summaryrefslogtreecommitdiff
path: root/src
diff options
context:
space:
mode:
Diffstat (limited to 'src')
-rw-r--r--src/ipa/ipu3/ipu3.cpp86
-rw-r--r--src/ipa/ipu3/ipu3_awb.cpp356
-rw-r--r--src/ipa/ipu3/ipu3_awb.h91
-rw-r--r--src/ipa/ipu3/meson.build7
4 files changed, 531 insertions, 9 deletions
diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp
index 38477cad..a4d327ab 100644
--- a/src/ipa/ipu3/ipu3.cpp
+++ b/src/ipa/ipu3/ipu3.cpp
@@ -21,6 +21,11 @@
#include "libcamera/internal/buffer.h"
#include "libcamera/internal/log.h"
+#include "ipu3_awb.h"
+
+static constexpr uint32_t kMaxCellWidthPerSet = 160;
+static constexpr uint32_t kMaxCellHeightPerSet = 56;
+
namespace libcamera {
LOG_DEFINE_CATEGORY(IPAIPU3)
@@ -51,6 +56,7 @@ private:
const ipu3_uapi_stats_3a *stats);
void setControls(unsigned int frame);
+ void calculateBdsGrid(const Size &bdsOutputSize);
std::map<unsigned int, MappedFrameBuffer> buffers_;
@@ -63,6 +69,14 @@ private:
uint32_t gain_;
uint32_t minGain_;
uint32_t maxGain_;
+
+ /* Interface to the AWB algorithm */
+ std::unique_ptr<IPU3Awb> awbAlgo_;
+
+ /* Local parameter storage */
+ struct ipu3_uapi_params params_;
+
+ struct ipu3_uapi_grid_config bdsGrid_;
};
int IPAIPU3::start()
@@ -72,8 +86,58 @@ int IPAIPU3::start()
return 0;
}
+/**
+ * This method calculates a grid for the AWB algorithm in the IPU3 firmware.
+ * Its input is the BDS output size calculated in the ImgU.
+ * It is limited for now to the simplest method: find the lesser error
+ * with the width/height and respective log2 width/height of the cells.
+ *
+ * \todo The frame is divided into cells which can be 8x8 => 128x128.
+ * As a smaller cell improves the algorithm precision, adapting the
+ * x_start and y_start parameters of the grid would provoke a loss of
+ * some pixels but would also result in more accurate algorithms.
+ */
+void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize)
+{
+ uint32_t minError = std::numeric_limits<uint32_t>::max();
+ Size best;
+ Size bestLog2;
+ bdsGrid_ = {};
+
+ for (uint32_t widthShift = 3; widthShift <= 7; ++widthShift) {
+ uint32_t width = std::min(kMaxCellWidthPerSet,
+ bdsOutputSize.width >> widthShift);
+ width = width << widthShift;
+ for (uint32_t heightShift = 3; heightShift <= 7; ++heightShift) {
+ int32_t height = std::min(kMaxCellHeightPerSet,
+ bdsOutputSize.height >> heightShift);
+ height = height << heightShift;
+ uint32_t error = std::abs(static_cast<int>(width - bdsOutputSize.width))
+ + std::abs(static_cast<int>(height - bdsOutputSize.height));
+
+ if (error > minError)
+ continue;
+
+ minError = error;
+ best.width = width;
+ best.height = height;
+ bestLog2.width = widthShift;
+ bestLog2.height = heightShift;
+ }
+ }
+
+ bdsGrid_.width = best.width >> bestLog2.width;
+ bdsGrid_.block_width_log2 = bestLog2.width;
+ bdsGrid_.height = best.height >> bestLog2.height;
+ bdsGrid_.block_height_log2 = bestLog2.height;
+
+ LOG(IPAIPU3, Debug) << "Best grid found is: ("
+ << (int)bdsGrid_.width << " << " << (int)bdsGrid_.block_width_log2 << ") x ("
+ << (int)bdsGrid_.height << " << " << (int)bdsGrid_.block_height_log2 << ")";
+}
+
void IPAIPU3::configure(const std::map<uint32_t, ControlInfoMap> &entityControls,
- [[maybe_unused]] const Size &bdsOutputSize)
+ const Size &bdsOutputSize)
{
if (entityControls.empty())
return;
