ipa: libipa: Add frame context pointer in process()

Currently we have a single structure of IPAFrameContext but
subsequently, we shall have a ring buffer (or similar) container
to keep IPAFrameContext structures for each frame.

It would be a hassle to query out the frame context required for
process() (since they will reside in a ring buffer) by the IPA
for each process. Hence, prepare the process() libipa template to
accept a particular IPAFrameContext early on.

As for this patch, we shall pass in the pointer as nullptr, so
that the changes compile and keep working as-is.

Signed-off-by: Umang Jain <umang.jain@ideasonboard.com>
Reviewed-by: Jacopo Mondi <jacopo@jmondi.org>
Reviewed-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>
Reviewed-by: Kieran Bingham <kieran.bingham@ideasonboard.com>
Signed-off-by: Kieran Bingham <kieran.bingham@ideasonboard.com>

18 files changed, 40 insertions, 17 deletions

diff --git a/src/ipa/ipu3/algorithms/af.cpp b/src/ipa/ipu3/algorithms/af.cpp
index 8a5a6b1a..d07521a0 100644
--- a/src/ipa/ipu3/algorithms/af.cpp
+++ b/src/ipa/ipu3/algorithms/af.cpp
@@ -406,6 +406,7 @@ bool Af::afIsOutOfFocus(IPAContext context)
 /**
  * \brief Determine the max contrast image and lens position.
  * \param[in] context The IPA context.
+ * \param[in] frameContext The current frame context
  * \param[in] stats The statistics buffer of IPU3.
  *
  * Ideally, a clear image also has a relatively higher contrast. So, every
@@ -419,7 +420,8 @@ bool Af::afIsOutOfFocus(IPAContext context)
  *
  * [1] Hill Climbing Algorithm, https://en.wikipedia.org/wiki/Hill_climbing
  */
-void Af::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Af::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+		 const ipu3_uapi_stats_3a *stats)
 {
 	/* Evaluate the AF buffer length */
 	uint32_t afRawBufferLen = context.configuration.af.afGrid.width *
diff --git a/src/ipa/ipu3/algorithms/af.h b/src/ipa/ipu3/algorithms/af.h
index b85cf941..ccf015f3 100644
--- a/src/ipa/ipu3/algorithms/af.h
+++ b/src/ipa/ipu3/algorithms/af.h
@@ -32,7 +32,8 @@ public:
 
 	void prepare(IPAContext &context, ipu3_uapi_params *params) override;
 	int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
-	void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+	void process(IPAContext &context, IPAFrameContext *frameContext,
+		     const ipu3_uapi_stats_3a *stats) override;
 
 private:
 	void afCoarseScan(IPAContext &context);
diff --git a/src/ipa/ipu3/algorithms/agc.cpp b/src/ipa/ipu3/algorithms/agc.cpp
index fdeec09d..383a8deb 100644
--- a/src/ipa/ipu3/algorithms/agc.cpp
+++ b/src/ipa/ipu3/algorithms/agc.cpp
@@ -318,12 +318,14 @@ double Agc::estimateLuminance(IPAActiveState &activeState,
 /**
  * \brief Process IPU3 statistics, and run AGC operations
  * \param[in] context The shared IPA context
+ * \param[in] frameContext The current frame context
  * \param[in] stats The IPU3 statistics and ISP results
  *
  * Identify the current image brightness, and use that to estimate the optimal
  * new exposure and gain for the scene.
  */
-void Agc::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Agc::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+		  const ipu3_uapi_stats_3a *stats)
 {
 	/*
 	 * Estimate the gain needed to have the proportion of pixels in a given
diff --git a/src/ipa/ipu3/algorithms/agc.h b/src/ipa/ipu3/algorithms/agc.h
index 31420841..219a1a96 100644
--- a/src/ipa/ipu3/algorithms/agc.h
+++ b/src/ipa/ipu3/algorithms/agc.h
@@ -28,7 +28,8 @@ public:
 	~Agc() = default;
 
 	int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
-	void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+	void process(IPAContext &context, IPAFrameContext *frameContext,
+		     const ipu3_uapi_stats_3a *stats) override;
 
 private:
 	double measureBrightness(const ipu3_uapi_stats_3a *stats,
diff --git a/src/ipa/ipu3/algorithms/algorithm.h b/src/ipa/ipu3/algorithms/algorithm.h
index d2eecc78..234b2bd7 100644
--- a/src/ipa/ipu3/algorithms/algorithm.h
+++ b/src/ipa/ipu3/algorithms/algorithm.h
@@ -17,7 +17,9 @@ namespace libcamera {
 
 namespace ipa::ipu3 {
 
-using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAConfigInfo, ipu3_uapi_params, ipu3_uapi_stats_3a>;
+using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAFrameContext,
+					    IPAConfigInfo, ipu3_uapi_params,
+					    ipu3_uapi_stats_3a>;
 
