summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorJean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>2021-08-19 09:03:37 +0200
committerJean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>2021-08-20 12:11:28 +0200
commit96dfda8e4b4ef3021f025ea295c10fec49e081d8 (patch)
treef7ac80bd3ba5e0653d45fd454940ce7687417413
parentb3a2882b36db009baf473f1a45b4beee929fbb55 (diff)
ipa: ipu3: Introduce modular algorithm
Implement a new modular framework for algorithms with a common context structure that is passed to each algorithm through a common API. This patch: - removes all the local references from IPAIPU3 and uses IPAContext - implements the list of pointers and the loop at configure call on each algorithm - loops in fillParams on each prepare() call on the algorithm list - loops in prepareStats on each process() call on the algorithm list Signed-off-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com> Reviewed-by: Kieran Bingham <kieran.bingham@ideasonboard.com> Reviewed-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
-rw-r--r--src/ipa/ipu3/ipa_context.h6
-rw-r--r--src/ipa/ipu3/ipu3.cpp57
2 files changed, 51 insertions, 12 deletions
diff --git a/src/ipa/ipu3/ipa_context.h b/src/ipa/ipu3/ipa_context.h
index 2706d3ca..a031ab83 100644
--- a/src/ipa/ipu3/ipa_context.h
+++ b/src/ipa/ipu3/ipa_context.h
@@ -10,11 +10,17 @@
#include <linux/intel-ipu3.h>
+#include <libcamera/geometry.h>
+
namespace libcamera {
namespace ipa::ipu3 {
struct IPASessionConfiguration {
+ struct {
+ ipu3_uapi_grid_config bdsGrid;
+ Size bdsOutputSize;
+ } grid;
};
struct IPAFrameContext {
diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp
index d9be37e9..4d5b0af1 100644
--- a/src/ipa/ipu3/ipu3.cpp
+++ b/src/ipa/ipu3/ipu3.cpp
@@ -29,6 +29,7 @@
#include "libcamera/internal/mapped_framebuffer.h"
+#include "algorithms/algorithm.h"
#include "ipu3_agc.h"
#include "ipu3_awb.h"
#include "libipa/camera_sensor_helper.h"
@@ -79,6 +80,17 @@
* are run. This needs to be turned into real per-frame data storage.
*/
+/**
+ * \struct IPASessionConfiguration::grid
+ * \brief Grid configuration of the IPA
+ *
+ * \var IPASessionConfiguration::grid::bdsGrid
+ * \brief Bayer Down Scaler grid plane config used by the kernel
+ *
+ * \var IPASessionConfiguration::grid::bdsOutputSize
+ * \brief BDS output size configured by the pipeline handler
+ */
+
static constexpr uint32_t kMaxCellWidthPerSet = 160;
static constexpr uint32_t kMaxCellHeightPerSet = 56;
@@ -137,10 +149,12 @@ private:
/* Interface to the Camera Helper */
std::unique_ptr<CameraSensorHelper> camHelper_;
+ /* Maintain the algorithms used by the IPA */
+ std::list<std::unique_ptr<ipa::ipu3::Algorithm>> algorithms_;
+
/* Local parameter storage */
+ struct IPAContext context_;
struct ipu3_uapi_params params_;
-
- struct ipu3_uapi_grid_config bdsGrid_;
};
/**
@@ -237,7 +251,9 @@ void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize)
uint32_t minError = std::numeric_limits<uint32_t>::max();
Size best;
Size bestLog2;
- bdsGrid_ = {};
+
+ /* Set the BDS output size in the IPAConfiguration structure */
+ context_.configuration.grid.bdsOutputSize = bdsOutputSize;
for (uint32_t widthShift = 3; widthShift <= 7; ++widthShift) {
uint32_t width = std::min(kMaxCellWidthPerSet,
@@ -261,14 +277,17 @@ void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize)
}
}
- bdsGrid_.width = best.width >> bestLog2.width;
- bdsGrid_.block_width_log2 = bestLog2.width;
- bdsGrid_.height = best.height >> bestLog2.height;
- bdsGrid_.block_height_log2 = bestLog2.height;
+ struct ipu3_uapi_grid_config &bdsGrid = context_.configuration.grid.bdsGrid;
+ bdsGrid.x_start = 0;
+ bdsGrid.y_start = 0;
+ bdsGrid.width = best.width >> bestLog2.width;
+ bdsGrid.block_width_log2 = bestLog2.width;
+ bdsGrid.height = best.height >> bestLog2.height;
+ bdsGrid.block_height_log2 = bestLog2.height;
LOG(IPAIPU3, Debug) << "Best grid found is: ("
- << (int)bdsGrid_.width << " << " << (int)bdsGrid_.block_width_log2 << ") x ("
- << (int)bdsGrid_.height << " << " << (int)bdsGrid_.block_height_log2 << ")";
+ << (int)bdsGrid.width << " << " << (int)bdsGrid.block_width_log2 << ") x ("
+ << (int)bdsGrid.height << " << " << (int)bdsGrid.block_height_log2 << ")";
}
int IPAIPU3::configure(const IPAConfigInfo &configInfo)
@@ -310,15 +329,23 @@ int IPAIPU3::configure(const IPAConfigInfo &configInfo)
defVBlank_ = itVBlank->second.def().get<int32_t>();
+ /* Clean context and IPU3 parameters at configuration */
params_ = {};
+ context_ = {};
calculateBdsGrid(configInfo.bdsOutputSize);
- awbAlgo_ = std::make_unique<IPU3Awb>();
- awbAlgo_->initialise(params_, configInfo.bdsOutputSize, bdsGrid_);
+ for (auto const &algo : algorithms_) {
+ int ret = algo->configure(context_, configInfo);
+ if (ret)
+ return ret;
+ }
+ awbAlgo_ = std::make_unique<IPU3Awb>();
+ awbAlgo_->initialise(params_, context_.configuration.grid.bdsOutputSize,
+ context_.configuration.grid.bdsGrid);
agcAlgo_ = std::make_unique<IPU3Agc>();
- agcAlgo_->initialise(bdsGrid_, sensorInfo_);
+ agcAlgo_->initialise(context_.configuration.grid.bdsGrid, sensorInfo_);
return 0;
}
@@ -392,6 +419,9 @@ void IPAIPU3::processControls([[maybe_unused]] unsigned int frame,
void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params)
{
+ for (auto const &algo : algorithms_)
+ algo->prepare(context_, &params_);
+
if (agcAlgo_->updateControls())
awbAlgo_->updateWbParameters(params_, agcAlgo_->gamma());
@@ -409,6 +439,9 @@ void IPAIPU3::parseStatistics(unsigned int frame,
{
ControlList ctrls(controls::controls);
+ for (auto const &algo : algorithms_)
+ algo->process(context_, stats);
+
double gain = camHelper_->gain(gain_);
agcAlgo_->process(stats, exposure_, gain);
gain_ = camHelper_->gainCode(gain);