@@ -94,11 +158,18 @@ void IPAIPU3::configure(const std::map<uint32_t, ControlInfoMap> &entityControls
minExposure_ = std::max(itExp->second.min().get<int32_t>(), 1);
maxExposure_ = itExp->second.max().get<int32_t>();
- exposure_ = maxExposure_;
+ exposure_ = minExposure_;
minGain_ = std::max(itGain->second.min().get<int32_t>(), 1);
maxGain_ = itGain->second.max().get<int32_t>();
- gain_ = maxGain_;
+ gain_ = minGain_;
+
+ params_ = {};
+
+ calculateBdsGrid(bdsOutputSize);
+
+ awbAlgo_ = std::make_unique<IPU3Awb>();
+ awbAlgo_->initialise(params_, bdsOutputSize, bdsGrid_);
}
void IPAIPU3::mapBuffers(const std::vector<IPABuffer> &buffers)
@@ -170,10 +241,10 @@ void IPAIPU3::processControls([[maybe_unused]] unsigned int frame,
void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params)
{
- /* Prepare parameters buffer. */
- memset(params, 0, sizeof(*params));
+ /* Pass a default gamma of 1.0 (default linear correction) */
+ awbAlgo_->updateWbParameters(params_, 1.0);
- /* \todo Fill in parameters buffer. */
+ *params = params_;
IPU3Action op;
op.op = ActionParamFilled;
@@ -186,8 +257,7 @@ void IPAIPU3::parseStatistics(unsigned int frame,
{
ControlList ctrls(controls::controls);
- /* \todo React to statistics and update internal state machine. */
- /* \todo Add meta-data information to ctrls. */
+ awbAlgo_->calculateWBGains(stats);
IPU3Action op;
op.op = ActionMetadataReady;
diff --git a/src/ipa/ipu3/ipu3_awb.cpp b/src/ipa/ipu3/ipu3_awb.cpp
new file mode 100644
index 00000000..060d1e18
--- /dev/null
+++ b/src/ipa/ipu3/ipu3_awb.cpp
@@ -0,0 +1,356 @@
+/* SPDX-License-Identifier: LGPL-2.1-or-later */
+/*
+ * Copyright (C) 2021, Ideas On Board
+ *
+ * ipu3_awb.cpp - AWB control algorithm
+ */
+#include "ipu3_awb.h"
+
+#include <cmath>
+#include <numeric>
+#include <unordered_map>
+
+#include "libcamera/internal/log.h"
+
+namespace libcamera {
+
+namespace ipa::ipu3 {
+
+LOG_DEFINE_CATEGORY(IPU3Awb)
+
+static constexpr uint32_t kMinZonesCounted = 16;
+static constexpr uint32_t kMinGreenLevelInZone = 32;
+
+/**
+ * \struct IspStatsRegion
+ * \brief RGB statistics for a given region
+ *
+ * The IspStatsRegion structure is intended to abstract the ISP specific
+ * statistics and use an agnostic algorithm to compute AWB.
+ *
+ * \var IspStatsRegion::counted
+ * \brief Number of pixels used to calculate the sums
+ *
+ * \var IspStatsRegion::uncounted
+ * \brief Remaining number of pixels in the region
+ *
+ * \var IspStatsRegion::rSum
+ * \brief Sum of the red values in the region
+ *
+ * \var IspStatsRegion::gSum
+ * \brief Sum of the green values in the region
+ *
+ * \var IspStatsRegion::bSum
+ * \brief Sum of the blue values in the region
+ */
+
+/**
+ * \struct AwbStatus
+ * \brief AWB parameters calculated
+ *
+ * The AwbStatus structure is intended to store the AWB
+ * parameters calculated by the algorithm
+ *
+ * \var AwbStatus::temperatureK
+ * \brief Color temperature calculated
+ *
+ * \var AwbStatus::redGain
+ * \brief Gain calculated for the red channel
+ *
+ * \var AwbStatus::greenGain
+ * \brief Gain calculated for the green channel
+ *
+ * \var AwbStatus::blueGain
+ * \brief Gain calculated for the blue channel
+ */
+
+/**
+ * \struct Ipu3AwbCell
+ * \brief Memory layout for each cell in AWB metadata
+ *
+ * The Ipu3AwbCell structure is used to get individual values
+ * such as red average or saturation ratio in a particular cell.
