diff options
Diffstat (limited to 'src')
-rw-r--r-- | src/ipa/ipu3/ipa_context.h | 6 | ||||
-rw-r--r-- | src/ipa/ipu3/ipu3.cpp | 57 |
2 files changed, 51 insertions, 12 deletions
diff --git a/src/ipa/ipu3/ipa_context.h b/src/ipa/ipu3/ipa_context.h index 2706d3ca..a031ab83 100644 --- a/src/ipa/ipu3/ipa_context.h +++ b/src/ipa/ipu3/ipa_context.h @@ -10,11 +10,17 @@ #include <linux/intel-ipu3.h> +#include <libcamera/geometry.h> + namespace libcamera { namespace ipa::ipu3 { struct IPASessionConfiguration { + struct { + ipu3_uapi_grid_config bdsGrid; + Size bdsOutputSize; + } grid; }; struct IPAFrameContext { diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp index d9be37e9..4d5b0af1 100644 --- a/src/ipa/ipu3/ipu3.cpp +++ b/src/ipa/ipu3/ipu3.cpp @@ -29,6 +29,7 @@ #include "libcamera/internal/mapped_framebuffer.h" +#include "algorithms/algorithm.h" #include "ipu3_agc.h" #include "ipu3_awb.h" #include "libipa/camera_sensor_helper.h" @@ -79,6 +80,17 @@ * are run. This needs to be turned into real per-frame data storage. */ +/** + * \struct IPASessionConfiguration::grid + * \brief Grid configuration of the IPA + * + * \var IPASessionConfiguration::grid::bdsGrid + * \brief Bayer Down Scaler grid plane config used by the kernel + * + * \var IPASessionConfiguration::grid::bdsOutputSize + * \brief BDS output size configured by the pipeline handler + */ + static constexpr uint32_t kMaxCellWidthPerSet = 160; static constexpr uint32_t kMaxCellHeightPerSet = 56; @@ -137,10 +149,12 @@ private: /* Interface to the Camera Helper */ std::unique_ptr<CameraSensorHelper> camHelper_; + /* Maintain the algorithms used by the IPA */ + std::list<std::unique_ptr<ipa::ipu3::Algorithm>> algorithms_; + /* Local parameter storage */ + struct IPAContext context_; struct ipu3_uapi_params params_; - - struct ipu3_uapi_grid_config bdsGrid_; }; /** @@ -237,7 +251,9 @@ void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize) uint32_t minError = std::numeric_limits<uint32_t>::max(); Size best; Size bestLog2; - bdsGrid_ = {}; + + /* Set the BDS output size in the IPAConfiguration structure */ + context_.configuration.grid.bdsOutputSize = bdsOutputSize; for (uint32_t widthShift = 3; widthShift <= 7; ++widthShift) { uint32_t width = std::min(kMaxCellWidthPerSet, @@ -261,14 +277,17 @@ void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize) } } - bdsGrid_.width = best.width >> bestLog2.width; - bdsGrid_.block_width_log2 = bestLog2.width; - bdsGrid_.height = best.height >> bestLog2.height; - bdsGrid_.block_height_log2 = bestLog2.height; + struct ipu3_uapi_grid_config &bdsGrid = context_.configuration.grid.bdsGrid; + bdsGrid.x_start = 0; + bdsGrid.y_start = 0; + bdsGrid.width = best.width >> bestLog2.width; + bdsGrid.block_width_log2 = bestLog2.width; + bdsGrid.height = best.height >> bestLog2.height; + bdsGrid.block_height_log2 = bestLog2.height; LOG(IPAIPU3, Debug) << "Best grid found is: (" - << (int)bdsGrid_.width << " << " << (int)bdsGrid_.block_width_log2 << ") x (" - << (int)bdsGrid_.height << " << " << (int)bdsGrid_.block_height_log2 << ")"; + << (int)bdsGrid.width << " << " << (int)bdsGrid.block_width_log2 << ") x (" + << (int)bdsGrid.height << " << " << (int)bdsGrid.block_height_log2 << ")"; } int IPAIPU3::configure(const IPAConfigInfo &configInfo) @@ -310,15 +329,23 @@ int IPAIPU3::configure(const IPAConfigInfo &configInfo) defVBlank_ = itVBlank->second.def().get<int32_t>(); + /* Clean context and IPU3 parameters at configuration */ params_ = {}; + context_ = {}; calculateBdsGrid(configInfo.bdsOutputSize); - awbAlgo_ = std::make_unique<IPU3Awb>(); - awbAlgo_->initialise(params_, configInfo.bdsOutputSize, bdsGrid_); + for (auto const &algo : algorithms_) { + int ret = algo->configure(context_, configInfo); + if (ret) + return ret; + } + awbAlgo_ = std::make_unique<IPU3Awb>(); + awbAlgo_->initialise(params_, context_.configuration.grid.bdsOutputSize, + context_.configuration.grid.bdsGrid); agcAlgo_ = std::make_unique<IPU3Agc>(); - agcAlgo_->initialise(bdsGrid_, sensorInfo_); + agcAlgo_->initialise(context_.configuration.grid.bdsGrid, sensorInfo_); return 0; } @@ -392,6 +419,9 @@ void IPAIPU3::processControls([[maybe_unused]] unsigned int frame, void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params) { + for (auto const &algo : algorithms_) + algo->prepare(context_, ¶ms_); + if (agcAlgo_->updateControls()) awbAlgo_->updateWbParameters(params_, agcAlgo_->gamma()); @@ -409,6 +439,9 @@ void IPAIPU3::parseStatistics(unsigned int frame, { ControlList ctrls(controls::controls); + for (auto const &algo : algorithms_) + algo->process(context_, stats); + double gain = camHelper_->gain(gain_); agcAlgo_->process(stats, exposure_, gain); gain_ = camHelper_->gainCode(gain); |