 } /* namespace ipa::ipu3 */
 
diff --git a/src/ipa/ipu3/algorithms/awb.cpp b/src/ipa/ipu3/algorithms/awb.cpp
index ab6924eb..5c232d92 100644
--- a/src/ipa/ipu3/algorithms/awb.cpp
+++ b/src/ipa/ipu3/algorithms/awb.cpp
@@ -387,7 +387,8 @@ void Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats)
 /**
  * \copydoc libcamera::ipa::Algorithm::process
  */
-void Awb::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Awb::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+		  const ipu3_uapi_stats_3a *stats)
 {
 	calculateWBGains(stats);
 
diff --git a/src/ipa/ipu3/algorithms/awb.h b/src/ipa/ipu3/algorithms/awb.h
index ab4b0a33..9a50a985 100644
--- a/src/ipa/ipu3/algorithms/awb.h
+++ b/src/ipa/ipu3/algorithms/awb.h
@@ -40,7 +40,8 @@ public:
 
 	int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
 	void prepare(IPAContext &context, ipu3_uapi_params *params) override;
-	void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+	void process(IPAContext &context, IPAFrameContext *frameContext,
+		     const ipu3_uapi_stats_3a *stats) override;
 
 private:
 	/* \todo Make these structs available to all the ISPs ? */
diff --git a/src/ipa/ipu3/algorithms/tone_mapping.cpp b/src/ipa/ipu3/algorithms/tone_mapping.cpp
index 7c78d0d9..f86e79b2 100644
--- a/src/ipa/ipu3/algorithms/tone_mapping.cpp
+++ b/src/ipa/ipu3/algorithms/tone_mapping.cpp
@@ -72,12 +72,13 @@ void ToneMapping::prepare([[maybe_unused]] IPAContext &context,
 /**
  * \brief Calculate the tone mapping look up table
  * \param context The shared IPA context
+ * \param frameContext The current frame context
  * \param stats The IPU3 statistics and ISP results
  *
  * The tone mapping look up table is generated as an inverse power curve from
  * our gamma setting.
  */
-void ToneMapping::process(IPAContext &context,
+void ToneMapping::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
 			  [[maybe_unused]] const ipu3_uapi_stats_3a *stats)
 {
 	/*
diff --git a/src/ipa/ipu3/algorithms/tone_mapping.h b/src/ipa/ipu3/algorithms/tone_mapping.h
index b727ab1e..d7d48006 100644
--- a/src/ipa/ipu3/algorithms/tone_mapping.h
+++ b/src/ipa/ipu3/algorithms/tone_mapping.h
@@ -20,7 +20,8 @@ public:
 
 	int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
 	void prepare(IPAContext &context, ipu3_uapi_params *params) override;
-	void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+	void process(IPAContext &context, IPAFrameContext *frameContext,
+		     const ipu3_uapi_stats_3a *stats) override;
 
 private:
 	double gamma_;
diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp
index 3b4fc911..16e5028f 100644
--- a/src/ipa/ipu3/ipu3.cpp
+++ b/src/ipa/ipu3/ipu3.cpp
@@ -576,7 +576,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame,
 	ControlList ctrls(controls::controls);
 
 	for (auto const &algo : algorithms_)
-		algo->process(context_, stats);
+		algo->process(context_, nullptr, stats);
 
 	setControls(frame);
 
diff --git a/src/ipa/libipa/algorithm.cpp b/src/ipa/libipa/algorithm.cpp
index 398d5372..cce2ed62 100644
--- a/src/ipa/libipa/algorithm.cpp
+++ b/src/ipa/libipa/algorithm.cpp
@@ -64,6 +64,7 @@ namespace ipa {
  * \fn Algorithm::process()
  * \brief Process ISP statistics, and run algorithm operations
  * \param[in] context The shared IPA context
+ * \param[in] frameContext The current frame's context
  * \param[in] stats The IPA statistics and ISP results
  *
  * This function is called while camera is running for every frame processed by
diff --git a/src/ipa/libipa/algorithm.h b/src/ipa/libipa/algorithm.h
index 766aee5d..032a05b5 100644
--- a/src/ipa/libipa/algorithm.h
+++ b/src/ipa/libipa/algorithm.h
@@ -10,7 +10,8 @@ namespace libcamera {
 
 namespace ipa {
 
-template<typename Context, typename Config, typename Params, typename Stats>
+template<typename Context, typename FrameContext, typename Config,
+	 typename Params, typename Stats>
 class Algorithm
 {
 public:
@@ -28,6 +29,7 @@ public:
 	}
 