+ *
+ * \var Ipu3AwbCell::greenRedAvg
+ * \brief Green average for red lines in the cell
+ *
+ * \var Ipu3AwbCell::redAvg
+ * \brief Red average in the cell
+ *
+ * \var Ipu3AwbCell::blueAvg
+ * \brief blue average in the cell
+ *
+ * \var Ipu3AwbCell::greenBlueAvg
+ * \brief Green average for blue lines
+ *
+ * \var Ipu3AwbCell::satRatio
+ * \brief Saturation ratio in the cell
+ *
+ * \var Ipu3AwbCell::padding
+ * \brief array of unused bytes for padding
+ */
+
+/* Default settings for Bayer noise reduction replicated from the Kernel */
+static const struct ipu3_uapi_bnr_static_config imguCssBnrDefaults = {
+ .wb_gains = { 16, 16, 16, 16 },
+ .wb_gains_thr = { 255, 255, 255, 255 },
+ .thr_coeffs = { 1700, 0, 31, 31, 0, 16 },
+ .thr_ctrl_shd = { 26, 26, 26, 26 },
+ .opt_center{ -648, 0, -366, 0 },
+ .lut = {
+ { 17, 23, 28, 32, 36, 39, 42, 45,
+ 48, 51, 53, 55, 58, 60, 62, 64,
+ 66, 68, 70, 72, 73, 75, 77, 78,
+ 80, 82, 83, 85, 86, 88, 89, 90 } },
+ .bp_ctrl = { 20, 0, 1, 40, 0, 6, 0, 6, 0 },
+ .dn_detect_ctrl{ 9, 3, 4, 0, 8, 0, 1, 1, 1, 1, 0 },
+ .column_size = 1296,
+ .opt_center_sqr = { 419904, 133956 },
+};
+
+/* Default settings for Auto White Balance replicated from the Kernel*/
+static const struct ipu3_uapi_awb_config_s imguCssAwbDefaults = {
+ .rgbs_thr_gr = 8191,
+ .rgbs_thr_r = 8191,
+ .rgbs_thr_gb = 8191,
+ .rgbs_thr_b = 8191 | IPU3_UAPI_AWB_RGBS_THR_B_EN | IPU3_UAPI_AWB_RGBS_THR_B_INCL_SAT,
+ .grid = {
+ .width = 160,
+ .height = 36,
+ .block_width_log2 = 3,
+ .block_height_log2 = 4,
+ .height_per_slice = 1, /* Overridden by kernel. */
+ .x_start = 0,
+ .y_start = 0,
+ .x_end = 0,
+ .y_end = 0,
+ },
+};
+
+/* Default color correction matrix defined as an identity matrix */
+static const struct ipu3_uapi_ccm_mat_config imguCssCcmDefault = {
+ 8191, 0, 0, 0,
+ 0, 8191, 0, 0,
+ 0, 0, 8191, 0
+};
+
+IPU3Awb::IPU3Awb()
+ : Algorithm()
+{
+ asyncResults_.blueGain = 1.0;
+ asyncResults_.greenGain = 1.0;
+ asyncResults_.redGain = 1.0;
+ asyncResults_.temperatureK = 4500;
+}
+
+IPU3Awb::~IPU3Awb()
+{
+}
+
+void IPU3Awb::initialise(ipu3_uapi_params &params, const Size &bdsOutputSize, struct ipu3_uapi_grid_config &bdsGrid)
+{
+ params.use.acc_awb = 1;
+ params.acc_param.awb.config = imguCssAwbDefaults;
+
+ awbGrid_ = bdsGrid;
+ params.acc_param.awb.config.grid = awbGrid_;
+
+ params.use.acc_bnr = 1;
+ params.acc_param.bnr = imguCssBnrDefaults;
+ /**
+ * Optical center is column (respectively row) startminus X (respectively Y) center.
+ * For the moment use BDS as a first approximation, but it should
+ * be calculated based on Shading (SHD) parameters.
