diff options
author | Umang Jain <umang.jain@ideasonboard.com> | 2022-05-17 22:12:33 +0530 |
---|---|---|
committer | Kieran Bingham <kieran.bingham@ideasonboard.com> | 2022-05-18 15:27:32 +0100 |
commit | 8b291bce82f7cc8307e8ef55ff20e3f41462fa3f (patch) | |
tree | 342247f930b0b5544c536cfa6d12ae02d262c63a /src/ipa/ipu3 | |
parent | bab437df1fb02046fc8dfd4bb5457e0b60ce3213 (diff) |
ipa: libipa: Add frame context pointer in process()
Currently we have a single structure of IPAFrameContext but
subsequently, we shall have a ring buffer (or similar) container
to keep IPAFrameContext structures for each frame.
It would be a hassle to query out the frame context required for
process() (since they will reside in a ring buffer) by the IPA
for each process. Hence, prepare the process() libipa template to
accept a particular IPAFrameContext early on.
As for this patch, we shall pass in the pointer as nullptr, so
that the changes compile and keep working as-is.
Signed-off-by: Umang Jain <umang.jain@ideasonboard.com>
Reviewed-by: Jacopo Mondi <jacopo@jmondi.org>
Reviewed-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>
Reviewed-by: Kieran Bingham <kieran.bingham@ideasonboard.com>
Signed-off-by: Kieran Bingham <kieran.bingham@ideasonboard.com>
Diffstat (limited to 'src/ipa/ipu3')
-rw-r--r-- | src/ipa/ipu3/algorithms/af.cpp | 4 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/af.h | 3 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/agc.cpp | 4 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/agc.h | 3 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/algorithm.h | 4 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/awb.cpp | 3 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/awb.h | 3 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/tone_mapping.cpp | 3 | ||||
-rw-r--r-- | src/ipa/ipu3/algorithms/tone_mapping.h | 3 | ||||
-rw-r--r-- | src/ipa/ipu3/ipu3.cpp | 2 |
10 files changed, 22 insertions, 10 deletions
diff --git a/src/ipa/ipu3/algorithms/af.cpp b/src/ipa/ipu3/algorithms/af.cpp index 8a5a6b1a..d07521a0 100644 --- a/src/ipa/ipu3/algorithms/af.cpp +++ b/src/ipa/ipu3/algorithms/af.cpp @@ -406,6 +406,7 @@ bool Af::afIsOutOfFocus(IPAContext context) /** * \brief Determine the max contrast image and lens position. * \param[in] context The IPA context. + * \param[in] frameContext The current frame context * \param[in] stats The statistics buffer of IPU3. * * Ideally, a clear image also has a relatively higher contrast. So, every @@ -419,7 +420,8 @@ bool Af::afIsOutOfFocus(IPAContext context) * * [1] Hill Climbing Algorithm, https://en.wikipedia.org/wiki/Hill_climbing */ -void Af::process(IPAContext &context, const ipu3_uapi_stats_3a *stats) +void Af::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) { /* Evaluate the AF buffer length */ uint32_t afRawBufferLen = context.configuration.af.afGrid.width * diff --git a/src/ipa/ipu3/algorithms/af.h b/src/ipa/ipu3/algorithms/af.h index b85cf941..ccf015f3 100644 --- a/src/ipa/ipu3/algorithms/af.h +++ b/src/ipa/ipu3/algorithms/af.h @@ -32,7 +32,8 @@ public: void prepare(IPAContext &context, ipu3_uapi_params *params) override; int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; - void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override; + void process(IPAContext &context, IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) override; private: void afCoarseScan(IPAContext &context); diff --git a/src/ipa/ipu3/algorithms/agc.cpp b/src/ipa/ipu3/algorithms/agc.cpp index fdeec09d..383a8deb 100644 --- a/src/ipa/ipu3/algorithms/agc.cpp +++ b/src/ipa/ipu3/algorithms/agc.cpp @@ -318,12 +318,14 @@ double Agc::estimateLuminance(IPAActiveState &activeState, /** * \brief Process IPU3 statistics, and run AGC operations * \param[in] context The shared IPA context + * \param[in] frameContext The current frame context * \param[in] stats The IPU3 statistics and ISP results * * Identify the current image brightness, and use that to estimate the optimal * new exposure and gain for the scene. */ -void Agc::process(IPAContext &context, const ipu3_uapi_stats_3a *stats) +void Agc::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) { /* * Estimate the gain needed to have the proportion of pixels in a given diff --git a/src/ipa/ipu3/algorithms/agc.h b/src/ipa/ipu3/algorithms/agc.h index 31420841..219a1a96 100644 --- a/src/ipa/ipu3/algorithms/agc.h +++ b/src/ipa/ipu3/algorithms/agc.h @@ -28,7 +28,8 @@ public: ~Agc() = default; int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; - void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override; + void process(IPAContext &context, IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) override; private: double measureBrightness(const ipu3_uapi_stats_3a *stats, diff --git a/src/ipa/ipu3/algorithms/algorithm.h b/src/ipa/ipu3/algorithms/algorithm.h index d2eecc78..234b2bd7 100644 --- a/src/ipa/ipu3/algorithms/algorithm.h +++ b/src/ipa/ipu3/algorithms/algorithm.h @@ -17,7 +17,9 @@ namespace libcamera { namespace ipa::ipu3 { -using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAConfigInfo, ipu3_uapi_params, ipu3_uapi_stats_3a>; +using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAFrameContext, + IPAConfigInfo, ipu3_uapi_params, + ipu3_uapi_stats_3a>; } /* namespace ipa::ipu3 */ diff --git a/src/ipa/ipu3/algorithms/awb.cpp b/src/ipa/ipu3/algorithms/awb.cpp index ab6924eb..5c232d92 100644 --- a/src/ipa/ipu3/algorithms/awb.cpp +++ b/src/ipa/ipu3/algorithms/awb.cpp @@ -387,7 +387,8 @@ void Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats) /** * \copydoc libcamera::ipa::Algorithm::process */ -void Awb::process(IPAContext &context, const ipu3_uapi_stats_3a *stats) +void Awb::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) { calculateWBGains(stats); diff --git a/src/ipa/ipu3/algorithms/awb.h b/src/ipa/ipu3/algorithms/awb.h index ab4b0a33..9a50a985 100644 --- a/src/ipa/ipu3/algorithms/awb.h +++ b/src/ipa/ipu3/algorithms/awb.h @@ -40,7 +40,8 @@ public: int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; void prepare(IPAContext &context, ipu3_uapi_params *params) override; - void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override; + void process(IPAContext &context, IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) override; private: /* \todo Make these structs available to all the ISPs ? */ diff --git a/src/ipa/ipu3/algorithms/tone_mapping.cpp b/src/ipa/ipu3/algorithms/tone_mapping.cpp index 7c78d0d9..f86e79b2 100644 --- a/src/ipa/ipu3/algorithms/tone_mapping.cpp +++ b/src/ipa/ipu3/algorithms/tone_mapping.cpp @@ -72,12 +72,13 @@ void ToneMapping::prepare([[maybe_unused]] IPAContext &context, /** * \brief Calculate the tone mapping look up table * \param context The shared IPA context + * \param frameContext The current frame context * \param stats The IPU3 statistics and ISP results * * The tone mapping look up table is generated as an inverse power curve from * our gamma setting. */ -void ToneMapping::process(IPAContext &context, +void ToneMapping::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, [[maybe_unused]] const ipu3_uapi_stats_3a *stats) { /* diff --git a/src/ipa/ipu3/algorithms/tone_mapping.h b/src/ipa/ipu3/algorithms/tone_mapping.h index b727ab1e..d7d48006 100644 --- a/src/ipa/ipu3/algorithms/tone_mapping.h +++ b/src/ipa/ipu3/algorithms/tone_mapping.h @@ -20,7 +20,8 @@ public: int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; void prepare(IPAContext &context, ipu3_uapi_params *params) override; - void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override; + void process(IPAContext &context, IPAFrameContext *frameContext, + const ipu3_uapi_stats_3a *stats) override; private: double gamma_; diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp index 3b4fc911..16e5028f 100644 --- a/src/ipa/ipu3/ipu3.cpp +++ b/src/ipa/ipu3/ipu3.cpp @@ -576,7 +576,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame, ControlList ctrls(controls::controls); for (auto const &algo : algorithms_) - algo->process(context_, stats); + algo->process(context_, nullptr, stats); setControls(frame); |