 	virtual void process([[maybe_unused]] Context &context,
+			     [[maybe_unused]] FrameContext *frameContext,
 			     [[maybe_unused]] const Stats *stats)
 	{
 	}
diff --git a/src/ipa/rkisp1/algorithms/agc.cpp b/src/ipa/rkisp1/algorithms/agc.cpp
index 5f4c3f93..b5a184d9 100644
--- a/src/ipa/rkisp1/algorithms/agc.cpp
+++ b/src/ipa/rkisp1/algorithms/agc.cpp
@@ -280,7 +280,9 @@ double Agc::measureBrightness(const rkisp1_cif_isp_hist_stat *hist) const
  * Identify the current image brightness, and use that to estimate the optimal
  * new exposure and gain for the scene.
  */
-void Agc::process(IPAContext &context, const rkisp1_stat_buffer *stats)
+void Agc::process(IPAContext &context,
+		  [[maybe_unused]] IPAFrameContext *frameContext,
+		  const rkisp1_stat_buffer *stats)
 {
 	const rkisp1_cif_isp_stat *params = &stats->params;
 	ASSERT(stats->meas_type & RKISP1_CIF_ISP_STAT_AUTOEXP);
diff --git a/src/ipa/rkisp1/algorithms/agc.h b/src/ipa/rkisp1/algorithms/agc.h
index ce1adf27..22c02779 100644
--- a/src/ipa/rkisp1/algorithms/agc.h
+++ b/src/ipa/rkisp1/algorithms/agc.h
@@ -29,7 +29,8 @@ public:
 
 	int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override;
 	void prepare(IPAContext &context, rkisp1_params_cfg *params) override;
-	void process(IPAContext &context, const rkisp1_stat_buffer *stats) override;
+	void process(IPAContext &context, IPAFrameContext *frameContext,
+		     const rkisp1_stat_buffer *stats) override;
 
 private:
 	void computeExposure(IPAContext &Context, double yGain, double iqMeanGain);
diff --git a/src/ipa/rkisp1/algorithms/algorithm.h b/src/ipa/rkisp1/algorithms/algorithm.h
index d46c3188..68e3a44e 100644
--- a/src/ipa/rkisp1/algorithms/algorithm.h
+++ b/src/ipa/rkisp1/algorithms/algorithm.h
@@ -19,7 +19,9 @@ namespace libcamera {
 
 namespace ipa::rkisp1 {
 
-using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPACameraSensorInfo, rkisp1_params_cfg, rkisp1_stat_buffer>;
+using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAFrameContext,
+					    IPACameraSensorInfo, rkisp1_params_cfg,
+					    rkisp1_stat_buffer>;
 
 } /* namespace ipa::rkisp1 */
 
diff --git a/src/ipa/rkisp1/algorithms/awb.cpp b/src/ipa/rkisp1/algorithms/awb.cpp
index be4585c6..88441382 100644
--- a/src/ipa/rkisp1/algorithms/awb.cpp
+++ b/src/ipa/rkisp1/algorithms/awb.cpp
@@ -119,7 +119,9 @@ void Awb::prepare(IPAContext &context, rkisp1_params_cfg *params)
 /**
  * \copydoc libcamera::ipa::Algorithm::process
  */
-void Awb::process([[maybe_unused]] IPAContext &context, const rkisp1_stat_buffer *stats)
+void Awb::process([[maybe_unused]] IPAContext &context,
+		  [[maybe_unused]] IPAFrameContext *frameCtx,
+		  const rkisp1_stat_buffer *stats)
 {
 	const rkisp1_cif_isp_stat *params = &stats->params;
 	const rkisp1_cif_isp_awb_stat *awb = &params->awb;
diff --git a/src/ipa/rkisp1/algorithms/awb.h b/src/ipa/rkisp1/algorithms/awb.h
index 11946643..7647842f 100644
--- a/src/ipa/rkisp1/algorithms/awb.h
+++ b/src/ipa/rkisp1/algorithms/awb.h
@@ -23,7 +23,8 @@ public:
 
 	int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override;
 	void prepare(IPAContext &context, rkisp1_params_cfg *params) override;
-	void process(IPAContext &context, const rkisp1_stat_buffer *stats) override;
+	void process(IPAContext &context, IPAFrameContext *frameCtx,
+		     const rkisp1_stat_buffer *stats) override;
 
 private:
 	uint32_t estimateCCT(double red, double green, double blue);
diff --git a/src/ipa/rkisp1/rkisp1.cpp b/src/ipa/rkisp1/rkisp1.cpp
index ef1f0d56..c818a6d7 100644
--- a/src/ipa/rkisp1/rkisp1.cpp
+++ b/src/ipa/rkisp1/rkisp1.cpp
@@ -272,7 +272,7 @@ void IPARkISP1::processStatsBuffer(const uint32_t frame, const uint32_t bufferId
 	unsigned int aeState = 0;
 
 	for (auto const &algo : algorithms_)
-		algo->process(context_, stats);
+		algo->process(context_, nullptr, stats);
 
 	setControls(frame);