+ */
+ params.acc_param.bnr.column_size = bdsOutputSize.width;
+ params.acc_param.bnr.opt_center.x_reset = awbGrid_.x_start - (bdsOutputSize.width / 2);
+ params.acc_param.bnr.opt_center.y_reset = awbGrid_.y_start - (bdsOutputSize.height / 2);
+ params.acc_param.bnr.opt_center_sqr.x_sqr_reset = params.acc_param.bnr.opt_center.x_reset
+ * params.acc_param.bnr.opt_center.x_reset;
+ params.acc_param.bnr.opt_center_sqr.y_sqr_reset = params.acc_param.bnr.opt_center.y_reset
+ * params.acc_param.bnr.opt_center.y_reset;
+
+ params.use.acc_ccm = 1;
+ params.acc_param.ccm = imguCssCcmDefault;
+
+ params.use.acc_gamma = 1;
+ params.acc_param.gamma.gc_ctrl.enable = 1;
+
+ zones_.reserve(kAwbStatsSizeX * kAwbStatsSizeY);
+}
+
+/**
+ * The function estimates the correlated color temperature using
+ * from RGB color space input.
+ * In physics and color science, the Planckian locus or black body locus is
+ * the path or locus that the color of an incandescent black body would take
+ * in a particular chromaticity space as the blackbody temperature changes.
+ *
+ * If a narrow range of color temperatures is considered (those encapsulating
+ * daylight being the most practical case) one can approximate the Planckian
+ * locus in order to calculate the CCT in terms of chromaticity coordinates.
+ *
+ * More detailed information can be found in:
+ * https://en.wikipedia.org/wiki/Color_temperature#Approximation
+ */
+uint32_t IPU3Awb::estimateCCT(double red, double green, double blue)
+{
+ /* Convert the RGB values to CIE tristimulus values (XYZ) */
+ double X = (-0.14282) * (red) + (1.54924) * (green) + (-0.95641) * (blue);
+ double Y = (-0.32466) * (red) + (1.57837) * (green) + (-0.73191) * (blue);
+ double Z = (-0.68202) * (red) + (0.77073) * (green) + (0.56332) * (blue);
+
+ /* Calculate the normalized chromaticity values */
+ double x = X / (X + Y + Z);
+ double y = Y / (X + Y + Z);
+
+ /* Calculate CCT */
+ double n = (x - 0.3320) / (0.1858 - y);
+ return 449 * n * n * n + 3525 * n * n + 6823.3 * n + 5520.33;
+}
+
+/* Generate an RGB vector with the average values for each region */
+void IPU3Awb::generateZones(std::vector<RGB> &zones)
+{
+ for (unsigned int i = 0; i < kAwbStatsSizeX * kAwbStatsSizeY; i++) {
+ RGB zone;
+ double counted = awbStats_[i].counted;
+ if (counted >= kMinZonesCounted) {
+ zone.G = awbStats_[i].gSum / counted;
+ if (zone.G >= kMinGreenLevelInZone) {
+ zone.R = awbStats_[i].rSum / counted;
+ zone.B = awbStats_[i].bSum / counted;
+ zones.push_back(zone);
+ }
+ }
+ }
+}
+
+/* Translate the IPU3 statistics into the default statistics region array */
+void IPU3Awb::generateAwbStats(const ipu3_uapi_stats_3a *stats)
+{
+ uint32_t regionWidth = round(awbGrid_.width / static_cast<double>(kAwbStatsSizeX));
+ uint32_t regionHeight = round(awbGrid_.height / static_cast<double>(kAwbStatsSizeY));
+
+ /*
+ * Generate a (kAwbStatsSizeX x kAwbStatsSizeY) array from the IPU3 grid which is
+ * (awbGrid_.width x awbGrid_.height).
