (colour rectangles around the dots), and an array of their locations print("Finding dots") Cam.log += '\nFinding dots' dots, dots_locations = find_dots_locations(rgb_image) # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out # by how far the chromatic aberration has shifted each channel Cam.log += '\nDots found: {}'.format(str(len(dots))) print('Dots found: ' + str(len(dots))) for dot, dot_location in zip(dots, dots_locations): if len(dot) > 0: if (dot_location[0] > 0) and (dot_location[1] > 0): ret = analyse_dot(dot, dot_location) red_shift.append(ret[0]) blue_shift.append(ret[1]) # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix # for the CAC block to handle and then store these as a .json file to be added to the camera # tuning file print("\nCreating output grid") Cam.log += '\nCreating output grid' rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size) print("CAC correction complete!") Cam.log += '\nCAC correction complete!' # Give the JSON dict back to the main ctt program return {"strength": 1.0, "lut_rx": list(rx.round(2).reshape(81)), "lut_ry": list(ry.round(2).reshape(81)), "lut_bx": list(bx.round(2).reshape(81)), "lut_by": list(by.round(2).reshape(81))} pan class="hl opt">*buffer) { if (buffer->metadata().status != FrameMetadata::FrameSuccess) return; completeBuffersCount_++; } void requestComplete(Request *request) { if (request->status() != Request::RequestComplete) return; const Request::BufferMap &buffers = request->buffers(); completeRequestsCount_++; /* Create a new request. */ const Stream *stream = buffers.begin()->first; FrameBuffer *buffer = buffers.begin()->second; request->reuse(); request->addBuffer(stream, buffer); camera_->queueRequest(request); } int init() override { if (status_ != TestPass) return status_; config_ = camera_->generateConfiguration({ StreamRole::VideoRecording }); if (!config_ || config_->size() != 1) { cout << "Failed to generate default configuration" << endl; return TestFail; } allocator_ = new FrameBufferAllocator(camera_); return TestPass; } void cleanup() override { delete allocator_; } int run() override { StreamConfiguration &cfg = config_->at(0);