+ */
+ for (unsigned int j = 0; j < kAwbStatsSizeY * regionHeight; j++) {
+ for (unsigned int i = 0; i < kAwbStatsSizeX * regionWidth; i++) {
+ uint32_t cellPosition = j * awbGrid_.width + i;
+ uint32_t cellX = (cellPosition / regionWidth) % kAwbStatsSizeX;
+ uint32_t cellY = ((cellPosition / awbGrid_.width) / regionHeight) % kAwbStatsSizeY;
+
+ uint32_t awbRegionPosition = cellY * kAwbStatsSizeX + cellX;
+ cellPosition *= 8;
+
+ /* Cast the initial IPU3 structure to simplify the reading */
+ Ipu3AwbCell *currentCell = reinterpret_cast<Ipu3AwbCell *>(const_cast<uint8_t *>(&stats->awb_raw_buffer.meta_data[cellPosition]));
+ if (currentCell->satRatio == 0) {
+ /* The cell is not saturated, use the current cell */
+ awbStats_[awbRegionPosition].counted++;
+ uint32_t greenValue = currentCell->greenRedAvg + currentCell->greenBlueAvg;
+ awbStats_[awbRegionPosition].gSum += greenValue / 2;
+ awbStats_[awbRegionPosition].rSum += currentCell->redAvg;
+ awbStats_[awbRegionPosition].bSum += currentCell->blueAvg;
+ }
+ }
+ }
+}
+
+void IPU3Awb::clearAwbStats()
+{
+ for (unsigned int i = 0; i < kAwbStatsSizeX * kAwbStatsSizeY; i++) {
+ awbStats_[i].bSum = 0;
+ awbStats_[i].rSum = 0;
+ awbStats_[i].gSum = 0;
+ awbStats_[i].counted = 0;
+ awbStats_[i].uncounted = 0;
+ }
+}
+
+void IPU3Awb::awbGreyWorld()
+{
+ LOG(IPU3Awb, Debug) << "Grey world AWB";
+ /*
+ * Make a separate list of the derivatives for each of red and blue, so
+ * that we can sort them to exclude the extreme gains. We could
+ * consider some variations, such as normalising all the zones first, or
+ * doing an L2 average etc.
+ */
+ std::vector<RGB> &redDerivative(zones_);
+ std::vector<RGB> blueDerivative(redDerivative);
+ std::sort(redDerivative.begin(), redDerivative.end(),
+ [](RGB const &a, RGB const &b) {
+ return a.G * b.R < b.G * a.R;
+ });
+ std::sort(blueDerivative.begin(), blueDerivative.end(),
+ [](RGB const &a, RGB const &b) {
+ return a.G * b.B < b.G * a.B;
+ });
+
+ /* Average the middle half of the values. */
+ int discard = redDerivative.size() / 4;
+
+ RGB sumRed(0, 0, 0);
+ RGB sumBlue(0, 0, 0);
+ for (auto ri = redDerivative.begin() + discard,
+ bi = blueDerivative.begin() + discard;
+ ri != redDerivative.end() - discard; ri++, bi++)
+ sumRed += *ri, sumBlue += *bi;
+
+ double redGain = sumRed.G / (sumRed.R + 1),
+ blueGain = sumBlue.G / (sumBlue.B + 1);
+
+ /* Color temperature is not relevant in Grey world but still useful to estimate it :-) */
+ asyncResults_.temperatureK = estimateCCT(sumRed.R, sumRed.G, sumBlue.B);
+ asyncResults_.redGain = redGain;
+ asyncResults_.greenGain = 1.0;
+ asyncResults_.blueGain = blueGain;
+}
+
+void IPU3Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats)
+{
+ ASSERT(stats->stats_3a_status.awb_en);
+ zones_.clear();
+ clearAwbStats();
+ generateAwbStats(stats);
+ generateZones(zones_);
+ LOG(IPU3Awb, Debug) << "Valid zones: " << zones_.size();
+ if (zones_.size() > 10) {
+ awbGreyWorld();
+ LOG(IPU3Awb, Debug) << "Gain found for red: " << asyncResults_.redGain
+ << " and for blue: " << asyncResults_.blueGain;
+ }
+}
+
+void IPU3Awb::updateWbParameters(ipu3_uapi_params &params, double agcGamma)
+{
+ /*
+ * Green gains should not be touched and considered 1.
+ * Default is 16, so do not change it at all.
+ * 4096 is the value for a gain of 1.0
+ */
+ params.acc_param.bnr.wb_gains.gr = 16;
+ params.acc_param.bnr.wb_gains.r = 4096 * asyncResults_.redGain;
+ params.acc_param.bnr.wb_gains.b = 4096 * asyncResults_.blueGain;
+ params.acc_param.bnr.wb_gains.gb = 16;
+
+ LOG(IPU3Awb, Debug) << "Color temperature estimated: " << asyncResults_.temperatureK
+ << " and gamma calculated: " << agcGamma;
+
+ /* The CCM matrix may change when color temperature will be used */
+ params.acc_param.ccm = imguCssCcmDefault;
+
+ for (uint32_t i = 0; i < 256; i++) {
+ double j = i / 255.0;
+ double gamma = std::pow(j, 1.0 / agcGamma);
+ /* The maximum value 255 is represented on 13 bits in the IPU3 */
+ params.acc_param.gamma.gc_lut.lut[i] = gamma * 8191;
+ }
+}
+
+} /* namespace ipa::ipu3 */
+
+} /* namespace libcamera */
diff --git a/src/ipa/ipu3/ipu3_awb.h b/src/ipa/ipu3/ipu3_awb.h
new file mode 100644
index 00000000..122cf68c
--- /dev/null
+++ b/src/ipa/ipu3/ipu3_awb.h
@@ -0,0 +1,91 @@
+/* SPDX-License-Identifier: LGPL-2.1-or-later */
+/*
+ * Copyright (C) 2021, Ideas On Board
+ *
+ * ipu3_awb.h - IPU3 AWB control algorithm
+ */
+#ifndef __LIBCAMERA_IPU3_AWB_H__
+#define __LIBCAMERA_IPU3_AWB_H__
+
+#include <vector>
+
+#include <linux/intel-ipu3.h>
+
+#include <libcamera/geometry.h>
+
+#include "libipa/algorithm.h"
+
+namespace libcamera {
+
+namespace ipa::ipu3 {
+
+/* Region size for the statistics generation algorithm */
+static constexpr uint32_t kAwbStatsSizeX = 16;
+static constexpr uint32_t kAwbStatsSizeY = 12;
+
+class IPU3Awb : public Algorithm
+{
+public:
+ IPU3Awb();
+ ~IPU3Awb();
+
+ void initialise(ipu3_uapi_params &params, const Size &bdsOutputSize, struct ipu3_uapi_grid_config &bdsGrid);
+ void calculateWBGains(const ipu3_uapi_stats_3a *stats);
+ void updateWbParameters(ipu3_uapi_params &params, double agcGamma);
+
+ struct Ipu3AwbCell {
+ unsigned char greenRedAvg;
+ unsigned char redAvg;
+ unsigned char blueAvg;
+ unsigned char greenBlueAvg;
+ unsigned char satRatio;
+ unsigned char padding[3];
+ } __attribute__((packed));
+
+ /* \todo Make these three structs available to all the ISPs ? */
+ struct RGB {
+ RGB(double _R = 0, double _G = 0, double _B = 0)
+ : R(_R), G(_G), B(_B)
+ {
+ }
+ double R, G, B;
+ RGB &operator+=(RGB const &other)
+ {
+ R += other.R, G += other.G, B += other.B;
+ return *this;
+ }
+ };
+
+ struct IspStatsRegion {
+ unsigned int counted;
+ unsigned int uncounted;
+ unsigned long long rSum;
+ unsigned long long gSum;
+ unsigned long long bSum;
+ };
+
+ struct AwbStatus {
+ double temperatureK;
+ double redGain;
+ double greenGain;
+ double blueGain;
+ };
+
+private:
+ void generateZones(std::vector<RGB> &zones);
+ void generateAwbStats(const ipu3_uapi_stats_3a *stats);
+ void clearAwbStats();
+ void awbGreyWorld();
+ uint32_t estimateCCT(double red, double green, double blue);
+
+ struct ipu3_uapi_grid_config awbGrid_;
+
+ std::vector<RGB> zones_;
+ IspStatsRegion awbStats_[kAwbStatsSizeX * kAwbStatsSizeY];
+ AwbStatus asyncResults_;
+};
+
+} /* namespace ipa::ipu3 */
+
+} /* namespace libcamera*/
+#endif /* __LIBCAMERA_IPU3_AWB_H__ */
diff --git a/src/ipa/ipu3/meson.build b/src/ipa/ipu3/meson.build
index a241f617..1040698e 100644
--- a/src/ipa/ipu3/meson.build
+++ b/src/ipa/ipu3/meson.build
@@ -2,8 +2,13 @@
ipa_name = 'ipa_ipu3'
+ipu3_ipa_sources = files([
+ 'ipu3.cpp',
+ 'ipu3_awb.cpp',
+])
+
mod = shared_module(ipa_name,
- ['ipu3.cpp', libcamera_generated_ipa_headers],
+ [ipu3_ipa_sources, libcamera_generated_ipa_headers],
name_prefix : '',
include_directories : [ipa_includes, libipa_includes],
dependencies : libcamera_dep,